{"version":3,"file":"main-DD2oxdXb.js","sources":["../../../node_modules/@vue/compat/dist/vue.esm-bundler.js","../../../node_modules/@intlify/shared/dist/shared.mjs","../../../node_modules/@intlify/message-compiler/dist/message-compiler.esm-browser.js","../../../node_modules/@intlify/core-base/dist/core-base.mjs","../../../node_modules/@vue/devtools-api/lib/esm/env.js","../../../node_modules/@vue/devtools-api/lib/esm/const.js","../../../node_modules/@vue/devtools-api/lib/esm/time.js","../../../node_modules/@vue/devtools-api/lib/esm/proxy.js","../../../node_modules/@vue/devtools-api/lib/esm/index.js","../../../node_modules/vue-i18n/dist/vue-i18n.runtime.mjs","../../../node_modules/vuex/dist/vuex.esm-bundler.js","../../../src/models/dynamicrighslotdata.ts","../../../src/models/dynamicmodaldata.ts","../../../src/models/latlngpoint.ts","../../../src/models/municipalitiesandregionsmodel.ts","../../../src/models/radiobuttonmodel.ts","../../../src/models/tabledata.ts","../../../src/models/apidatamodel.ts","../../../src/models/datatransfermodel.ts","../../../src/models/operatormodel.ts","../../../src/store/store.ts","../../../src/i18n.ts","../../../node_modules/vue-facing-decorator/dist/esm/deco3/utils.js","../../../node_modules/vue-facing-decorator/dist/esm/utils.js","../../../node_modules/vue-facing-decorator/dist/esm/option/setup.js","../../../node_modules/vue-facing-decorator/dist/esm/option/computed.js","../../../node_modules/vue-facing-decorator/dist/esm/option/data.js","../../../node_modules/vue-facing-decorator/dist/esm/option/methodsAndHooks.js","../../../node_modules/vue-facing-decorator/dist/esm/optionBuilder.js","../../../node_modules/vue-facing-decorator/dist/esm/option/ref.js","../../../node_modules/vue-facing-decorator/dist/esm/option/watch.js","../../../node_modules/vue-facing-decorator/dist/esm/option/props.js","../../../node_modules/vue-facing-decorator/dist/esm/option/inject.js","../../../node_modules/vue-facing-decorator/dist/esm/option/provide.js","../../../node_modules/vue-facing-decorator/dist/esm/option/emit.js","../../../node_modules/vue-facing-decorator/dist/esm/option/vmodel.js","../../../node_modules/vue-facing-decorator/dist/esm/option/accessor.js","../../../node_modules/vue-facing-decorator/dist/esm/component.js","../../../node_modules/vue-facing-decorator/dist/esm/index.js","../../../src/components/DynamicTable.vue","../../../src/components/DynamicTable.vue","../../../src/views/Viestinta/LaajakaistaJaPuhelin/Modals/LisatiedotKunnanLaajakaistaliittymistaModal.vue","../../../src/views/Viestinta/LaajakaistaJaPuhelin/Modals/LisatiedotKunnanLaajakaistaliittymistaModal.vue","../../../src/views/Viestinta/LaajakaistaJaPuhelin/Modals/LisatiedotKunnanMobiililiittymistaModal.vue","../../../src/views/Viestinta/LaajakaistaJaPuhelin/Modals/LisatiedotKunnanMobiililiittymistaModal.vue","../../../src/views/Viestinta/LaajakaistaJaPuhelin/Modals/LaajakaistahankkeetModal.vue","../../../src/views/Viestinta/LaajakaistaJaPuhelin/Modals/LaajakaistahankkeetModal.vue","../../../src/views/Viestinta/TVJaRadio/Modals/AntenniTVSaatavuusModal.vue","../../../src/views/Viestinta/TVJaRadio/Modals/AntenniTVSaatavuusModal.vue","../../../src/views/Viestinta/ViatJaHairiot/Modals/ViatJaHairiotModal.vue","../../../src/views/Viestinta/ViatJaHairiot/Modals/ViatJaHairiotModal.vue","../../../src/views/Viestinta/Posti/Modals/PostitoimipisteetModal.vue","../../../src/views/Viestinta/Posti/Modals/PostitoimipisteetModal.vue","../../../src/views/Liikenne/Tieliikenne/Modals/LupaJaRekisterointitoimipaikat.vue","../../../src/views/Liikenne/Tieliikenne/Modals/LupaJaRekisterointitoimipaikat.vue","../../../src/views/Liikenne/Vesiliikenne/Modals/Rekisterointitoimipaikat.vue","../../../src/views/Liikenne/Vesiliikenne/Modals/Rekisterointitoimipaikat.vue","../../../src/views/Modals/TietoaSivustosta.vue","../../../src/views/Modals/TietoaSivustosta.vue","../../../src/helpers/pageWhitelistUtils.ts","../../../node_modules/vue-router/dist/vue-router.mjs","../../../node_modules/moment/dist/moment.js","../../../src/utils/utils.ts","../../../src/helpers/pageLinkUtils.ts","../../../src/components/SivukarttaRouterLink.vue","../../../src/components/SivukarttaRouterLink.vue","../../../src/views/Modals/Sivukartta.vue","../../../src/views/Modals/Sivukartta.vue","../../../src/layout/Modal.vue","../../../src/layout/Modal.vue","../../../node_modules/vue-spinner/src/ClipLoader.vue","../../../node_modules/axios/lib/helpers/bind.js","../../../node_modules/axios/lib/utils.js","../../../node_modules/axios/lib/core/AxiosError.js","../../../node_modules/axios/lib/helpers/null.js","../../../node_modules/axios/lib/helpers/toFormData.js","../../../node_modules/axios/lib/helpers/AxiosURLSearchParams.js","../../../node_modules/axios/lib/helpers/buildURL.js","../../../node_modules/axios/lib/core/InterceptorManager.js","../../../node_modules/axios/lib/defaults/transitional.js","../../../node_modules/axios/lib/platform/browser/classes/URLSearchParams.js","../../../node_modules/axios/lib/platform/browser/classes/FormData.js","../../../node_modules/axios/lib/platform/browser/classes/Blob.js","../../../node_modules/axios/lib/platform/browser/index.js","../../../node_modules/axios/lib/platform/common/utils.js","../../../node_modules/axios/lib/platform/index.js","../../../node_modules/axios/lib/helpers/toURLEncodedForm.js","../../../node_modules/axios/lib/helpers/formDataToJSON.js","../../../node_modules/axios/lib/defaults/index.js","../../../node_modules/axios/lib/helpers/parseHeaders.js","../../../node_modules/axios/lib/core/AxiosHeaders.js","../../../node_modules/axios/lib/core/transformData.js","../../../node_modules/axios/lib/cancel/isCancel.js","../../../node_modules/axios/lib/cancel/CanceledError.js","../../../node_modules/axios/lib/core/settle.js","../../../node_modules/axios/lib/helpers/parseProtocol.js","../../../node_modules/axios/lib/helpers/speedometer.js","../../../node_modules/axios/lib/helpers/throttle.js","../../../node_modules/axios/lib/helpers/progressEventReducer.js","../../../node_modules/axios/lib/helpers/isURLSameOrigin.js","../../../node_modules/axios/lib/helpers/cookies.js","../../../node_modules/axios/lib/helpers/isAbsoluteURL.js","../../../node_modules/axios/lib/helpers/combineURLs.js","../../../node_modules/axios/lib/core/buildFullPath.js","../../../node_modules/axios/lib/core/mergeConfig.js","../../../node_modules/axios/lib/helpers/resolveConfig.js","../../../node_modules/axios/lib/adapters/xhr.js","../../../node_modules/axios/lib/helpers/composeSignals.js","../../../node_modules/axios/lib/helpers/trackStream.js","../../../node_modules/axios/lib/adapters/fetch.js","../../../node_modules/axios/lib/adapters/adapters.js","../../../node_modules/axios/lib/core/dispatchRequest.js","../../../node_modules/axios/lib/env/data.js","../../../node_modules/axios/lib/helpers/validator.js","../../../node_modules/axios/lib/core/Axios.js","../../../node_modules/axios/lib/cancel/CancelToken.js","../../../node_modules/axios/lib/helpers/spread.js","../../../node_modules/axios/lib/helpers/isAxiosError.js","../../../node_modules/axios/lib/helpers/HttpStatusCode.js","../../../node_modules/axios/lib/axios.js","../../../src/services/ApiService.ts","../../../src/App.vue","../../../src/App.vue","../../../src/views/Etusivu.vue","../../../src/views/Etusivu.vue","../../../src/models/searchresultmodel.ts","../../../node_modules/proj4/lib/global.js","../../../node_modules/proj4/lib/constants/values.js","../../../node_modules/proj4/lib/constants/PrimeMeridian.js","../../../node_modules/proj4/lib/constants/units.js","../../../node_modules/proj4/lib/match.js","../../../node_modules/proj4/lib/projString.js","../../../node_modules/wkt-parser/parser.js","../../../node_modules/wkt-parser/process.js","../../../node_modules/wkt-parser/index.js","../../../node_modules/proj4/lib/defs.js","../../../node_modules/proj4/lib/parseCode.js","../../../node_modules/proj4/lib/extend.js","../../../node_modules/proj4/lib/common/msfnz.js","../../../node_modules/proj4/lib/common/sign.js","../../../node_modules/proj4/lib/common/adjust_lon.js","../../../node_modules/proj4/lib/common/tsfnz.js","../../../node_modules/proj4/lib/common/phi2z.js","../../../node_modules/proj4/lib/projections/merc.js","../../../node_modules/proj4/lib/projections/longlat.js","../../../node_modules/proj4/lib/projections.js","../../../node_modules/proj4/lib/constants/Ellipsoid.js","../../../node_modules/proj4/lib/deriveConstants.js","../../../node_modules/proj4/lib/constants/Datum.js","../../../node_modules/proj4/lib/datum.js","../../../node_modules/proj4/lib/nadgrid.js","../../../node_modules/proj4/lib/Proj.js","../../../node_modules/proj4/lib/datumUtils.js","../../../node_modules/proj4/lib/datum_transform.js","../../../node_modules/proj4/lib/adjust_axis.js","../../../node_modules/proj4/lib/common/toPoint.js","../../../node_modules/proj4/lib/checkSanity.js","../../../node_modules/proj4/lib/transform.js","../../../node_modules/proj4/lib/core.js","../../../node_modules/mgrs/mgrs.js","../../../node_modules/proj4/lib/Point.js","../../../node_modules/proj4/lib/common/pj_enfn.js","../../../node_modules/proj4/lib/common/pj_mlfn.js","../../../node_modules/proj4/lib/common/pj_inv_mlfn.js","../../../node_modules/proj4/lib/projections/tmerc.js","../../../node_modules/proj4/lib/common/sinh.js","../../../node_modules/proj4/lib/common/hypot.js","../../../node_modules/proj4/lib/common/log1py.js","../../../node_modules/proj4/lib/common/asinhy.js","../../../node_modules/proj4/lib/common/gatg.js","../../../node_modules/proj4/lib/common/clens.js","../../../node_modules/proj4/lib/common/cosh.js","../../../node_modules/proj4/lib/common/clens_cmplx.js","../../../node_modules/proj4/lib/projections/etmerc.js","../../../node_modules/proj4/lib/common/adjust_zone.js","../../../node_modules/proj4/lib/projections/utm.js","../../../node_modules/proj4/lib/common/srat.js","../../../node_modules/proj4/lib/projections/gauss.js","../../../node_modules/proj4/lib/projections/sterea.js","../../../node_modules/proj4/lib/projections/stere.js","../../../node_modules/proj4/lib/projections/somerc.js","../../../node_modules/proj4/lib/projections/omerc.js","../../../node_modules/proj4/lib/projections/lcc.js","../../../node_modules/proj4/lib/projections/krovak.js","../../../node_modules/proj4/lib/common/mlfn.js","../../../node_modules/proj4/lib/common/e0fn.js","../../../node_modules/proj4/lib/common/e1fn.js","../../../node_modules/proj4/lib/common/e2fn.js","../../../node_modules/proj4/lib/common/e3fn.js","../../../node_modules/proj4/lib/common/gN.js","../../../node_modules/proj4/lib/common/adjust_lat.js","../../../node_modules/proj4/lib/common/imlfn.js","../../../node_modules/proj4/lib/projections/cass.js","../../../node_modules/proj4/lib/common/qsfnz.js","../../../node_modules/proj4/lib/projections/laea.js","../../../node_modules/proj4/lib/common/asinz.js","../../../node_modules/proj4/lib/projections/aea.js","../../../node_modules/proj4/lib/projections/gnom.js","../../../node_modules/proj4/lib/common/iqsfnz.js","../../../node_modules/proj4/lib/projections/cea.js","../../../node_modules/proj4/lib/projections/eqc.js","../../../node_modules/proj4/lib/projections/poly.js","../../../node_modules/proj4/lib/projections/nzmg.js","../../../node_modules/proj4/lib/projections/mill.js","../../../node_modules/proj4/lib/projections/sinu.js","../../../node_modules/proj4/lib/projections/moll.js","../../../node_modules/proj4/lib/projections/eqdc.js","../../../node_modules/proj4/lib/projections/vandg.js","../../../node_modules/proj4/lib/projections/aeqd.js","../../../node_modules/proj4/lib/projections/ortho.js","../../../node_modules/proj4/lib/projections/qsc.js","../../../node_modules/proj4/lib/projections/robin.js","../../../node_modules/proj4/lib/projections/geocent.js","../../../node_modules/proj4/lib/projections/tpers.js","../../../node_modules/proj4/lib/projections/geos.js","../../../node_modules/proj4/lib/projections/eqearth.js","../../../node_modules/proj4/projs.js","../../../node_modules/proj4/lib/index.js","../../../src/eventBus.ts","../../../src/components/SearchAddress.vue","../../../src/components/SearchAddress.vue","../../../src/helpers/enums.ts","../../../src/helpers/markerUtils.ts","../../../src/components/LocateMeLink.vue","../../../src/components/LocateMeLink.vue","../../../src/components/RadioButtonListWithDropdown.vue","../../../src/components/RadioButtonListWithDropdown.vue","../../../src/models/dropdownlistmodel.ts","../../../src/components/SelectListWithSearch.vue","../../../src/components/SelectListWithSearch.vue","../../../src/components/RadioButtonListWithDropdownSearch.vue","../../../src/components/RadioButtonListWithDropdownSearch.vue","../../../src/components/MunicipalitiesAndProvinces.vue","../../../src/components/MunicipalitiesAndProvinces.vue","../../../node_modules/leaflet/dist/leaflet-src.js","../../../node_modules/vue3-leaflet/src/utils/utils.js","../../../node_modules/vue3-leaflet/src/mixins/Options.js","../../../node_modules/@terraformer/wkt/dist/t-wkt.esm.js","../../../node_modules/proj4leaflet/src/proj4leaflet.js","../../../node_modules/vue3-leaflet/src/components/map/src/customCrs.js","../../../node_modules/vue3-leaflet/src/components/map/src/main.vue","../../../node_modules/vue3-leaflet/src/components/map/index.js","../../../node_modules/vue3-leaflet/src/components/tileLayer/src/main.vue","../../../node_modules/vue3-leaflet/src/components/tileLayer/index.js","../../../node_modules/vue3-leaflet/src/components/wmsTileLayer/src/main.vue","../../../node_modules/vue3-leaflet/src/components/wmsTileLayer/index.js","../../../node_modules/vue3-leaflet/src/mapPlugin/WMTS.js","../../../node_modules/vue3-leaflet/src/components/wmtsTileLayer/src/main.vue","../../../node_modules/vue3-leaflet/src/components/wmtsTileLayer/index.js","../../../node_modules/vue3-leaflet/src/components/imageOverlay/src/main.vue","../../../node_modules/vue3-leaflet/src/components/imageOverlay/index.js","../../../node_modules/vue3-leaflet/src/mapPlugin/Leaflet.ImageOverlay.Rotated.js","../../../node_modules/vue3-leaflet/src/components/imageOverlayRotated/src/main.vue","../../../node_modules/vue3-leaflet/src/components/imageOverlayRotated/index.js","../../../node_modules/vue3-leaflet/src/components/videoOverlay/src/main.vue","../../../node_modules/vue3-leaflet/src/components/videoOverlay/index.js","../../../node_modules/vue3-leaflet/src/components/baseLayer/src/main.vue","../../../node_modules/vue3-leaflet/src/components/baseLayer/index.js","../../../node_modules/@turf/helpers/dist/es/index.js","../../../node_modules/@turf/meta/dist/es/index.js","../../../node_modules/@turf/invariant/dist/es/index.js","../../../node_modules/@turf/boolean-point-in-polygon/dist/es/index.js","../../../node_modules/@turf/distance/dist/es/index.js","../../../node_modules/@turf/area/dist/es/index.js","../../../node_modules/@turf/length/dist/es/index.js","../../../node_modules/leaflet/dist/images/marker-icon.png","../../../node_modules/leaflet/dist/images/marker-shadow.png","../../../node_modules/vue3-leaflet/src/mixins/drawMixin.js","../../../node_modules/vue3-leaflet/src/components/drawLayer/src/main.vue","../../../node_modules/vue3-leaflet/src/components/drawLayer/index.js","../../../node_modules/vue3-leaflet/src/components/layerGroup/src/main.vue","../../../node_modules/vue3-leaflet/src/components/layerGroup/index.js","../../../node_modules/vue3-leaflet/src/components/featureGroup/src/main.vue","../../../node_modules/vue3-leaflet/src/components/featureGroup/index.js","../../../node_modules/vue3-leaflet/src/components/geoJson/src/main.vue","../../../node_modules/vue3-leaflet/src/components/geoJson/index.js","../../../node_modules/vue3-leaflet/src/components/polyline/src/main.vue","../../../node_modules/vue3-leaflet/src/components/polyline/index.js","../../../node_modules/vue3-leaflet/src/components/polygon/src/main.vue","../../../node_modules/vue3-leaflet/src/components/polygon/index.js","../../../node_modules/vue3-leaflet/src/components/rectangle/src/main.vue","../../../node_modules/vue3-leaflet/src/components/rectangle/index.js","../../../node_modules/vue3-leaflet/src/components/circle/src/main.vue","../../../node_modules/vue3-leaflet/src/components/circle/index.js","../../../node_modules/vue3-leaflet/src/components/circleMarker/src/main.vue","../../../node_modules/vue3-leaflet/src/components/circleMarker/index.js","../../../node_modules/vue3-leaflet/src/components/marker/src/main.vue","../../../node_modules/vue3-leaflet/src/components/marker/index.js","../../../node_modules/vue3-leaflet/src/components/popup/src/main.vue","../../../node_modules/vue3-leaflet/src/components/popup/index.js","../../../node_modules/vue3-leaflet/src/components/tooltip/src/main.vue","../../../node_modules/vue3-leaflet/src/components/tooltip/index.js","../../../src/views/Viestinta/LaajakaistaJaPuhelin/LaajakaistaJaPuhelin.vue","../../../src/views/Viestinta/LaajakaistaJaPuhelin/LaajakaistaJaPuhelin.vue","../../../src/components/CheckboxList.vue","../../../src/components/CheckboxList.vue","../../../src/models/checkboxmodel.ts","../../../node_modules/lodash/lodash.js","../../../src/helpers/areaUtils.ts","../../../src/services/PostiService.ts","../../../src/views/Viestinta/Posti/Posti.vue","../../../src/views/Viestinta/Posti/Posti.vue","../../../src/components/DropdownList.vue","../../../src/components/DropdownList.vue","../../../src/components/CheckboxSelectList.vue","../../../src/components/CheckboxSelectList.vue","../../../src/views/Viestinta/TVJaRadio/TVJaRadio.vue","../../../src/views/Viestinta/TVJaRadio/TVJaRadio.vue","../../../src/views/Viestinta/ViatJaHairiot/ViatJaHairiot.vue","../../../src/views/Viestinta/ViatJaHairiot/ViatJaHairiot.vue","../../../src/views/Liikenne/Tieliikenne/Tieliikenne.vue","../../../src/views/Liikenne/Tieliikenne/Tieliikenne.vue","../../../src/views/Liikenne/Vesiliikenne/Vesiliikenne.vue","../../../src/views/Liikenne/Vesiliikenne/Vesiliikenne.vue","../../../src/views/Infokartat/Infokartat.vue","../../../src/views/Infokartat/Infokartat.vue","../../../src/helpers/localeHelper.ts","../../../src/services/RadiomikrofonitaajuudetService.ts","../../../src/components/TextField.vue","../../../src/components/TextField.vue","../../../src/views/Viestinta/Radiomikrofonitaajuudet/Radiomikrofonitaajuudet.vue","../../../src/views/Viestinta/Radiomikrofonitaajuudet/Radiomikrofonitaajuudet.vue","../../../src/components/RadioButtonList.vue","../../../src/components/RadioButtonList.vue","../../../src/models/simpleradiobuttonmodel.ts","../../../src/helpers/bittimittariUtils.ts","../../../src/helpers/legendLimitsUtils.ts","../../../src/services/BittimittariService.ts","../../../src/components/Guide.vue","../../../src/components/Guide.vue","../../../src/views/Viestinta/Bittimittari/Bittimittari.vue","../../../src/views/Viestinta/Bittimittari/Bittimittari.vue","../../../src/templates/LeftSlotTemplate.vue","../../../src/templates/LeftSlotTemplate.vue","../../../src/views/Liikenne/Tieliikenne/RightSlots/MyonnetytTaksiluvat.vue","../../../src/views/Liikenne/Tieliikenne/RightSlots/MyonnetytTaksiluvat.vue","../../../src/components/DynamicTableResponsive.vue","../../../src/components/DynamicTableResponsive.vue","../../../src/views/Liikenne/Tieliikenne/RightSlots/LupaJaRekisterointitoimipaikat.vue","../../../src/views/Liikenne/Tieliikenne/RightSlots/LupaJaRekisterointitoimipaikat.vue","../../../src/views/Liikenne/Tieliikenne/RightSlots/EnsirekisteroidytHenkiloAutot.vue","../../../src/views/Liikenne/Tieliikenne/RightSlots/EnsirekisteroidytHenkiloAutot.vue","../../../src/views/Liikenne/Tieliikenne/RightSlots/EnsirekisteroidytHenkiloAutotPaastot.vue","../../../src/views/Liikenne/Tieliikenne/RightSlots/EnsirekisteroidytHenkiloAutotPaastot.vue","../../../src/views/Liikenne/Tieliikenne/RightSlots/LiikennekaytossaHenkiloAutot.vue","../../../src/views/Liikenne/Tieliikenne/RightSlots/LiikennekaytossaHenkiloAutot.vue","../../../src/views/Liikenne/Tieliikenne/RightSlots/LiikennekaytossaHenkiloAutotKeskiIka.vue","../../../src/views/Liikenne/Tieliikenne/RightSlots/LiikennekaytossaHenkiloAutotKeskiIka.vue","../../../src/views/Liikenne/Tieliikenne/RightSlots/Liikenneonnettomuudet.vue","../../../src/views/Liikenne/Tieliikenne/RightSlots/Liikenneonnettomuudet.vue","../../../src/views/Liikenne/Tieliikenne/RightSlots/VoimassaOlevatAjokortit.vue","../../../src/views/Liikenne/Tieliikenne/RightSlots/VoimassaOlevatAjokortit.vue","../../../src/views/Viestinta/TVJaRadio/RightSlots/TVPeittoalueet.vue","../../../src/views/Viestinta/TVJaRadio/RightSlots/TVPeittoalueet.vue","../../../src/views/Viestinta/TVJaRadio/RightSlots/AntenniTVSaatavuus.vue","../../../src/views/Viestinta/TVJaRadio/RightSlots/AntenniTVSaatavuus.vue","../../../src/views/Viestinta/TVJaRadio/RightSlots/RadioPeittoalueet.vue","../../../src/views/Viestinta/TVJaRadio/RightSlots/RadioPeittoalueet.vue","../../../src/views/Viestinta/TVJaRadio/RightSlots/RadioasemienKuuluvuus.vue","../../../src/views/Viestinta/TVJaRadio/RightSlots/RadioasemienKuuluvuus.vue","../../../src/components/DateSlider.vue","../../../src/components/DateSlider.vue","../../../src/views/Viestinta/ViatJaHairiot/RightSlots/ViatJaHairiotTiedot.vue","../../../src/views/Viestinta/ViatJaHairiot/RightSlots/ViatJaHairiotTiedot.vue","../../../src/components/StarRating.vue","../../../src/components/StarRating.vue","../../../src/views/Viestinta/LaajakaistaJaPuhelin/RightSlots/KiinteanLaajakaistanSaatavuus.vue","../../../src/views/Viestinta/LaajakaistaJaPuhelin/RightSlots/KiinteanLaajakaistanSaatavuus.vue","../../../src/views/Viestinta/LaajakaistaJaPuhelin/RightSlots/MobiiliverkonKattavuus.vue","../../../src/views/Viestinta/LaajakaistaJaPuhelin/RightSlots/MobiiliverkonKattavuus.vue","../../../src/views/Viestinta/LaajakaistaJaPuhelin/RightSlots/Laajakaistahankkeet.vue","../../../src/views/Viestinta/LaajakaistaJaPuhelin/RightSlots/Laajakaistahankkeet.vue","../../../src/views/Viestinta/LaajakaistaJaPuhelin/RightSlots/OikeusPuhelinJaLaajakaistaLiittymaan.vue","../../../src/views/Viestinta/LaajakaistaJaPuhelin/RightSlots/OikeusPuhelinJaLaajakaistaLiittymaan.vue","../../../src/views/Viestinta/LaajakaistaJaPuhelin/RightSlots/KiinteanVerkonSaatavuusRuuduilla.vue","../../../src/views/Viestinta/LaajakaistaJaPuhelin/RightSlots/KiinteanVerkonSaatavuusRuuduilla.vue","../../../src/views/Liikenne/Vesiliikenne/RightSlots/Rekisterointitoimipaikat.vue","../../../src/views/Liikenne/Vesiliikenne/RightSlots/Rekisterointitoimipaikat.vue","../../../src/views/Liikenne/Vesiliikenne/RightSlots/RekisteroidytVesikulkuneuvot.vue","../../../src/views/Liikenne/Vesiliikenne/RightSlots/RekisteroidytVesikulkuneuvot.vue","../../../src/views/Viestinta/Posti/RightSlots/PostiHaeToimipaikkoja.vue","../../../src/views/Viestinta/Posti/RightSlots/PostiHaeToimipaikkoja.vue","../../../src/views/Viestinta/Posti/RightSlots/PostiTarkasteleMaaraa.vue","../../../src/views/Viestinta/Posti/RightSlots/PostiTarkasteleMaaraa.vue","../../../src/views/Infokartat/Liikenne/RightSlots/Infokartat.vue","../../../src/views/Infokartat/Liikenne/RightSlots/Infokartat.vue","../../../src/views/Viestinta/Radiomikrofonitaajuudet/RightSlots/Radiomikrofonitaajuudet.vue","../../../src/views/Viestinta/Radiomikrofonitaajuudet/RightSlots/Radiomikrofonitaajuudet.vue","../../../src/views/Viestinta/Bittimittari/RightSlots/BittimittariVuorokaudenaikaanPohjautuvatTiedot.vue","../../../src/views/Viestinta/Bittimittari/RightSlots/BittimittariVuorokaudenaikaanPohjautuvatTiedot.vue","../../../src/views/Viestinta/Bittimittari/RightSlots/BittimittariOperaattorikohtaisetTiedot.vue","../../../src/views/Viestinta/Bittimittari/RightSlots/BittimittariOperaattorikohtaisetTiedot.vue","../../../src/views/Viestinta/Bittimittari/RightSlots/BittimittariVuorokaudenaikaanPohjautuvatRuudut.vue","../../../src/views/Viestinta/Bittimittari/RightSlots/BittimittariVuorokaudenaikaanPohjautuvatRuudut.vue","../../../src/templates/RightSlotTemplate.vue","../../../src/templates/RightSlotTemplate.vue","../../../src/templates/RightSlotHeaderTemplate.vue","../../../src/templates/RightSlotHeaderTemplate.vue","../../../node_modules/leaflet.markercluster/dist/leaflet.markercluster-src.js","../../../src/services/LaajakaistaJaPuhelinService.ts","../../../src/helpers/liikenneUtils.ts","../../../src/services/TieliikenneService.ts","../../../src/services/VesiliikenneService.ts","../../../src/services/TVJaRadioService.ts","../../../src/helpers/postiMarkerUtils.ts","../../../src/helpers/liikenneMarkerUtils.ts","../../../src/helpers/locateMeHelper.ts","../../../src/services/InfokartatService.ts","../../../src/services/ViatJaHairiotService.ts","../../../node_modules/entities/lib/generated/decode-data-html.js","../../../node_modules/entities/lib/generated/decode-data-xml.js","../../../node_modules/entities/lib/decode_codepoint.js","../../../node_modules/entities/lib/decode.js","../../../node_modules/htmlparser2/lib/Tokenizer.js","../../../node_modules/htmlparser2/lib/Parser.js","../../../node_modules/domelementtype/lib/index.js","../../../node_modules/domhandler/lib/node.js","../../../node_modules/domhandler/lib/index.js","../../../node_modules/entities/lib/generated/encode-html.js","../../../node_modules/entities/lib/escape.js","../../../node_modules/entities/lib/encode.js","../../../node_modules/entities/lib/index.js","../../../node_modules/dom-serializer/lib/foreignNames.js","../../../node_modules/dom-serializer/lib/index.js","../../../node_modules/domutils/lib/stringify.js","../../../node_modules/domutils/lib/traversal.js","../../../node_modules/domutils/lib/manipulation.js","../../../node_modules/domutils/lib/querying.js","../../../node_modules/domutils/lib/legacy.js","../../../node_modules/domutils/lib/helpers.js","../../../node_modules/domutils/lib/feeds.js","../../../node_modules/domutils/lib/index.js","../../../node_modules/htmlparser2/lib/index.js","../../../node_modules/sanitize-html/node_modules/escape-string-regexp/index.js","../../../node_modules/is-plain-object/dist/is-plain-object.js","../../../node_modules/deepmerge/dist/cjs.js","../../../node_modules/parse-srcset/src/parse-srcset.js","../../../node_modules/picocolors/picocolors.browser.js","../../../__vite-browser-external","../../../node_modules/postcss/lib/css-syntax-error.js","../../../node_modules/postcss/lib/stringifier.js","../../../node_modules/postcss/lib/stringify.js","../../../node_modules/postcss/lib/symbols.js","../../../node_modules/postcss/lib/node.js","../../../node_modules/postcss/lib/comment.js","../../../node_modules/postcss/lib/declaration.js","../../../node_modules/postcss/lib/container.js","../../../node_modules/postcss/lib/at-rule.js","../../../node_modules/postcss/lib/document.js","../../../node_modules/nanoid/non-secure/index.cjs","../../../node_modules/postcss/lib/previous-map.js","../../../node_modules/postcss/lib/input.js","../../../node_modules/postcss/lib/root.js","../../../node_modules/postcss/lib/list.js","../../../node_modules/postcss/lib/rule.js","../../../node_modules/postcss/lib/fromJSON.js","../../../node_modules/postcss/lib/map-generator.js","../../../node_modules/postcss/lib/tokenize.js","../../../node_modules/postcss/lib/parser.js","../../../node_modules/postcss/lib/parse.js","../../../node_modules/postcss/lib/warning.js","../../../node_modules/postcss/lib/result.js","../../../node_modules/postcss/lib/lazy-result.js","../../../node_modules/postcss/lib/no-work-result.js","../../../node_modules/postcss/lib/processor.js","../../../node_modules/postcss/lib/postcss.js","../../../node_modules/sanitize-html/index.js","../../../src/map/Map.vue","../../../src/map/Map.vue","../../../src/layout/Footer.vue","../../../src/layout/Footer.vue","../../../src/components/LangChange.vue","../../../src/components/LangChange.vue","../../../src/components/CustomRouterLink.vue","../../../src/components/CustomRouterLink.vue","../../../src/layout/headerComponents/NavigationList.vue","../../../src/layout/headerComponents/NavigationList.vue","../../../src/layout/Header.vue","../../../src/layout/Header.vue","../../../src/map/MapLegend.vue","../../../src/map/MapLegend.vue","../../../src/views/NotFound.vue","../../../src/views/NotFound.vue","../../../src/components/MobileFrontPageInfo.vue","../../../src/components/MobileFrontPageInfo.vue","../../../src/templates/PageTemplate.vue","../../../src/templates/PageTemplate.vue","../../../src/iframe/IframeTemplate.vue","../../../src/iframe/IframeTemplate.vue","../../../src/iframe/YleispalveluhakuIframe.vue","../../../src/iframe/YleispalveluhakuIframe.vue","../../../src/router/router.ts","../../../node_modules/@kyvg/vue3-notification/dist/index.es.js","../../../node_modules/click-outside-vue3/dist/v-click-outside.umd.js","../../../src/main.ts"],"sourcesContent":["/**\n* @vue/compat v3.4.31\n* (c) 2018-present Yuxi (Evan) You and Vue contributors\n* @license MIT\n**/\n/*! #__NO_SIDE_EFFECTS__ */\n// @__NO_SIDE_EFFECTS__\nfunction makeMap(str, expectsLowerCase) {\n const set = new Set(str.split(\",\"));\n return expectsLowerCase ? (val) => set.has(val.toLowerCase()) : (val) => set.has(val);\n}\n\nconst EMPTY_OBJ = !!(process.env.NODE_ENV !== \"production\") ? Object.freeze({}) : {};\nconst EMPTY_ARR = !!(process.env.NODE_ENV !== \"production\") ? Object.freeze([]) : [];\nconst NOOP = () => {\n};\nconst NO = () => false;\nconst isOn = (key) => key.charCodeAt(0) === 111 && key.charCodeAt(1) === 110 && // uppercase letter\n(key.charCodeAt(2) > 122 || key.charCodeAt(2) < 97);\nconst isModelListener = (key) => key.startsWith(\"onUpdate:\");\nconst extend = Object.assign;\nconst remove = (arr, el) => {\n const i = arr.indexOf(el);\n if (i > -1) {\n arr.splice(i, 1);\n }\n};\nconst hasOwnProperty$1 = Object.prototype.hasOwnProperty;\nconst hasOwn = (val, key) => hasOwnProperty$1.call(val, key);\nconst isArray = Array.isArray;\nconst isMap = (val) => toTypeString(val) === \"[object Map]\";\nconst isSet = (val) => toTypeString(val) === \"[object Set]\";\nconst isDate = (val) => toTypeString(val) === \"[object Date]\";\nconst isRegExp = (val) => toTypeString(val) === \"[object RegExp]\";\nconst isFunction = (val) => typeof val === \"function\";\nconst isString = (val) => typeof val === \"string\";\nconst isSymbol = (val) => typeof val === \"symbol\";\nconst isObject = (val) => val !== null && typeof val === \"object\";\nconst isPromise = (val) => {\n return (isObject(val) || isFunction(val)) && isFunction(val.then) && isFunction(val.catch);\n};\nconst objectToString = Object.prototype.toString;\nconst toTypeString = (value) => objectToString.call(value);\nconst toRawType = (value) => {\n return toTypeString(value).slice(8, -1);\n};\nconst isPlainObject = (val) => toTypeString(val) === \"[object Object]\";\nconst isIntegerKey = (key) => isString(key) && key !== \"NaN\" && key[0] !== \"-\" && \"\" + parseInt(key, 10) === key;\nconst isReservedProp = /* @__PURE__ */ makeMap(\n // the leading comma is intentional so empty string \"\" is also included\n \",key,ref,ref_for,ref_key,onVnodeBeforeMount,onVnodeMounted,onVnodeBeforeUpdate,onVnodeUpdated,onVnodeBeforeUnmount,onVnodeUnmounted\"\n);\nconst isBuiltInDirective = /* @__PURE__ */ makeMap(\n \"bind,cloak,else-if,else,for,html,if,model,on,once,pre,show,slot,text,memo\"\n);\nconst cacheStringFunction = (fn) => {\n const cache = /* @__PURE__ */ Object.create(null);\n return (str) => {\n const hit = cache[str];\n return hit || (cache[str] = fn(str));\n };\n};\nconst camelizeRE = /-(\\w)/g;\nconst camelize = cacheStringFunction((str) => {\n return str.replace(camelizeRE, (_, c) => c ? c.toUpperCase() : \"\");\n});\nconst hyphenateRE = /\\B([A-Z])/g;\nconst hyphenate = cacheStringFunction(\n (str) => str.replace(hyphenateRE, \"-$1\").toLowerCase()\n);\nconst capitalize = cacheStringFunction((str) => {\n return str.charAt(0).toUpperCase() + str.slice(1);\n});\nconst toHandlerKey = cacheStringFunction((str) => {\n const s = str ? `on${capitalize(str)}` : ``;\n return s;\n});\nconst hasChanged = (value, oldValue) => !Object.is(value, oldValue);\nconst invokeArrayFns = (fns, ...arg) => {\n for (let i = 0; i < fns.length; i++) {\n fns[i](...arg);\n }\n};\nconst def = (obj, key, value, writable = false) => {\n Object.defineProperty(obj, key, {\n configurable: true,\n enumerable: false,\n writable,\n value\n });\n};\nconst looseToNumber = (val) => {\n const n = parseFloat(val);\n return isNaN(n) ? val : n;\n};\nconst toNumber = (val) => {\n const n = isString(val) ? Number(val) : NaN;\n return isNaN(n) ? val : n;\n};\nlet _globalThis;\nconst getGlobalThis = () => {\n return _globalThis || (_globalThis = typeof globalThis !== \"undefined\" ? globalThis : typeof self !== \"undefined\" ? self : typeof window !== \"undefined\" ? window : typeof global !== \"undefined\" ? global : {});\n};\n\nconst PatchFlagNames = {\n [1]: `TEXT`,\n [2]: `CLASS`,\n [4]: `STYLE`,\n [8]: `PROPS`,\n [16]: `FULL_PROPS`,\n [32]: `NEED_HYDRATION`,\n [64]: `STABLE_FRAGMENT`,\n [128]: `KEYED_FRAGMENT`,\n [256]: `UNKEYED_FRAGMENT`,\n [512]: `NEED_PATCH`,\n [1024]: `DYNAMIC_SLOTS`,\n [2048]: `DEV_ROOT_FRAGMENT`,\n [-1]: `HOISTED`,\n [-2]: `BAIL`\n};\n\nconst slotFlagsText = {\n [1]: \"STABLE\",\n [2]: \"DYNAMIC\",\n [3]: \"FORWARDED\"\n};\n\nconst GLOBALS_ALLOWED = \"Infinity,undefined,NaN,isFinite,isNaN,parseFloat,parseInt,decodeURI,decodeURIComponent,encodeURI,encodeURIComponent,Math,Number,Date,Array,Object,Boolean,String,RegExp,Map,Set,JSON,Intl,BigInt,console,Error\";\nconst isGloballyAllowed = /* @__PURE__ */ makeMap(GLOBALS_ALLOWED);\n\nconst range = 2;\nfunction generateCodeFrame(source, start = 0, end = source.length) {\n start = Math.max(0, Math.min(start, source.length));\n end = Math.max(0, Math.min(end, source.length));\n if (start > end) return \"\";\n let lines = source.split(/(\\r?\\n)/);\n const newlineSequences = lines.filter((_, idx) => idx % 2 === 1);\n lines = lines.filter((_, idx) => idx % 2 === 0);\n let count = 0;\n const res = [];\n for (let i = 0; i < lines.length; i++) {\n count += lines[i].length + (newlineSequences[i] && newlineSequences[i].length || 0);\n if (count >= start) {\n for (let j = i - range; j <= i + range || end > count; j++) {\n if (j < 0 || j >= lines.length) continue;\n const line = j + 1;\n res.push(\n `${line}${\" \".repeat(Math.max(3 - String(line).length, 0))}| ${lines[j]}`\n );\n const lineLength = lines[j].length;\n const newLineSeqLength = newlineSequences[j] && newlineSequences[j].length || 0;\n if (j === i) {\n const pad = start - (count - (lineLength + newLineSeqLength));\n const length = Math.max(\n 1,\n end > count ? lineLength - pad : end - start\n );\n res.push(` | ` + \" \".repeat(pad) + \"^\".repeat(length));\n } else if (j > i) {\n if (end > count) {\n const length = Math.max(Math.min(end - count, lineLength), 1);\n res.push(` | ` + \"^\".repeat(length));\n }\n count += lineLength + newLineSeqLength;\n }\n }\n break;\n }\n }\n return res.join(\"\\n\");\n}\n\nfunction normalizeStyle(value) {\n if (isArray(value)) {\n const res = {};\n for (let i = 0; i < value.length; i++) {\n const item = value[i];\n const normalized = isString(item) ? parseStringStyle(item) : normalizeStyle(item);\n if (normalized) {\n for (const key in normalized) {\n res[key] = normalized[key];\n }\n }\n }\n return res;\n } else if (isString(value) || isObject(value)) {\n return value;\n }\n}\nconst listDelimiterRE = /;(?![^(]*\\))/g;\nconst propertyDelimiterRE = /:([^]+)/;\nconst styleCommentRE = /\\/\\*[^]*?\\*\\//g;\nfunction parseStringStyle(cssText) {\n const ret = {};\n cssText.replace(styleCommentRE, \"\").split(listDelimiterRE).forEach((item) => {\n if (item) {\n const tmp = item.split(propertyDelimiterRE);\n tmp.length > 1 && (ret[tmp[0].trim()] = tmp[1].trim());\n }\n });\n return ret;\n}\nfunction stringifyStyle(styles) {\n let ret = \"\";\n if (!styles || isString(styles)) {\n return ret;\n }\n for (const key in styles) {\n const value = styles[key];\n if (isString(value) || typeof value === \"number\") {\n const normalizedKey = key.startsWith(`--`) ? key : hyphenate(key);\n ret += `${normalizedKey}:${value};`;\n }\n }\n return ret;\n}\nfunction normalizeClass(value) {\n let res = \"\";\n if (isString(value)) {\n res = value;\n } else if (isArray(value)) {\n for (let i = 0; i < value.length; i++) {\n const normalized = normalizeClass(value[i]);\n if (normalized) {\n res += normalized + \" \";\n }\n }\n } else if (isObject(value)) {\n for (const name in value) {\n if (value[name]) {\n res += name + \" \";\n }\n }\n }\n return res.trim();\n}\nfunction normalizeProps(props) {\n if (!props) return null;\n let { class: klass, style } = props;\n if (klass && !isString(klass)) {\n props.class = normalizeClass(klass);\n }\n if (style) {\n props.style = normalizeStyle(style);\n }\n return props;\n}\n\nconst HTML_TAGS = \"html,body,base,head,link,meta,style,title,address,article,aside,footer,header,hgroup,h1,h2,h3,h4,h5,h6,nav,section,div,dd,dl,dt,figcaption,figure,picture,hr,img,li,main,ol,p,pre,ul,a,b,abbr,bdi,bdo,br,cite,code,data,dfn,em,i,kbd,mark,q,rp,rt,ruby,s,samp,small,span,strong,sub,sup,time,u,var,wbr,area,audio,map,track,video,embed,object,param,source,canvas,script,noscript,del,ins,caption,col,colgroup,table,thead,tbody,td,th,tr,button,datalist,fieldset,form,input,label,legend,meter,optgroup,option,output,progress,select,textarea,details,dialog,menu,summary,template,blockquote,iframe,tfoot\";\nconst SVG_TAGS = \"svg,animate,animateMotion,animateTransform,circle,clipPath,color-profile,defs,desc,discard,ellipse,feBlend,feColorMatrix,feComponentTransfer,feComposite,feConvolveMatrix,feDiffuseLighting,feDisplacementMap,feDistantLight,feDropShadow,feFlood,feFuncA,feFuncB,feFuncG,feFuncR,feGaussianBlur,feImage,feMerge,feMergeNode,feMorphology,feOffset,fePointLight,feSpecularLighting,feSpotLight,feTile,feTurbulence,filter,foreignObject,g,hatch,hatchpath,image,line,linearGradient,marker,mask,mesh,meshgradient,meshpatch,meshrow,metadata,mpath,path,pattern,polygon,polyline,radialGradient,rect,set,solidcolor,stop,switch,symbol,text,textPath,title,tspan,unknown,use,view\";\nconst MATH_TAGS = \"annotation,annotation-xml,maction,maligngroup,malignmark,math,menclose,merror,mfenced,mfrac,mfraction,mglyph,mi,mlabeledtr,mlongdiv,mmultiscripts,mn,mo,mover,mpadded,mphantom,mprescripts,mroot,mrow,ms,mscarries,mscarry,msgroup,msline,mspace,msqrt,msrow,mstack,mstyle,msub,msubsup,msup,mtable,mtd,mtext,mtr,munder,munderover,none,semantics\";\nconst VOID_TAGS = \"area,base,br,col,embed,hr,img,input,link,meta,param,source,track,wbr\";\nconst isHTMLTag = /* @__PURE__ */ makeMap(HTML_TAGS);\nconst isSVGTag = /* @__PURE__ */ makeMap(SVG_TAGS);\nconst isMathMLTag = /* @__PURE__ */ makeMap(MATH_TAGS);\nconst isVoidTag = /* @__PURE__ */ makeMap(VOID_TAGS);\n\nconst specialBooleanAttrs = `itemscope,allowfullscreen,formnovalidate,ismap,nomodule,novalidate,readonly`;\nconst isSpecialBooleanAttr = /* @__PURE__ */ makeMap(specialBooleanAttrs);\nconst isBooleanAttr = /* @__PURE__ */ makeMap(\n specialBooleanAttrs + `,async,autofocus,autoplay,controls,default,defer,disabled,hidden,inert,loop,open,required,reversed,scoped,seamless,checked,muted,multiple,selected`\n);\nfunction includeBooleanAttr(value) {\n return !!value || value === \"\";\n}\nconst isKnownHtmlAttr = /* @__PURE__ */ makeMap(\n `accept,accept-charset,accesskey,action,align,allow,alt,async,autocapitalize,autocomplete,autofocus,autoplay,background,bgcolor,border,buffered,capture,challenge,charset,checked,cite,class,code,codebase,color,cols,colspan,content,contenteditable,contextmenu,controls,coords,crossorigin,csp,data,datetime,decoding,default,defer,dir,dirname,disabled,download,draggable,dropzone,enctype,enterkeyhint,for,form,formaction,formenctype,formmethod,formnovalidate,formtarget,headers,height,hidden,high,href,hreflang,http-equiv,icon,id,importance,inert,integrity,ismap,itemprop,keytype,kind,label,lang,language,loading,list,loop,low,manifest,max,maxlength,minlength,media,min,multiple,muted,name,novalidate,open,optimum,pattern,ping,placeholder,poster,preload,radiogroup,readonly,referrerpolicy,rel,required,reversed,rows,rowspan,sandbox,scope,scoped,selected,shape,size,sizes,slot,span,spellcheck,src,srcdoc,srclang,srcset,start,step,style,summary,tabindex,target,title,translate,type,usemap,value,width,wrap`\n);\nconst isKnownSvgAttr = /* @__PURE__ */ makeMap(\n `xmlns,accent-height,accumulate,additive,alignment-baseline,alphabetic,amplitude,arabic-form,ascent,attributeName,attributeType,azimuth,baseFrequency,baseline-shift,baseProfile,bbox,begin,bias,by,calcMode,cap-height,class,clip,clipPathUnits,clip-path,clip-rule,color,color-interpolation,color-interpolation-filters,color-profile,color-rendering,contentScriptType,contentStyleType,crossorigin,cursor,cx,cy,d,decelerate,descent,diffuseConstant,direction,display,divisor,dominant-baseline,dur,dx,dy,edgeMode,elevation,enable-background,end,exponent,fill,fill-opacity,fill-rule,filter,filterRes,filterUnits,flood-color,flood-opacity,font-family,font-size,font-size-adjust,font-stretch,font-style,font-variant,font-weight,format,from,fr,fx,fy,g1,g2,glyph-name,glyph-orientation-horizontal,glyph-orientation-vertical,glyphRef,gradientTransform,gradientUnits,hanging,height,href,hreflang,horiz-adv-x,horiz-origin-x,id,ideographic,image-rendering,in,in2,intercept,k,k1,k2,k3,k4,kernelMatrix,kernelUnitLength,kerning,keyPoints,keySplines,keyTimes,lang,lengthAdjust,letter-spacing,lighting-color,limitingConeAngle,local,marker-end,marker-mid,marker-start,markerHeight,markerUnits,markerWidth,mask,maskContentUnits,maskUnits,mathematical,max,media,method,min,mode,name,numOctaves,offset,opacity,operator,order,orient,orientation,origin,overflow,overline-position,overline-thickness,panose-1,paint-order,path,pathLength,patternContentUnits,patternTransform,patternUnits,ping,pointer-events,points,pointsAtX,pointsAtY,pointsAtZ,preserveAlpha,preserveAspectRatio,primitiveUnits,r,radius,referrerPolicy,refX,refY,rel,rendering-intent,repeatCount,repeatDur,requiredExtensions,requiredFeatures,restart,result,rotate,rx,ry,scale,seed,shape-rendering,slope,spacing,specularConstant,specularExponent,speed,spreadMethod,startOffset,stdDeviation,stemh,stemv,stitchTiles,stop-color,stop-opacity,strikethrough-position,strikethrough-thickness,string,stroke,stroke-dasharray,stroke-dashoffset,stroke-linecap,stroke-linejoin,stroke-miterlimit,stroke-opacity,stroke-width,style,surfaceScale,systemLanguage,tabindex,tableValues,target,targetX,targetY,text-anchor,text-decoration,text-rendering,textLength,to,transform,transform-origin,type,u1,u2,underline-position,underline-thickness,unicode,unicode-bidi,unicode-range,units-per-em,v-alphabetic,v-hanging,v-ideographic,v-mathematical,values,vector-effect,version,vert-adv-y,vert-origin-x,vert-origin-y,viewBox,viewTarget,visibility,width,widths,word-spacing,writing-mode,x,x-height,x1,x2,xChannelSelector,xlink:actuate,xlink:arcrole,xlink:href,xlink:role,xlink:show,xlink:title,xlink:type,xmlns:xlink,xml:base,xml:lang,xml:space,y,y1,y2,yChannelSelector,z,zoomAndPan`\n);\nfunction isRenderableAttrValue(value) {\n if (value == null) {\n return false;\n }\n const type = typeof value;\n return type === \"string\" || type === \"number\" || type === \"boolean\";\n}\n\nfunction looseCompareArrays(a, b) {\n if (a.length !== b.length) return false;\n let equal = true;\n for (let i = 0; equal && i < a.length; i++) {\n equal = looseEqual(a[i], b[i]);\n }\n return equal;\n}\nfunction looseEqual(a, b) {\n if (a === b) return true;\n let aValidType = isDate(a);\n let bValidType = isDate(b);\n if (aValidType || bValidType) {\n return aValidType && bValidType ? a.getTime() === b.getTime() : false;\n }\n aValidType = isSymbol(a);\n bValidType = isSymbol(b);\n if (aValidType || bValidType) {\n return a === b;\n }\n aValidType = isArray(a);\n bValidType = isArray(b);\n if (aValidType || bValidType) {\n return aValidType && bValidType ? looseCompareArrays(a, b) : false;\n }\n aValidType = isObject(a);\n bValidType = isObject(b);\n if (aValidType || bValidType) {\n if (!aValidType || !bValidType) {\n return false;\n }\n const aKeysCount = Object.keys(a).length;\n const bKeysCount = Object.keys(b).length;\n if (aKeysCount !== bKeysCount) {\n return false;\n }\n for (const key in a) {\n const aHasKey = a.hasOwnProperty(key);\n const bHasKey = b.hasOwnProperty(key);\n if (aHasKey && !bHasKey || !aHasKey && bHasKey || !looseEqual(a[key], b[key])) {\n return false;\n }\n }\n }\n return String(a) === String(b);\n}\nfunction looseIndexOf(arr, val) {\n return arr.findIndex((item) => looseEqual(item, val));\n}\n\nconst isRef$1 = (val) => {\n return !!(val && val.__v_isRef === true);\n};\nconst toDisplayString = (val) => {\n return isString(val) ? val : val == null ? \"\" : isArray(val) || isObject(val) && (val.toString === objectToString || !isFunction(val.toString)) ? isRef$1(val) ? toDisplayString(val.value) : JSON.stringify(val, replacer, 2) : String(val);\n};\nconst replacer = (_key, val) => {\n if (isRef$1(val)) {\n return replacer(_key, val.value);\n } else if (isMap(val)) {\n return {\n [`Map(${val.size})`]: [...val.entries()].reduce(\n (entries, [key, val2], i) => {\n entries[stringifySymbol(key, i) + \" =>\"] = val2;\n return entries;\n },\n {}\n )\n };\n } else if (isSet(val)) {\n return {\n [`Set(${val.size})`]: [...val.values()].map((v) => stringifySymbol(v))\n };\n } else if (isSymbol(val)) {\n return stringifySymbol(val);\n } else if (isObject(val) && !isArray(val) && !isPlainObject(val)) {\n return String(val);\n }\n return val;\n};\nconst stringifySymbol = (v, i = \"\") => {\n var _a;\n return (\n // Symbol.description in es2019+ so we need to cast here to pass\n // the lib: es2016 check\n isSymbol(v) ? `Symbol(${(_a = v.description) != null ? _a : i})` : v\n );\n};\n\nfunction warn$2(msg, ...args) {\n console.warn(`[Vue warn] ${msg}`, ...args);\n}\n\nlet activeEffectScope;\nclass EffectScope {\n constructor(detached = false) {\n this.detached = detached;\n /**\n * @internal\n */\n this._active = true;\n /**\n * @internal\n */\n this.effects = [];\n /**\n * @internal\n */\n this.cleanups = [];\n this.parent = activeEffectScope;\n if (!detached && activeEffectScope) {\n this.index = (activeEffectScope.scopes || (activeEffectScope.scopes = [])).push(\n this\n ) - 1;\n }\n }\n get active() {\n return this._active;\n }\n run(fn) {\n if (this._active) {\n const currentEffectScope = activeEffectScope;\n try {\n activeEffectScope = this;\n return fn();\n } finally {\n activeEffectScope = currentEffectScope;\n }\n } else if (!!(process.env.NODE_ENV !== \"production\")) {\n warn$2(`cannot run an inactive effect scope.`);\n }\n }\n /**\n * This should only be called on non-detached scopes\n * @internal\n */\n on() {\n activeEffectScope = this;\n }\n /**\n * This should only be called on non-detached scopes\n * @internal\n */\n off() {\n activeEffectScope = this.parent;\n }\n stop(fromParent) {\n if (this._active) {\n let i, l;\n for (i = 0, l = this.effects.length; i < l; i++) {\n this.effects[i].stop();\n }\n for (i = 0, l = this.cleanups.length; i < l; i++) {\n this.cleanups[i]();\n }\n if (this.scopes) {\n for (i = 0, l = this.scopes.length; i < l; i++) {\n this.scopes[i].stop(true);\n }\n }\n if (!this.detached && this.parent && !fromParent) {\n const last = this.parent.scopes.pop();\n if (last && last !== this) {\n this.parent.scopes[this.index] = last;\n last.index = this.index;\n }\n }\n this.parent = void 0;\n this._active = false;\n }\n }\n}\nfunction effectScope(detached) {\n return new EffectScope(detached);\n}\nfunction recordEffectScope(effect, scope = activeEffectScope) {\n if (scope && scope.active) {\n scope.effects.push(effect);\n }\n}\nfunction getCurrentScope() {\n return activeEffectScope;\n}\nfunction onScopeDispose(fn) {\n if (activeEffectScope) {\n activeEffectScope.cleanups.push(fn);\n } else if (!!(process.env.NODE_ENV !== \"production\")) {\n warn$2(\n `onScopeDispose() is called when there is no active effect scope to be associated with.`\n );\n }\n}\n\nlet activeEffect;\nclass ReactiveEffect {\n constructor(fn, trigger, scheduler, scope) {\n this.fn = fn;\n this.trigger = trigger;\n this.scheduler = scheduler;\n this.active = true;\n this.deps = [];\n /**\n * @internal\n */\n this._dirtyLevel = 4;\n /**\n * @internal\n */\n this._trackId = 0;\n /**\n * @internal\n */\n this._runnings = 0;\n /**\n * @internal\n */\n this._shouldSchedule = false;\n /**\n * @internal\n */\n this._depsLength = 0;\n recordEffectScope(this, scope);\n }\n get dirty() {\n if (this._dirtyLevel === 2 || this._dirtyLevel === 3) {\n this._dirtyLevel = 1;\n pauseTracking();\n for (let i = 0; i < this._depsLength; i++) {\n const dep = this.deps[i];\n if (dep.computed) {\n triggerComputed(dep.computed);\n if (this._dirtyLevel >= 4) {\n break;\n }\n }\n }\n if (this._dirtyLevel === 1) {\n this._dirtyLevel = 0;\n }\n resetTracking();\n }\n return this._dirtyLevel >= 4;\n }\n set dirty(v) {\n this._dirtyLevel = v ? 4 : 0;\n }\n run() {\n this._dirtyLevel = 0;\n if (!this.active) {\n return this.fn();\n }\n let lastShouldTrack = shouldTrack;\n let lastEffect = activeEffect;\n try {\n shouldTrack = true;\n activeEffect = this;\n this._runnings++;\n preCleanupEffect(this);\n return this.fn();\n } finally {\n postCleanupEffect(this);\n this._runnings--;\n activeEffect = lastEffect;\n shouldTrack = lastShouldTrack;\n }\n }\n stop() {\n if (this.active) {\n preCleanupEffect(this);\n postCleanupEffect(this);\n this.onStop && this.onStop();\n this.active = false;\n }\n }\n}\nfunction triggerComputed(computed) {\n return computed.value;\n}\nfunction preCleanupEffect(effect2) {\n effect2._trackId++;\n effect2._depsLength = 0;\n}\nfunction postCleanupEffect(effect2) {\n if (effect2.deps.length > effect2._depsLength) {\n for (let i = effect2._depsLength; i < effect2.deps.length; i++) {\n cleanupDepEffect(effect2.deps[i], effect2);\n }\n effect2.deps.length = effect2._depsLength;\n }\n}\nfunction cleanupDepEffect(dep, effect2) {\n const trackId = dep.get(effect2);\n if (trackId !== void 0 && effect2._trackId !== trackId) {\n dep.delete(effect2);\n if (dep.size === 0) {\n dep.cleanup();\n }\n }\n}\nfunction effect(fn, options) {\n if (fn.effect instanceof ReactiveEffect) {\n fn = fn.effect.fn;\n }\n const _effect = new ReactiveEffect(fn, NOOP, () => {\n if (_effect.dirty) {\n _effect.run();\n }\n });\n if (options) {\n extend(_effect, options);\n if (options.scope) recordEffectScope(_effect, options.scope);\n }\n if (!options || !options.lazy) {\n _effect.run();\n }\n const runner = _effect.run.bind(_effect);\n runner.effect = _effect;\n return runner;\n}\nfunction stop(runner) {\n runner.effect.stop();\n}\nlet shouldTrack = true;\nlet pauseScheduleStack = 0;\nconst trackStack = [];\nfunction pauseTracking() {\n trackStack.push(shouldTrack);\n shouldTrack = false;\n}\nfunction resetTracking() {\n const last = trackStack.pop();\n shouldTrack = last === void 0 ? true : last;\n}\nfunction pauseScheduling() {\n pauseScheduleStack++;\n}\nfunction resetScheduling() {\n pauseScheduleStack--;\n while (!pauseScheduleStack && queueEffectSchedulers.length) {\n queueEffectSchedulers.shift()();\n }\n}\nfunction trackEffect(effect2, dep, debuggerEventExtraInfo) {\n var _a;\n if (dep.get(effect2) !== effect2._trackId) {\n dep.set(effect2, effect2._trackId);\n const oldDep = effect2.deps[effect2._depsLength];\n if (oldDep !== dep) {\n if (oldDep) {\n cleanupDepEffect(oldDep, effect2);\n }\n effect2.deps[effect2._depsLength++] = dep;\n } else {\n effect2._depsLength++;\n }\n if (!!(process.env.NODE_ENV !== \"production\")) {\n (_a = effect2.onTrack) == null ? void 0 : _a.call(effect2, extend({ effect: effect2 }, debuggerEventExtraInfo));\n }\n }\n}\nconst queueEffectSchedulers = [];\nfunction triggerEffects(dep, dirtyLevel, debuggerEventExtraInfo) {\n var _a;\n pauseScheduling();\n for (const effect2 of dep.keys()) {\n let tracking;\n if (effect2._dirtyLevel < dirtyLevel && (tracking != null ? tracking : tracking = dep.get(effect2) === effect2._trackId)) {\n effect2._shouldSchedule || (effect2._shouldSchedule = effect2._dirtyLevel === 0);\n effect2._dirtyLevel = dirtyLevel;\n }\n if (effect2._shouldSchedule && (tracking != null ? tracking : tracking = dep.get(effect2) === effect2._trackId)) {\n if (!!(process.env.NODE_ENV !== \"production\")) {\n (_a = effect2.onTrigger) == null ? void 0 : _a.call(effect2, extend({ effect: effect2 }, debuggerEventExtraInfo));\n }\n effect2.trigger();\n if ((!effect2._runnings || effect2.allowRecurse) && effect2._dirtyLevel !== 2) {\n effect2._shouldSchedule = false;\n if (effect2.scheduler) {\n queueEffectSchedulers.push(effect2.scheduler);\n }\n }\n }\n }\n resetScheduling();\n}\n\nconst createDep = (cleanup, computed) => {\n const dep = /* @__PURE__ */ new Map();\n dep.cleanup = cleanup;\n dep.computed = computed;\n return dep;\n};\n\nconst targetMap = /* @__PURE__ */ new WeakMap();\nconst ITERATE_KEY = Symbol(!!(process.env.NODE_ENV !== \"production\") ? \"iterate\" : \"\");\nconst MAP_KEY_ITERATE_KEY = Symbol(!!(process.env.NODE_ENV !== \"production\") ? \"Map key iterate\" : \"\");\nfunction track(target, type, key) {\n if (shouldTrack && activeEffect) {\n let depsMap = targetMap.get(target);\n if (!depsMap) {\n targetMap.set(target, depsMap = /* @__PURE__ */ new Map());\n }\n let dep = depsMap.get(key);\n if (!dep) {\n depsMap.set(key, dep = createDep(() => depsMap.delete(key)));\n }\n trackEffect(\n activeEffect,\n dep,\n !!(process.env.NODE_ENV !== \"production\") ? {\n target,\n type,\n key\n } : void 0\n );\n }\n}\nfunction trigger(target, type, key, newValue, oldValue, oldTarget) {\n const depsMap = targetMap.get(target);\n if (!depsMap) {\n return;\n }\n let deps = [];\n if (type === \"clear\") {\n deps = [...depsMap.values()];\n } else if (key === \"length\" && isArray(target)) {\n const newLength = Number(newValue);\n depsMap.forEach((dep, key2) => {\n if (key2 === \"length\" || !isSymbol(key2) && key2 >= newLength) {\n deps.push(dep);\n }\n });\n } else {\n if (key !== void 0) {\n deps.push(depsMap.get(key));\n }\n switch (type) {\n case \"add\":\n if (!isArray(target)) {\n deps.push(depsMap.get(ITERATE_KEY));\n if (isMap(target)) {\n deps.push(depsMap.get(MAP_KEY_ITERATE_KEY));\n }\n } else if (isIntegerKey(key)) {\n deps.push(depsMap.get(\"length\"));\n }\n break;\n case \"delete\":\n if (!isArray(target)) {\n deps.push(depsMap.get(ITERATE_KEY));\n if (isMap(target)) {\n deps.push(depsMap.get(MAP_KEY_ITERATE_KEY));\n }\n }\n break;\n case \"set\":\n if (isMap(target)) {\n deps.push(depsMap.get(ITERATE_KEY));\n }\n break;\n }\n }\n pauseScheduling();\n for (const dep of deps) {\n if (dep) {\n triggerEffects(\n dep,\n 4,\n !!(process.env.NODE_ENV !== \"production\") ? {\n target,\n type,\n key,\n newValue,\n oldValue,\n oldTarget\n } : void 0\n );\n }\n }\n resetScheduling();\n}\nfunction getDepFromReactive(object, key) {\n const depsMap = targetMap.get(object);\n return depsMap && depsMap.get(key);\n}\n\nconst isNonTrackableKeys = /* @__PURE__ */ makeMap(`__proto__,__v_isRef,__isVue`);\nconst builtInSymbols = new Set(\n /* @__PURE__ */ Object.getOwnPropertyNames(Symbol).filter((key) => key !== \"arguments\" && key !== \"caller\").map((key) => Symbol[key]).filter(isSymbol)\n);\nconst arrayInstrumentations = /* @__PURE__ */ createArrayInstrumentations();\nfunction createArrayInstrumentations() {\n const instrumentations = {};\n [\"includes\", \"indexOf\", \"lastIndexOf\"].forEach((key) => {\n instrumentations[key] = function(...args) {\n const arr = toRaw(this);\n for (let i = 0, l = this.length; i < l; i++) {\n track(arr, \"get\", i + \"\");\n }\n const res = arr[key](...args);\n if (res === -1 || res === false) {\n return arr[key](...args.map(toRaw));\n } else {\n return res;\n }\n };\n });\n [\"push\", \"pop\", \"shift\", \"unshift\", \"splice\"].forEach((key) => {\n instrumentations[key] = function(...args) {\n pauseTracking();\n pauseScheduling();\n const res = toRaw(this)[key].apply(this, args);\n resetScheduling();\n resetTracking();\n return res;\n };\n });\n return instrumentations;\n}\nfunction hasOwnProperty(key) {\n if (!isSymbol(key)) key = String(key);\n const obj = toRaw(this);\n track(obj, \"has\", key);\n return obj.hasOwnProperty(key);\n}\nclass BaseReactiveHandler {\n constructor(_isReadonly = false, _isShallow = false) {\n this._isReadonly = _isReadonly;\n this._isShallow = _isShallow;\n }\n get(target, key, receiver) {\n const isReadonly2 = this._isReadonly, isShallow2 = this._isShallow;\n if (key === \"__v_isReactive\") {\n return !isReadonly2;\n } else if (key === \"__v_isReadonly\") {\n return isReadonly2;\n } else if (key === \"__v_isShallow\") {\n return isShallow2;\n } else if (key === \"__v_raw\") {\n if (receiver === (isReadonly2 ? isShallow2 ? shallowReadonlyMap : readonlyMap : isShallow2 ? shallowReactiveMap : reactiveMap).get(target) || // receiver is not the reactive proxy, but has the same prototype\n // this means the reciever is a user proxy of the reactive proxy\n Object.getPrototypeOf(target) === Object.getPrototypeOf(receiver)) {\n return target;\n }\n return;\n }\n const targetIsArray = isArray(target);\n if (!isReadonly2) {\n if (targetIsArray && hasOwn(arrayInstrumentations, key)) {\n return Reflect.get(arrayInstrumentations, key, receiver);\n }\n if (key === \"hasOwnProperty\") {\n return hasOwnProperty;\n }\n }\n const res = Reflect.get(target, key, receiver);\n if (isSymbol(key) ? builtInSymbols.has(key) : isNonTrackableKeys(key)) {\n return res;\n }\n if (!isReadonly2) {\n track(target, \"get\", key);\n }\n if (isShallow2) {\n return res;\n }\n if (isRef(res)) {\n return targetIsArray && isIntegerKey(key) ? res : res.value;\n }\n if (isObject(res)) {\n return isReadonly2 ? readonly(res) : reactive(res);\n }\n return res;\n }\n}\nclass MutableReactiveHandler extends BaseReactiveHandler {\n constructor(isShallow2 = false) {\n super(false, isShallow2);\n }\n set(target, key, value, receiver) {\n let oldValue = target[key];\n if (!this._isShallow) {\n const isOldValueReadonly = isReadonly(oldValue);\n if (!isShallow(value) && !isReadonly(value)) {\n oldValue = toRaw(oldValue);\n value = toRaw(value);\n }\n if (!isArray(target) && isRef(oldValue) && !isRef(value)) {\n if (isOldValueReadonly) {\n return false;\n } else {\n oldValue.value = value;\n return true;\n }\n }\n }\n const hadKey = isArray(target) && isIntegerKey(key) ? Number(key) < target.length : hasOwn(target, key);\n const result = Reflect.set(target, key, value, receiver);\n if (target === toRaw(receiver)) {\n if (!hadKey) {\n trigger(target, \"add\", key, value);\n } else if (hasChanged(value, oldValue)) {\n trigger(target, \"set\", key, value, oldValue);\n }\n }\n return result;\n }\n deleteProperty(target, key) {\n const hadKey = hasOwn(target, key);\n const oldValue = target[key];\n const result = Reflect.deleteProperty(target, key);\n if (result && hadKey) {\n trigger(target, \"delete\", key, void 0, oldValue);\n }\n return result;\n }\n has(target, key) {\n const result = Reflect.has(target, key);\n if (!isSymbol(key) || !builtInSymbols.has(key)) {\n track(target, \"has\", key);\n }\n return result;\n }\n ownKeys(target) {\n track(\n target,\n \"iterate\",\n isArray(target) ? \"length\" : ITERATE_KEY\n );\n return Reflect.ownKeys(target);\n }\n}\nclass ReadonlyReactiveHandler extends BaseReactiveHandler {\n constructor(isShallow2 = false) {\n super(true, isShallow2);\n }\n set(target, key) {\n if (!!(process.env.NODE_ENV !== \"production\")) {\n warn$2(\n `Set operation on key \"${String(key)}\" failed: target is readonly.`,\n target\n );\n }\n return true;\n }\n deleteProperty(target, key) {\n if (!!(process.env.NODE_ENV !== \"production\")) {\n warn$2(\n `Delete operation on key \"${String(key)}\" failed: target is readonly.`,\n target\n );\n }\n return true;\n }\n}\nconst mutableHandlers = /* @__PURE__ */ new MutableReactiveHandler();\nconst readonlyHandlers = /* @__PURE__ */ new ReadonlyReactiveHandler();\nconst shallowReactiveHandlers = /* @__PURE__ */ new MutableReactiveHandler(\n true\n);\nconst shallowReadonlyHandlers = /* @__PURE__ */ new ReadonlyReactiveHandler(true);\n\nconst toShallow = (value) => value;\nconst getProto = (v) => Reflect.getPrototypeOf(v);\nfunction get(target, key, isReadonly = false, isShallow = false) {\n target = target[\"__v_raw\"];\n const rawTarget = toRaw(target);\n const rawKey = toRaw(key);\n if (!isReadonly) {\n if (hasChanged(key, rawKey)) {\n track(rawTarget, \"get\", key);\n }\n track(rawTarget, \"get\", rawKey);\n }\n const { has: has2 } = getProto(rawTarget);\n const wrap = isShallow ? toShallow : isReadonly ? toReadonly : toReactive;\n if (has2.call(rawTarget, key)) {\n return wrap(target.get(key));\n } else if (has2.call(rawTarget, rawKey)) {\n return wrap(target.get(rawKey));\n } else if (target !== rawTarget) {\n target.get(key);\n }\n}\nfunction has(key, isReadonly = false) {\n const target = this[\"__v_raw\"];\n const rawTarget = toRaw(target);\n const rawKey = toRaw(key);\n if (!isReadonly) {\n if (hasChanged(key, rawKey)) {\n track(rawTarget, \"has\", key);\n }\n track(rawTarget, \"has\", rawKey);\n }\n return key === rawKey ? target.has(key) : target.has(key) || target.has(rawKey);\n}\nfunction size(target, isReadonly = false) {\n target = target[\"__v_raw\"];\n !isReadonly && track(toRaw(target), \"iterate\", ITERATE_KEY);\n return Reflect.get(target, \"size\", target);\n}\nfunction add(value) {\n value = toRaw(value);\n const target = toRaw(this);\n const proto = getProto(target);\n const hadKey = proto.has.call(target, value);\n if (!hadKey) {\n target.add(value);\n trigger(target, \"add\", value, value);\n }\n return this;\n}\nfunction set(key, value) {\n value = toRaw(value);\n const target = toRaw(this);\n const { has: has2, get: get2 } = getProto(target);\n let hadKey = has2.call(target, key);\n if (!hadKey) {\n key = toRaw(key);\n hadKey = has2.call(target, key);\n } else if (!!(process.env.NODE_ENV !== \"production\")) {\n checkIdentityKeys(target, has2, key);\n }\n const oldValue = get2.call(target, key);\n target.set(key, value);\n if (!hadKey) {\n trigger(target, \"add\", key, value);\n } else if (hasChanged(value, oldValue)) {\n trigger(target, \"set\", key, value, oldValue);\n }\n return this;\n}\nfunction deleteEntry(key) {\n const target = toRaw(this);\n const { has: has2, get: get2 } = getProto(target);\n let hadKey = has2.call(target, key);\n if (!hadKey) {\n key = toRaw(key);\n hadKey = has2.call(target, key);\n } else if (!!(process.env.NODE_ENV !== \"production\")) {\n checkIdentityKeys(target, has2, key);\n }\n const oldValue = get2 ? get2.call(target, key) : void 0;\n const result = target.delete(key);\n if (hadKey) {\n trigger(target, \"delete\", key, void 0, oldValue);\n }\n return result;\n}\nfunction clear() {\n const target = toRaw(this);\n const hadItems = target.size !== 0;\n const oldTarget = !!(process.env.NODE_ENV !== \"production\") ? isMap(target) ? new Map(target) : new Set(target) : void 0;\n const result = target.clear();\n if (hadItems) {\n trigger(target, \"clear\", void 0, void 0, oldTarget);\n }\n return result;\n}\nfunction createForEach(isReadonly, isShallow) {\n return function forEach(callback, thisArg) {\n const observed = this;\n const target = observed[\"__v_raw\"];\n const rawTarget = toRaw(target);\n const wrap = isShallow ? toShallow : isReadonly ? toReadonly : toReactive;\n !isReadonly && track(rawTarget, \"iterate\", ITERATE_KEY);\n return target.forEach((value, key) => {\n return callback.call(thisArg, wrap(value), wrap(key), observed);\n });\n };\n}\nfunction createIterableMethod(method, isReadonly, isShallow) {\n return function(...args) {\n const target = this[\"__v_raw\"];\n const rawTarget = toRaw(target);\n const targetIsMap = isMap(rawTarget);\n const isPair = method === \"entries\" || method === Symbol.iterator && targetIsMap;\n const isKeyOnly = method === \"keys\" && targetIsMap;\n const innerIterator = target[method](...args);\n const wrap = isShallow ? toShallow : isReadonly ? toReadonly : toReactive;\n !isReadonly && track(\n rawTarget,\n \"iterate\",\n isKeyOnly ? MAP_KEY_ITERATE_KEY : ITERATE_KEY\n );\n return {\n // iterator protocol\n next() {\n const { value, done } = innerIterator.next();\n return done ? { value, done } : {\n value: isPair ? [wrap(value[0]), wrap(value[1])] : wrap(value),\n done\n };\n },\n // iterable protocol\n [Symbol.iterator]() {\n return this;\n }\n };\n };\n}\nfunction createReadonlyMethod(type) {\n return function(...args) {\n if (!!(process.env.NODE_ENV !== \"production\")) {\n const key = args[0] ? `on key \"${args[0]}\" ` : ``;\n warn$2(\n `${capitalize(type)} operation ${key}failed: target is readonly.`,\n toRaw(this)\n );\n }\n return type === \"delete\" ? false : type === \"clear\" ? void 0 : this;\n };\n}\nfunction createInstrumentations() {\n const mutableInstrumentations2 = {\n get(key) {\n return get(this, key);\n },\n get size() {\n return size(this);\n },\n has,\n add,\n set,\n delete: deleteEntry,\n clear,\n forEach: createForEach(false, false)\n };\n const shallowInstrumentations2 = {\n get(key) {\n return get(this, key, false, true);\n },\n get size() {\n return size(this);\n },\n has,\n add,\n set,\n delete: deleteEntry,\n clear,\n forEach: createForEach(false, true)\n };\n const readonlyInstrumentations2 = {\n get(key) {\n return get(this, key, true);\n },\n get size() {\n return size(this, true);\n },\n has(key) {\n return has.call(this, key, true);\n },\n add: createReadonlyMethod(\"add\"),\n set: createReadonlyMethod(\"set\"),\n delete: createReadonlyMethod(\"delete\"),\n clear: createReadonlyMethod(\"clear\"),\n forEach: createForEach(true, false)\n };\n const shallowReadonlyInstrumentations2 = {\n get(key) {\n return get(this, key, true, true);\n },\n get size() {\n return size(this, true);\n },\n has(key) {\n return has.call(this, key, true);\n },\n add: createReadonlyMethod(\"add\"),\n set: createReadonlyMethod(\"set\"),\n delete: createReadonlyMethod(\"delete\"),\n clear: createReadonlyMethod(\"clear\"),\n forEach: createForEach(true, true)\n };\n const iteratorMethods = [\n \"keys\",\n \"values\",\n \"entries\",\n Symbol.iterator\n ];\n iteratorMethods.forEach((method) => {\n mutableInstrumentations2[method] = createIterableMethod(method, false, false);\n readonlyInstrumentations2[method] = createIterableMethod(method, true, false);\n shallowInstrumentations2[method] = createIterableMethod(method, false, true);\n shallowReadonlyInstrumentations2[method] = createIterableMethod(\n method,\n true,\n true\n );\n });\n return [\n mutableInstrumentations2,\n readonlyInstrumentations2,\n shallowInstrumentations2,\n shallowReadonlyInstrumentations2\n ];\n}\nconst [\n mutableInstrumentations,\n readonlyInstrumentations,\n shallowInstrumentations,\n shallowReadonlyInstrumentations\n] = /* @__PURE__ */ createInstrumentations();\nfunction createInstrumentationGetter(isReadonly, shallow) {\n const instrumentations = shallow ? isReadonly ? shallowReadonlyInstrumentations : shallowInstrumentations : isReadonly ? readonlyInstrumentations : mutableInstrumentations;\n return (target, key, receiver) => {\n if (key === \"__v_isReactive\") {\n return !isReadonly;\n } else if (key === \"__v_isReadonly\") {\n return isReadonly;\n } else if (key === \"__v_raw\") {\n return target;\n }\n return Reflect.get(\n hasOwn(instrumentations, key) && key in target ? instrumentations : target,\n key,\n receiver\n );\n };\n}\nconst mutableCollectionHandlers = {\n get: /* @__PURE__ */ createInstrumentationGetter(false, false)\n};\nconst shallowCollectionHandlers = {\n get: /* @__PURE__ */ createInstrumentationGetter(false, true)\n};\nconst readonlyCollectionHandlers = {\n get: /* @__PURE__ */ createInstrumentationGetter(true, false)\n};\nconst shallowReadonlyCollectionHandlers = {\n get: /* @__PURE__ */ createInstrumentationGetter(true, true)\n};\nfunction checkIdentityKeys(target, has2, key) {\n const rawKey = toRaw(key);\n if (rawKey !== key && has2.call(target, rawKey)) {\n const type = toRawType(target);\n warn$2(\n `Reactive ${type} contains both the raw and reactive versions of the same object${type === `Map` ? ` as keys` : ``}, which can lead to inconsistencies. Avoid differentiating between the raw and reactive versions of an object and only use the reactive version if possible.`\n );\n }\n}\n\nconst reactiveMap = /* @__PURE__ */ new WeakMap();\nconst shallowReactiveMap = /* @__PURE__ */ new WeakMap();\nconst readonlyMap = /* @__PURE__ */ new WeakMap();\nconst shallowReadonlyMap = /* @__PURE__ */ new WeakMap();\nfunction targetTypeMap(rawType) {\n switch (rawType) {\n case \"Object\":\n case \"Array\":\n return 1 /* COMMON */;\n case \"Map\":\n case \"Set\":\n case \"WeakMap\":\n case \"WeakSet\":\n return 2 /* COLLECTION */;\n default:\n return 0 /* INVALID */;\n }\n}\nfunction getTargetType(value) {\n return value[\"__v_skip\"] || !Object.isExtensible(value) ? 0 /* INVALID */ : targetTypeMap(toRawType(value));\n}\nfunction reactive(target) {\n if (isReadonly(target)) {\n return target;\n }\n return createReactiveObject(\n target,\n false,\n mutableHandlers,\n mutableCollectionHandlers,\n reactiveMap\n );\n}\nfunction shallowReactive(target) {\n return createReactiveObject(\n target,\n false,\n shallowReactiveHandlers,\n shallowCollectionHandlers,\n shallowReactiveMap\n );\n}\nfunction readonly(target) {\n return createReactiveObject(\n target,\n true,\n readonlyHandlers,\n readonlyCollectionHandlers,\n readonlyMap\n );\n}\nfunction shallowReadonly(target) {\n return createReactiveObject(\n target,\n true,\n shallowReadonlyHandlers,\n shallowReadonlyCollectionHandlers,\n shallowReadonlyMap\n );\n}\nfunction createReactiveObject(target, isReadonly2, baseHandlers, collectionHandlers, proxyMap) {\n if (!isObject(target)) {\n if (!!(process.env.NODE_ENV !== \"production\")) {\n warn$2(\n `value cannot be made ${isReadonly2 ? \"readonly\" : \"reactive\"}: ${String(\n target\n )}`\n );\n }\n return target;\n }\n if (target[\"__v_raw\"] && !(isReadonly2 && target[\"__v_isReactive\"])) {\n return target;\n }\n const existingProxy = proxyMap.get(target);\n if (existingProxy) {\n return existingProxy;\n }\n const targetType = getTargetType(target);\n if (targetType === 0 /* INVALID */) {\n return target;\n }\n const proxy = new Proxy(\n target,\n targetType === 2 /* COLLECTION */ ? collectionHandlers : baseHandlers\n );\n proxyMap.set(target, proxy);\n return proxy;\n}\nfunction isReactive(value) {\n if (isReadonly(value)) {\n return isReactive(value[\"__v_raw\"]);\n }\n return !!(value && value[\"__v_isReactive\"]);\n}\nfunction isReadonly(value) {\n return !!(value && value[\"__v_isReadonly\"]);\n}\nfunction isShallow(value) {\n return !!(value && value[\"__v_isShallow\"]);\n}\nfunction isProxy(value) {\n return value ? !!value[\"__v_raw\"] : false;\n}\nfunction toRaw(observed) {\n const raw = observed && observed[\"__v_raw\"];\n return raw ? toRaw(raw) : observed;\n}\nfunction markRaw(value) {\n if (Object.isExtensible(value)) {\n def(value, \"__v_skip\", true);\n }\n return value;\n}\nconst toReactive = (value) => isObject(value) ? reactive(value) : value;\nconst toReadonly = (value) => isObject(value) ? readonly(value) : value;\n\nconst COMPUTED_SIDE_EFFECT_WARN = `Computed is still dirty after getter evaluation, likely because a computed is mutating its own dependency in its getter. State mutations in computed getters should be avoided. Check the docs for more details: https://vuejs.org/guide/essentials/computed.html#getters-should-be-side-effect-free`;\nclass ComputedRefImpl {\n constructor(getter, _setter, isReadonly, isSSR) {\n this.getter = getter;\n this._setter = _setter;\n this.dep = void 0;\n this.__v_isRef = true;\n this[\"__v_isReadonly\"] = false;\n this.effect = new ReactiveEffect(\n () => getter(this._value),\n () => triggerRefValue(\n this,\n this.effect._dirtyLevel === 2 ? 2 : 3\n )\n );\n this.effect.computed = this;\n this.effect.active = this._cacheable = !isSSR;\n this[\"__v_isReadonly\"] = isReadonly;\n }\n get value() {\n const self = toRaw(this);\n if ((!self._cacheable || self.effect.dirty) && hasChanged(self._value, self._value = self.effect.run())) {\n triggerRefValue(self, 4);\n }\n trackRefValue(self);\n if (self.effect._dirtyLevel >= 2) {\n if (!!(process.env.NODE_ENV !== \"production\") && this._warnRecursive) {\n warn$2(COMPUTED_SIDE_EFFECT_WARN, `\n\ngetter: `, this.getter);\n }\n triggerRefValue(self, 2);\n }\n return self._value;\n }\n set value(newValue) {\n this._setter(newValue);\n }\n // #region polyfill _dirty for backward compatibility third party code for Vue <= 3.3.x\n get _dirty() {\n return this.effect.dirty;\n }\n set _dirty(v) {\n this.effect.dirty = v;\n }\n // #endregion\n}\nfunction computed$1(getterOrOptions, debugOptions, isSSR = false) {\n let getter;\n let setter;\n const onlyGetter = isFunction(getterOrOptions);\n if (onlyGetter) {\n getter = getterOrOptions;\n setter = !!(process.env.NODE_ENV !== \"production\") ? () => {\n warn$2(\"Write operation failed: computed value is readonly\");\n } : NOOP;\n } else {\n getter = getterOrOptions.get;\n setter = getterOrOptions.set;\n }\n const cRef = new ComputedRefImpl(getter, setter, onlyGetter || !setter, isSSR);\n if (!!(process.env.NODE_ENV !== \"production\") && debugOptions && !isSSR) {\n cRef.effect.onTrack = debugOptions.onTrack;\n cRef.effect.onTrigger = debugOptions.onTrigger;\n }\n return cRef;\n}\n\nfunction trackRefValue(ref2) {\n var _a;\n if (shouldTrack && activeEffect) {\n ref2 = toRaw(ref2);\n trackEffect(\n activeEffect,\n (_a = ref2.dep) != null ? _a : ref2.dep = createDep(\n () => ref2.dep = void 0,\n ref2 instanceof ComputedRefImpl ? ref2 : void 0\n ),\n !!(process.env.NODE_ENV !== \"production\") ? {\n target: ref2,\n type: \"get\",\n key: \"value\"\n } : void 0\n );\n }\n}\nfunction triggerRefValue(ref2, dirtyLevel = 4, newVal, oldVal) {\n ref2 = toRaw(ref2);\n const dep = ref2.dep;\n if (dep) {\n triggerEffects(\n dep,\n dirtyLevel,\n !!(process.env.NODE_ENV !== \"production\") ? {\n target: ref2,\n type: \"set\",\n key: \"value\",\n newValue: newVal,\n oldValue: oldVal\n } : void 0\n );\n }\n}\nfunction isRef(r) {\n return !!(r && r.__v_isRef === true);\n}\nfunction ref(value) {\n return createRef(value, false);\n}\nfunction shallowRef(value) {\n return createRef(value, true);\n}\nfunction createRef(rawValue, shallow) {\n if (isRef(rawValue)) {\n return rawValue;\n }\n return new RefImpl(rawValue, shallow);\n}\nclass RefImpl {\n constructor(value, __v_isShallow) {\n this.__v_isShallow = __v_isShallow;\n this.dep = void 0;\n this.__v_isRef = true;\n this._rawValue = __v_isShallow ? value : toRaw(value);\n this._value = __v_isShallow ? value : toReactive(value);\n }\n get value() {\n trackRefValue(this);\n return this._value;\n }\n set value(newVal) {\n const useDirectValue = this.__v_isShallow || isShallow(newVal) || isReadonly(newVal);\n newVal = useDirectValue ? newVal : toRaw(newVal);\n if (hasChanged(newVal, this._rawValue)) {\n const oldVal = this._rawValue;\n this._rawValue = newVal;\n this._value = useDirectValue ? newVal : toReactive(newVal);\n triggerRefValue(this, 4, newVal, oldVal);\n }\n }\n}\nfunction triggerRef(ref2) {\n triggerRefValue(ref2, 4, !!(process.env.NODE_ENV !== \"production\") ? ref2.value : void 0);\n}\nfunction unref(ref2) {\n return isRef(ref2) ? ref2.value : ref2;\n}\nfunction toValue(source) {\n return isFunction(source) ? source() : unref(source);\n}\nconst shallowUnwrapHandlers = {\n get: (target, key, receiver) => unref(Reflect.get(target, key, receiver)),\n set: (target, key, value, receiver) => {\n const oldValue = target[key];\n if (isRef(oldValue) && !isRef(value)) {\n oldValue.value = value;\n return true;\n } else {\n return Reflect.set(target, key, value, receiver);\n }\n }\n};\nfunction proxyRefs(objectWithRefs) {\n return isReactive(objectWithRefs) ? objectWithRefs : new Proxy(objectWithRefs, shallowUnwrapHandlers);\n}\nclass CustomRefImpl {\n constructor(factory) {\n this.dep = void 0;\n this.__v_isRef = true;\n const { get, set } = factory(\n () => trackRefValue(this),\n () => triggerRefValue(this)\n );\n this._get = get;\n this._set = set;\n }\n get value() {\n return this._get();\n }\n set value(newVal) {\n this._set(newVal);\n }\n}\nfunction customRef(factory) {\n return new CustomRefImpl(factory);\n}\nfunction toRefs(object) {\n if (!!(process.env.NODE_ENV !== \"production\") && !isProxy(object)) {\n warn$2(`toRefs() expects a reactive object but received a plain one.`);\n }\n const ret = isArray(object) ? new Array(object.length) : {};\n for (const key in object) {\n ret[key] = propertyToRef(object, key);\n }\n return ret;\n}\nclass ObjectRefImpl {\n constructor(_object, _key, _defaultValue) {\n this._object = _object;\n this._key = _key;\n this._defaultValue = _defaultValue;\n this.__v_isRef = true;\n }\n get value() {\n const val = this._object[this._key];\n return val === void 0 ? this._defaultValue : val;\n }\n set value(newVal) {\n this._object[this._key] = newVal;\n }\n get dep() {\n return getDepFromReactive(toRaw(this._object), this._key);\n }\n}\nclass GetterRefImpl {\n constructor(_getter) {\n this._getter = _getter;\n this.__v_isRef = true;\n this.__v_isReadonly = true;\n }\n get value() {\n return this._getter();\n }\n}\nfunction toRef(source, key, defaultValue) {\n if (isRef(source)) {\n return source;\n } else if (isFunction(source)) {\n return new GetterRefImpl(source);\n } else if (isObject(source) && arguments.length > 1) {\n return propertyToRef(source, key, defaultValue);\n } else {\n return ref(source);\n }\n}\nfunction propertyToRef(source, key, defaultValue) {\n const val = source[key];\n return isRef(val) ? val : new ObjectRefImpl(source, key, defaultValue);\n}\n\nconst TrackOpTypes = {\n \"GET\": \"get\",\n \"HAS\": \"has\",\n \"ITERATE\": \"iterate\"\n};\nconst TriggerOpTypes = {\n \"SET\": \"set\",\n \"ADD\": \"add\",\n \"DELETE\": \"delete\",\n \"CLEAR\": \"clear\"\n};\n\nconst stack$1 = [];\nfunction pushWarningContext(vnode) {\n stack$1.push(vnode);\n}\nfunction popWarningContext() {\n stack$1.pop();\n}\nfunction warn$1(msg, ...args) {\n pauseTracking();\n const instance = stack$1.length ? stack$1[stack$1.length - 1].component : null;\n const appWarnHandler = instance && instance.appContext.config.warnHandler;\n const trace = getComponentTrace();\n if (appWarnHandler) {\n callWithErrorHandling(\n appWarnHandler,\n instance,\n 11,\n [\n // eslint-disable-next-line no-restricted-syntax\n msg + args.map((a) => {\n var _a, _b;\n return (_b = (_a = a.toString) == null ? void 0 : _a.call(a)) != null ? _b : JSON.stringify(a);\n }).join(\"\"),\n instance && instance.proxy,\n trace.map(\n ({ vnode }) => `at <${formatComponentName(instance, vnode.type)}>`\n ).join(\"\\n\"),\n trace\n ]\n );\n } else {\n const warnArgs = [`[Vue warn]: ${msg}`, ...args];\n if (trace.length && // avoid spamming console during tests\n true) {\n warnArgs.push(`\n`, ...formatTrace(trace));\n }\n console.warn(...warnArgs);\n }\n resetTracking();\n}\nfunction getComponentTrace() {\n let currentVNode = stack$1[stack$1.length - 1];\n if (!currentVNode) {\n return [];\n }\n const normalizedStack = [];\n while (currentVNode) {\n const last = normalizedStack[0];\n if (last && last.vnode === currentVNode) {\n last.recurseCount++;\n } else {\n normalizedStack.push({\n vnode: currentVNode,\n recurseCount: 0\n });\n }\n const parentInstance = currentVNode.component && currentVNode.component.parent;\n currentVNode = parentInstance && parentInstance.vnode;\n }\n return normalizedStack;\n}\nfunction formatTrace(trace) {\n const logs = [];\n trace.forEach((entry, i) => {\n logs.push(...i === 0 ? [] : [`\n`], ...formatTraceEntry(entry));\n });\n return logs;\n}\nfunction formatTraceEntry({ vnode, recurseCount }) {\n const postfix = recurseCount > 0 ? `... (${recurseCount} recursive calls)` : ``;\n const isRoot = vnode.component ? vnode.component.parent == null : false;\n const open = ` at <${formatComponentName(\n vnode.component,\n vnode.type,\n isRoot\n )}`;\n const close = `>` + postfix;\n return vnode.props ? [open, ...formatProps(vnode.props), close] : [open + close];\n}\nfunction formatProps(props) {\n const res = [];\n const keys = Object.keys(props);\n keys.slice(0, 3).forEach((key) => {\n res.push(...formatProp(key, props[key]));\n });\n if (keys.length > 3) {\n res.push(` ...`);\n }\n return res;\n}\nfunction formatProp(key, value, raw) {\n if (isString(value)) {\n value = JSON.stringify(value);\n return raw ? value : [`${key}=${value}`];\n } else if (typeof value === \"number\" || typeof value === \"boolean\" || value == null) {\n return raw ? value : [`${key}=${value}`];\n } else if (isRef(value)) {\n value = formatProp(key, toRaw(value.value), true);\n return raw ? value : [`${key}=Ref<`, value, `>`];\n } else if (isFunction(value)) {\n return [`${key}=fn${value.name ? `<${value.name}>` : ``}`];\n } else {\n value = toRaw(value);\n return raw ? value : [`${key}=`, value];\n }\n}\nfunction assertNumber(val, type) {\n if (!!!(process.env.NODE_ENV !== \"production\")) return;\n if (val === void 0) {\n return;\n } else if (typeof val !== \"number\") {\n warn$1(`${type} is not a valid number - got ${JSON.stringify(val)}.`);\n } else if (isNaN(val)) {\n warn$1(`${type} is NaN - the duration expression might be incorrect.`);\n }\n}\n\nconst ErrorCodes = {\n \"SETUP_FUNCTION\": 0,\n \"0\": \"SETUP_FUNCTION\",\n \"RENDER_FUNCTION\": 1,\n \"1\": \"RENDER_FUNCTION\",\n \"WATCH_GETTER\": 2,\n \"2\": \"WATCH_GETTER\",\n \"WATCH_CALLBACK\": 3,\n \"3\": \"WATCH_CALLBACK\",\n \"WATCH_CLEANUP\": 4,\n \"4\": \"WATCH_CLEANUP\",\n \"NATIVE_EVENT_HANDLER\": 5,\n \"5\": \"NATIVE_EVENT_HANDLER\",\n \"COMPONENT_EVENT_HANDLER\": 6,\n \"6\": \"COMPONENT_EVENT_HANDLER\",\n \"VNODE_HOOK\": 7,\n \"7\": \"VNODE_HOOK\",\n \"DIRECTIVE_HOOK\": 8,\n \"8\": \"DIRECTIVE_HOOK\",\n \"TRANSITION_HOOK\": 9,\n \"9\": \"TRANSITION_HOOK\",\n \"APP_ERROR_HANDLER\": 10,\n \"10\": \"APP_ERROR_HANDLER\",\n \"APP_WARN_HANDLER\": 11,\n \"11\": \"APP_WARN_HANDLER\",\n \"FUNCTION_REF\": 12,\n \"12\": \"FUNCTION_REF\",\n \"ASYNC_COMPONENT_LOADER\": 13,\n \"13\": \"ASYNC_COMPONENT_LOADER\",\n \"SCHEDULER\": 14,\n \"14\": \"SCHEDULER\"\n};\nconst ErrorTypeStrings$1 = {\n [\"sp\"]: \"serverPrefetch hook\",\n [\"bc\"]: \"beforeCreate hook\",\n [\"c\"]: \"created hook\",\n [\"bm\"]: \"beforeMount hook\",\n [\"m\"]: \"mounted hook\",\n [\"bu\"]: \"beforeUpdate hook\",\n [\"u\"]: \"updated\",\n [\"bum\"]: \"beforeUnmount hook\",\n [\"um\"]: \"unmounted hook\",\n [\"a\"]: \"activated hook\",\n [\"da\"]: \"deactivated hook\",\n [\"ec\"]: \"errorCaptured hook\",\n [\"rtc\"]: \"renderTracked hook\",\n [\"rtg\"]: \"renderTriggered hook\",\n [0]: \"setup function\",\n [1]: \"render function\",\n [2]: \"watcher getter\",\n [3]: \"watcher callback\",\n [4]: \"watcher cleanup function\",\n [5]: \"native event handler\",\n [6]: \"component event handler\",\n [7]: \"vnode hook\",\n [8]: \"directive hook\",\n [9]: \"transition hook\",\n [10]: \"app errorHandler\",\n [11]: \"app warnHandler\",\n [12]: \"ref function\",\n [13]: \"async component loader\",\n [14]: \"scheduler flush. This is likely a Vue internals bug. Please open an issue at https://github.com/vuejs/core .\"\n};\nfunction callWithErrorHandling(fn, instance, type, args) {\n try {\n return args ? fn(...args) : fn();\n } catch (err) {\n handleError(err, instance, type);\n }\n}\nfunction callWithAsyncErrorHandling(fn, instance, type, args) {\n if (isFunction(fn)) {\n const res = callWithErrorHandling(fn, instance, type, args);\n if (res && isPromise(res)) {\n res.catch((err) => {\n handleError(err, instance, type);\n });\n }\n return res;\n }\n if (isArray(fn)) {\n const values = [];\n for (let i = 0; i < fn.length; i++) {\n values.push(callWithAsyncErrorHandling(fn[i], instance, type, args));\n }\n return values;\n } else if (!!(process.env.NODE_ENV !== \"production\")) {\n warn$1(\n `Invalid value type passed to callWithAsyncErrorHandling(): ${typeof fn}`\n );\n }\n}\nfunction handleError(err, instance, type, throwInDev = true) {\n const contextVNode = instance ? instance.vnode : null;\n if (instance) {\n let cur = instance.parent;\n const exposedInstance = instance.proxy;\n const errorInfo = !!(process.env.NODE_ENV !== \"production\") ? ErrorTypeStrings$1[type] : `https://vuejs.org/error-reference/#runtime-${type}`;\n while (cur) {\n const errorCapturedHooks = cur.ec;\n if (errorCapturedHooks) {\n for (let i = 0; i < errorCapturedHooks.length; i++) {\n if (errorCapturedHooks[i](err, exposedInstance, errorInfo) === false) {\n return;\n }\n }\n }\n cur = cur.parent;\n }\n const appErrorHandler = instance.appContext.config.errorHandler;\n if (appErrorHandler) {\n pauseTracking();\n callWithErrorHandling(\n appErrorHandler,\n null,\n 10,\n [err, exposedInstance, errorInfo]\n );\n resetTracking();\n return;\n }\n }\n logError(err, type, contextVNode, throwInDev);\n}\nfunction logError(err, type, contextVNode, throwInDev = true) {\n if (!!(process.env.NODE_ENV !== \"production\")) {\n const info = ErrorTypeStrings$1[type];\n if (contextVNode) {\n pushWarningContext(contextVNode);\n }\n warn$1(`Unhandled error${info ? ` during execution of ${info}` : ``}`);\n if (contextVNode) {\n popWarningContext();\n }\n if (throwInDev) {\n throw err;\n } else {\n console.error(err);\n }\n } else {\n console.error(err);\n }\n}\n\nlet isFlushing = false;\nlet isFlushPending = false;\nconst queue = [];\nlet flushIndex = 0;\nconst pendingPostFlushCbs = [];\nlet activePostFlushCbs = null;\nlet postFlushIndex = 0;\nconst resolvedPromise = /* @__PURE__ */ Promise.resolve();\nlet currentFlushPromise = null;\nconst RECURSION_LIMIT = 100;\nfunction nextTick(fn) {\n const p = currentFlushPromise || resolvedPromise;\n return fn ? p.then(this ? fn.bind(this) : fn) : p;\n}\nfunction findInsertionIndex(id) {\n let start = flushIndex + 1;\n let end = queue.length;\n while (start < end) {\n const middle = start + end >>> 1;\n const middleJob = queue[middle];\n const middleJobId = getId(middleJob);\n if (middleJobId < id || middleJobId === id && middleJob.pre) {\n start = middle + 1;\n } else {\n end = middle;\n }\n }\n return start;\n}\nfunction queueJob(job) {\n if (!queue.length || !queue.includes(\n job,\n isFlushing && job.allowRecurse ? flushIndex + 1 : flushIndex\n )) {\n if (job.id == null) {\n queue.push(job);\n } else {\n queue.splice(findInsertionIndex(job.id), 0, job);\n }\n queueFlush();\n }\n}\nfunction queueFlush() {\n if (!isFlushing && !isFlushPending) {\n isFlushPending = true;\n currentFlushPromise = resolvedPromise.then(flushJobs);\n }\n}\nfunction invalidateJob(job) {\n const i = queue.indexOf(job);\n if (i > flushIndex) {\n queue.splice(i, 1);\n }\n}\nfunction queuePostFlushCb(cb) {\n if (!isArray(cb)) {\n if (!activePostFlushCbs || !activePostFlushCbs.includes(\n cb,\n cb.allowRecurse ? postFlushIndex + 1 : postFlushIndex\n )) {\n pendingPostFlushCbs.push(cb);\n }\n } else {\n pendingPostFlushCbs.push(...cb);\n }\n queueFlush();\n}\nfunction flushPreFlushCbs(instance, seen, i = isFlushing ? flushIndex + 1 : 0) {\n if (!!(process.env.NODE_ENV !== \"production\")) {\n seen = seen || /* @__PURE__ */ new Map();\n }\n for (; i < queue.length; i++) {\n const cb = queue[i];\n if (cb && cb.pre) {\n if (instance && cb.id !== instance.uid) {\n continue;\n }\n if (!!(process.env.NODE_ENV !== \"production\") && checkRecursiveUpdates(seen, cb)) {\n continue;\n }\n queue.splice(i, 1);\n i--;\n cb();\n }\n }\n}\nfunction flushPostFlushCbs(seen) {\n if (pendingPostFlushCbs.length) {\n const deduped = [...new Set(pendingPostFlushCbs)].sort(\n (a, b) => getId(a) - getId(b)\n );\n pendingPostFlushCbs.length = 0;\n if (activePostFlushCbs) {\n activePostFlushCbs.push(...deduped);\n return;\n }\n activePostFlushCbs = deduped;\n if (!!(process.env.NODE_ENV !== \"production\")) {\n seen = seen || /* @__PURE__ */ new Map();\n }\n for (postFlushIndex = 0; postFlushIndex < activePostFlushCbs.length; postFlushIndex++) {\n const cb = activePostFlushCbs[postFlushIndex];\n if (!!(process.env.NODE_ENV !== \"production\") && checkRecursiveUpdates(seen, cb)) {\n continue;\n }\n if (cb.active !== false) cb();\n }\n activePostFlushCbs = null;\n postFlushIndex = 0;\n }\n}\nconst getId = (job) => job.id == null ? Infinity : job.id;\nconst comparator = (a, b) => {\n const diff = getId(a) - getId(b);\n if (diff === 0) {\n if (a.pre && !b.pre) return -1;\n if (b.pre && !a.pre) return 1;\n }\n return diff;\n};\nfunction flushJobs(seen) {\n isFlushPending = false;\n isFlushing = true;\n if (!!(process.env.NODE_ENV !== \"production\")) {\n seen = seen || /* @__PURE__ */ new Map();\n }\n queue.sort(comparator);\n const check = !!(process.env.NODE_ENV !== \"production\") ? (job) => checkRecursiveUpdates(seen, job) : NOOP;\n try {\n for (flushIndex = 0; flushIndex < queue.length; flushIndex++) {\n const job = queue[flushIndex];\n if (job && job.active !== false) {\n if (!!(process.env.NODE_ENV !== \"production\") && check(job)) {\n continue;\n }\n callWithErrorHandling(job, null, 14);\n }\n }\n } finally {\n flushIndex = 0;\n queue.length = 0;\n flushPostFlushCbs(seen);\n isFlushing = false;\n currentFlushPromise = null;\n if (queue.length || pendingPostFlushCbs.length) {\n flushJobs(seen);\n }\n }\n}\nfunction checkRecursiveUpdates(seen, fn) {\n if (!seen.has(fn)) {\n seen.set(fn, 1);\n } else {\n const count = seen.get(fn);\n if (count > RECURSION_LIMIT) {\n const instance = fn.ownerInstance;\n const componentName = instance && getComponentName(instance.type);\n handleError(\n `Maximum recursive updates exceeded${componentName ? ` in component <${componentName}>` : ``}. This means you have a reactive effect that is mutating its own dependencies and thus recursively triggering itself. Possible sources include component template, render function, updated hook or watcher source function.`,\n null,\n 10\n );\n return true;\n } else {\n seen.set(fn, count + 1);\n }\n }\n}\n\nlet isHmrUpdating = false;\nconst hmrDirtyComponents = /* @__PURE__ */ new Set();\nif (!!(process.env.NODE_ENV !== \"production\")) {\n getGlobalThis().__VUE_HMR_RUNTIME__ = {\n createRecord: tryWrap(createRecord),\n rerender: tryWrap(rerender),\n reload: tryWrap(reload)\n };\n}\nconst map = /* @__PURE__ */ new Map();\nfunction registerHMR(instance) {\n const id = instance.type.__hmrId;\n let record = map.get(id);\n if (!record) {\n createRecord(id, instance.type);\n record = map.get(id);\n }\n record.instances.add(instance);\n}\nfunction unregisterHMR(instance) {\n map.get(instance.type.__hmrId).instances.delete(instance);\n}\nfunction createRecord(id, initialDef) {\n if (map.has(id)) {\n return false;\n }\n map.set(id, {\n initialDef: normalizeClassComponent(initialDef),\n instances: /* @__PURE__ */ new Set()\n });\n return true;\n}\nfunction normalizeClassComponent(component) {\n return isClassComponent(component) ? component.__vccOpts : component;\n}\nfunction rerender(id, newRender) {\n const record = map.get(id);\n if (!record) {\n return;\n }\n record.initialDef.render = newRender;\n [...record.instances].forEach((instance) => {\n if (newRender) {\n instance.render = newRender;\n normalizeClassComponent(instance.type).render = newRender;\n }\n instance.renderCache = [];\n isHmrUpdating = true;\n instance.effect.dirty = true;\n instance.update();\n isHmrUpdating = false;\n });\n}\nfunction reload(id, newComp) {\n const record = map.get(id);\n if (!record) return;\n newComp = normalizeClassComponent(newComp);\n updateComponentDef(record.initialDef, newComp);\n const instances = [...record.instances];\n for (const instance of instances) {\n const oldComp = normalizeClassComponent(instance.type);\n if (!hmrDirtyComponents.has(oldComp)) {\n if (oldComp !== record.initialDef) {\n updateComponentDef(oldComp, newComp);\n }\n hmrDirtyComponents.add(oldComp);\n }\n instance.appContext.propsCache.delete(instance.type);\n instance.appContext.emitsCache.delete(instance.type);\n instance.appContext.optionsCache.delete(instance.type);\n if (instance.ceReload) {\n hmrDirtyComponents.add(oldComp);\n instance.ceReload(newComp.styles);\n hmrDirtyComponents.delete(oldComp);\n } else if (instance.parent) {\n instance.parent.effect.dirty = true;\n queueJob(() => {\n instance.parent.update();\n hmrDirtyComponents.delete(oldComp);\n });\n } else if (instance.appContext.reload) {\n instance.appContext.reload();\n } else if (typeof window !== \"undefined\") {\n window.location.reload();\n } else {\n console.warn(\n \"[HMR] Root or manually mounted instance modified. Full reload required.\"\n );\n }\n }\n queuePostFlushCb(() => {\n for (const instance of instances) {\n hmrDirtyComponents.delete(\n normalizeClassComponent(instance.type)\n );\n }\n });\n}\nfunction updateComponentDef(oldComp, newComp) {\n extend(oldComp, newComp);\n for (const key in oldComp) {\n if (key !== \"__file\" && !(key in newComp)) {\n delete oldComp[key];\n }\n }\n}\nfunction tryWrap(fn) {\n return (id, arg) => {\n try {\n return fn(id, arg);\n } catch (e) {\n console.error(e);\n console.warn(\n `[HMR] Something went wrong during Vue component hot-reload. Full reload required.`\n );\n }\n };\n}\n\nlet devtools$1;\nlet buffer = [];\nlet devtoolsNotInstalled = false;\nfunction emit$2(event, ...args) {\n if (devtools$1) {\n devtools$1.emit(event, ...args);\n } else if (!devtoolsNotInstalled) {\n buffer.push({ event, args });\n }\n}\nfunction setDevtoolsHook$1(hook, target) {\n var _a, _b;\n devtools$1 = hook;\n if (devtools$1) {\n devtools$1.enabled = true;\n buffer.forEach(({ event, args }) => devtools$1.emit(event, ...args));\n buffer = [];\n } else if (\n // handle late devtools injection - only do this if we are in an actual\n // browser environment to avoid the timer handle stalling test runner exit\n // (#4815)\n typeof window !== \"undefined\" && // some envs mock window but not fully\n window.HTMLElement && // also exclude jsdom\n // eslint-disable-next-line no-restricted-syntax\n !((_b = (_a = window.navigator) == null ? void 0 : _a.userAgent) == null ? void 0 : _b.includes(\"jsdom\"))\n ) {\n const replay = target.__VUE_DEVTOOLS_HOOK_REPLAY__ = target.__VUE_DEVTOOLS_HOOK_REPLAY__ || [];\n replay.push((newHook) => {\n setDevtoolsHook$1(newHook, target);\n });\n setTimeout(() => {\n if (!devtools$1) {\n target.__VUE_DEVTOOLS_HOOK_REPLAY__ = null;\n devtoolsNotInstalled = true;\n buffer = [];\n }\n }, 3e3);\n } else {\n devtoolsNotInstalled = true;\n buffer = [];\n }\n}\nfunction devtoolsInitApp(app, version) {\n emit$2(\"app:init\" /* APP_INIT */, app, version, {\n Fragment,\n Text,\n Comment,\n Static\n });\n}\nfunction devtoolsUnmountApp(app) {\n emit$2(\"app:unmount\" /* APP_UNMOUNT */, app);\n}\nconst devtoolsComponentAdded = /* @__PURE__ */ createDevtoolsComponentHook(\n \"component:added\" /* COMPONENT_ADDED */\n);\nconst devtoolsComponentUpdated = /* @__PURE__ */ createDevtoolsComponentHook(\"component:updated\" /* COMPONENT_UPDATED */);\nconst _devtoolsComponentRemoved = /* @__PURE__ */ createDevtoolsComponentHook(\n \"component:removed\" /* COMPONENT_REMOVED */\n);\nconst devtoolsComponentRemoved = (component) => {\n if (devtools$1 && typeof devtools$1.cleanupBuffer === \"function\" && // remove the component if it wasn't buffered\n !devtools$1.cleanupBuffer(component)) {\n _devtoolsComponentRemoved(component);\n }\n};\n/*! #__NO_SIDE_EFFECTS__ */\n// @__NO_SIDE_EFFECTS__\nfunction createDevtoolsComponentHook(hook) {\n return (component) => {\n emit$2(\n hook,\n component.appContext.app,\n component.uid,\n component.parent ? component.parent.uid : void 0,\n component\n );\n };\n}\nconst devtoolsPerfStart = /* @__PURE__ */ createDevtoolsPerformanceHook(\n \"perf:start\" /* PERFORMANCE_START */\n);\nconst devtoolsPerfEnd = /* @__PURE__ */ createDevtoolsPerformanceHook(\n \"perf:end\" /* PERFORMANCE_END */\n);\nfunction createDevtoolsPerformanceHook(hook) {\n return (component, type, time) => {\n emit$2(hook, component.appContext.app, component.uid, component, type, time);\n };\n}\nfunction devtoolsComponentEmit(component, event, params) {\n emit$2(\n \"component:emit\" /* COMPONENT_EMIT */,\n component.appContext.app,\n component,\n event,\n params\n );\n}\n\nconst DeprecationTypes$1 = {\n \"GLOBAL_MOUNT\": \"GLOBAL_MOUNT\",\n \"GLOBAL_MOUNT_CONTAINER\": \"GLOBAL_MOUNT_CONTAINER\",\n \"GLOBAL_EXTEND\": \"GLOBAL_EXTEND\",\n \"GLOBAL_PROTOTYPE\": \"GLOBAL_PROTOTYPE\",\n \"GLOBAL_SET\": \"GLOBAL_SET\",\n \"GLOBAL_DELETE\": \"GLOBAL_DELETE\",\n \"GLOBAL_OBSERVABLE\": \"GLOBAL_OBSERVABLE\",\n \"GLOBAL_PRIVATE_UTIL\": \"GLOBAL_PRIVATE_UTIL\",\n \"CONFIG_SILENT\": \"CONFIG_SILENT\",\n \"CONFIG_DEVTOOLS\": \"CONFIG_DEVTOOLS\",\n \"CONFIG_KEY_CODES\": \"CONFIG_KEY_CODES\",\n \"CONFIG_PRODUCTION_TIP\": \"CONFIG_PRODUCTION_TIP\",\n \"CONFIG_IGNORED_ELEMENTS\": \"CONFIG_IGNORED_ELEMENTS\",\n \"CONFIG_WHITESPACE\": \"CONFIG_WHITESPACE\",\n \"CONFIG_OPTION_MERGE_STRATS\": \"CONFIG_OPTION_MERGE_STRATS\",\n \"INSTANCE_SET\": \"INSTANCE_SET\",\n \"INSTANCE_DELETE\": \"INSTANCE_DELETE\",\n \"INSTANCE_DESTROY\": \"INSTANCE_DESTROY\",\n \"INSTANCE_EVENT_EMITTER\": \"INSTANCE_EVENT_EMITTER\",\n \"INSTANCE_EVENT_HOOKS\": \"INSTANCE_EVENT_HOOKS\",\n \"INSTANCE_CHILDREN\": \"INSTANCE_CHILDREN\",\n \"INSTANCE_LISTENERS\": \"INSTANCE_LISTENERS\",\n \"INSTANCE_SCOPED_SLOTS\": \"INSTANCE_SCOPED_SLOTS\",\n \"INSTANCE_ATTRS_CLASS_STYLE\": \"INSTANCE_ATTRS_CLASS_STYLE\",\n \"OPTIONS_DATA_FN\": \"OPTIONS_DATA_FN\",\n \"OPTIONS_DATA_MERGE\": \"OPTIONS_DATA_MERGE\",\n \"OPTIONS_BEFORE_DESTROY\": \"OPTIONS_BEFORE_DESTROY\",\n \"OPTIONS_DESTROYED\": \"OPTIONS_DESTROYED\",\n \"WATCH_ARRAY\": \"WATCH_ARRAY\",\n \"PROPS_DEFAULT_THIS\": \"PROPS_DEFAULT_THIS\",\n \"V_ON_KEYCODE_MODIFIER\": \"V_ON_KEYCODE_MODIFIER\",\n \"CUSTOM_DIR\": \"CUSTOM_DIR\",\n \"ATTR_FALSE_VALUE\": \"ATTR_FALSE_VALUE\",\n \"ATTR_ENUMERATED_COERCION\": \"ATTR_ENUMERATED_COERCION\",\n \"TRANSITION_CLASSES\": \"TRANSITION_CLASSES\",\n \"TRANSITION_GROUP_ROOT\": \"TRANSITION_GROUP_ROOT\",\n \"COMPONENT_ASYNC\": \"COMPONENT_ASYNC\",\n \"COMPONENT_FUNCTIONAL\": \"COMPONENT_FUNCTIONAL\",\n \"COMPONENT_V_MODEL\": \"COMPONENT_V_MODEL\",\n \"RENDER_FUNCTION\": \"RENDER_FUNCTION\",\n \"FILTERS\": \"FILTERS\",\n \"PRIVATE_APIS\": \"PRIVATE_APIS\"\n};\nconst deprecationData$1 = {\n [\"GLOBAL_MOUNT\"]: {\n message: `The global app bootstrapping API has changed: vm.$mount() and the \"el\" option have been removed. Use createApp(RootComponent).mount() instead.`,\n link: `https://v3-migration.vuejs.org/breaking-changes/global-api.html#mounting-app-instance`\n },\n [\"GLOBAL_MOUNT_CONTAINER\"]: {\n message: `Vue detected directives on the mount container. In Vue 3, the container is no longer considered part of the template and will not be processed/replaced.`,\n link: `https://v3-migration.vuejs.org/breaking-changes/mount-changes.html`\n },\n [\"GLOBAL_EXTEND\"]: {\n message: `Vue.extend() has been removed in Vue 3. Use defineComponent() instead.`,\n link: `https://vuejs.org/api/general.html#definecomponent`\n },\n [\"GLOBAL_PROTOTYPE\"]: {\n message: `Vue.prototype is no longer available in Vue 3. Use app.config.globalProperties instead.`,\n link: `https://v3-migration.vuejs.org/breaking-changes/global-api.html#vue-prototype-replaced-by-config-globalproperties`\n },\n [\"GLOBAL_SET\"]: {\n message: `Vue.set() has been removed as it is no longer needed in Vue 3. Simply use native JavaScript mutations.`\n },\n [\"GLOBAL_DELETE\"]: {\n message: `Vue.delete() has been removed as it is no longer needed in Vue 3. Simply use native JavaScript mutations.`\n },\n [\"GLOBAL_OBSERVABLE\"]: {\n message: `Vue.observable() has been removed. Use \\`import { reactive } from \"vue\"\\` from Composition API instead.`,\n link: `https://vuejs.org/api/reactivity-core.html#reactive`\n },\n [\"GLOBAL_PRIVATE_UTIL\"]: {\n message: `Vue.util has been removed. Please refactor to avoid its usage since it was an internal API even in Vue 2.`\n },\n [\"CONFIG_SILENT\"]: {\n message: `config.silent has been removed because it is not good practice to intentionally suppress warnings. You can use your browser console's filter features to focus on relevant messages.`\n },\n [\"CONFIG_DEVTOOLS\"]: {\n message: `config.devtools has been removed. To enable devtools for production, configure the __VUE_PROD_DEVTOOLS__ compile-time flag.`,\n link: `https://github.com/vuejs/core/tree/main/packages/vue#bundler-build-feature-flags`\n },\n [\"CONFIG_KEY_CODES\"]: {\n message: `config.keyCodes has been removed. In Vue 3, you can directly use the kebab-case key names as v-on modifiers.`,\n link: `https://v3-migration.vuejs.org/breaking-changes/keycode-modifiers.html`\n },\n [\"CONFIG_PRODUCTION_TIP\"]: {\n message: `config.productionTip has been removed.`,\n link: `https://v3-migration.vuejs.org/breaking-changes/global-api.html#config-productiontip-removed`\n },\n [\"CONFIG_IGNORED_ELEMENTS\"]: {\n message: () => {\n let msg = `config.ignoredElements has been removed.`;\n if (isRuntimeOnly()) {\n msg += ` Pass the \"isCustomElement\" option to @vue/compiler-dom instead.`;\n } else {\n msg += ` Use config.isCustomElement instead.`;\n }\n return msg;\n },\n link: `https://v3-migration.vuejs.org/breaking-changes/global-api.html#config-ignoredelements-is-now-config-iscustomelement`\n },\n [\"CONFIG_WHITESPACE\"]: {\n // this warning is only relevant in the full build when using runtime\n // compilation, so it's put in the runtime compatConfig list.\n message: `Vue 3 compiler's whitespace option will default to \"condense\" instead of \"preserve\". To suppress this warning, provide an explicit value for \\`config.compilerOptions.whitespace\\`.`\n },\n [\"CONFIG_OPTION_MERGE_STRATS\"]: {\n message: `config.optionMergeStrategies no longer exposes internal strategies. Use custom merge functions instead.`\n },\n [\"INSTANCE_SET\"]: {\n message: `vm.$set() has been removed as it is no longer needed in Vue 3. Simply use native JavaScript mutations.`\n },\n [\"INSTANCE_DELETE\"]: {\n message: `vm.$delete() has been removed as it is no longer needed in Vue 3. Simply use native JavaScript mutations.`\n },\n [\"INSTANCE_DESTROY\"]: {\n message: `vm.$destroy() has been removed. Use app.unmount() instead.`,\n link: `https://vuejs.org/api/application.html#app-unmount`\n },\n [\"INSTANCE_EVENT_EMITTER\"]: {\n message: `vm.$on/$once/$off() have been removed. Use an external event emitter library instead.`,\n link: `https://v3-migration.vuejs.org/breaking-changes/events-api.html`\n },\n [\"INSTANCE_EVENT_HOOKS\"]: {\n message: (event) => `\"${event}\" lifecycle events are no longer supported. From templates, use the \"vue:\" prefix instead of \"hook:\". For example, @${event} should be changed to @vue:${event.slice(5)}. From JavaScript, use Composition API to dynamically register lifecycle hooks.`,\n link: `https://v3-migration.vuejs.org/breaking-changes/vnode-lifecycle-events.html`\n },\n [\"INSTANCE_CHILDREN\"]: {\n message: `vm.$children has been removed. Consider refactoring your logic to avoid relying on direct access to child components.`,\n link: `https://v3-migration.vuejs.org/breaking-changes/children.html`\n },\n [\"INSTANCE_LISTENERS\"]: {\n message: `vm.$listeners has been removed. In Vue 3, parent v-on listeners are included in vm.$attrs and it is no longer necessary to separately use v-on=\"$listeners\" if you are already using v-bind=\"$attrs\". (Note: the Vue 3 behavior only applies if this compat config is disabled)`,\n link: `https://v3-migration.vuejs.org/breaking-changes/listeners-removed.html`\n },\n [\"INSTANCE_SCOPED_SLOTS\"]: {\n message: `vm.$scopedSlots has been removed. Use vm.$slots instead.`,\n link: `https://v3-migration.vuejs.org/breaking-changes/slots-unification.html`\n },\n [\"INSTANCE_ATTRS_CLASS_STYLE\"]: {\n message: (componentName) => `Component <${componentName || \"Anonymous\"}> has \\`inheritAttrs: false\\` but is relying on class/style fallthrough from parent. In Vue 3, class/style are now included in $attrs and will no longer fallthrough when inheritAttrs is false. If you are already using v-bind=\"$attrs\" on component root it should render the same end result. If you are binding $attrs to a non-root element and expecting class/style to fallthrough on root, you will need to now manually bind them on root via :class=\"$attrs.class\".`,\n link: `https://v3-migration.vuejs.org/breaking-changes/attrs-includes-class-style.html`\n },\n [\"OPTIONS_DATA_FN\"]: {\n message: `The \"data\" option can no longer be a plain object. Always use a function.`,\n link: `https://v3-migration.vuejs.org/breaking-changes/data-option.html`\n },\n [\"OPTIONS_DATA_MERGE\"]: {\n message: (key) => `Detected conflicting key \"${key}\" when merging data option values. In Vue 3, data keys are merged shallowly and will override one another.`,\n link: `https://v3-migration.vuejs.org/breaking-changes/data-option.html#mixin-merge-behavior-change`\n },\n [\"OPTIONS_BEFORE_DESTROY\"]: {\n message: `\\`beforeDestroy\\` has been renamed to \\`beforeUnmount\\`.`\n },\n [\"OPTIONS_DESTROYED\"]: {\n message: `\\`destroyed\\` has been renamed to \\`unmounted\\`.`\n },\n [\"WATCH_ARRAY\"]: {\n message: `\"watch\" option or vm.$watch on an array value will no longer trigger on array mutation unless the \"deep\" option is specified. If current usage is intended, you can disable the compat behavior and suppress this warning with:\n\n configureCompat({ ${\"WATCH_ARRAY\"}: false })\n`,\n link: `https://v3-migration.vuejs.org/breaking-changes/watch.html`\n },\n [\"PROPS_DEFAULT_THIS\"]: {\n message: (key) => `props default value function no longer has access to \"this\". The compat build only offers access to this.$options.(found in prop \"${key}\")`,\n link: `https://v3-migration.vuejs.org/breaking-changes/props-default-this.html`\n },\n [\"CUSTOM_DIR\"]: {\n message: (legacyHook, newHook) => `Custom directive hook \"${legacyHook}\" has been removed. Use \"${newHook}\" instead.`,\n link: `https://v3-migration.vuejs.org/breaking-changes/custom-directives.html`\n },\n [\"V_ON_KEYCODE_MODIFIER\"]: {\n message: `Using keyCode as v-on modifier is no longer supported. Use kebab-case key name modifiers instead.`,\n link: `https://v3-migration.vuejs.org/breaking-changes/keycode-modifiers.html`\n },\n [\"ATTR_FALSE_VALUE\"]: {\n message: (name) => `Attribute \"${name}\" with v-bind value \\`false\\` will render ${name}=\"false\" instead of removing it in Vue 3. To remove the attribute, use \\`null\\` or \\`undefined\\` instead. If the usage is intended, you can disable the compat behavior and suppress this warning with:\n\n configureCompat({ ${\"ATTR_FALSE_VALUE\"}: false })\n`,\n link: `https://v3-migration.vuejs.org/breaking-changes/attribute-coercion.html`\n },\n [\"ATTR_ENUMERATED_COERCION\"]: {\n message: (name, value, coerced) => `Enumerated attribute \"${name}\" with v-bind value \\`${value}\\` will ${value === null ? `be removed` : `render the value as-is`} instead of coercing the value to \"${coerced}\" in Vue 3. Always use explicit \"true\" or \"false\" values for enumerated attributes. If the usage is intended, you can disable the compat behavior and suppress this warning with:\n\n configureCompat({ ${\"ATTR_ENUMERATED_COERCION\"}: false })\n`,\n link: `https://v3-migration.vuejs.org/breaking-changes/attribute-coercion.html`\n },\n [\"TRANSITION_CLASSES\"]: {\n message: ``\n // this feature cannot be runtime-detected\n },\n [\"TRANSITION_GROUP_ROOT\"]: {\n message: ` no longer renders a root element by default if no \"tag\" prop is specified. If you do not rely on the span for styling, you can disable the compat behavior and suppress this warning with:\n\n configureCompat({ ${\"TRANSITION_GROUP_ROOT\"}: false })\n`,\n link: `https://v3-migration.vuejs.org/breaking-changes/transition-group.html`\n },\n [\"COMPONENT_ASYNC\"]: {\n message: (comp) => {\n const name = getComponentName(comp);\n return `Async component${name ? ` <${name}>` : `s`} should be explicitly created via \\`defineAsyncComponent()\\` in Vue 3. Plain functions will be treated as functional components in non-compat build. If you have already migrated all async component usage and intend to use plain functions for functional components, you can disable the compat behavior and suppress this warning with:\n\n configureCompat({ ${\"COMPONENT_ASYNC\"}: false })\n`;\n },\n link: `https://v3-migration.vuejs.org/breaking-changes/async-components.html`\n },\n [\"COMPONENT_FUNCTIONAL\"]: {\n message: (comp) => {\n const name = getComponentName(comp);\n return `Functional component${name ? ` <${name}>` : `s`} should be defined as a plain function in Vue 3. The \"functional\" option has been removed. NOTE: Before migrating to use plain functions for functional components, first make sure that all async components usage have been migrated and its compat behavior has been disabled.`;\n },\n link: `https://v3-migration.vuejs.org/breaking-changes/functional-components.html`\n },\n [\"COMPONENT_V_MODEL\"]: {\n message: (comp) => {\n const configMsg = `opt-in to Vue 3 behavior on a per-component basis with \\`compatConfig: { ${\"COMPONENT_V_MODEL\"}: false }\\`.`;\n if (comp.props && (isArray(comp.props) ? comp.props.includes(\"modelValue\") : hasOwn(comp.props, \"modelValue\"))) {\n return `Component declares \"modelValue\" prop, which is Vue 3 usage, but is running under Vue 2 compat v-model behavior. You can ${configMsg}`;\n }\n return `v-model usage on component has changed in Vue 3. Component that expects to work with v-model should now use the \"modelValue\" prop and emit the \"update:modelValue\" event. You can update the usage and then ${configMsg}`;\n },\n link: `https://v3-migration.vuejs.org/breaking-changes/v-model.html`\n },\n [\"RENDER_FUNCTION\"]: {\n message: `Vue 3's render function API has changed. You can opt-in to the new API with:\n\n configureCompat({ ${\"RENDER_FUNCTION\"}: false })\n\n (This can also be done per-component via the \"compatConfig\" option.)`,\n link: `https://v3-migration.vuejs.org/breaking-changes/render-function-api.html`\n },\n [\"FILTERS\"]: {\n message: `filters have been removed in Vue 3. The \"|\" symbol will be treated as native JavaScript bitwise OR operator. Use method calls or computed properties instead.`,\n link: `https://v3-migration.vuejs.org/breaking-changes/filters.html`\n },\n [\"PRIVATE_APIS\"]: {\n message: (name) => `\"${name}\" is a Vue 2 private API that no longer exists in Vue 3. If you are seeing this warning only due to a dependency, you can suppress this warning via { PRIVATE_APIS: 'suppress-warning' }.`\n }\n};\nconst instanceWarned = /* @__PURE__ */ Object.create(null);\nconst warnCount = /* @__PURE__ */ Object.create(null);\nfunction warnDeprecation$1(key, instance, ...args) {\n if (!!!(process.env.NODE_ENV !== \"production\")) {\n return;\n }\n instance = instance || getCurrentInstance();\n const config = getCompatConfigForKey(key, instance);\n if (config === \"suppress-warning\") {\n return;\n }\n const dupKey = key + args.join(\"\");\n let compId = instance && formatComponentName(instance, instance.type);\n if (compId === \"Anonymous\" && instance) {\n compId = instance.uid;\n }\n const componentDupKey = dupKey + compId;\n if (componentDupKey in instanceWarned) {\n return;\n }\n instanceWarned[componentDupKey] = true;\n if (dupKey in warnCount) {\n warn$1(`(deprecation ${key}) (${++warnCount[dupKey] + 1})`);\n return;\n }\n warnCount[dupKey] = 0;\n const { message, link } = deprecationData$1[key];\n warn$1(\n `(deprecation ${key}) ${typeof message === \"function\" ? message(...args) : message}${link ? `\n Details: ${link}` : ``}`\n );\n if (!isCompatEnabled$1(key, instance, true)) {\n console.error(\n `^ The above deprecation's compat behavior is disabled and will likely lead to runtime errors.`\n );\n }\n}\nconst globalCompatConfig = {\n MODE: 2\n};\nfunction configureCompat$1(config) {\n if (!!(process.env.NODE_ENV !== \"production\")) {\n validateCompatConfig(config);\n }\n extend(globalCompatConfig, config);\n}\nconst seenConfigObjects = /* @__PURE__ */ new WeakSet();\nconst warnedInvalidKeys = {};\nfunction validateCompatConfig(config, instance) {\n if (seenConfigObjects.has(config)) {\n return;\n }\n seenConfigObjects.add(config);\n for (const key of Object.keys(config)) {\n if (key !== \"MODE\" && !(key in deprecationData$1) && !(key in warnedInvalidKeys)) {\n if (key.startsWith(\"COMPILER_\")) {\n if (isRuntimeOnly()) {\n warn$1(\n `Deprecation config \"${key}\" is compiler-specific and you are running a runtime-only build of Vue. This deprecation should be configured via compiler options in your build setup instead.\nDetails: https://v3-migration.vuejs.org/breaking-changes/migration-build.html`\n );\n }\n } else {\n warn$1(`Invalid deprecation config \"${key}\".`);\n }\n warnedInvalidKeys[key] = true;\n }\n }\n}\nfunction getCompatConfigForKey(key, instance) {\n const instanceConfig = instance && instance.type.compatConfig;\n if (instanceConfig && key in instanceConfig) {\n return instanceConfig[key];\n }\n return globalCompatConfig[key];\n}\nfunction isCompatEnabled$1(key, instance, enableForBuiltIn = false) {\n if (!enableForBuiltIn && instance && instance.type.__isBuiltIn) {\n return false;\n }\n const rawMode = getCompatConfigForKey(\"MODE\", instance) || 2;\n const val = getCompatConfigForKey(key, instance);\n const mode = isFunction(rawMode) ? rawMode(instance && instance.type) : rawMode;\n if (mode === 2) {\n return val !== false;\n } else {\n return val === true || val === \"suppress-warning\";\n }\n}\nfunction assertCompatEnabled(key, instance, ...args) {\n if (!isCompatEnabled$1(key, instance)) {\n throw new Error(`${key} compat has been disabled.`);\n } else if (!!(process.env.NODE_ENV !== \"production\")) {\n warnDeprecation$1(key, instance, ...args);\n }\n}\nfunction softAssertCompatEnabled(key, instance, ...args) {\n if (!!(process.env.NODE_ENV !== \"production\")) {\n warnDeprecation$1(key, instance, ...args);\n }\n return isCompatEnabled$1(key, instance);\n}\nfunction checkCompatEnabled$1(key, instance, ...args) {\n const enabled = isCompatEnabled$1(key, instance);\n if (!!(process.env.NODE_ENV !== \"production\") && enabled) {\n warnDeprecation$1(key, instance, ...args);\n }\n return enabled;\n}\n\nconst eventRegistryMap = /* @__PURE__ */ new WeakMap();\nfunction getRegistry(instance) {\n let events = eventRegistryMap.get(instance);\n if (!events) {\n eventRegistryMap.set(instance, events = /* @__PURE__ */ Object.create(null));\n }\n return events;\n}\nfunction on(instance, event, fn) {\n if (isArray(event)) {\n event.forEach((e) => on(instance, e, fn));\n } else {\n if (event.startsWith(\"hook:\")) {\n assertCompatEnabled(\n \"INSTANCE_EVENT_HOOKS\",\n instance,\n event\n );\n } else {\n assertCompatEnabled(\"INSTANCE_EVENT_EMITTER\", instance);\n }\n const events = getRegistry(instance);\n (events[event] || (events[event] = [])).push(fn);\n }\n return instance.proxy;\n}\nfunction once(instance, event, fn) {\n const wrapped = (...args) => {\n off(instance, event, wrapped);\n fn.call(instance.proxy, ...args);\n };\n wrapped.fn = fn;\n on(instance, event, wrapped);\n return instance.proxy;\n}\nfunction off(instance, event, fn) {\n assertCompatEnabled(\"INSTANCE_EVENT_EMITTER\", instance);\n const vm = instance.proxy;\n if (!event) {\n eventRegistryMap.set(instance, /* @__PURE__ */ Object.create(null));\n return vm;\n }\n if (isArray(event)) {\n event.forEach((e) => off(instance, e, fn));\n return vm;\n }\n const events = getRegistry(instance);\n const cbs = events[event];\n if (!cbs) {\n return vm;\n }\n if (!fn) {\n events[event] = void 0;\n return vm;\n }\n events[event] = cbs.filter((cb) => !(cb === fn || cb.fn === fn));\n return vm;\n}\nfunction emit$1(instance, event, args) {\n const cbs = getRegistry(instance)[event];\n if (cbs) {\n callWithAsyncErrorHandling(\n cbs.map((cb) => cb.bind(instance.proxy)),\n instance,\n 6,\n args\n );\n }\n return instance.proxy;\n}\n\nconst compatModelEventPrefix = `onModelCompat:`;\nconst warnedTypes = /* @__PURE__ */ new WeakSet();\nfunction convertLegacyVModelProps(vnode) {\n const { type, shapeFlag, props, dynamicProps } = vnode;\n const comp = type;\n if (shapeFlag & 6 && props && \"modelValue\" in props) {\n if (!isCompatEnabled$1(\n \"COMPONENT_V_MODEL\",\n // this is a special case where we want to use the vnode component's\n // compat config instead of the current rendering instance (which is the\n // parent of the component that exposes v-model)\n { type }\n )) {\n return;\n }\n if (!!(process.env.NODE_ENV !== \"production\") && !warnedTypes.has(comp)) {\n pushWarningContext(vnode);\n warnDeprecation$1(\"COMPONENT_V_MODEL\", { type }, comp);\n popWarningContext();\n warnedTypes.add(comp);\n }\n const model = comp.model || {};\n applyModelFromMixins(model, comp.mixins);\n const { prop = \"value\", event = \"input\" } = model;\n if (prop !== \"modelValue\") {\n props[prop] = props.modelValue;\n delete props.modelValue;\n }\n if (dynamicProps) {\n dynamicProps[dynamicProps.indexOf(\"modelValue\")] = prop;\n }\n props[compatModelEventPrefix + event] = props[\"onUpdate:modelValue\"];\n delete props[\"onUpdate:modelValue\"];\n }\n}\nfunction applyModelFromMixins(model, mixins) {\n if (mixins) {\n mixins.forEach((m) => {\n if (m.model) extend(model, m.model);\n if (m.mixins) applyModelFromMixins(model, m.mixins);\n });\n }\n}\nfunction compatModelEmit(instance, event, args) {\n if (!isCompatEnabled$1(\"COMPONENT_V_MODEL\", instance)) {\n return;\n }\n const props = instance.vnode.props;\n const modelHandler = props && props[compatModelEventPrefix + event];\n if (modelHandler) {\n callWithErrorHandling(\n modelHandler,\n instance,\n 6,\n args\n );\n }\n}\n\nfunction emit(instance, event, ...rawArgs) {\n if (instance.isUnmounted) return;\n const props = instance.vnode.props || EMPTY_OBJ;\n if (!!(process.env.NODE_ENV !== \"production\")) {\n const {\n emitsOptions,\n propsOptions: [propsOptions]\n } = instance;\n if (emitsOptions) {\n if (!(event in emitsOptions) && !(event.startsWith(\"hook:\") || event.startsWith(compatModelEventPrefix))) {\n if (!propsOptions || !(toHandlerKey(event) in propsOptions)) {\n warn$1(\n `Component emitted event \"${event}\" but it is neither declared in the emits option nor as an \"${toHandlerKey(event)}\" prop.`\n );\n }\n } else {\n const validator = emitsOptions[event];\n if (isFunction(validator)) {\n const isValid = validator(...rawArgs);\n if (!isValid) {\n warn$1(\n `Invalid event arguments: event validation failed for event \"${event}\".`\n );\n }\n }\n }\n }\n }\n let args = rawArgs;\n const isModelListener = event.startsWith(\"update:\");\n const modelArg = isModelListener && event.slice(7);\n if (modelArg && modelArg in props) {\n const modifiersKey = `${modelArg === \"modelValue\" ? \"model\" : modelArg}Modifiers`;\n const { number, trim } = props[modifiersKey] || EMPTY_OBJ;\n if (trim) {\n args = rawArgs.map((a) => isString(a) ? a.trim() : a);\n }\n if (number) {\n args = rawArgs.map(looseToNumber);\n }\n }\n if (!!(process.env.NODE_ENV !== \"production\") || __VUE_PROD_DEVTOOLS__) {\n devtoolsComponentEmit(instance, event, args);\n }\n if (!!(process.env.NODE_ENV !== \"production\")) {\n const lowerCaseEvent = event.toLowerCase();\n if (lowerCaseEvent !== event && props[toHandlerKey(lowerCaseEvent)]) {\n warn$1(\n `Event \"${lowerCaseEvent}\" is emitted in component ${formatComponentName(\n instance,\n instance.type\n )} but the handler is registered for \"${event}\". Note that HTML attributes are case-insensitive and you cannot use v-on to listen to camelCase events when using in-DOM templates. You should probably use \"${hyphenate(\n event\n )}\" instead of \"${event}\".`\n );\n }\n }\n let handlerName;\n let handler = props[handlerName = toHandlerKey(event)] || // also try camelCase event handler (#2249)\n props[handlerName = toHandlerKey(camelize(event))];\n if (!handler && isModelListener) {\n handler = props[handlerName = toHandlerKey(hyphenate(event))];\n }\n if (handler) {\n callWithAsyncErrorHandling(\n handler,\n instance,\n 6,\n args\n );\n }\n const onceHandler = props[handlerName + `Once`];\n if (onceHandler) {\n if (!instance.emitted) {\n instance.emitted = {};\n } else if (instance.emitted[handlerName]) {\n return;\n }\n instance.emitted[handlerName] = true;\n callWithAsyncErrorHandling(\n onceHandler,\n instance,\n 6,\n args\n );\n }\n {\n compatModelEmit(instance, event, args);\n return emit$1(instance, event, args);\n }\n}\nfunction normalizeEmitsOptions(comp, appContext, asMixin = false) {\n const cache = appContext.emitsCache;\n const cached = cache.get(comp);\n if (cached !== void 0) {\n return cached;\n }\n const raw = comp.emits;\n let normalized = {};\n let hasExtends = false;\n if (__VUE_OPTIONS_API__ && !isFunction(comp)) {\n const extendEmits = (raw2) => {\n const normalizedFromExtend = normalizeEmitsOptions(raw2, appContext, true);\n if (normalizedFromExtend) {\n hasExtends = true;\n extend(normalized, normalizedFromExtend);\n }\n };\n if (!asMixin && appContext.mixins.length) {\n appContext.mixins.forEach(extendEmits);\n }\n if (comp.extends) {\n extendEmits(comp.extends);\n }\n if (comp.mixins) {\n comp.mixins.forEach(extendEmits);\n }\n }\n if (!raw && !hasExtends) {\n if (isObject(comp)) {\n cache.set(comp, null);\n }\n return null;\n }\n if (isArray(raw)) {\n raw.forEach((key) => normalized[key] = null);\n } else {\n extend(normalized, raw);\n }\n if (isObject(comp)) {\n cache.set(comp, normalized);\n }\n return normalized;\n}\nfunction isEmitListener(options, key) {\n if (!options || !isOn(key)) {\n return false;\n }\n if (key.startsWith(compatModelEventPrefix)) {\n return true;\n }\n key = key.slice(2).replace(/Once$/, \"\");\n return hasOwn(options, key[0].toLowerCase() + key.slice(1)) || hasOwn(options, hyphenate(key)) || hasOwn(options, key);\n}\n\nlet currentRenderingInstance = null;\nlet currentScopeId = null;\nfunction setCurrentRenderingInstance(instance) {\n const prev = currentRenderingInstance;\n currentRenderingInstance = instance;\n currentScopeId = instance && instance.type.__scopeId || null;\n if (!currentScopeId) {\n currentScopeId = instance && instance.type._scopeId || null;\n }\n return prev;\n}\nfunction pushScopeId(id) {\n currentScopeId = id;\n}\nfunction popScopeId() {\n currentScopeId = null;\n}\nconst withScopeId = (_id) => withCtx;\nfunction withCtx(fn, ctx = currentRenderingInstance, isNonScopedSlot) {\n if (!ctx) return fn;\n if (fn._n) {\n return fn;\n }\n const renderFnWithContext = (...args) => {\n if (renderFnWithContext._d) {\n setBlockTracking(-1);\n }\n const prevInstance = setCurrentRenderingInstance(ctx);\n let res;\n try {\n res = fn(...args);\n } finally {\n setCurrentRenderingInstance(prevInstance);\n if (renderFnWithContext._d) {\n setBlockTracking(1);\n }\n }\n if (!!(process.env.NODE_ENV !== \"production\") || __VUE_PROD_DEVTOOLS__) {\n devtoolsComponentUpdated(ctx);\n }\n return res;\n };\n renderFnWithContext._n = true;\n renderFnWithContext._c = true;\n renderFnWithContext._d = true;\n if (isNonScopedSlot) {\n renderFnWithContext._ns = true;\n }\n return renderFnWithContext;\n}\n\nlet accessedAttrs = false;\nfunction markAttrsAccessed() {\n accessedAttrs = true;\n}\nfunction renderComponentRoot(instance) {\n const {\n type: Component,\n vnode,\n proxy,\n withProxy,\n propsOptions: [propsOptions],\n slots,\n attrs,\n emit,\n render,\n renderCache,\n props,\n data,\n setupState,\n ctx,\n inheritAttrs\n } = instance;\n const prev = setCurrentRenderingInstance(instance);\n let result;\n let fallthroughAttrs;\n if (!!(process.env.NODE_ENV !== \"production\")) {\n accessedAttrs = false;\n }\n try {\n if (vnode.shapeFlag & 4) {\n const proxyToUse = withProxy || proxy;\n const thisProxy = !!(process.env.NODE_ENV !== \"production\") && setupState.__isScriptSetup ? new Proxy(proxyToUse, {\n get(target, key, receiver) {\n warn$1(\n `Property '${String(\n key\n )}' was accessed via 'this'. Avoid using 'this' in templates.`\n );\n return Reflect.get(target, key, receiver);\n }\n }) : proxyToUse;\n result = normalizeVNode(\n render.call(\n thisProxy,\n proxyToUse,\n renderCache,\n !!(process.env.NODE_ENV !== \"production\") ? shallowReadonly(props) : props,\n setupState,\n data,\n ctx\n )\n );\n fallthroughAttrs = attrs;\n } else {\n const render2 = Component;\n if (!!(process.env.NODE_ENV !== \"production\") && attrs === props) {\n markAttrsAccessed();\n }\n result = normalizeVNode(\n render2.length > 1 ? render2(\n !!(process.env.NODE_ENV !== \"production\") ? shallowReadonly(props) : props,\n !!(process.env.NODE_ENV !== \"production\") ? {\n get attrs() {\n markAttrsAccessed();\n return shallowReadonly(attrs);\n },\n slots,\n emit\n } : { attrs, slots, emit }\n ) : render2(\n !!(process.env.NODE_ENV !== \"production\") ? shallowReadonly(props) : props,\n null\n )\n );\n fallthroughAttrs = Component.props ? attrs : getFunctionalFallthrough(attrs);\n }\n } catch (err) {\n blockStack.length = 0;\n handleError(err, instance, 1);\n result = createVNode(Comment);\n }\n let root = result;\n let setRoot = void 0;\n if (!!(process.env.NODE_ENV !== \"production\") && result.patchFlag > 0 && result.patchFlag & 2048) {\n [root, setRoot] = getChildRoot(result);\n }\n if (fallthroughAttrs && inheritAttrs !== false) {\n const keys = Object.keys(fallthroughAttrs);\n const { shapeFlag } = root;\n if (keys.length) {\n if (shapeFlag & (1 | 6)) {\n if (propsOptions && keys.some(isModelListener)) {\n fallthroughAttrs = filterModelListeners(\n fallthroughAttrs,\n propsOptions\n );\n }\n root = cloneVNode(root, fallthroughAttrs, false, true);\n } else if (!!(process.env.NODE_ENV !== \"production\") && !accessedAttrs && root.type !== Comment) {\n const allAttrs = Object.keys(attrs);\n const eventAttrs = [];\n const extraAttrs = [];\n for (let i = 0, l = allAttrs.length; i < l; i++) {\n const key = allAttrs[i];\n if (isOn(key)) {\n if (!isModelListener(key)) {\n eventAttrs.push(key[2].toLowerCase() + key.slice(3));\n }\n } else {\n extraAttrs.push(key);\n }\n }\n if (extraAttrs.length) {\n warn$1(\n `Extraneous non-props attributes (${extraAttrs.join(\", \")}) were passed to component but could not be automatically inherited because component renders fragment or text root nodes.`\n );\n }\n if (eventAttrs.length) {\n warn$1(\n `Extraneous non-emits event listeners (${eventAttrs.join(\", \")}) were passed to component but could not be automatically inherited because component renders fragment or text root nodes. If the listener is intended to be a component custom event listener only, declare it using the \"emits\" option.`\n );\n }\n }\n }\n }\n if (isCompatEnabled$1(\"INSTANCE_ATTRS_CLASS_STYLE\", instance) && vnode.shapeFlag & 4 && root.shapeFlag & (1 | 6)) {\n const { class: cls, style } = vnode.props || {};\n if (cls || style) {\n if (!!(process.env.NODE_ENV !== \"production\") && inheritAttrs === false) {\n warnDeprecation$1(\n \"INSTANCE_ATTRS_CLASS_STYLE\",\n instance,\n getComponentName(instance.type)\n );\n }\n root = cloneVNode(\n root,\n {\n class: cls,\n style\n },\n false,\n true\n );\n }\n }\n if (vnode.dirs) {\n if (!!(process.env.NODE_ENV !== \"production\") && !isElementRoot(root)) {\n warn$1(\n `Runtime directive used on component with non-element root node. The directives will not function as intended.`\n );\n }\n root = cloneVNode(root, null, false, true);\n root.dirs = root.dirs ? root.dirs.concat(vnode.dirs) : vnode.dirs;\n }\n if (vnode.transition) {\n if (!!(process.env.NODE_ENV !== \"production\") && !isElementRoot(root)) {\n warn$1(\n `Component inside renders non-element root node that cannot be animated.`\n );\n }\n root.transition = vnode.transition;\n }\n if (!!(process.env.NODE_ENV !== \"production\") && setRoot) {\n setRoot(root);\n } else {\n result = root;\n }\n setCurrentRenderingInstance(prev);\n return result;\n}\nconst getChildRoot = (vnode) => {\n const rawChildren = vnode.children;\n const dynamicChildren = vnode.dynamicChildren;\n const childRoot = filterSingleRoot(rawChildren, false);\n if (!childRoot) {\n return [vnode, void 0];\n } else if (!!(process.env.NODE_ENV !== \"production\") && childRoot.patchFlag > 0 && childRoot.patchFlag & 2048) {\n return getChildRoot(childRoot);\n }\n const index = rawChildren.indexOf(childRoot);\n const dynamicIndex = dynamicChildren ? dynamicChildren.indexOf(childRoot) : -1;\n const setRoot = (updatedRoot) => {\n rawChildren[index] = updatedRoot;\n if (dynamicChildren) {\n if (dynamicIndex > -1) {\n dynamicChildren[dynamicIndex] = updatedRoot;\n } else if (updatedRoot.patchFlag > 0) {\n vnode.dynamicChildren = [...dynamicChildren, updatedRoot];\n }\n }\n };\n return [normalizeVNode(childRoot), setRoot];\n};\nfunction filterSingleRoot(children, recurse = true) {\n let singleRoot;\n for (let i = 0; i < children.length; i++) {\n const child = children[i];\n if (isVNode(child)) {\n if (child.type !== Comment || child.children === \"v-if\") {\n if (singleRoot) {\n return;\n } else {\n singleRoot = child;\n if (!!(process.env.NODE_ENV !== \"production\") && recurse && singleRoot.patchFlag > 0 && singleRoot.patchFlag & 2048) {\n return filterSingleRoot(singleRoot.children);\n }\n }\n }\n } else {\n return;\n }\n }\n return singleRoot;\n}\nconst getFunctionalFallthrough = (attrs) => {\n let res;\n for (const key in attrs) {\n if (key === \"class\" || key === \"style\" || isOn(key)) {\n (res || (res = {}))[key] = attrs[key];\n }\n }\n return res;\n};\nconst filterModelListeners = (attrs, props) => {\n const res = {};\n for (const key in attrs) {\n if (!isModelListener(key) || !(key.slice(9) in props)) {\n res[key] = attrs[key];\n }\n }\n return res;\n};\nconst isElementRoot = (vnode) => {\n return vnode.shapeFlag & (6 | 1) || vnode.type === Comment;\n};\nfunction shouldUpdateComponent(prevVNode, nextVNode, optimized) {\n const { props: prevProps, children: prevChildren, component } = prevVNode;\n const { props: nextProps, children: nextChildren, patchFlag } = nextVNode;\n const emits = component.emitsOptions;\n if (!!(process.env.NODE_ENV !== \"production\") && (prevChildren || nextChildren) && isHmrUpdating) {\n return true;\n }\n if (nextVNode.dirs || nextVNode.transition) {\n return true;\n }\n if (optimized && patchFlag >= 0) {\n if (patchFlag & 1024) {\n return true;\n }\n if (patchFlag & 16) {\n if (!prevProps) {\n return !!nextProps;\n }\n return hasPropsChanged(prevProps, nextProps, emits);\n } else if (patchFlag & 8) {\n const dynamicProps = nextVNode.dynamicProps;\n for (let i = 0; i < dynamicProps.length; i++) {\n const key = dynamicProps[i];\n if (nextProps[key] !== prevProps[key] && !isEmitListener(emits, key)) {\n return true;\n }\n }\n }\n } else {\n if (prevChildren || nextChildren) {\n if (!nextChildren || !nextChildren.$stable) {\n return true;\n }\n }\n if (prevProps === nextProps) {\n return false;\n }\n if (!prevProps) {\n return !!nextProps;\n }\n if (!nextProps) {\n return true;\n }\n return hasPropsChanged(prevProps, nextProps, emits);\n }\n return false;\n}\nfunction hasPropsChanged(prevProps, nextProps, emitsOptions) {\n const nextKeys = Object.keys(nextProps);\n if (nextKeys.length !== Object.keys(prevProps).length) {\n return true;\n }\n for (let i = 0; i < nextKeys.length; i++) {\n const key = nextKeys[i];\n if (nextProps[key] !== prevProps[key] && !isEmitListener(emitsOptions, key)) {\n return true;\n }\n }\n return false;\n}\nfunction updateHOCHostEl({ vnode, parent }, el) {\n while (parent) {\n const root = parent.subTree;\n if (root.suspense && root.suspense.activeBranch === vnode) {\n root.el = vnode.el;\n }\n if (root === vnode) {\n (vnode = parent.vnode).el = el;\n parent = parent.parent;\n } else {\n break;\n }\n }\n}\n\nconst COMPONENTS = \"components\";\nconst DIRECTIVES = \"directives\";\nconst FILTERS = \"filters\";\nfunction resolveComponent(name, maybeSelfReference) {\n return resolveAsset(COMPONENTS, name, true, maybeSelfReference) || name;\n}\nconst NULL_DYNAMIC_COMPONENT = Symbol.for(\"v-ndc\");\nfunction resolveDynamicComponent(component) {\n if (isString(component)) {\n return resolveAsset(COMPONENTS, component, false) || component;\n } else {\n return component || NULL_DYNAMIC_COMPONENT;\n }\n}\nfunction resolveDirective(name) {\n return resolveAsset(DIRECTIVES, name);\n}\nfunction resolveFilter$1(name) {\n return resolveAsset(FILTERS, name);\n}\nfunction resolveAsset(type, name, warnMissing = true, maybeSelfReference = false) {\n const instance = currentRenderingInstance || currentInstance;\n if (instance) {\n const Component = instance.type;\n if (type === COMPONENTS) {\n const selfName = getComponentName(\n Component,\n false\n );\n if (selfName && (selfName === name || selfName === camelize(name) || selfName === capitalize(camelize(name)))) {\n return Component;\n }\n }\n const res = (\n // local registration\n // check instance[type] first which is resolved for options API\n resolve(instance[type] || Component[type], name) || // global registration\n resolve(instance.appContext[type], name)\n );\n if (!res && maybeSelfReference) {\n return Component;\n }\n if (!!(process.env.NODE_ENV !== \"production\") && warnMissing && !res) {\n const extra = type === COMPONENTS ? `\nIf this is a native custom element, make sure to exclude it from component resolution via compilerOptions.isCustomElement.` : ``;\n warn$1(`Failed to resolve ${type.slice(0, -1)}: ${name}${extra}`);\n }\n return res;\n } else if (!!(process.env.NODE_ENV !== \"production\")) {\n warn$1(\n `resolve${capitalize(type.slice(0, -1))} can only be used in render() or setup().`\n );\n }\n}\nfunction resolve(registry, name) {\n return registry && (registry[name] || registry[camelize(name)] || registry[capitalize(camelize(name))]);\n}\n\nconst isSuspense = (type) => type.__isSuspense;\nlet suspenseId = 0;\nconst SuspenseImpl = {\n name: \"Suspense\",\n // In order to make Suspense tree-shakable, we need to avoid importing it\n // directly in the renderer. The renderer checks for the __isSuspense flag\n // on a vnode's type and calls the `process` method, passing in renderer\n // internals.\n __isSuspense: true,\n process(n1, n2, container, anchor, parentComponent, parentSuspense, namespace, slotScopeIds, optimized, rendererInternals) {\n if (n1 == null) {\n mountSuspense(\n n2,\n container,\n anchor,\n parentComponent,\n parentSuspense,\n namespace,\n slotScopeIds,\n optimized,\n rendererInternals\n );\n } else {\n if (parentSuspense && parentSuspense.deps > 0 && !n1.suspense.isInFallback) {\n n2.suspense = n1.suspense;\n n2.suspense.vnode = n2;\n n2.el = n1.el;\n return;\n }\n patchSuspense(\n n1,\n n2,\n container,\n anchor,\n parentComponent,\n namespace,\n slotScopeIds,\n optimized,\n rendererInternals\n );\n }\n },\n hydrate: hydrateSuspense,\n normalize: normalizeSuspenseChildren\n};\nconst Suspense = SuspenseImpl ;\nfunction triggerEvent(vnode, name) {\n const eventListener = vnode.props && vnode.props[name];\n if (isFunction(eventListener)) {\n eventListener();\n }\n}\nfunction mountSuspense(vnode, container, anchor, parentComponent, parentSuspense, namespace, slotScopeIds, optimized, rendererInternals) {\n const {\n p: patch,\n o: { createElement }\n } = rendererInternals;\n const hiddenContainer = createElement(\"div\");\n const suspense = vnode.suspense = createSuspenseBoundary(\n vnode,\n parentSuspense,\n parentComponent,\n container,\n hiddenContainer,\n anchor,\n namespace,\n slotScopeIds,\n optimized,\n rendererInternals\n );\n patch(\n null,\n suspense.pendingBranch = vnode.ssContent,\n hiddenContainer,\n null,\n parentComponent,\n suspense,\n namespace,\n slotScopeIds\n );\n if (suspense.deps > 0) {\n triggerEvent(vnode, \"onPending\");\n triggerEvent(vnode, \"onFallback\");\n patch(\n null,\n vnode.ssFallback,\n container,\n anchor,\n parentComponent,\n null,\n // fallback tree will not have suspense context\n namespace,\n slotScopeIds\n );\n setActiveBranch(suspense, vnode.ssFallback);\n } else {\n suspense.resolve(false, true);\n }\n}\nfunction patchSuspense(n1, n2, container, anchor, parentComponent, namespace, slotScopeIds, optimized, { p: patch, um: unmount, o: { createElement } }) {\n const suspense = n2.suspense = n1.suspense;\n suspense.vnode = n2;\n n2.el = n1.el;\n const newBranch = n2.ssContent;\n const newFallback = n2.ssFallback;\n const { activeBranch, pendingBranch, isInFallback, isHydrating } = suspense;\n if (pendingBranch) {\n suspense.pendingBranch = newBranch;\n if (isSameVNodeType(newBranch, pendingBranch)) {\n patch(\n pendingBranch,\n newBranch,\n suspense.hiddenContainer,\n null,\n parentComponent,\n suspense,\n namespace,\n slotScopeIds,\n optimized\n );\n if (suspense.deps <= 0) {\n suspense.resolve();\n } else if (isInFallback) {\n if (!isHydrating) {\n patch(\n activeBranch,\n newFallback,\n container,\n anchor,\n parentComponent,\n null,\n // fallback tree will not have suspense context\n namespace,\n slotScopeIds,\n optimized\n );\n setActiveBranch(suspense, newFallback);\n }\n }\n } else {\n suspense.pendingId = suspenseId++;\n if (isHydrating) {\n suspense.isHydrating = false;\n suspense.activeBranch = pendingBranch;\n } else {\n unmount(pendingBranch, parentComponent, suspense);\n }\n suspense.deps = 0;\n suspense.effects.length = 0;\n suspense.hiddenContainer = createElement(\"div\");\n if (isInFallback) {\n patch(\n null,\n newBranch,\n suspense.hiddenContainer,\n null,\n parentComponent,\n suspense,\n namespace,\n slotScopeIds,\n optimized\n );\n if (suspense.deps <= 0) {\n suspense.resolve();\n } else {\n patch(\n activeBranch,\n newFallback,\n container,\n anchor,\n parentComponent,\n null,\n // fallback tree will not have suspense context\n namespace,\n slotScopeIds,\n optimized\n );\n setActiveBranch(suspense, newFallback);\n }\n } else if (activeBranch && isSameVNodeType(newBranch, activeBranch)) {\n patch(\n activeBranch,\n newBranch,\n container,\n anchor,\n parentComponent,\n suspense,\n namespace,\n slotScopeIds,\n optimized\n );\n suspense.resolve(true);\n } else {\n patch(\n null,\n newBranch,\n suspense.hiddenContainer,\n null,\n parentComponent,\n suspense,\n namespace,\n slotScopeIds,\n optimized\n );\n if (suspense.deps <= 0) {\n suspense.resolve();\n }\n }\n }\n } else {\n if (activeBranch && isSameVNodeType(newBranch, activeBranch)) {\n patch(\n activeBranch,\n newBranch,\n container,\n anchor,\n parentComponent,\n suspense,\n namespace,\n slotScopeIds,\n optimized\n );\n setActiveBranch(suspense, newBranch);\n } else {\n triggerEvent(n2, \"onPending\");\n suspense.pendingBranch = newBranch;\n if (newBranch.shapeFlag & 512) {\n suspense.pendingId = newBranch.component.suspenseId;\n } else {\n suspense.pendingId = suspenseId++;\n }\n patch(\n null,\n newBranch,\n suspense.hiddenContainer,\n null,\n parentComponent,\n suspense,\n namespace,\n slotScopeIds,\n optimized\n );\n if (suspense.deps <= 0) {\n suspense.resolve();\n } else {\n const { timeout, pendingId } = suspense;\n if (timeout > 0) {\n setTimeout(() => {\n if (suspense.pendingId === pendingId) {\n suspense.fallback(newFallback);\n }\n }, timeout);\n } else if (timeout === 0) {\n suspense.fallback(newFallback);\n }\n }\n }\n }\n}\nlet hasWarned = false;\nfunction createSuspenseBoundary(vnode, parentSuspense, parentComponent, container, hiddenContainer, anchor, namespace, slotScopeIds, optimized, rendererInternals, isHydrating = false) {\n if (!!(process.env.NODE_ENV !== \"production\") && true && !hasWarned) {\n hasWarned = true;\n console[console.info ? \"info\" : \"log\"](\n ` is an experimental feature and its API will likely change.`\n );\n }\n const {\n p: patch,\n m: move,\n um: unmount,\n n: next,\n o: { parentNode, remove }\n } = rendererInternals;\n let parentSuspenseId;\n const isSuspensible = isVNodeSuspensible(vnode);\n if (isSuspensible) {\n if (parentSuspense && parentSuspense.pendingBranch) {\n parentSuspenseId = parentSuspense.pendingId;\n parentSuspense.deps++;\n }\n }\n const timeout = vnode.props ? toNumber(vnode.props.timeout) : void 0;\n if (!!(process.env.NODE_ENV !== \"production\")) {\n assertNumber(timeout, `Suspense timeout`);\n }\n const initialAnchor = anchor;\n const suspense = {\n vnode,\n parent: parentSuspense,\n parentComponent,\n namespace,\n container,\n hiddenContainer,\n deps: 0,\n pendingId: suspenseId++,\n timeout: typeof timeout === \"number\" ? timeout : -1,\n activeBranch: null,\n pendingBranch: null,\n isInFallback: !isHydrating,\n isHydrating,\n isUnmounted: false,\n effects: [],\n resolve(resume = false, sync = false) {\n if (!!(process.env.NODE_ENV !== \"production\")) {\n if (!resume && !suspense.pendingBranch) {\n throw new Error(\n `suspense.resolve() is called without a pending branch.`\n );\n }\n if (suspense.isUnmounted) {\n throw new Error(\n `suspense.resolve() is called on an already unmounted suspense boundary.`\n );\n }\n }\n const {\n vnode: vnode2,\n activeBranch,\n pendingBranch,\n pendingId,\n effects,\n parentComponent: parentComponent2,\n container: container2\n } = suspense;\n let delayEnter = false;\n if (suspense.isHydrating) {\n suspense.isHydrating = false;\n } else if (!resume) {\n delayEnter = activeBranch && pendingBranch.transition && pendingBranch.transition.mode === \"out-in\";\n if (delayEnter) {\n activeBranch.transition.afterLeave = () => {\n if (pendingId === suspense.pendingId) {\n move(\n pendingBranch,\n container2,\n anchor === initialAnchor ? next(activeBranch) : anchor,\n 0\n );\n queuePostFlushCb(effects);\n }\n };\n }\n if (activeBranch) {\n if (parentNode(activeBranch.el) !== suspense.hiddenContainer) {\n anchor = next(activeBranch);\n }\n unmount(activeBranch, parentComponent2, suspense, true);\n }\n if (!delayEnter) {\n move(pendingBranch, container2, anchor, 0);\n }\n }\n setActiveBranch(suspense, pendingBranch);\n suspense.pendingBranch = null;\n suspense.isInFallback = false;\n let parent = suspense.parent;\n let hasUnresolvedAncestor = false;\n while (parent) {\n if (parent.pendingBranch) {\n parent.effects.push(...effects);\n hasUnresolvedAncestor = true;\n break;\n }\n parent = parent.parent;\n }\n if (!hasUnresolvedAncestor && !delayEnter) {\n queuePostFlushCb(effects);\n }\n suspense.effects = [];\n if (isSuspensible) {\n if (parentSuspense && parentSuspense.pendingBranch && parentSuspenseId === parentSuspense.pendingId) {\n parentSuspense.deps--;\n if (parentSuspense.deps === 0 && !sync) {\n parentSuspense.resolve();\n }\n }\n }\n triggerEvent(vnode2, \"onResolve\");\n },\n fallback(fallbackVNode) {\n if (!suspense.pendingBranch) {\n return;\n }\n const { vnode: vnode2, activeBranch, parentComponent: parentComponent2, container: container2, namespace: namespace2 } = suspense;\n triggerEvent(vnode2, \"onFallback\");\n const anchor2 = next(activeBranch);\n const mountFallback = () => {\n if (!suspense.isInFallback) {\n return;\n }\n patch(\n null,\n fallbackVNode,\n container2,\n anchor2,\n parentComponent2,\n null,\n // fallback tree will not have suspense context\n namespace2,\n slotScopeIds,\n optimized\n );\n setActiveBranch(suspense, fallbackVNode);\n };\n const delayEnter = fallbackVNode.transition && fallbackVNode.transition.mode === \"out-in\";\n if (delayEnter) {\n activeBranch.transition.afterLeave = mountFallback;\n }\n suspense.isInFallback = true;\n unmount(\n activeBranch,\n parentComponent2,\n null,\n // no suspense so unmount hooks fire now\n true\n // shouldRemove\n );\n if (!delayEnter) {\n mountFallback();\n }\n },\n move(container2, anchor2, type) {\n suspense.activeBranch && move(suspense.activeBranch, container2, anchor2, type);\n suspense.container = container2;\n },\n next() {\n return suspense.activeBranch && next(suspense.activeBranch);\n },\n registerDep(instance, setupRenderEffect, optimized2) {\n const isInPendingSuspense = !!suspense.pendingBranch;\n if (isInPendingSuspense) {\n suspense.deps++;\n }\n const hydratedEl = instance.vnode.el;\n instance.asyncDep.catch((err) => {\n handleError(err, instance, 0);\n }).then((asyncSetupResult) => {\n if (instance.isUnmounted || suspense.isUnmounted || suspense.pendingId !== instance.suspenseId) {\n return;\n }\n instance.asyncResolved = true;\n const { vnode: vnode2 } = instance;\n if (!!(process.env.NODE_ENV !== \"production\")) {\n pushWarningContext(vnode2);\n }\n handleSetupResult(instance, asyncSetupResult, false);\n if (hydratedEl) {\n vnode2.el = hydratedEl;\n }\n const placeholder = !hydratedEl && instance.subTree.el;\n setupRenderEffect(\n instance,\n vnode2,\n // component may have been moved before resolve.\n // if this is not a hydration, instance.subTree will be the comment\n // placeholder.\n parentNode(hydratedEl || instance.subTree.el),\n // anchor will not be used if this is hydration, so only need to\n // consider the comment placeholder case.\n hydratedEl ? null : next(instance.subTree),\n suspense,\n namespace,\n optimized2\n );\n if (placeholder) {\n remove(placeholder);\n }\n updateHOCHostEl(instance, vnode2.el);\n if (!!(process.env.NODE_ENV !== \"production\")) {\n popWarningContext();\n }\n if (isInPendingSuspense && --suspense.deps === 0) {\n suspense.resolve();\n }\n });\n },\n unmount(parentSuspense2, doRemove) {\n suspense.isUnmounted = true;\n if (suspense.activeBranch) {\n unmount(\n suspense.activeBranch,\n parentComponent,\n parentSuspense2,\n doRemove\n );\n }\n if (suspense.pendingBranch) {\n unmount(\n suspense.pendingBranch,\n parentComponent,\n parentSuspense2,\n doRemove\n );\n }\n }\n };\n return suspense;\n}\nfunction hydrateSuspense(node, vnode, parentComponent, parentSuspense, namespace, slotScopeIds, optimized, rendererInternals, hydrateNode) {\n const suspense = vnode.suspense = createSuspenseBoundary(\n vnode,\n parentSuspense,\n parentComponent,\n node.parentNode,\n // eslint-disable-next-line no-restricted-globals\n document.createElement(\"div\"),\n null,\n namespace,\n slotScopeIds,\n optimized,\n rendererInternals,\n true\n );\n const result = hydrateNode(\n node,\n suspense.pendingBranch = vnode.ssContent,\n parentComponent,\n suspense,\n slotScopeIds,\n optimized\n );\n if (suspense.deps === 0) {\n suspense.resolve(false, true);\n }\n return result;\n}\nfunction normalizeSuspenseChildren(vnode) {\n const { shapeFlag, children } = vnode;\n const isSlotChildren = shapeFlag & 32;\n vnode.ssContent = normalizeSuspenseSlot(\n isSlotChildren ? children.default : children\n );\n vnode.ssFallback = isSlotChildren ? normalizeSuspenseSlot(children.fallback) : createVNode(Comment);\n}\nfunction normalizeSuspenseSlot(s) {\n let block;\n if (isFunction(s)) {\n const trackBlock = isBlockTreeEnabled && s._c;\n if (trackBlock) {\n s._d = false;\n openBlock();\n }\n s = s();\n if (trackBlock) {\n s._d = true;\n block = currentBlock;\n closeBlock();\n }\n }\n if (isArray(s)) {\n const singleChild = filterSingleRoot(s);\n if (!!(process.env.NODE_ENV !== \"production\") && !singleChild && s.filter((child) => child !== NULL_DYNAMIC_COMPONENT).length > 0) {\n warn$1(` slots expect a single root node.`);\n }\n s = singleChild;\n }\n s = normalizeVNode(s);\n if (block && !s.dynamicChildren) {\n s.dynamicChildren = block.filter((c) => c !== s);\n }\n return s;\n}\nfunction queueEffectWithSuspense(fn, suspense) {\n if (suspense && suspense.pendingBranch) {\n if (isArray(fn)) {\n suspense.effects.push(...fn);\n } else {\n suspense.effects.push(fn);\n }\n } else {\n queuePostFlushCb(fn);\n }\n}\nfunction setActiveBranch(suspense, branch) {\n suspense.activeBranch = branch;\n const { vnode, parentComponent } = suspense;\n let el = branch.el;\n while (!el && branch.component) {\n branch = branch.component.subTree;\n el = branch.el;\n }\n vnode.el = el;\n if (parentComponent && parentComponent.subTree === vnode) {\n parentComponent.vnode.el = el;\n updateHOCHostEl(parentComponent, el);\n }\n}\nfunction isVNodeSuspensible(vnode) {\n const suspensible = vnode.props && vnode.props.suspensible;\n return suspensible != null && suspensible !== false;\n}\n\nfunction injectHook(type, hook, target = currentInstance, prepend = false) {\n if (target) {\n const hooks = target[type] || (target[type] = []);\n const wrappedHook = hook.__weh || (hook.__weh = (...args) => {\n pauseTracking();\n const reset = setCurrentInstance(target);\n const res = callWithAsyncErrorHandling(hook, target, type, args);\n reset();\n resetTracking();\n return res;\n });\n if (prepend) {\n hooks.unshift(wrappedHook);\n } else {\n hooks.push(wrappedHook);\n }\n return wrappedHook;\n } else if (!!(process.env.NODE_ENV !== \"production\")) {\n const apiName = toHandlerKey(ErrorTypeStrings$1[type].replace(/ hook$/, \"\"));\n warn$1(\n `${apiName} is called when there is no active component instance to be associated with. Lifecycle injection APIs can only be used during execution of setup().` + (` If you are using async setup(), make sure to register lifecycle hooks before the first await statement.` )\n );\n }\n}\nconst createHook = (lifecycle) => (hook, target = currentInstance) => {\n if (!isInSSRComponentSetup || lifecycle === \"sp\") {\n injectHook(lifecycle, (...args) => hook(...args), target);\n }\n};\nconst onBeforeMount = createHook(\"bm\");\nconst onMounted = createHook(\"m\");\nconst onBeforeUpdate = createHook(\"bu\");\nconst onUpdated = createHook(\"u\");\nconst onBeforeUnmount = createHook(\"bum\");\nconst onUnmounted = createHook(\"um\");\nconst onServerPrefetch = createHook(\"sp\");\nconst onRenderTriggered = createHook(\n \"rtg\"\n);\nconst onRenderTracked = createHook(\n \"rtc\"\n);\nfunction onErrorCaptured(hook, target = currentInstance) {\n injectHook(\"ec\", hook, target);\n}\n\nconst legacyDirectiveHookMap = {\n beforeMount: \"bind\",\n mounted: \"inserted\",\n updated: [\"update\", \"componentUpdated\"],\n unmounted: \"unbind\"\n};\nfunction mapCompatDirectiveHook(name, dir, instance) {\n const mappedName = legacyDirectiveHookMap[name];\n if (mappedName) {\n if (isArray(mappedName)) {\n const hook = [];\n mappedName.forEach((mapped) => {\n const mappedHook = dir[mapped];\n if (mappedHook) {\n softAssertCompatEnabled(\n \"CUSTOM_DIR\",\n instance,\n mapped,\n name\n );\n hook.push(mappedHook);\n }\n });\n return hook.length ? hook : void 0;\n } else {\n if (dir[mappedName]) {\n softAssertCompatEnabled(\n \"CUSTOM_DIR\",\n instance,\n mappedName,\n name\n );\n }\n return dir[mappedName];\n }\n }\n}\n\nfunction validateDirectiveName(name) {\n if (isBuiltInDirective(name)) {\n warn$1(\"Do not use built-in directive ids as custom directive id: \" + name);\n }\n}\nfunction withDirectives(vnode, directives) {\n if (currentRenderingInstance === null) {\n !!(process.env.NODE_ENV !== \"production\") && warn$1(`withDirectives can only be used inside render functions.`);\n return vnode;\n }\n const instance = getComponentPublicInstance(currentRenderingInstance);\n const bindings = vnode.dirs || (vnode.dirs = []);\n for (let i = 0; i < directives.length; i++) {\n let [dir, value, arg, modifiers = EMPTY_OBJ] = directives[i];\n if (dir) {\n if (isFunction(dir)) {\n dir = {\n mounted: dir,\n updated: dir\n };\n }\n if (dir.deep) {\n traverse(value);\n }\n bindings.push({\n dir,\n instance,\n value,\n oldValue: void 0,\n arg,\n modifiers\n });\n }\n }\n return vnode;\n}\nfunction invokeDirectiveHook(vnode, prevVNode, instance, name) {\n const bindings = vnode.dirs;\n const oldBindings = prevVNode && prevVNode.dirs;\n for (let i = 0; i < bindings.length; i++) {\n const binding = bindings[i];\n if (oldBindings) {\n binding.oldValue = oldBindings[i].value;\n }\n let hook = binding.dir[name];\n if (!hook) {\n hook = mapCompatDirectiveHook(name, binding.dir, instance);\n }\n if (hook) {\n pauseTracking();\n callWithAsyncErrorHandling(hook, instance, 8, [\n vnode.el,\n binding,\n vnode,\n prevVNode\n ]);\n resetTracking();\n }\n }\n}\n\nfunction getCompatChildren(instance) {\n assertCompatEnabled(\"INSTANCE_CHILDREN\", instance);\n const root = instance.subTree;\n const children = [];\n if (root) {\n walk$1(root, children);\n }\n return children;\n}\nfunction walk$1(vnode, children) {\n if (vnode.component) {\n children.push(vnode.component.proxy);\n } else if (vnode.shapeFlag & 16) {\n const vnodes = vnode.children;\n for (let i = 0; i < vnodes.length; i++) {\n walk$1(vnodes[i], children);\n }\n }\n}\n\nfunction getCompatListeners(instance) {\n assertCompatEnabled(\"INSTANCE_LISTENERS\", instance);\n const listeners = {};\n const rawProps = instance.vnode.props;\n if (!rawProps) {\n return listeners;\n }\n for (const key in rawProps) {\n if (isOn(key)) {\n listeners[key[2].toLowerCase() + key.slice(3)] = rawProps[key];\n }\n }\n return listeners;\n}\n\nfunction convertLegacyRenderFn(instance) {\n const Component = instance.type;\n const render = Component.render;\n if (!render || render._rc || render._compatChecked || render._compatWrapped) {\n return;\n }\n if (render.length >= 2) {\n render._compatChecked = true;\n return;\n }\n if (checkCompatEnabled$1(\"RENDER_FUNCTION\", instance)) {\n const wrapped = Component.render = function compatRender() {\n return render.call(this, compatH);\n };\n wrapped._compatWrapped = true;\n }\n}\nfunction compatH(type, propsOrChildren, children) {\n if (!type) {\n type = Comment;\n }\n if (typeof type === \"string\") {\n const t = hyphenate(type);\n if (t === \"transition\" || t === \"transition-group\" || t === \"keep-alive\") {\n type = `__compat__${t}`;\n }\n type = resolveDynamicComponent(type);\n }\n const l = arguments.length;\n const is2ndArgArrayChildren = isArray(propsOrChildren);\n if (l === 2 || is2ndArgArrayChildren) {\n if (isObject(propsOrChildren) && !is2ndArgArrayChildren) {\n if (isVNode(propsOrChildren)) {\n return convertLegacySlots(createVNode(type, null, [propsOrChildren]));\n }\n return convertLegacySlots(\n convertLegacyDirectives(\n createVNode(type, convertLegacyProps(propsOrChildren, type)),\n propsOrChildren\n )\n );\n } else {\n return convertLegacySlots(createVNode(type, null, propsOrChildren));\n }\n } else {\n if (isVNode(children)) {\n children = [children];\n }\n return convertLegacySlots(\n convertLegacyDirectives(\n createVNode(type, convertLegacyProps(propsOrChildren, type), children),\n propsOrChildren\n )\n );\n }\n}\nconst skipLegacyRootLevelProps = /* @__PURE__ */ makeMap(\n \"staticStyle,staticClass,directives,model,hook\"\n);\nfunction convertLegacyProps(legacyProps, type) {\n if (!legacyProps) {\n return null;\n }\n const converted = {};\n for (const key in legacyProps) {\n if (key === \"attrs\" || key === \"domProps\" || key === \"props\") {\n extend(converted, legacyProps[key]);\n } else if (key === \"on\" || key === \"nativeOn\") {\n const listeners = legacyProps[key];\n for (const event in listeners) {\n let handlerKey = convertLegacyEventKey(event);\n if (key === \"nativeOn\") handlerKey += `Native`;\n const existing = converted[handlerKey];\n const incoming = listeners[event];\n if (existing !== incoming) {\n if (existing) {\n converted[handlerKey] = [].concat(existing, incoming);\n } else {\n converted[handlerKey] = incoming;\n }\n }\n }\n } else if (!skipLegacyRootLevelProps(key)) {\n converted[key] = legacyProps[key];\n }\n }\n if (legacyProps.staticClass) {\n converted.class = normalizeClass([legacyProps.staticClass, converted.class]);\n }\n if (legacyProps.staticStyle) {\n converted.style = normalizeStyle([legacyProps.staticStyle, converted.style]);\n }\n if (legacyProps.model && isObject(type)) {\n const { prop = \"value\", event = \"input\" } = type.model || {};\n converted[prop] = legacyProps.model.value;\n converted[compatModelEventPrefix + event] = legacyProps.model.callback;\n }\n return converted;\n}\nfunction convertLegacyEventKey(event) {\n if (event[0] === \"&\") {\n event = event.slice(1) + \"Passive\";\n }\n if (event[0] === \"~\") {\n event = event.slice(1) + \"Once\";\n }\n if (event[0] === \"!\") {\n event = event.slice(1) + \"Capture\";\n }\n return toHandlerKey(event);\n}\nfunction convertLegacyDirectives(vnode, props) {\n if (props && props.directives) {\n return withDirectives(\n vnode,\n props.directives.map(({ name, value, arg, modifiers }) => {\n return [\n resolveDirective(name),\n value,\n arg,\n modifiers\n ];\n })\n );\n }\n return vnode;\n}\nfunction convertLegacySlots(vnode) {\n const { props, children } = vnode;\n let slots;\n if (vnode.shapeFlag & 6 && isArray(children)) {\n slots = {};\n for (let i = 0; i < children.length; i++) {\n const child = children[i];\n const slotName = isVNode(child) && child.props && child.props.slot || \"default\";\n const slot = slots[slotName] || (slots[slotName] = []);\n if (isVNode(child) && child.type === \"template\") {\n slot.push(child.children);\n } else {\n slot.push(child);\n }\n }\n if (slots) {\n for (const key in slots) {\n const slotChildren = slots[key];\n slots[key] = () => slotChildren;\n slots[key]._ns = true;\n }\n }\n }\n const scopedSlots = props && props.scopedSlots;\n if (scopedSlots) {\n delete props.scopedSlots;\n if (slots) {\n extend(slots, scopedSlots);\n } else {\n slots = scopedSlots;\n }\n }\n if (slots) {\n normalizeChildren(vnode, slots);\n }\n return vnode;\n}\nfunction defineLegacyVNodeProperties(vnode) {\n if (isCompatEnabled$1(\n \"RENDER_FUNCTION\",\n currentRenderingInstance,\n true\n ) && isCompatEnabled$1(\n \"PRIVATE_APIS\",\n currentRenderingInstance,\n true\n )) {\n const context = currentRenderingInstance;\n const getInstance = () => vnode.component && vnode.component.proxy;\n let componentOptions;\n Object.defineProperties(vnode, {\n tag: { get: () => vnode.type },\n data: { get: () => vnode.props || {}, set: (p) => vnode.props = p },\n elm: { get: () => vnode.el },\n componentInstance: { get: getInstance },\n child: { get: getInstance },\n text: { get: () => isString(vnode.children) ? vnode.children : null },\n context: { get: () => context && context.proxy },\n componentOptions: {\n get: () => {\n if (vnode.shapeFlag & 4) {\n if (componentOptions) {\n return componentOptions;\n }\n return componentOptions = {\n Ctor: vnode.type,\n propsData: vnode.props,\n children: vnode.children\n };\n }\n }\n }\n });\n }\n}\n\nconst normalizedFunctionalComponentMap = /* @__PURE__ */ new WeakMap();\nconst legacySlotProxyHandlers = {\n get(target, key) {\n const slot = target[key];\n return slot && slot();\n }\n};\nfunction convertLegacyFunctionalComponent(comp) {\n if (normalizedFunctionalComponentMap.has(comp)) {\n return normalizedFunctionalComponentMap.get(comp);\n }\n const legacyFn = comp.render;\n const Func = (props, ctx) => {\n const instance = getCurrentInstance();\n const legacyCtx = {\n props,\n children: instance.vnode.children || [],\n data: instance.vnode.props || {},\n scopedSlots: ctx.slots,\n parent: instance.parent && instance.parent.proxy,\n slots() {\n return new Proxy(ctx.slots, legacySlotProxyHandlers);\n },\n get listeners() {\n return getCompatListeners(instance);\n },\n get injections() {\n if (comp.inject) {\n const injections = {};\n resolveInjections(comp.inject, injections);\n return injections;\n }\n return {};\n }\n };\n return legacyFn(compatH, legacyCtx);\n };\n Func.props = comp.props;\n Func.displayName = comp.name;\n Func.compatConfig = comp.compatConfig;\n Func.inheritAttrs = false;\n normalizedFunctionalComponentMap.set(comp, Func);\n return Func;\n}\n\nfunction renderList(source, renderItem, cache, index) {\n let ret;\n const cached = cache && cache[index];\n if (isArray(source) || isString(source)) {\n ret = new Array(source.length);\n for (let i = 0, l = source.length; i < l; i++) {\n ret[i] = renderItem(source[i], i, void 0, cached && cached[i]);\n }\n } else if (typeof source === \"number\") {\n if (!!(process.env.NODE_ENV !== \"production\") && !Number.isInteger(source)) {\n warn$1(`The v-for range expect an integer value but got ${source}.`);\n }\n ret = new Array(source);\n for (let i = 0; i < source; i++) {\n ret[i] = renderItem(i + 1, i, void 0, cached && cached[i]);\n }\n } else if (isObject(source)) {\n if (source[Symbol.iterator]) {\n ret = Array.from(\n source,\n (item, i) => renderItem(item, i, void 0, cached && cached[i])\n );\n } else {\n const keys = Object.keys(source);\n ret = new Array(keys.length);\n for (let i = 0, l = keys.length; i < l; i++) {\n const key = keys[i];\n ret[i] = renderItem(source[key], key, i, cached && cached[i]);\n }\n }\n } else {\n ret = [];\n }\n if (cache) {\n cache[index] = ret;\n }\n return ret;\n}\n\nfunction createSlots(slots, dynamicSlots) {\n for (let i = 0; i < dynamicSlots.length; i++) {\n const slot = dynamicSlots[i];\n if (isArray(slot)) {\n for (let j = 0; j < slot.length; j++) {\n slots[slot[j].name] = slot[j].fn;\n }\n } else if (slot) {\n slots[slot.name] = slot.key ? (...args) => {\n const res = slot.fn(...args);\n if (res) res.key = slot.key;\n return res;\n } : slot.fn;\n }\n }\n return slots;\n}\n\n/*! #__NO_SIDE_EFFECTS__ */\n// @__NO_SIDE_EFFECTS__\nfunction defineComponent(options, extraOptions) {\n return isFunction(options) ? (\n // #8326: extend call and options.name access are considered side-effects\n // by Rollup, so we have to wrap it in a pure-annotated IIFE.\n /* @__PURE__ */ (() => extend({ name: options.name }, extraOptions, { setup: options }))()\n ) : options;\n}\n\nconst isAsyncWrapper = (i) => !!i.type.__asyncLoader;\n/*! #__NO_SIDE_EFFECTS__ */\n// @__NO_SIDE_EFFECTS__\nfunction defineAsyncComponent(source) {\n if (isFunction(source)) {\n source = { loader: source };\n }\n const {\n loader,\n loadingComponent,\n errorComponent,\n delay = 200,\n timeout,\n // undefined = never times out\n suspensible = true,\n onError: userOnError\n } = source;\n let pendingRequest = null;\n let resolvedComp;\n let retries = 0;\n const retry = () => {\n retries++;\n pendingRequest = null;\n return load();\n };\n const load = () => {\n let thisRequest;\n return pendingRequest || (thisRequest = pendingRequest = loader().catch((err) => {\n err = err instanceof Error ? err : new Error(String(err));\n if (userOnError) {\n return new Promise((resolve, reject) => {\n const userRetry = () => resolve(retry());\n const userFail = () => reject(err);\n userOnError(err, userRetry, userFail, retries + 1);\n });\n } else {\n throw err;\n }\n }).then((comp) => {\n if (thisRequest !== pendingRequest && pendingRequest) {\n return pendingRequest;\n }\n if (!!(process.env.NODE_ENV !== \"production\") && !comp) {\n warn$1(\n `Async component loader resolved to undefined. If you are using retry(), make sure to return its return value.`\n );\n }\n if (comp && (comp.__esModule || comp[Symbol.toStringTag] === \"Module\")) {\n comp = comp.default;\n }\n if (!!(process.env.NODE_ENV !== \"production\") && comp && !isObject(comp) && !isFunction(comp)) {\n throw new Error(`Invalid async component load result: ${comp}`);\n }\n resolvedComp = comp;\n return comp;\n }));\n };\n return defineComponent({\n name: \"AsyncComponentWrapper\",\n __asyncLoader: load,\n get __asyncResolved() {\n return resolvedComp;\n },\n setup() {\n const instance = currentInstance;\n if (resolvedComp) {\n return () => createInnerComp(resolvedComp, instance);\n }\n const onError = (err) => {\n pendingRequest = null;\n handleError(\n err,\n instance,\n 13,\n !errorComponent\n );\n };\n if (suspensible && instance.suspense || isInSSRComponentSetup) {\n return load().then((comp) => {\n return () => createInnerComp(comp, instance);\n }).catch((err) => {\n onError(err);\n return () => errorComponent ? createVNode(errorComponent, {\n error: err\n }) : null;\n });\n }\n const loaded = ref(false);\n const error = ref();\n const delayed = ref(!!delay);\n if (delay) {\n setTimeout(() => {\n delayed.value = false;\n }, delay);\n }\n if (timeout != null) {\n setTimeout(() => {\n if (!loaded.value && !error.value) {\n const err = new Error(\n `Async component timed out after ${timeout}ms.`\n );\n onError(err);\n error.value = err;\n }\n }, timeout);\n }\n load().then(() => {\n loaded.value = true;\n if (instance.parent && isKeepAlive(instance.parent.vnode)) {\n instance.parent.effect.dirty = true;\n queueJob(instance.parent.update);\n }\n }).catch((err) => {\n onError(err);\n error.value = err;\n });\n return () => {\n if (loaded.value && resolvedComp) {\n return createInnerComp(resolvedComp, instance);\n } else if (error.value && errorComponent) {\n return createVNode(errorComponent, {\n error: error.value\n });\n } else if (loadingComponent && !delayed.value) {\n return createVNode(loadingComponent);\n }\n };\n }\n });\n}\nfunction createInnerComp(comp, parent) {\n const { ref: ref2, props, children, ce } = parent.vnode;\n const vnode = createVNode(comp, props, children);\n vnode.ref = ref2;\n vnode.ce = ce;\n delete parent.vnode.ce;\n return vnode;\n}\n\nfunction renderSlot(slots, name, props = {}, fallback, noSlotted) {\n if (currentRenderingInstance.isCE || currentRenderingInstance.parent && isAsyncWrapper(currentRenderingInstance.parent) && currentRenderingInstance.parent.isCE) {\n if (name !== \"default\") props.name = name;\n return createVNode(\"slot\", props, fallback && fallback());\n }\n let slot = slots[name];\n if (!!(process.env.NODE_ENV !== \"production\") && slot && slot.length > 1) {\n warn$1(\n `SSR-optimized slot function detected in a non-SSR-optimized render function. You need to mark this component with $dynamic-slots in the parent template.`\n );\n slot = () => [];\n }\n if (slot && slot._c) {\n slot._d = false;\n }\n openBlock();\n const validSlotContent = slot && ensureValidVNode(slot(props));\n const rendered = createBlock(\n Fragment,\n {\n key: props.key || // slot content array of a dynamic conditional slot may have a branch\n // key attached in the `createSlots` helper, respect that\n validSlotContent && validSlotContent.key || `_${name}`\n },\n validSlotContent || (fallback ? fallback() : []),\n validSlotContent && slots._ === 1 ? 64 : -2\n );\n if (!noSlotted && rendered.scopeId) {\n rendered.slotScopeIds = [rendered.scopeId + \"-s\"];\n }\n if (slot && slot._c) {\n slot._d = true;\n }\n return rendered;\n}\nfunction ensureValidVNode(vnodes) {\n return vnodes.some((child) => {\n if (!isVNode(child)) return true;\n if (child.type === Comment) return false;\n if (child.type === Fragment && !ensureValidVNode(child.children))\n return false;\n return true;\n }) ? vnodes : null;\n}\n\nfunction toHandlers(obj, preserveCaseIfNecessary) {\n const ret = {};\n if (!!(process.env.NODE_ENV !== \"production\") && !isObject(obj)) {\n warn$1(`v-on with no argument expects an object value.`);\n return ret;\n }\n for (const key in obj) {\n ret[preserveCaseIfNecessary && /[A-Z]/.test(key) ? `on:${key}` : toHandlerKey(key)] = obj[key];\n }\n return ret;\n}\n\nfunction toObject(arr) {\n const res = {};\n for (let i = 0; i < arr.length; i++) {\n if (arr[i]) {\n extend(res, arr[i]);\n }\n }\n return res;\n}\nfunction legacyBindObjectProps(data, _tag, value, _asProp, isSync) {\n if (value && isObject(value)) {\n if (isArray(value)) {\n value = toObject(value);\n }\n for (const key in value) {\n if (isReservedProp(key)) {\n data[key] = value[key];\n } else if (key === \"class\") {\n data.class = normalizeClass([data.class, value.class]);\n } else if (key === \"style\") {\n data.style = normalizeClass([data.style, value.style]);\n } else {\n const attrs = data.attrs || (data.attrs = {});\n const camelizedKey = camelize(key);\n const hyphenatedKey = hyphenate(key);\n if (!(camelizedKey in attrs) && !(hyphenatedKey in attrs)) {\n attrs[key] = value[key];\n if (isSync) {\n const on = data.on || (data.on = {});\n on[`update:${key}`] = function($event) {\n value[key] = $event;\n };\n }\n }\n }\n }\n }\n return data;\n}\nfunction legacyBindObjectListeners(props, listeners) {\n return mergeProps(props, toHandlers(listeners));\n}\nfunction legacyRenderSlot(instance, name, fallback, props, bindObject) {\n if (bindObject) {\n props = mergeProps(props, bindObject);\n }\n return renderSlot(instance.slots, name, props, fallback && (() => fallback));\n}\nfunction legacyresolveScopedSlots(fns, raw, hasDynamicKeys) {\n return createSlots(\n raw || { $stable: !hasDynamicKeys },\n mapKeyToName(fns)\n );\n}\nfunction mapKeyToName(slots) {\n for (let i = 0; i < slots.length; i++) {\n const fn = slots[i];\n if (fn) {\n if (isArray(fn)) {\n mapKeyToName(fn);\n } else {\n fn.name = fn.key || \"default\";\n }\n }\n }\n return slots;\n}\nconst staticCacheMap = /* @__PURE__ */ new WeakMap();\nfunction legacyRenderStatic(instance, index) {\n let cache = staticCacheMap.get(instance);\n if (!cache) {\n staticCacheMap.set(instance, cache = []);\n }\n if (cache[index]) {\n return cache[index];\n }\n const fn = instance.type.staticRenderFns[index];\n const ctx = instance.proxy;\n return cache[index] = fn.call(ctx, null, ctx);\n}\nfunction legacyCheckKeyCodes(instance, eventKeyCode, key, builtInKeyCode, eventKeyName, builtInKeyName) {\n const config = instance.appContext.config;\n const configKeyCodes = config.keyCodes || {};\n const mappedKeyCode = configKeyCodes[key] || builtInKeyCode;\n if (builtInKeyName && eventKeyName && !configKeyCodes[key]) {\n return isKeyNotMatch(builtInKeyName, eventKeyName);\n } else if (mappedKeyCode) {\n return isKeyNotMatch(mappedKeyCode, eventKeyCode);\n } else if (eventKeyName) {\n return hyphenate(eventKeyName) !== key;\n }\n}\nfunction isKeyNotMatch(expect, actual) {\n if (isArray(expect)) {\n return !expect.includes(actual);\n } else {\n return expect !== actual;\n }\n}\nfunction legacyMarkOnce(tree) {\n return tree;\n}\nfunction legacyBindDynamicKeys(props, values) {\n for (let i = 0; i < values.length; i += 2) {\n const key = values[i];\n if (typeof key === \"string\" && key) {\n props[values[i]] = values[i + 1];\n }\n }\n return props;\n}\nfunction legacyPrependModifier(value, symbol) {\n return typeof value === \"string\" ? symbol + value : value;\n}\n\nfunction installCompatInstanceProperties(map) {\n const set = (target, key, val) => {\n target[key] = val;\n return target[key];\n };\n const del = (target, key) => {\n delete target[key];\n };\n extend(map, {\n $set: (i) => {\n assertCompatEnabled(\"INSTANCE_SET\", i);\n return set;\n },\n $delete: (i) => {\n assertCompatEnabled(\"INSTANCE_DELETE\", i);\n return del;\n },\n $mount: (i) => {\n assertCompatEnabled(\n \"GLOBAL_MOUNT\",\n null\n );\n return i.ctx._compat_mount || NOOP;\n },\n $destroy: (i) => {\n assertCompatEnabled(\"INSTANCE_DESTROY\", i);\n return i.ctx._compat_destroy || NOOP;\n },\n // overrides existing accessor\n $slots: (i) => {\n if (isCompatEnabled$1(\"RENDER_FUNCTION\", i) && i.render && i.render._compatWrapped) {\n return new Proxy(i.slots, legacySlotProxyHandlers);\n }\n return !!(process.env.NODE_ENV !== \"production\") ? shallowReadonly(i.slots) : i.slots;\n },\n $scopedSlots: (i) => {\n assertCompatEnabled(\"INSTANCE_SCOPED_SLOTS\", i);\n return !!(process.env.NODE_ENV !== \"production\") ? shallowReadonly(i.slots) : i.slots;\n },\n $on: (i) => on.bind(null, i),\n $once: (i) => once.bind(null, i),\n $off: (i) => off.bind(null, i),\n $children: getCompatChildren,\n $listeners: getCompatListeners,\n // inject additional properties into $options for compat\n // e.g. vuex needs this.$options.parent\n $options: (i) => {\n if (!isCompatEnabled$1(\"PRIVATE_APIS\", i)) {\n return resolveMergedOptions(i);\n }\n if (i.resolvedOptions) {\n return i.resolvedOptions;\n }\n const res = i.resolvedOptions = extend({}, resolveMergedOptions(i));\n Object.defineProperties(res, {\n parent: {\n get() {\n warnDeprecation$1(\"PRIVATE_APIS\", i, \"$options.parent\");\n return i.proxy.$parent;\n }\n },\n propsData: {\n get() {\n warnDeprecation$1(\n \"PRIVATE_APIS\",\n i,\n \"$options.propsData\"\n );\n return i.vnode.props;\n }\n }\n });\n return res;\n }\n });\n const privateAPIs = {\n // needed by many libs / render fns\n $vnode: (i) => i.vnode,\n // some private properties that are likely accessed...\n _self: (i) => i.proxy,\n _uid: (i) => i.uid,\n _data: (i) => i.data,\n _isMounted: (i) => i.isMounted,\n _isDestroyed: (i) => i.isUnmounted,\n // v2 render helpers\n $createElement: () => compatH,\n _c: () => compatH,\n _o: () => legacyMarkOnce,\n _n: () => looseToNumber,\n _s: () => toDisplayString,\n _l: () => renderList,\n _t: (i) => legacyRenderSlot.bind(null, i),\n _q: () => looseEqual,\n _i: () => looseIndexOf,\n _m: (i) => legacyRenderStatic.bind(null, i),\n _f: () => resolveFilter$1,\n _k: (i) => legacyCheckKeyCodes.bind(null, i),\n _b: () => legacyBindObjectProps,\n _v: () => createTextVNode,\n _e: () => createCommentVNode,\n _u: () => legacyresolveScopedSlots,\n _g: () => legacyBindObjectListeners,\n _d: () => legacyBindDynamicKeys,\n _p: () => legacyPrependModifier\n };\n for (const key in privateAPIs) {\n map[key] = (i) => {\n if (isCompatEnabled$1(\"PRIVATE_APIS\", i)) {\n return privateAPIs[key](i);\n }\n };\n }\n}\n\nconst getPublicInstance = (i) => {\n if (!i) return null;\n if (isStatefulComponent(i)) return getComponentPublicInstance(i);\n return getPublicInstance(i.parent);\n};\nconst publicPropertiesMap = (\n // Move PURE marker to new line to workaround compiler discarding it\n // due to type annotation\n /* @__PURE__ */ extend(/* @__PURE__ */ Object.create(null), {\n $: (i) => i,\n $el: (i) => i.vnode.el,\n $data: (i) => i.data,\n $props: (i) => !!(process.env.NODE_ENV !== \"production\") ? shallowReadonly(i.props) : i.props,\n $attrs: (i) => !!(process.env.NODE_ENV !== \"production\") ? shallowReadonly(i.attrs) : i.attrs,\n $slots: (i) => !!(process.env.NODE_ENV !== \"production\") ? shallowReadonly(i.slots) : i.slots,\n $refs: (i) => !!(process.env.NODE_ENV !== \"production\") ? shallowReadonly(i.refs) : i.refs,\n $parent: (i) => getPublicInstance(i.parent),\n $root: (i) => getPublicInstance(i.root),\n $emit: (i) => i.emit,\n $options: (i) => __VUE_OPTIONS_API__ ? resolveMergedOptions(i) : i.type,\n $forceUpdate: (i) => i.f || (i.f = () => {\n i.effect.dirty = true;\n queueJob(i.update);\n }),\n $nextTick: (i) => i.n || (i.n = nextTick.bind(i.proxy)),\n $watch: (i) => __VUE_OPTIONS_API__ ? instanceWatch.bind(i) : NOOP\n })\n);\n{\n installCompatInstanceProperties(publicPropertiesMap);\n}\nconst isReservedPrefix = (key) => key === \"_\" || key === \"$\";\nconst hasSetupBinding = (state, key) => state !== EMPTY_OBJ && !state.__isScriptSetup && hasOwn(state, key);\nconst PublicInstanceProxyHandlers = {\n get({ _: instance }, key) {\n if (key === \"__v_skip\") {\n return true;\n }\n const { ctx, setupState, data, props, accessCache, type, appContext } = instance;\n if (!!(process.env.NODE_ENV !== \"production\") && key === \"__isVue\") {\n return true;\n }\n let normalizedProps;\n if (key[0] !== \"$\") {\n const n = accessCache[key];\n if (n !== void 0) {\n switch (n) {\n case 1 /* SETUP */:\n return setupState[key];\n case 2 /* DATA */:\n return data[key];\n case 4 /* CONTEXT */:\n return ctx[key];\n case 3 /* PROPS */:\n return props[key];\n }\n } else if (hasSetupBinding(setupState, key)) {\n accessCache[key] = 1 /* SETUP */;\n return setupState[key];\n } else if (data !== EMPTY_OBJ && hasOwn(data, key)) {\n accessCache[key] = 2 /* DATA */;\n return data[key];\n } else if (\n // only cache other properties when instance has declared (thus stable)\n // props\n (normalizedProps = instance.propsOptions[0]) && hasOwn(normalizedProps, key)\n ) {\n accessCache[key] = 3 /* PROPS */;\n return props[key];\n } else if (ctx !== EMPTY_OBJ && hasOwn(ctx, key)) {\n accessCache[key] = 4 /* CONTEXT */;\n return ctx[key];\n } else if (!__VUE_OPTIONS_API__ || shouldCacheAccess) {\n accessCache[key] = 0 /* OTHER */;\n }\n }\n const publicGetter = publicPropertiesMap[key];\n let cssModule, globalProperties;\n if (publicGetter) {\n if (key === \"$attrs\") {\n track(instance.attrs, \"get\", \"\");\n !!(process.env.NODE_ENV !== \"production\") && markAttrsAccessed();\n } else if (!!(process.env.NODE_ENV !== \"production\") && key === \"$slots\") {\n track(instance, \"get\", key);\n }\n return publicGetter(instance);\n } else if (\n // css module (injected by vue-loader)\n (cssModule = type.__cssModules) && (cssModule = cssModule[key])\n ) {\n return cssModule;\n } else if (ctx !== EMPTY_OBJ && hasOwn(ctx, key)) {\n accessCache[key] = 4 /* CONTEXT */;\n return ctx[key];\n } else if (\n // global properties\n globalProperties = appContext.config.globalProperties, hasOwn(globalProperties, key)\n ) {\n {\n const desc = Object.getOwnPropertyDescriptor(globalProperties, key);\n if (desc.get) {\n return desc.get.call(instance.proxy);\n } else {\n const val = globalProperties[key];\n return isFunction(val) ? extend(val.bind(instance.proxy), val) : val;\n }\n }\n } else if (!!(process.env.NODE_ENV !== \"production\") && currentRenderingInstance && (!isString(key) || // #1091 avoid internal isRef/isVNode checks on component instance leading\n // to infinite warning loop\n key.indexOf(\"__v\") !== 0)) {\n if (data !== EMPTY_OBJ && isReservedPrefix(key[0]) && hasOwn(data, key)) {\n warn$1(\n `Property ${JSON.stringify(\n key\n )} must be accessed via $data because it starts with a reserved character (\"$\" or \"_\") and is not proxied on the render context.`\n );\n } else if (instance === currentRenderingInstance) {\n warn$1(\n `Property ${JSON.stringify(key)} was accessed during render but is not defined on instance.`\n );\n }\n }\n },\n set({ _: instance }, key, value) {\n const { data, setupState, ctx } = instance;\n if (hasSetupBinding(setupState, key)) {\n setupState[key] = value;\n return true;\n } else if (!!(process.env.NODE_ENV !== \"production\") && setupState.__isScriptSetup && hasOwn(setupState, key)) {\n warn$1(`Cannot mutate \r\n\r\n\r\n","\r\n\r\n\r\n\r\n\r\n","\r\n\r\n\r\n","\r\n\r\n\r\n","\r\n\r\n\r\n","\r\n\r\n\r\n","\r\n\r\n\r\n\r\n","\r\n\r\n\r\n\r\n","\r\n\r\n\r\n","\r\n\r\n\r\n","\r\n\r\n\r\n","\r\n\r\n\r\n","\r\n\r\n\r\n","\r\n\r\n\r\n","\r\n\r\n\r\n","\r\n\r\n\r\n","\r\n\r\n\r\n","\r\n\r\n\r\n","\r\n\r\n\r\n","\r\n\r\n\r\n","import { store } from \"@/store/store\"\r\n\r\nexport default class PageWhitelistUtils {\r\n isMenuOnWhiteList(name: string): boolean {\r\n const whitelist = store.getters.pageWhitelist as Map | null\r\n if (whitelist != null) {\r\n const length = whitelist.get(name)?.trim().length\r\n if (length !== undefined && length > 0) {\r\n // Menu löytyi whitelistalta. Menu voidaan näyttää.\r\n return true\r\n }\r\n }\r\n return false\r\n }\r\n\r\n isSubjectOnWhiteList(name: string): boolean {\r\n if (name !== \"\") {\r\n const whitelist = store.getters.pageWhitelist as Map | null\r\n if (whitelist != null) {\r\n for (const entry of whitelist) {\r\n const values = entry[1].split(\",\")\r\n for (const subject of values) {\r\n if (subject.trim() === name) {\r\n // Aihe löytyi whitelistalta. Sivu voidaan näyttää.\r\n return true\r\n }\r\n }\r\n }\r\n }\r\n }\r\n return false\r\n }\r\n\r\n isUrlParamInfokartta(subTopic: string | null): boolean {\r\n const infokartat: any = store.getters.infokarttaRadioValues\r\n if (subTopic) {\r\n for (const element of infokartat) {\r\n if (element.tunniste === subTopic) {\r\n return true\r\n }\r\n }\r\n }\r\n return false\r\n }\r\n}\r\n","/*!\n * vue-router v4.4.0\n * (c) 2024 Eduardo San Martin Morote\n * @license MIT\n */\nimport { getCurrentInstance, inject, onUnmounted, onDeactivated, onActivated, computed, unref, watchEffect, defineComponent, reactive, h, provide, ref, watch, shallowRef, shallowReactive, nextTick } from 'vue';\nimport { setupDevtoolsPlugin } from '@vue/devtools-api';\n\nconst isBrowser = typeof document !== 'undefined';\n\nfunction isESModule(obj) {\n return obj.__esModule || obj[Symbol.toStringTag] === 'Module';\n}\nconst assign = Object.assign;\nfunction applyToParams(fn, params) {\n const newParams = {};\n for (const key in params) {\n const value = params[key];\n newParams[key] = isArray(value)\n ? value.map(fn)\n : fn(value);\n }\n return newParams;\n}\nconst noop = () => { };\n/**\n * Typesafe alternative to Array.isArray\n * https://github.com/microsoft/TypeScript/pull/48228\n */\nconst isArray = Array.isArray;\n\nfunction warn(msg) {\n // avoid using ...args as it breaks in older Edge builds\n const args = Array.from(arguments).slice(1);\n console.warn.apply(console, ['[Vue Router warn]: ' + msg].concat(args));\n}\n\n/**\n * Encoding Rules (␣ = Space)\n * - Path: ␣ \" < > # ? { }\n * - Query: ␣ \" < > # & =\n * - Hash: ␣ \" < > `\n *\n * On top of that, the RFC3986 (https://tools.ietf.org/html/rfc3986#section-2.2)\n * defines some extra characters to be encoded. Most browsers do not encode them\n * in encodeURI https://github.com/whatwg/url/issues/369, so it may be safer to\n * also encode `!'()*`. Leaving un-encoded only ASCII alphanumeric(`a-zA-Z0-9`)\n * plus `-._~`. This extra safety should be applied to query by patching the\n * string returned by encodeURIComponent encodeURI also encodes `[\\]^`. `\\`\n * should be encoded to avoid ambiguity. Browsers (IE, FF, C) transform a `\\`\n * into a `/` if directly typed in. The _backtick_ (`````) should also be\n * encoded everywhere because some browsers like FF encode it when directly\n * written while others don't. Safari and IE don't encode ``\"<>{}``` in hash.\n */\n// const EXTRA_RESERVED_RE = /[!'()*]/g\n// const encodeReservedReplacer = (c: string) => '%' + c.charCodeAt(0).toString(16)\nconst HASH_RE = /#/g; // %23\nconst AMPERSAND_RE = /&/g; // %26\nconst SLASH_RE = /\\//g; // %2F\nconst EQUAL_RE = /=/g; // %3D\nconst IM_RE = /\\?/g; // %3F\nconst PLUS_RE = /\\+/g; // %2B\n/**\n * NOTE: It's not clear to me if we should encode the + symbol in queries, it\n * seems to be less flexible than not doing so and I can't find out the legacy\n * systems requiring this for regular requests like text/html. In the standard,\n * the encoding of the plus character is only mentioned for\n * application/x-www-form-urlencoded\n * (https://url.spec.whatwg.org/#urlencoded-parsing) and most browsers seems lo\n * leave the plus character as is in queries. To be more flexible, we allow the\n * plus character on the query, but it can also be manually encoded by the user.\n *\n * Resources:\n * - https://url.spec.whatwg.org/#urlencoded-parsing\n * - https://stackoverflow.com/questions/1634271/url-encoding-the-space-character-or-20\n */\nconst ENC_BRACKET_OPEN_RE = /%5B/g; // [\nconst ENC_BRACKET_CLOSE_RE = /%5D/g; // ]\nconst ENC_CARET_RE = /%5E/g; // ^\nconst ENC_BACKTICK_RE = /%60/g; // `\nconst ENC_CURLY_OPEN_RE = /%7B/g; // {\nconst ENC_PIPE_RE = /%7C/g; // |\nconst ENC_CURLY_CLOSE_RE = /%7D/g; // }\nconst ENC_SPACE_RE = /%20/g; // }\n/**\n * Encode characters that need to be encoded on the path, search and hash\n * sections of the URL.\n *\n * @internal\n * @param text - string to encode\n * @returns encoded string\n */\nfunction commonEncode(text) {\n return encodeURI('' + text)\n .replace(ENC_PIPE_RE, '|')\n .replace(ENC_BRACKET_OPEN_RE, '[')\n .replace(ENC_BRACKET_CLOSE_RE, ']');\n}\n/**\n * Encode characters that need to be encoded on the hash section of the URL.\n *\n * @param text - string to encode\n * @returns encoded string\n */\nfunction encodeHash(text) {\n return commonEncode(text)\n .replace(ENC_CURLY_OPEN_RE, '{')\n .replace(ENC_CURLY_CLOSE_RE, '}')\n .replace(ENC_CARET_RE, '^');\n}\n/**\n * Encode characters that need to be encoded query values on the query\n * section of the URL.\n *\n * @param text - string to encode\n * @returns encoded string\n */\nfunction encodeQueryValue(text) {\n return (commonEncode(text)\n // Encode the space as +, encode the + to differentiate it from the space\n .replace(PLUS_RE, '%2B')\n .replace(ENC_SPACE_RE, '+')\n .replace(HASH_RE, '%23')\n .replace(AMPERSAND_RE, '%26')\n .replace(ENC_BACKTICK_RE, '`')\n .replace(ENC_CURLY_OPEN_RE, '{')\n .replace(ENC_CURLY_CLOSE_RE, '}')\n .replace(ENC_CARET_RE, '^'));\n}\n/**\n * Like `encodeQueryValue` but also encodes the `=` character.\n *\n * @param text - string to encode\n */\nfunction encodeQueryKey(text) {\n return encodeQueryValue(text).replace(EQUAL_RE, '%3D');\n}\n/**\n * Encode characters that need to be encoded on the path section of the URL.\n *\n * @param text - string to encode\n * @returns encoded string\n */\nfunction encodePath(text) {\n return commonEncode(text).replace(HASH_RE, '%23').replace(IM_RE, '%3F');\n}\n/**\n * Encode characters that need to be encoded on the path section of the URL as a\n * param. This function encodes everything {@link encodePath} does plus the\n * slash (`/`) character. If `text` is `null` or `undefined`, returns an empty\n * string instead.\n *\n * @param text - string to encode\n * @returns encoded string\n */\nfunction encodeParam(text) {\n return text == null ? '' : encodePath(text).replace(SLASH_RE, '%2F');\n}\n/**\n * Decode text using `decodeURIComponent`. Returns the original text if it\n * fails.\n *\n * @param text - string to decode\n * @returns decoded string\n */\nfunction decode(text) {\n try {\n return decodeURIComponent('' + text);\n }\n catch (err) {\n (process.env.NODE_ENV !== 'production') && warn(`Error decoding \"${text}\". Using original value`);\n }\n return '' + text;\n}\n\nconst TRAILING_SLASH_RE = /\\/$/;\nconst removeTrailingSlash = (path) => path.replace(TRAILING_SLASH_RE, '');\n/**\n * Transforms a URI into a normalized history location\n *\n * @param parseQuery\n * @param location - URI to normalize\n * @param currentLocation - current absolute location. Allows resolving relative\n * paths. Must start with `/`. Defaults to `/`\n * @returns a normalized history location\n */\nfunction parseURL(parseQuery, location, currentLocation = '/') {\n let path, query = {}, searchString = '', hash = '';\n // Could use URL and URLSearchParams but IE 11 doesn't support it\n // TODO: move to new URL()\n const hashPos = location.indexOf('#');\n let searchPos = location.indexOf('?');\n // the hash appears before the search, so it's not part of the search string\n if (hashPos < searchPos && hashPos >= 0) {\n searchPos = -1;\n }\n if (searchPos > -1) {\n path = location.slice(0, searchPos);\n searchString = location.slice(searchPos + 1, hashPos > -1 ? hashPos : location.length);\n query = parseQuery(searchString);\n }\n if (hashPos > -1) {\n path = path || location.slice(0, hashPos);\n // keep the # character\n hash = location.slice(hashPos, location.length);\n }\n // no search and no query\n path = resolveRelativePath(path != null ? path : location, currentLocation);\n // empty path means a relative query or hash `?foo=f`, `#thing`\n return {\n fullPath: path + (searchString && '?') + searchString + hash,\n path,\n query,\n hash: decode(hash),\n };\n}\n/**\n * Stringifies a URL object\n *\n * @param stringifyQuery\n * @param location\n */\nfunction stringifyURL(stringifyQuery, location) {\n const query = location.query ? stringifyQuery(location.query) : '';\n return location.path + (query && '?') + query + (location.hash || '');\n}\n/**\n * Strips off the base from the beginning of a location.pathname in a non-case-sensitive way.\n *\n * @param pathname - location.pathname\n * @param base - base to strip off\n */\nfunction stripBase(pathname, base) {\n // no base or base is not found at the beginning\n if (!base || !pathname.toLowerCase().startsWith(base.toLowerCase()))\n return pathname;\n return pathname.slice(base.length) || '/';\n}\n/**\n * Checks if two RouteLocation are equal. This means that both locations are\n * pointing towards the same {@link RouteRecord} and that all `params`, `query`\n * parameters and `hash` are the same\n *\n * @param stringifyQuery - A function that takes a query object of type LocationQueryRaw and returns a string representation of it.\n * @param a - first {@link RouteLocation}\n * @param b - second {@link RouteLocation}\n */\nfunction isSameRouteLocation(stringifyQuery, a, b) {\n const aLastIndex = a.matched.length - 1;\n const bLastIndex = b.matched.length - 1;\n return (aLastIndex > -1 &&\n aLastIndex === bLastIndex &&\n isSameRouteRecord(a.matched[aLastIndex], b.matched[bLastIndex]) &&\n isSameRouteLocationParams(a.params, b.params) &&\n stringifyQuery(a.query) === stringifyQuery(b.query) &&\n a.hash === b.hash);\n}\n/**\n * Check if two `RouteRecords` are equal. Takes into account aliases: they are\n * considered equal to the `RouteRecord` they are aliasing.\n *\n * @param a - first {@link RouteRecord}\n * @param b - second {@link RouteRecord}\n */\nfunction isSameRouteRecord(a, b) {\n // since the original record has an undefined value for aliasOf\n // but all aliases point to the original record, this will always compare\n // the original record\n return (a.aliasOf || a) === (b.aliasOf || b);\n}\nfunction isSameRouteLocationParams(a, b) {\n if (Object.keys(a).length !== Object.keys(b).length)\n return false;\n for (const key in a) {\n if (!isSameRouteLocationParamsValue(a[key], b[key]))\n return false;\n }\n return true;\n}\nfunction isSameRouteLocationParamsValue(a, b) {\n return isArray(a)\n ? isEquivalentArray(a, b)\n : isArray(b)\n ? isEquivalentArray(b, a)\n : a === b;\n}\n/**\n * Check if two arrays are the same or if an array with one single entry is the\n * same as another primitive value. Used to check query and parameters\n *\n * @param a - array of values\n * @param b - array of values or a single value\n */\nfunction isEquivalentArray(a, b) {\n return isArray(b)\n ? a.length === b.length && a.every((value, i) => value === b[i])\n : a.length === 1 && a[0] === b;\n}\n/**\n * Resolves a relative path that starts with `.`.\n *\n * @param to - path location we are resolving\n * @param from - currentLocation.path, should start with `/`\n */\nfunction resolveRelativePath(to, from) {\n if (to.startsWith('/'))\n return to;\n if ((process.env.NODE_ENV !== 'production') && !from.startsWith('/')) {\n warn(`Cannot resolve a relative location without an absolute path. Trying to resolve \"${to}\" from \"${from}\". It should look like \"/${from}\".`);\n return to;\n }\n if (!to)\n return from;\n const fromSegments = from.split('/');\n const toSegments = to.split('/');\n const lastToSegment = toSegments[toSegments.length - 1];\n // make . and ./ the same (../ === .., ../../ === ../..)\n // this is the same behavior as new URL()\n if (lastToSegment === '..' || lastToSegment === '.') {\n toSegments.push('');\n }\n let position = fromSegments.length - 1;\n let toPosition;\n let segment;\n for (toPosition = 0; toPosition < toSegments.length; toPosition++) {\n segment = toSegments[toPosition];\n // we stay on the same position\n if (segment === '.')\n continue;\n // go up in the from array\n if (segment === '..') {\n // we can't go below zero, but we still need to increment toPosition\n if (position > 1)\n position--;\n // continue\n }\n // we reached a non-relative path, we stop here\n else\n break;\n }\n return (fromSegments.slice(0, position).join('/') +\n '/' +\n toSegments.slice(toPosition).join('/'));\n}\n/**\n * Initial route location where the router is. Can be used in navigation guards\n * to differentiate the initial navigation.\n *\n * @example\n * ```js\n * import { START_LOCATION } from 'vue-router'\n *\n * router.beforeEach((to, from) => {\n * if (from === START_LOCATION) {\n * // initial navigation\n * }\n * })\n * ```\n */\nconst START_LOCATION_NORMALIZED = {\n path: '/',\n // TODO: could we use a symbol in the future?\n name: undefined,\n params: {},\n query: {},\n hash: '',\n fullPath: '/',\n matched: [],\n meta: {},\n redirectedFrom: undefined,\n};\n\nvar NavigationType;\n(function (NavigationType) {\n NavigationType[\"pop\"] = \"pop\";\n NavigationType[\"push\"] = \"push\";\n})(NavigationType || (NavigationType = {}));\nvar NavigationDirection;\n(function (NavigationDirection) {\n NavigationDirection[\"back\"] = \"back\";\n NavigationDirection[\"forward\"] = \"forward\";\n NavigationDirection[\"unknown\"] = \"\";\n})(NavigationDirection || (NavigationDirection = {}));\n/**\n * Starting location for Histories\n */\nconst START = '';\n// Generic utils\n/**\n * Normalizes a base by removing any trailing slash and reading the base tag if\n * present.\n *\n * @param base - base to normalize\n */\nfunction normalizeBase(base) {\n if (!base) {\n if (isBrowser) {\n // respect tag\n const baseEl = document.querySelector('base');\n base = (baseEl && baseEl.getAttribute('href')) || '/';\n // strip full URL origin\n base = base.replace(/^\\w+:\\/\\/[^\\/]+/, '');\n }\n else {\n base = '/';\n }\n }\n // ensure leading slash when it was removed by the regex above avoid leading\n // slash with hash because the file could be read from the disk like file://\n // and the leading slash would cause problems\n if (base[0] !== '/' && base[0] !== '#')\n base = '/' + base;\n // remove the trailing slash so all other method can just do `base + fullPath`\n // to build an href\n return removeTrailingSlash(base);\n}\n// remove any character before the hash\nconst BEFORE_HASH_RE = /^[^#]+#/;\nfunction createHref(base, location) {\n return base.replace(BEFORE_HASH_RE, '#') + location;\n}\n\nfunction getElementPosition(el, offset) {\n const docRect = document.documentElement.getBoundingClientRect();\n const elRect = el.getBoundingClientRect();\n return {\n behavior: offset.behavior,\n left: elRect.left - docRect.left - (offset.left || 0),\n top: elRect.top - docRect.top - (offset.top || 0),\n };\n}\nconst computeScrollPosition = () => ({\n left: window.scrollX,\n top: window.scrollY,\n});\nfunction scrollToPosition(position) {\n let scrollToOptions;\n if ('el' in position) {\n const positionEl = position.el;\n const isIdSelector = typeof positionEl === 'string' && positionEl.startsWith('#');\n /**\n * `id`s can accept pretty much any characters, including CSS combinators\n * like `>` or `~`. It's still possible to retrieve elements using\n * `document.getElementById('~')` but it needs to be escaped when using\n * `document.querySelector('#\\\\~')` for it to be valid. The only\n * requirements for `id`s are them to be unique on the page and to not be\n * empty (`id=\"\"`). Because of that, when passing an id selector, it should\n * be properly escaped for it to work with `querySelector`. We could check\n * for the id selector to be simple (no CSS combinators `+ >~`) but that\n * would make things inconsistent since they are valid characters for an\n * `id` but would need to be escaped when using `querySelector`, breaking\n * their usage and ending up in no selector returned. Selectors need to be\n * escaped:\n *\n * - `#1-thing` becomes `#\\31 -thing`\n * - `#with~symbols` becomes `#with\\\\~symbols`\n *\n * - More information about the topic can be found at\n * https://mathiasbynens.be/notes/html5-id-class.\n * - Practical example: https://mathiasbynens.be/demo/html5-id\n */\n if ((process.env.NODE_ENV !== 'production') && typeof position.el === 'string') {\n if (!isIdSelector || !document.getElementById(position.el.slice(1))) {\n try {\n const foundEl = document.querySelector(position.el);\n if (isIdSelector && foundEl) {\n warn(`The selector \"${position.el}\" should be passed as \"el: document.querySelector('${position.el}')\" because it starts with \"#\".`);\n // return to avoid other warnings\n return;\n }\n }\n catch (err) {\n warn(`The selector \"${position.el}\" is invalid. If you are using an id selector, make sure to escape it. You can find more information about escaping characters in selectors at https://mathiasbynens.be/notes/css-escapes or use CSS.escape (https://developer.mozilla.org/en-US/docs/Web/API/CSS/escape).`);\n // return to avoid other warnings\n return;\n }\n }\n }\n const el = typeof positionEl === 'string'\n ? isIdSelector\n ? document.getElementById(positionEl.slice(1))\n : document.querySelector(positionEl)\n : positionEl;\n if (!el) {\n (process.env.NODE_ENV !== 'production') &&\n warn(`Couldn't find element using selector \"${position.el}\" returned by scrollBehavior.`);\n return;\n }\n scrollToOptions = getElementPosition(el, position);\n }\n else {\n scrollToOptions = position;\n }\n if ('scrollBehavior' in document.documentElement.style)\n window.scrollTo(scrollToOptions);\n else {\n window.scrollTo(scrollToOptions.left != null ? scrollToOptions.left : window.scrollX, scrollToOptions.top != null ? scrollToOptions.top : window.scrollY);\n }\n}\nfunction getScrollKey(path, delta) {\n const position = history.state ? history.state.position - delta : -1;\n return position + path;\n}\nconst scrollPositions = new Map();\nfunction saveScrollPosition(key, scrollPosition) {\n scrollPositions.set(key, scrollPosition);\n}\nfunction getSavedScrollPosition(key) {\n const scroll = scrollPositions.get(key);\n // consume it so it's not used again\n scrollPositions.delete(key);\n return scroll;\n}\n// TODO: RFC about how to save scroll position\n/**\n * ScrollBehavior instance used by the router to compute and restore the scroll\n * position when navigating.\n */\n// export interface ScrollHandler {\n// // returns a scroll position that can be saved in history\n// compute(): ScrollPositionEntry\n// // can take an extended ScrollPositionEntry\n// scroll(position: ScrollPosition): void\n// }\n// export const scrollHandler: ScrollHandler = {\n// compute: computeScroll,\n// scroll: scrollToPosition,\n// }\n\nlet createBaseLocation = () => location.protocol + '//' + location.host;\n/**\n * Creates a normalized history location from a window.location object\n * @param base - The base path\n * @param location - The window.location object\n */\nfunction createCurrentLocation(base, location) {\n const { pathname, search, hash } = location;\n // allows hash bases like #, /#, #/, #!, #!/, /#!/, or even /folder#end\n const hashPos = base.indexOf('#');\n if (hashPos > -1) {\n let slicePos = hash.includes(base.slice(hashPos))\n ? base.slice(hashPos).length\n : 1;\n let pathFromHash = hash.slice(slicePos);\n // prepend the starting slash to hash so the url starts with /#\n if (pathFromHash[0] !== '/')\n pathFromHash = '/' + pathFromHash;\n return stripBase(pathFromHash, '');\n }\n const path = stripBase(pathname, base);\n return path + search + hash;\n}\nfunction useHistoryListeners(base, historyState, currentLocation, replace) {\n let listeners = [];\n let teardowns = [];\n // TODO: should it be a stack? a Dict. Check if the popstate listener\n // can trigger twice\n let pauseState = null;\n const popStateHandler = ({ state, }) => {\n const to = createCurrentLocation(base, location);\n const from = currentLocation.value;\n const fromState = historyState.value;\n let delta = 0;\n if (state) {\n currentLocation.value = to;\n historyState.value = state;\n // ignore the popstate and reset the pauseState\n if (pauseState && pauseState === from) {\n pauseState = null;\n return;\n }\n delta = fromState ? state.position - fromState.position : 0;\n }\n else {\n replace(to);\n }\n // Here we could also revert the navigation by calling history.go(-delta)\n // this listener will have to be adapted to not trigger again and to wait for the url\n // to be updated before triggering the listeners. Some kind of validation function would also\n // need to be passed to the listeners so the navigation can be accepted\n // call all listeners\n listeners.forEach(listener => {\n listener(currentLocation.value, from, {\n delta,\n type: NavigationType.pop,\n direction: delta\n ? delta > 0\n ? NavigationDirection.forward\n : NavigationDirection.back\n : NavigationDirection.unknown,\n });\n });\n };\n function pauseListeners() {\n pauseState = currentLocation.value;\n }\n function listen(callback) {\n // set up the listener and prepare teardown callbacks\n listeners.push(callback);\n const teardown = () => {\n const index = listeners.indexOf(callback);\n if (index > -1)\n listeners.splice(index, 1);\n };\n teardowns.push(teardown);\n return teardown;\n }\n function beforeUnloadListener() {\n const { history } = window;\n if (!history.state)\n return;\n history.replaceState(assign({}, history.state, { scroll: computeScrollPosition() }), '');\n }\n function destroy() {\n for (const teardown of teardowns)\n teardown();\n teardowns = [];\n window.removeEventListener('popstate', popStateHandler);\n window.removeEventListener('beforeunload', beforeUnloadListener);\n }\n // set up the listeners and prepare teardown callbacks\n window.addEventListener('popstate', popStateHandler);\n // TODO: could we use 'pagehide' or 'visibilitychange' instead?\n // https://developer.chrome.com/blog/page-lifecycle-api/\n window.addEventListener('beforeunload', beforeUnloadListener, {\n passive: true,\n });\n return {\n pauseListeners,\n listen,\n destroy,\n };\n}\n/**\n * Creates a state object\n */\nfunction buildState(back, current, forward, replaced = false, computeScroll = false) {\n return {\n back,\n current,\n forward,\n replaced,\n position: window.history.length,\n scroll: computeScroll ? computeScrollPosition() : null,\n };\n}\nfunction useHistoryStateNavigation(base) {\n const { history, location } = window;\n // private variables\n const currentLocation = {\n value: createCurrentLocation(base, location),\n };\n const historyState = { value: history.state };\n // build current history entry as this is a fresh navigation\n if (!historyState.value) {\n changeLocation(currentLocation.value, {\n back: null,\n current: currentLocation.value,\n forward: null,\n // the length is off by one, we need to decrease it\n position: history.length - 1,\n replaced: true,\n // don't add a scroll as the user may have an anchor, and we want\n // scrollBehavior to be triggered without a saved position\n scroll: null,\n }, true);\n }\n function changeLocation(to, state, replace) {\n /**\n * if a base tag is provided, and we are on a normal domain, we have to\n * respect the provided `base` attribute because pushState() will use it and\n * potentially erase anything before the `#` like at\n * https://github.com/vuejs/router/issues/685 where a base of\n * `/folder/#` but a base of `/` would erase the `/folder/` section. If\n * there is no host, the `` tag makes no sense and if there isn't a\n * base tag we can just use everything after the `#`.\n */\n const hashIndex = base.indexOf('#');\n const url = hashIndex > -1\n ? (location.host && document.querySelector('base')\n ? base\n : base.slice(hashIndex)) + to\n : createBaseLocation() + base + to;\n try {\n // BROWSER QUIRK\n // NOTE: Safari throws a SecurityError when calling this function 100 times in 30 seconds\n history[replace ? 'replaceState' : 'pushState'](state, '', url);\n historyState.value = state;\n }\n catch (err) {\n if ((process.env.NODE_ENV !== 'production')) {\n warn('Error with push/replace State', err);\n }\n else {\n console.error(err);\n }\n // Force the navigation, this also resets the call count\n location[replace ? 'replace' : 'assign'](url);\n }\n }\n function replace(to, data) {\n const state = assign({}, history.state, buildState(historyState.value.back, \n // keep back and forward entries but override current position\n to, historyState.value.forward, true), data, { position: historyState.value.position });\n changeLocation(to, state, true);\n currentLocation.value = to;\n }\n function push(to, data) {\n // Add to current entry the information of where we are going\n // as well as saving the current position\n const currentState = assign({}, \n // use current history state to gracefully handle a wrong call to\n // history.replaceState\n // https://github.com/vuejs/router/issues/366\n historyState.value, history.state, {\n forward: to,\n scroll: computeScrollPosition(),\n });\n if ((process.env.NODE_ENV !== 'production') && !history.state) {\n warn(`history.state seems to have been manually replaced without preserving the necessary values. Make sure to preserve existing history state if you are manually calling history.replaceState:\\n\\n` +\n `history.replaceState(history.state, '', url)\\n\\n` +\n `You can find more information at https://next.router.vuejs.org/guide/migration/#usage-of-history-state.`);\n }\n changeLocation(currentState.current, currentState, true);\n const state = assign({}, buildState(currentLocation.value, to, null), { position: currentState.position + 1 }, data);\n changeLocation(to, state, false);\n currentLocation.value = to;\n }\n return {\n location: currentLocation,\n state: historyState,\n push,\n replace,\n };\n}\n/**\n * Creates an HTML5 history. Most common history for single page applications.\n *\n * @param base -\n */\nfunction createWebHistory(base) {\n base = normalizeBase(base);\n const historyNavigation = useHistoryStateNavigation(base);\n const historyListeners = useHistoryListeners(base, historyNavigation.state, historyNavigation.location, historyNavigation.replace);\n function go(delta, triggerListeners = true) {\n if (!triggerListeners)\n historyListeners.pauseListeners();\n history.go(delta);\n }\n const routerHistory = assign({\n // it's overridden right after\n location: '',\n base,\n go,\n createHref: createHref.bind(null, base),\n }, historyNavigation, historyListeners);\n Object.defineProperty(routerHistory, 'location', {\n enumerable: true,\n get: () => historyNavigation.location.value,\n });\n Object.defineProperty(routerHistory, 'state', {\n enumerable: true,\n get: () => historyNavigation.state.value,\n });\n return routerHistory;\n}\n\n/**\n * Creates an in-memory based history. The main purpose of this history is to handle SSR. It starts in a special location that is nowhere.\n * It's up to the user to replace that location with the starter location by either calling `router.push` or `router.replace`.\n *\n * @param base - Base applied to all urls, defaults to '/'\n * @returns a history object that can be passed to the router constructor\n */\nfunction createMemoryHistory(base = '') {\n let listeners = [];\n let queue = [START];\n let position = 0;\n base = normalizeBase(base);\n function setLocation(location) {\n position++;\n if (position !== queue.length) {\n // we are in the middle, we remove everything from here in the queue\n queue.splice(position);\n }\n queue.push(location);\n }\n function triggerListeners(to, from, { direction, delta }) {\n const info = {\n direction,\n delta,\n type: NavigationType.pop,\n };\n for (const callback of listeners) {\n callback(to, from, info);\n }\n }\n const routerHistory = {\n // rewritten by Object.defineProperty\n location: START,\n // TODO: should be kept in queue\n state: {},\n base,\n createHref: createHref.bind(null, base),\n replace(to) {\n // remove current entry and decrement position\n queue.splice(position--, 1);\n setLocation(to);\n },\n push(to, data) {\n setLocation(to);\n },\n listen(callback) {\n listeners.push(callback);\n return () => {\n const index = listeners.indexOf(callback);\n if (index > -1)\n listeners.splice(index, 1);\n };\n },\n destroy() {\n listeners = [];\n queue = [START];\n position = 0;\n },\n go(delta, shouldTrigger = true) {\n const from = this.location;\n const direction = \n // we are considering delta === 0 going forward, but in abstract mode\n // using 0 for the delta doesn't make sense like it does in html5 where\n // it reloads the page\n delta < 0 ? NavigationDirection.back : NavigationDirection.forward;\n position = Math.max(0, Math.min(position + delta, queue.length - 1));\n if (shouldTrigger) {\n triggerListeners(this.location, from, {\n direction,\n delta,\n });\n }\n },\n };\n Object.defineProperty(routerHistory, 'location', {\n enumerable: true,\n get: () => queue[position],\n });\n return routerHistory;\n}\n\n/**\n * Creates a hash history. Useful for web applications with no host (e.g. `file://`) or when configuring a server to\n * handle any URL is not possible.\n *\n * @param base - optional base to provide. Defaults to `location.pathname + location.search` If there is a `` tag\n * in the `head`, its value will be ignored in favor of this parameter **but note it affects all the history.pushState()\n * calls**, meaning that if you use a `` tag, it's `href` value **has to match this parameter** (ignoring anything\n * after the `#`).\n *\n * @example\n * ```js\n * // at https://example.com/folder\n * createWebHashHistory() // gives a url of `https://example.com/folder#`\n * createWebHashHistory('/folder/') // gives a url of `https://example.com/folder/#`\n * // if the `#` is provided in the base, it won't be added by `createWebHashHistory`\n * createWebHashHistory('/folder/#/app/') // gives a url of `https://example.com/folder/#/app/`\n * // you should avoid doing this because it changes the original url and breaks copying urls\n * createWebHashHistory('/other-folder/') // gives a url of `https://example.com/other-folder/#`\n *\n * // at file:///usr/etc/folder/index.html\n * // for locations with no `host`, the base is ignored\n * createWebHashHistory('/iAmIgnored') // gives a url of `file:///usr/etc/folder/index.html#`\n * ```\n */\nfunction createWebHashHistory(base) {\n // Make sure this implementation is fine in terms of encoding, specially for IE11\n // for `file://`, directly use the pathname and ignore the base\n // location.pathname contains an initial `/` even at the root: `https://example.com`\n base = location.host ? base || location.pathname + location.search : '';\n // allow the user to provide a `#` in the middle: `/base/#/app`\n if (!base.includes('#'))\n base += '#';\n if ((process.env.NODE_ENV !== 'production') && !base.endsWith('#/') && !base.endsWith('#')) {\n warn(`A hash base must end with a \"#\":\\n\"${base}\" should be \"${base.replace(/#.*$/, '#')}\".`);\n }\n return createWebHistory(base);\n}\n\nfunction isRouteLocation(route) {\n return typeof route === 'string' || (route && typeof route === 'object');\n}\nfunction isRouteName(name) {\n return typeof name === 'string' || typeof name === 'symbol';\n}\n\nconst NavigationFailureSymbol = Symbol((process.env.NODE_ENV !== 'production') ? 'navigation failure' : '');\n/**\n * Enumeration with all possible types for navigation failures. Can be passed to\n * {@link isNavigationFailure} to check for specific failures.\n */\nvar NavigationFailureType;\n(function (NavigationFailureType) {\n /**\n * An aborted navigation is a navigation that failed because a navigation\n * guard returned `false` or called `next(false)`\n */\n NavigationFailureType[NavigationFailureType[\"aborted\"] = 4] = \"aborted\";\n /**\n * A cancelled navigation is a navigation that failed because a more recent\n * navigation finished started (not necessarily finished).\n */\n NavigationFailureType[NavigationFailureType[\"cancelled\"] = 8] = \"cancelled\";\n /**\n * A duplicated navigation is a navigation that failed because it was\n * initiated while already being at the exact same location.\n */\n NavigationFailureType[NavigationFailureType[\"duplicated\"] = 16] = \"duplicated\";\n})(NavigationFailureType || (NavigationFailureType = {}));\n// DEV only debug messages\nconst ErrorTypeMessages = {\n [1 /* ErrorTypes.MATCHER_NOT_FOUND */]({ location, currentLocation }) {\n return `No match for\\n ${JSON.stringify(location)}${currentLocation\n ? '\\nwhile being at\\n' + JSON.stringify(currentLocation)\n : ''}`;\n },\n [2 /* ErrorTypes.NAVIGATION_GUARD_REDIRECT */]({ from, to, }) {\n return `Redirected from \"${from.fullPath}\" to \"${stringifyRoute(to)}\" via a navigation guard.`;\n },\n [4 /* ErrorTypes.NAVIGATION_ABORTED */]({ from, to }) {\n return `Navigation aborted from \"${from.fullPath}\" to \"${to.fullPath}\" via a navigation guard.`;\n },\n [8 /* ErrorTypes.NAVIGATION_CANCELLED */]({ from, to }) {\n return `Navigation cancelled from \"${from.fullPath}\" to \"${to.fullPath}\" with a new navigation.`;\n },\n [16 /* ErrorTypes.NAVIGATION_DUPLICATED */]({ from, to }) {\n return `Avoided redundant navigation to current location: \"${from.fullPath}\".`;\n },\n};\n/**\n * Creates a typed NavigationFailure object.\n * @internal\n * @param type - NavigationFailureType\n * @param params - { from, to }\n */\nfunction createRouterError(type, params) {\n // keep full error messages in cjs versions\n if ((process.env.NODE_ENV !== 'production') || !true) {\n return assign(new Error(ErrorTypeMessages[type](params)), {\n type,\n [NavigationFailureSymbol]: true,\n }, params);\n }\n else {\n return assign(new Error(), {\n type,\n [NavigationFailureSymbol]: true,\n }, params);\n }\n}\nfunction isNavigationFailure(error, type) {\n return (error instanceof Error &&\n NavigationFailureSymbol in error &&\n (type == null || !!(error.type & type)));\n}\nconst propertiesToLog = ['params', 'query', 'hash'];\nfunction stringifyRoute(to) {\n if (typeof to === 'string')\n return to;\n if (to.path != null)\n return to.path;\n const location = {};\n for (const key of propertiesToLog) {\n if (key in to)\n location[key] = to[key];\n }\n return JSON.stringify(location, null, 2);\n}\n\n// default pattern for a param: non-greedy everything but /\nconst BASE_PARAM_PATTERN = '[^/]+?';\nconst BASE_PATH_PARSER_OPTIONS = {\n sensitive: false,\n strict: false,\n start: true,\n end: true,\n};\n// Special Regex characters that must be escaped in static tokens\nconst REGEX_CHARS_RE = /[.+*?^${}()[\\]/\\\\]/g;\n/**\n * Creates a path parser from an array of Segments (a segment is an array of Tokens)\n *\n * @param segments - array of segments returned by tokenizePath\n * @param extraOptions - optional options for the regexp\n * @returns a PathParser\n */\nfunction tokensToParser(segments, extraOptions) {\n const options = assign({}, BASE_PATH_PARSER_OPTIONS, extraOptions);\n // the amount of scores is the same as the length of segments except for the root segment \"/\"\n const score = [];\n // the regexp as a string\n let pattern = options.start ? '^' : '';\n // extracted keys\n const keys = [];\n for (const segment of segments) {\n // the root segment needs special treatment\n const segmentScores = segment.length ? [] : [90 /* PathScore.Root */];\n // allow trailing slash\n if (options.strict && !segment.length)\n pattern += '/';\n for (let tokenIndex = 0; tokenIndex < segment.length; tokenIndex++) {\n const token = segment[tokenIndex];\n // resets the score if we are inside a sub-segment /:a-other-:b\n let subSegmentScore = 40 /* PathScore.Segment */ +\n (options.sensitive ? 0.25 /* PathScore.BonusCaseSensitive */ : 0);\n if (token.type === 0 /* TokenType.Static */) {\n // prepend the slash if we are starting a new segment\n if (!tokenIndex)\n pattern += '/';\n pattern += token.value.replace(REGEX_CHARS_RE, '\\\\$&');\n subSegmentScore += 40 /* PathScore.Static */;\n }\n else if (token.type === 1 /* TokenType.Param */) {\n const { value, repeatable, optional, regexp } = token;\n keys.push({\n name: value,\n repeatable,\n optional,\n });\n const re = regexp ? regexp : BASE_PARAM_PATTERN;\n // the user provided a custom regexp /:id(\\\\d+)\n if (re !== BASE_PARAM_PATTERN) {\n subSegmentScore += 10 /* PathScore.BonusCustomRegExp */;\n // make sure the regexp is valid before using it\n try {\n new RegExp(`(${re})`);\n }\n catch (err) {\n throw new Error(`Invalid custom RegExp for param \"${value}\" (${re}): ` +\n err.message);\n }\n }\n // when we repeat we must take care of the repeating leading slash\n let subPattern = repeatable ? `((?:${re})(?:/(?:${re}))*)` : `(${re})`;\n // prepend the slash if we are starting a new segment\n if (!tokenIndex)\n subPattern =\n // avoid an optional / if there are more segments e.g. /:p?-static\n // or /:p?-:p2\n optional && segment.length < 2\n ? `(?:/${subPattern})`\n : '/' + subPattern;\n if (optional)\n subPattern += '?';\n pattern += subPattern;\n subSegmentScore += 20 /* PathScore.Dynamic */;\n if (optional)\n subSegmentScore += -8 /* PathScore.BonusOptional */;\n if (repeatable)\n subSegmentScore += -20 /* PathScore.BonusRepeatable */;\n if (re === '.*')\n subSegmentScore += -50 /* PathScore.BonusWildcard */;\n }\n segmentScores.push(subSegmentScore);\n }\n // an empty array like /home/ -> [[{home}], []]\n // if (!segment.length) pattern += '/'\n score.push(segmentScores);\n }\n // only apply the strict bonus to the last score\n if (options.strict && options.end) {\n const i = score.length - 1;\n score[i][score[i].length - 1] += 0.7000000000000001 /* PathScore.BonusStrict */;\n }\n // TODO: dev only warn double trailing slash\n if (!options.strict)\n pattern += '/?';\n if (options.end)\n pattern += '$';\n // allow paths like /dynamic to only match dynamic or dynamic/... but not dynamic_something_else\n else if (options.strict)\n pattern += '(?:/|$)';\n const re = new RegExp(pattern, options.sensitive ? '' : 'i');\n function parse(path) {\n const match = path.match(re);\n const params = {};\n if (!match)\n return null;\n for (let i = 1; i < match.length; i++) {\n const value = match[i] || '';\n const key = keys[i - 1];\n params[key.name] = value && key.repeatable ? value.split('/') : value;\n }\n return params;\n }\n function stringify(params) {\n let path = '';\n // for optional parameters to allow to be empty\n let avoidDuplicatedSlash = false;\n for (const segment of segments) {\n if (!avoidDuplicatedSlash || !path.endsWith('/'))\n path += '/';\n avoidDuplicatedSlash = false;\n for (const token of segment) {\n if (token.type === 0 /* TokenType.Static */) {\n path += token.value;\n }\n else if (token.type === 1 /* TokenType.Param */) {\n const { value, repeatable, optional } = token;\n const param = value in params ? params[value] : '';\n if (isArray(param) && !repeatable) {\n throw new Error(`Provided param \"${value}\" is an array but it is not repeatable (* or + modifiers)`);\n }\n const text = isArray(param)\n ? param.join('/')\n : param;\n if (!text) {\n if (optional) {\n // if we have more than one optional param like /:a?-static we don't need to care about the optional param\n if (segment.length < 2) {\n // remove the last slash as we could be at the end\n if (path.endsWith('/'))\n path = path.slice(0, -1);\n // do not append a slash on the next iteration\n else\n avoidDuplicatedSlash = true;\n }\n }\n else\n throw new Error(`Missing required param \"${value}\"`);\n }\n path += text;\n }\n }\n }\n // avoid empty path when we have multiple optional params\n return path || '/';\n }\n return {\n re,\n score,\n keys,\n parse,\n stringify,\n };\n}\n/**\n * Compares an array of numbers as used in PathParser.score and returns a\n * number. This function can be used to `sort` an array\n *\n * @param a - first array of numbers\n * @param b - second array of numbers\n * @returns 0 if both are equal, < 0 if a should be sorted first, > 0 if b\n * should be sorted first\n */\nfunction compareScoreArray(a, b) {\n let i = 0;\n while (i < a.length && i < b.length) {\n const diff = b[i] - a[i];\n // only keep going if diff === 0\n if (diff)\n return diff;\n i++;\n }\n // if the last subsegment was Static, the shorter segments should be sorted first\n // otherwise sort the longest segment first\n if (a.length < b.length) {\n return a.length === 1 && a[0] === 40 /* PathScore.Static */ + 40 /* PathScore.Segment */\n ? -1\n : 1;\n }\n else if (a.length > b.length) {\n return b.length === 1 && b[0] === 40 /* PathScore.Static */ + 40 /* PathScore.Segment */\n ? 1\n : -1;\n }\n return 0;\n}\n/**\n * Compare function that can be used with `sort` to sort an array of PathParser\n *\n * @param a - first PathParser\n * @param b - second PathParser\n * @returns 0 if both are equal, < 0 if a should be sorted first, > 0 if b\n */\nfunction comparePathParserScore(a, b) {\n let i = 0;\n const aScore = a.score;\n const bScore = b.score;\n while (i < aScore.length && i < bScore.length) {\n const comp = compareScoreArray(aScore[i], bScore[i]);\n // do not return if both are equal\n if (comp)\n return comp;\n i++;\n }\n if (Math.abs(bScore.length - aScore.length) === 1) {\n if (isLastScoreNegative(aScore))\n return 1;\n if (isLastScoreNegative(bScore))\n return -1;\n }\n // if a and b share the same score entries but b has more, sort b first\n return bScore.length - aScore.length;\n // this is the ternary version\n // return aScore.length < bScore.length\n // ? 1\n // : aScore.length > bScore.length\n // ? -1\n // : 0\n}\n/**\n * This allows detecting splats at the end of a path: /home/:id(.*)*\n *\n * @param score - score to check\n * @returns true if the last entry is negative\n */\nfunction isLastScoreNegative(score) {\n const last = score[score.length - 1];\n return score.length > 0 && last[last.length - 1] < 0;\n}\n\nconst ROOT_TOKEN = {\n type: 0 /* TokenType.Static */,\n value: '',\n};\nconst VALID_PARAM_RE = /[a-zA-Z0-9_]/;\n// After some profiling, the cache seems to be unnecessary because tokenizePath\n// (the slowest part of adding a route) is very fast\n// const tokenCache = new Map()\nfunction tokenizePath(path) {\n if (!path)\n return [[]];\n if (path === '/')\n return [[ROOT_TOKEN]];\n if (!path.startsWith('/')) {\n throw new Error((process.env.NODE_ENV !== 'production')\n ? `Route paths should start with a \"/\": \"${path}\" should be \"/${path}\".`\n : `Invalid path \"${path}\"`);\n }\n // if (tokenCache.has(path)) return tokenCache.get(path)!\n function crash(message) {\n throw new Error(`ERR (${state})/\"${buffer}\": ${message}`);\n }\n let state = 0 /* TokenizerState.Static */;\n let previousState = state;\n const tokens = [];\n // the segment will always be valid because we get into the initial state\n // with the leading /\n let segment;\n function finalizeSegment() {\n if (segment)\n tokens.push(segment);\n segment = [];\n }\n // index on the path\n let i = 0;\n // char at index\n let char;\n // buffer of the value read\n let buffer = '';\n // custom regexp for a param\n let customRe = '';\n function consumeBuffer() {\n if (!buffer)\n return;\n if (state === 0 /* TokenizerState.Static */) {\n segment.push({\n type: 0 /* TokenType.Static */,\n value: buffer,\n });\n }\n else if (state === 1 /* TokenizerState.Param */ ||\n state === 2 /* TokenizerState.ParamRegExp */ ||\n state === 3 /* TokenizerState.ParamRegExpEnd */) {\n if (segment.length > 1 && (char === '*' || char === '+'))\n crash(`A repeatable param (${buffer}) must be alone in its segment. eg: '/:ids+.`);\n segment.push({\n type: 1 /* TokenType.Param */,\n value: buffer,\n regexp: customRe,\n repeatable: char === '*' || char === '+',\n optional: char === '*' || char === '?',\n });\n }\n else {\n crash('Invalid state to consume buffer');\n }\n buffer = '';\n }\n function addCharToBuffer() {\n buffer += char;\n }\n while (i < path.length) {\n char = path[i++];\n if (char === '\\\\' && state !== 2 /* TokenizerState.ParamRegExp */) {\n previousState = state;\n state = 4 /* TokenizerState.EscapeNext */;\n continue;\n }\n switch (state) {\n case 0 /* TokenizerState.Static */:\n if (char === '/') {\n if (buffer) {\n consumeBuffer();\n }\n finalizeSegment();\n }\n else if (char === ':') {\n consumeBuffer();\n state = 1 /* TokenizerState.Param */;\n }\n else {\n addCharToBuffer();\n }\n break;\n case 4 /* TokenizerState.EscapeNext */:\n addCharToBuffer();\n state = previousState;\n break;\n case 1 /* TokenizerState.Param */:\n if (char === '(') {\n state = 2 /* TokenizerState.ParamRegExp */;\n }\n else if (VALID_PARAM_RE.test(char)) {\n addCharToBuffer();\n }\n else {\n consumeBuffer();\n state = 0 /* TokenizerState.Static */;\n // go back one character if we were not modifying\n if (char !== '*' && char !== '?' && char !== '+')\n i--;\n }\n break;\n case 2 /* TokenizerState.ParamRegExp */:\n // TODO: is it worth handling nested regexp? like :p(?:prefix_([^/]+)_suffix)\n // it already works by escaping the closing )\n // https://paths.esm.dev/?p=AAMeJbiAwQEcDKbAoAAkP60PG2R6QAvgNaA6AFACM2ABuQBB#\n // is this really something people need since you can also write\n // /prefix_:p()_suffix\n if (char === ')') {\n // handle the escaped )\n if (customRe[customRe.length - 1] == '\\\\')\n customRe = customRe.slice(0, -1) + char;\n else\n state = 3 /* TokenizerState.ParamRegExpEnd */;\n }\n else {\n customRe += char;\n }\n break;\n case 3 /* TokenizerState.ParamRegExpEnd */:\n // same as finalizing a param\n consumeBuffer();\n state = 0 /* TokenizerState.Static */;\n // go back one character if we were not modifying\n if (char !== '*' && char !== '?' && char !== '+')\n i--;\n customRe = '';\n break;\n default:\n crash('Unknown state');\n break;\n }\n }\n if (state === 2 /* TokenizerState.ParamRegExp */)\n crash(`Unfinished custom RegExp for param \"${buffer}\"`);\n consumeBuffer();\n finalizeSegment();\n // tokenCache.set(path, tokens)\n return tokens;\n}\n\nfunction createRouteRecordMatcher(record, parent, options) {\n const parser = tokensToParser(tokenizePath(record.path), options);\n // warn against params with the same name\n if ((process.env.NODE_ENV !== 'production')) {\n const existingKeys = new Set();\n for (const key of parser.keys) {\n if (existingKeys.has(key.name))\n warn(`Found duplicated params with name \"${key.name}\" for path \"${record.path}\". Only the last one will be available on \"$route.params\".`);\n existingKeys.add(key.name);\n }\n }\n const matcher = assign(parser, {\n record,\n parent,\n // these needs to be populated by the parent\n children: [],\n alias: [],\n });\n if (parent) {\n // both are aliases or both are not aliases\n // we don't want to mix them because the order is used when\n // passing originalRecord in Matcher.addRoute\n if (!matcher.record.aliasOf === !parent.record.aliasOf)\n parent.children.push(matcher);\n }\n return matcher;\n}\n\n/**\n * Creates a Router Matcher.\n *\n * @internal\n * @param routes - array of initial routes\n * @param globalOptions - global route options\n */\nfunction createRouterMatcher(routes, globalOptions) {\n // normalized ordered array of matchers\n const matchers = [];\n const matcherMap = new Map();\n globalOptions = mergeOptions({ strict: false, end: true, sensitive: false }, globalOptions);\n function getRecordMatcher(name) {\n return matcherMap.get(name);\n }\n function addRoute(record, parent, originalRecord) {\n // used later on to remove by name\n const isRootAdd = !originalRecord;\n const mainNormalizedRecord = normalizeRouteRecord(record);\n if ((process.env.NODE_ENV !== 'production')) {\n checkChildMissingNameWithEmptyPath(mainNormalizedRecord, parent);\n }\n // we might be the child of an alias\n mainNormalizedRecord.aliasOf = originalRecord && originalRecord.record;\n const options = mergeOptions(globalOptions, record);\n // generate an array of records to correctly handle aliases\n const normalizedRecords = [\n mainNormalizedRecord,\n ];\n if ('alias' in record) {\n const aliases = typeof record.alias === 'string' ? [record.alias] : record.alias;\n for (const alias of aliases) {\n normalizedRecords.push(assign({}, mainNormalizedRecord, {\n // this allows us to hold a copy of the `components` option\n // so that async components cache is hold on the original record\n components: originalRecord\n ? originalRecord.record.components\n : mainNormalizedRecord.components,\n path: alias,\n // we might be the child of an alias\n aliasOf: originalRecord\n ? originalRecord.record\n : mainNormalizedRecord,\n // the aliases are always of the same kind as the original since they\n // are defined on the same record\n }));\n }\n }\n let matcher;\n let originalMatcher;\n for (const normalizedRecord of normalizedRecords) {\n const { path } = normalizedRecord;\n // Build up the path for nested routes if the child isn't an absolute\n // route. Only add the / delimiter if the child path isn't empty and if the\n // parent path doesn't have a trailing slash\n if (parent && path[0] !== '/') {\n const parentPath = parent.record.path;\n const connectingSlash = parentPath[parentPath.length - 1] === '/' ? '' : '/';\n normalizedRecord.path =\n parent.record.path + (path && connectingSlash + path);\n }\n if ((process.env.NODE_ENV !== 'production') && normalizedRecord.path === '*') {\n throw new Error('Catch all routes (\"*\") must now be defined using a param with a custom regexp.\\n' +\n 'See more at https://next.router.vuejs.org/guide/migration/#removed-star-or-catch-all-routes.');\n }\n // create the object beforehand, so it can be passed to children\n matcher = createRouteRecordMatcher(normalizedRecord, parent, options);\n if ((process.env.NODE_ENV !== 'production') && parent && path[0] === '/')\n checkMissingParamsInAbsolutePath(matcher, parent);\n // if we are an alias we must tell the original record that we exist,\n // so we can be removed\n if (originalRecord) {\n originalRecord.alias.push(matcher);\n if ((process.env.NODE_ENV !== 'production')) {\n checkSameParams(originalRecord, matcher);\n }\n }\n else {\n // otherwise, the first record is the original and others are aliases\n originalMatcher = originalMatcher || matcher;\n if (originalMatcher !== matcher)\n originalMatcher.alias.push(matcher);\n // remove the route if named and only for the top record (avoid in nested calls)\n // this works because the original record is the first one\n if (isRootAdd && record.name && !isAliasRecord(matcher))\n removeRoute(record.name);\n }\n // Avoid adding a record that doesn't display anything. This allows passing through records without a component to\n // not be reached and pass through the catch all route\n if (isMatchable(matcher)) {\n insertMatcher(matcher);\n }\n if (mainNormalizedRecord.children) {\n const children = mainNormalizedRecord.children;\n for (let i = 0; i < children.length; i++) {\n addRoute(children[i], matcher, originalRecord && originalRecord.children[i]);\n }\n }\n // if there was no original record, then the first one was not an alias and all\n // other aliases (if any) need to reference this record when adding children\n originalRecord = originalRecord || matcher;\n // TODO: add normalized records for more flexibility\n // if (parent && isAliasRecord(originalRecord)) {\n // parent.children.push(originalRecord)\n // }\n }\n return originalMatcher\n ? () => {\n // since other matchers are aliases, they should be removed by the original matcher\n removeRoute(originalMatcher);\n }\n : noop;\n }\n function removeRoute(matcherRef) {\n if (isRouteName(matcherRef)) {\n const matcher = matcherMap.get(matcherRef);\n if (matcher) {\n matcherMap.delete(matcherRef);\n matchers.splice(matchers.indexOf(matcher), 1);\n matcher.children.forEach(removeRoute);\n matcher.alias.forEach(removeRoute);\n }\n }\n else {\n const index = matchers.indexOf(matcherRef);\n if (index > -1) {\n matchers.splice(index, 1);\n if (matcherRef.record.name)\n matcherMap.delete(matcherRef.record.name);\n matcherRef.children.forEach(removeRoute);\n matcherRef.alias.forEach(removeRoute);\n }\n }\n }\n function getRoutes() {\n return matchers;\n }\n function insertMatcher(matcher) {\n const index = findInsertionIndex(matcher, matchers);\n matchers.splice(index, 0, matcher);\n // only add the original record to the name map\n if (matcher.record.name && !isAliasRecord(matcher))\n matcherMap.set(matcher.record.name, matcher);\n }\n function resolve(location, currentLocation) {\n let matcher;\n let params = {};\n let path;\n let name;\n if ('name' in location && location.name) {\n matcher = matcherMap.get(location.name);\n if (!matcher)\n throw createRouterError(1 /* ErrorTypes.MATCHER_NOT_FOUND */, {\n location,\n });\n // warn if the user is passing invalid params so they can debug it better when they get removed\n if ((process.env.NODE_ENV !== 'production')) {\n const invalidParams = Object.keys(location.params || {}).filter(paramName => !matcher.keys.find(k => k.name === paramName));\n if (invalidParams.length) {\n warn(`Discarded invalid param(s) \"${invalidParams.join('\", \"')}\" when navigating. See https://github.com/vuejs/router/blob/main/packages/router/CHANGELOG.md#414-2022-08-22 for more details.`);\n }\n }\n name = matcher.record.name;\n params = assign(\n // paramsFromLocation is a new object\n paramsFromLocation(currentLocation.params, \n // only keep params that exist in the resolved location\n // only keep optional params coming from a parent record\n matcher.keys\n .filter(k => !k.optional)\n .concat(matcher.parent ? matcher.parent.keys.filter(k => k.optional) : [])\n .map(k => k.name)), \n // discard any existing params in the current location that do not exist here\n // #1497 this ensures better active/exact matching\n location.params &&\n paramsFromLocation(location.params, matcher.keys.map(k => k.name)));\n // throws if cannot be stringified\n path = matcher.stringify(params);\n }\n else if (location.path != null) {\n // no need to resolve the path with the matcher as it was provided\n // this also allows the user to control the encoding\n path = location.path;\n if ((process.env.NODE_ENV !== 'production') && !path.startsWith('/')) {\n warn(`The Matcher cannot resolve relative paths but received \"${path}\". Unless you directly called \\`matcher.resolve(\"${path}\")\\`, this is probably a bug in vue-router. Please open an issue at https://github.com/vuejs/router/issues/new/choose.`);\n }\n matcher = matchers.find(m => m.re.test(path));\n // matcher should have a value after the loop\n if (matcher) {\n // we know the matcher works because we tested the regexp\n params = matcher.parse(path);\n name = matcher.record.name;\n }\n // location is a relative path\n }\n else {\n // match by name or path of current route\n matcher = currentLocation.name\n ? matcherMap.get(currentLocation.name)\n : matchers.find(m => m.re.test(currentLocation.path));\n if (!matcher)\n throw createRouterError(1 /* ErrorTypes.MATCHER_NOT_FOUND */, {\n location,\n currentLocation,\n });\n name = matcher.record.name;\n // since we are navigating to the same location, we don't need to pick the\n // params like when `name` is provided\n params = assign({}, currentLocation.params, location.params);\n path = matcher.stringify(params);\n }\n const matched = [];\n let parentMatcher = matcher;\n while (parentMatcher) {\n // reversed order so parents are at the beginning\n matched.unshift(parentMatcher.record);\n parentMatcher = parentMatcher.parent;\n }\n return {\n name,\n path,\n params,\n matched,\n meta: mergeMetaFields(matched),\n };\n }\n // add initial routes\n routes.forEach(route => addRoute(route));\n function clearRoutes() {\n matchers.length = 0;\n matcherMap.clear();\n }\n return {\n addRoute,\n resolve,\n removeRoute,\n clearRoutes,\n getRoutes,\n getRecordMatcher,\n };\n}\nfunction paramsFromLocation(params, keys) {\n const newParams = {};\n for (const key of keys) {\n if (key in params)\n newParams[key] = params[key];\n }\n return newParams;\n}\n/**\n * Normalizes a RouteRecordRaw. Creates a copy\n *\n * @param record\n * @returns the normalized version\n */\nfunction normalizeRouteRecord(record) {\n return {\n path: record.path,\n redirect: record.redirect,\n name: record.name,\n meta: record.meta || {},\n aliasOf: undefined,\n beforeEnter: record.beforeEnter,\n props: normalizeRecordProps(record),\n children: record.children || [],\n instances: {},\n leaveGuards: new Set(),\n updateGuards: new Set(),\n enterCallbacks: {},\n components: 'components' in record\n ? record.components || null\n : record.component && { default: record.component },\n };\n}\n/**\n * Normalize the optional `props` in a record to always be an object similar to\n * components. Also accept a boolean for components.\n * @param record\n */\nfunction normalizeRecordProps(record) {\n const propsObject = {};\n // props does not exist on redirect records, but we can set false directly\n const props = record.props || false;\n if ('component' in record) {\n propsObject.default = props;\n }\n else {\n // NOTE: we could also allow a function to be applied to every component.\n // Would need user feedback for use cases\n for (const name in record.components)\n propsObject[name] = typeof props === 'object' ? props[name] : props;\n }\n return propsObject;\n}\n/**\n * Checks if a record or any of its parent is an alias\n * @param record\n */\nfunction isAliasRecord(record) {\n while (record) {\n if (record.record.aliasOf)\n return true;\n record = record.parent;\n }\n return false;\n}\n/**\n * Merge meta fields of an array of records\n *\n * @param matched - array of matched records\n */\nfunction mergeMetaFields(matched) {\n return matched.reduce((meta, record) => assign(meta, record.meta), {});\n}\nfunction mergeOptions(defaults, partialOptions) {\n const options = {};\n for (const key in defaults) {\n options[key] = key in partialOptions ? partialOptions[key] : defaults[key];\n }\n return options;\n}\nfunction isSameParam(a, b) {\n return (a.name === b.name &&\n a.optional === b.optional &&\n a.repeatable === b.repeatable);\n}\n/**\n * Check if a path and its alias have the same required params\n *\n * @param a - original record\n * @param b - alias record\n */\nfunction checkSameParams(a, b) {\n for (const key of a.keys) {\n if (!key.optional && !b.keys.find(isSameParam.bind(null, key)))\n return warn(`Alias \"${b.record.path}\" and the original record: \"${a.record.path}\" must have the exact same param named \"${key.name}\"`);\n }\n for (const key of b.keys) {\n if (!key.optional && !a.keys.find(isSameParam.bind(null, key)))\n return warn(`Alias \"${b.record.path}\" and the original record: \"${a.record.path}\" must have the exact same param named \"${key.name}\"`);\n }\n}\n/**\n * A route with a name and a child with an empty path without a name should warn when adding the route\n *\n * @param mainNormalizedRecord - RouteRecordNormalized\n * @param parent - RouteRecordMatcher\n */\nfunction checkChildMissingNameWithEmptyPath(mainNormalizedRecord, parent) {\n if (parent &&\n parent.record.name &&\n !mainNormalizedRecord.name &&\n !mainNormalizedRecord.path) {\n warn(`The route named \"${String(parent.record.name)}\" has a child without a name and an empty path. Using that name won't render the empty path child so you probably want to move the name to the child instead. If this is intentional, add a name to the child route to remove the warning.`);\n }\n}\nfunction checkMissingParamsInAbsolutePath(record, parent) {\n for (const key of parent.keys) {\n if (!record.keys.find(isSameParam.bind(null, key)))\n return warn(`Absolute path \"${record.record.path}\" must have the exact same param named \"${key.name}\" as its parent \"${parent.record.path}\".`);\n }\n}\n/**\n * Performs a binary search to find the correct insertion index for a new matcher.\n *\n * Matchers are primarily sorted by their score. If scores are tied then we also consider parent/child relationships,\n * with descendants coming before ancestors. If there's still a tie, new routes are inserted after existing routes.\n *\n * @param matcher - new matcher to be inserted\n * @param matchers - existing matchers\n */\nfunction findInsertionIndex(matcher, matchers) {\n // First phase: binary search based on score\n let lower = 0;\n let upper = matchers.length;\n while (lower !== upper) {\n const mid = (lower + upper) >> 1;\n const sortOrder = comparePathParserScore(matcher, matchers[mid]);\n if (sortOrder < 0) {\n upper = mid;\n }\n else {\n lower = mid + 1;\n }\n }\n // Second phase: check for an ancestor with the same score\n const insertionAncestor = getInsertionAncestor(matcher);\n if (insertionAncestor) {\n upper = matchers.lastIndexOf(insertionAncestor, upper - 1);\n if ((process.env.NODE_ENV !== 'production') && upper < 0) {\n // This should never happen\n warn(`Finding ancestor route \"${insertionAncestor.record.path}\" failed for \"${matcher.record.path}\"`);\n }\n }\n return upper;\n}\nfunction getInsertionAncestor(matcher) {\n let ancestor = matcher;\n while ((ancestor = ancestor.parent)) {\n if (isMatchable(ancestor) &&\n comparePathParserScore(matcher, ancestor) === 0) {\n return ancestor;\n }\n }\n return;\n}\n/**\n * Checks if a matcher can be reachable. This means if it's possible to reach it as a route. For example, routes without\n * a component, or name, or redirect, are just used to group other routes.\n * @param matcher\n * @param matcher.record record of the matcher\n * @returns\n */\nfunction isMatchable({ record }) {\n return !!(record.name ||\n (record.components && Object.keys(record.components).length) ||\n record.redirect);\n}\n\n/**\n * Transforms a queryString into a {@link LocationQuery} object. Accept both, a\n * version with the leading `?` and without Should work as URLSearchParams\n\n * @internal\n *\n * @param search - search string to parse\n * @returns a query object\n */\nfunction parseQuery(search) {\n const query = {};\n // avoid creating an object with an empty key and empty value\n // because of split('&')\n if (search === '' || search === '?')\n return query;\n const hasLeadingIM = search[0] === '?';\n const searchParams = (hasLeadingIM ? search.slice(1) : search).split('&');\n for (let i = 0; i < searchParams.length; ++i) {\n // pre decode the + into space\n const searchParam = searchParams[i].replace(PLUS_RE, ' ');\n // allow the = character\n const eqPos = searchParam.indexOf('=');\n const key = decode(eqPos < 0 ? searchParam : searchParam.slice(0, eqPos));\n const value = eqPos < 0 ? null : decode(searchParam.slice(eqPos + 1));\n if (key in query) {\n // an extra variable for ts types\n let currentValue = query[key];\n if (!isArray(currentValue)) {\n currentValue = query[key] = [currentValue];\n }\n currentValue.push(value);\n }\n else {\n query[key] = value;\n }\n }\n return query;\n}\n/**\n * Stringifies a {@link LocationQueryRaw} object. Like `URLSearchParams`, it\n * doesn't prepend a `?`\n *\n * @internal\n *\n * @param query - query object to stringify\n * @returns string version of the query without the leading `?`\n */\nfunction stringifyQuery(query) {\n let search = '';\n for (let key in query) {\n const value = query[key];\n key = encodeQueryKey(key);\n if (value == null) {\n // only null adds the value\n if (value !== undefined) {\n search += (search.length ? '&' : '') + key;\n }\n continue;\n }\n // keep null values\n const values = isArray(value)\n ? value.map(v => v && encodeQueryValue(v))\n : [value && encodeQueryValue(value)];\n values.forEach(value => {\n // skip undefined values in arrays as if they were not present\n // smaller code than using filter\n if (value !== undefined) {\n // only append & with non-empty search\n search += (search.length ? '&' : '') + key;\n if (value != null)\n search += '=' + value;\n }\n });\n }\n return search;\n}\n/**\n * Transforms a {@link LocationQueryRaw} into a {@link LocationQuery} by casting\n * numbers into strings, removing keys with an undefined value and replacing\n * undefined with null in arrays\n *\n * @param query - query object to normalize\n * @returns a normalized query object\n */\nfunction normalizeQuery(query) {\n const normalizedQuery = {};\n for (const key in query) {\n const value = query[key];\n if (value !== undefined) {\n normalizedQuery[key] = isArray(value)\n ? value.map(v => (v == null ? null : '' + v))\n : value == null\n ? value\n : '' + value;\n }\n }\n return normalizedQuery;\n}\n\n/**\n * RouteRecord being rendered by the closest ancestor Router View. Used for\n * `onBeforeRouteUpdate` and `onBeforeRouteLeave`. rvlm stands for Router View\n * Location Matched\n *\n * @internal\n */\nconst matchedRouteKey = Symbol((process.env.NODE_ENV !== 'production') ? 'router view location matched' : '');\n/**\n * Allows overriding the router view depth to control which component in\n * `matched` is rendered. rvd stands for Router View Depth\n *\n * @internal\n */\nconst viewDepthKey = Symbol((process.env.NODE_ENV !== 'production') ? 'router view depth' : '');\n/**\n * Allows overriding the router instance returned by `useRouter` in tests. r\n * stands for router\n *\n * @internal\n */\nconst routerKey = Symbol((process.env.NODE_ENV !== 'production') ? 'router' : '');\n/**\n * Allows overriding the current route returned by `useRoute` in tests. rl\n * stands for route location\n *\n * @internal\n */\nconst routeLocationKey = Symbol((process.env.NODE_ENV !== 'production') ? 'route location' : '');\n/**\n * Allows overriding the current route used by router-view. Internally this is\n * used when the `route` prop is passed.\n *\n * @internal\n */\nconst routerViewLocationKey = Symbol((process.env.NODE_ENV !== 'production') ? 'router view location' : '');\n\n/**\n * Create a list of callbacks that can be reset. Used to create before and after navigation guards list\n */\nfunction useCallbacks() {\n let handlers = [];\n function add(handler) {\n handlers.push(handler);\n return () => {\n const i = handlers.indexOf(handler);\n if (i > -1)\n handlers.splice(i, 1);\n };\n }\n function reset() {\n handlers = [];\n }\n return {\n add,\n list: () => handlers.slice(),\n reset,\n };\n}\n\nfunction registerGuard(record, name, guard) {\n const removeFromList = () => {\n record[name].delete(guard);\n };\n onUnmounted(removeFromList);\n onDeactivated(removeFromList);\n onActivated(() => {\n record[name].add(guard);\n });\n record[name].add(guard);\n}\n/**\n * Add a navigation guard that triggers whenever the component for the current\n * location is about to be left. Similar to {@link beforeRouteLeave} but can be\n * used in any component. The guard is removed when the component is unmounted.\n *\n * @param leaveGuard - {@link NavigationGuard}\n */\nfunction onBeforeRouteLeave(leaveGuard) {\n if ((process.env.NODE_ENV !== 'production') && !getCurrentInstance()) {\n warn('getCurrentInstance() returned null. onBeforeRouteLeave() must be called at the top of a setup function');\n return;\n }\n const activeRecord = inject(matchedRouteKey, \n // to avoid warning\n {}).value;\n if (!activeRecord) {\n (process.env.NODE_ENV !== 'production') &&\n warn('No active route record was found when calling `onBeforeRouteLeave()`. Make sure you call this function inside a component child of . Maybe you called it inside of App.vue?');\n return;\n }\n registerGuard(activeRecord, 'leaveGuards', leaveGuard);\n}\n/**\n * Add a navigation guard that triggers whenever the current location is about\n * to be updated. Similar to {@link beforeRouteUpdate} but can be used in any\n * component. The guard is removed when the component is unmounted.\n *\n * @param updateGuard - {@link NavigationGuard}\n */\nfunction onBeforeRouteUpdate(updateGuard) {\n if ((process.env.NODE_ENV !== 'production') && !getCurrentInstance()) {\n warn('getCurrentInstance() returned null. onBeforeRouteUpdate() must be called at the top of a setup function');\n return;\n }\n const activeRecord = inject(matchedRouteKey, \n // to avoid warning\n {}).value;\n if (!activeRecord) {\n (process.env.NODE_ENV !== 'production') &&\n warn('No active route record was found when calling `onBeforeRouteUpdate()`. Make sure you call this function inside a component child of . Maybe you called it inside of App.vue?');\n return;\n }\n registerGuard(activeRecord, 'updateGuards', updateGuard);\n}\nfunction guardToPromiseFn(guard, to, from, record, name, runWithContext = fn => fn()) {\n // keep a reference to the enterCallbackArray to prevent pushing callbacks if a new navigation took place\n const enterCallbackArray = record &&\n // name is defined if record is because of the function overload\n (record.enterCallbacks[name] = record.enterCallbacks[name] || []);\n return () => new Promise((resolve, reject) => {\n const next = (valid) => {\n if (valid === false) {\n reject(createRouterError(4 /* ErrorTypes.NAVIGATION_ABORTED */, {\n from,\n to,\n }));\n }\n else if (valid instanceof Error) {\n reject(valid);\n }\n else if (isRouteLocation(valid)) {\n reject(createRouterError(2 /* ErrorTypes.NAVIGATION_GUARD_REDIRECT */, {\n from: to,\n to: valid,\n }));\n }\n else {\n if (enterCallbackArray &&\n // since enterCallbackArray is truthy, both record and name also are\n record.enterCallbacks[name] === enterCallbackArray &&\n typeof valid === 'function') {\n enterCallbackArray.push(valid);\n }\n resolve();\n }\n };\n // wrapping with Promise.resolve allows it to work with both async and sync guards\n const guardReturn = runWithContext(() => guard.call(record && record.instances[name], to, from, (process.env.NODE_ENV !== 'production') ? canOnlyBeCalledOnce(next, to, from) : next));\n let guardCall = Promise.resolve(guardReturn);\n if (guard.length < 3)\n guardCall = guardCall.then(next);\n if ((process.env.NODE_ENV !== 'production') && guard.length > 2) {\n const message = `The \"next\" callback was never called inside of ${guard.name ? '\"' + guard.name + '\"' : ''}:\\n${guard.toString()}\\n. If you are returning a value instead of calling \"next\", make sure to remove the \"next\" parameter from your function.`;\n if (typeof guardReturn === 'object' && 'then' in guardReturn) {\n guardCall = guardCall.then(resolvedValue => {\n // @ts-expect-error: _called is added at canOnlyBeCalledOnce\n if (!next._called) {\n warn(message);\n return Promise.reject(new Error('Invalid navigation guard'));\n }\n return resolvedValue;\n });\n }\n else if (guardReturn !== undefined) {\n // @ts-expect-error: _called is added at canOnlyBeCalledOnce\n if (!next._called) {\n warn(message);\n reject(new Error('Invalid navigation guard'));\n return;\n }\n }\n }\n guardCall.catch(err => reject(err));\n });\n}\nfunction canOnlyBeCalledOnce(next, to, from) {\n let called = 0;\n return function () {\n if (called++ === 1)\n warn(`The \"next\" callback was called more than once in one navigation guard when going from \"${from.fullPath}\" to \"${to.fullPath}\". It should be called exactly one time in each navigation guard. This will fail in production.`);\n // @ts-expect-error: we put it in the original one because it's easier to check\n next._called = true;\n if (called === 1)\n next.apply(null, arguments);\n };\n}\nfunction extractComponentsGuards(matched, guardType, to, from, runWithContext = fn => fn()) {\n const guards = [];\n for (const record of matched) {\n if ((process.env.NODE_ENV !== 'production') && !record.components && !record.children.length) {\n warn(`Record with path \"${record.path}\" is either missing a \"component(s)\"` +\n ` or \"children\" property.`);\n }\n for (const name in record.components) {\n let rawComponent = record.components[name];\n if ((process.env.NODE_ENV !== 'production')) {\n if (!rawComponent ||\n (typeof rawComponent !== 'object' &&\n typeof rawComponent !== 'function')) {\n warn(`Component \"${name}\" in record with path \"${record.path}\" is not` +\n ` a valid component. Received \"${String(rawComponent)}\".`);\n // throw to ensure we stop here but warn to ensure the message isn't\n // missed by the user\n throw new Error('Invalid route component');\n }\n else if ('then' in rawComponent) {\n // warn if user wrote import('/component.vue') instead of () =>\n // import('./component.vue')\n warn(`Component \"${name}\" in record with path \"${record.path}\" is a ` +\n `Promise instead of a function that returns a Promise. Did you ` +\n `write \"import('./MyPage.vue')\" instead of ` +\n `\"() => import('./MyPage.vue')\" ? This will break in ` +\n `production if not fixed.`);\n const promise = rawComponent;\n rawComponent = () => promise;\n }\n else if (rawComponent.__asyncLoader &&\n // warn only once per component\n !rawComponent.__warnedDefineAsync) {\n rawComponent.__warnedDefineAsync = true;\n warn(`Component \"${name}\" in record with path \"${record.path}\" is defined ` +\n `using \"defineAsyncComponent()\". ` +\n `Write \"() => import('./MyPage.vue')\" instead of ` +\n `\"defineAsyncComponent(() => import('./MyPage.vue'))\".`);\n }\n }\n // skip update and leave guards if the route component is not mounted\n if (guardType !== 'beforeRouteEnter' && !record.instances[name])\n continue;\n if (isRouteComponent(rawComponent)) {\n // __vccOpts is added by vue-class-component and contain the regular options\n const options = rawComponent.__vccOpts || rawComponent;\n const guard = options[guardType];\n guard &&\n guards.push(guardToPromiseFn(guard, to, from, record, name, runWithContext));\n }\n else {\n // start requesting the chunk already\n let componentPromise = rawComponent();\n if ((process.env.NODE_ENV !== 'production') && !('catch' in componentPromise)) {\n warn(`Component \"${name}\" in record with path \"${record.path}\" is a function that does not return a Promise. If you were passing a functional component, make sure to add a \"displayName\" to the component. This will break in production if not fixed.`);\n componentPromise = Promise.resolve(componentPromise);\n }\n guards.push(() => componentPromise.then(resolved => {\n if (!resolved)\n return Promise.reject(new Error(`Couldn't resolve component \"${name}\" at \"${record.path}\"`));\n const resolvedComponent = isESModule(resolved)\n ? resolved.default\n : resolved;\n // replace the function with the resolved component\n // cannot be null or undefined because we went into the for loop\n record.components[name] = resolvedComponent;\n // __vccOpts is added by vue-class-component and contain the regular options\n const options = resolvedComponent.__vccOpts || resolvedComponent;\n const guard = options[guardType];\n return (guard &&\n guardToPromiseFn(guard, to, from, record, name, runWithContext)());\n }));\n }\n }\n }\n return guards;\n}\n/**\n * Allows differentiating lazy components from functional components and vue-class-component\n * @internal\n *\n * @param component\n */\nfunction isRouteComponent(component) {\n return (typeof component === 'object' ||\n 'displayName' in component ||\n 'props' in component ||\n '__vccOpts' in component);\n}\n/**\n * Ensures a route is loaded, so it can be passed as o prop to ``.\n *\n * @param route - resolved route to load\n */\nfunction loadRouteLocation(route) {\n return route.matched.every(record => record.redirect)\n ? Promise.reject(new Error('Cannot load a route that redirects.'))\n : Promise.all(route.matched.map(record => record.components &&\n Promise.all(Object.keys(record.components).reduce((promises, name) => {\n const rawComponent = record.components[name];\n if (typeof rawComponent === 'function' &&\n !('displayName' in rawComponent)) {\n promises.push(rawComponent().then(resolved => {\n if (!resolved)\n return Promise.reject(new Error(`Couldn't resolve component \"${name}\" at \"${record.path}\". Ensure you passed a function that returns a promise.`));\n const resolvedComponent = isESModule(resolved)\n ? resolved.default\n : resolved;\n // replace the function with the resolved component\n // cannot be null or undefined because we went into the for loop\n record.components[name] = resolvedComponent;\n return;\n }));\n }\n return promises;\n }, [])))).then(() => route);\n}\n\n// TODO: we could allow currentRoute as a prop to expose `isActive` and\n// `isExactActive` behavior should go through an RFC\n/**\n * Returns the internal behavior of a {@link RouterLink} without the rendering part.\n *\n * @param props - a `to` location and an optional `replace` flag\n */\nfunction useLink(props) {\n const router = inject(routerKey);\n const currentRoute = inject(routeLocationKey);\n let hasPrevious = false;\n let previousTo = null;\n const route = computed(() => {\n const to = unref(props.to);\n if ((process.env.NODE_ENV !== 'production') && (!hasPrevious || to !== previousTo)) {\n if (!isRouteLocation(to)) {\n if (hasPrevious) {\n warn(`Invalid value for prop \"to\" in useLink()\\n- to:`, to, `\\n- previous to:`, previousTo, `\\n- props:`, props);\n }\n else {\n warn(`Invalid value for prop \"to\" in useLink()\\n- to:`, to, `\\n- props:`, props);\n }\n }\n previousTo = to;\n hasPrevious = true;\n }\n return router.resolve(to);\n });\n const activeRecordIndex = computed(() => {\n const { matched } = route.value;\n const { length } = matched;\n const routeMatched = matched[length - 1];\n const currentMatched = currentRoute.matched;\n if (!routeMatched || !currentMatched.length)\n return -1;\n const index = currentMatched.findIndex(isSameRouteRecord.bind(null, routeMatched));\n if (index > -1)\n return index;\n // possible parent record\n const parentRecordPath = getOriginalPath(matched[length - 2]);\n return (\n // we are dealing with nested routes\n length > 1 &&\n // if the parent and matched route have the same path, this link is\n // referring to the empty child. Or we currently are on a different\n // child of the same parent\n getOriginalPath(routeMatched) === parentRecordPath &&\n // avoid comparing the child with its parent\n currentMatched[currentMatched.length - 1].path !== parentRecordPath\n ? currentMatched.findIndex(isSameRouteRecord.bind(null, matched[length - 2]))\n : index);\n });\n const isActive = computed(() => activeRecordIndex.value > -1 &&\n includesParams(currentRoute.params, route.value.params));\n const isExactActive = computed(() => activeRecordIndex.value > -1 &&\n activeRecordIndex.value === currentRoute.matched.length - 1 &&\n isSameRouteLocationParams(currentRoute.params, route.value.params));\n function navigate(e = {}) {\n if (guardEvent(e)) {\n return router[unref(props.replace) ? 'replace' : 'push'](unref(props.to)\n // avoid uncaught errors are they are logged anyway\n ).catch(noop);\n }\n return Promise.resolve();\n }\n // devtools only\n if (((process.env.NODE_ENV !== 'production') || __VUE_PROD_DEVTOOLS__) && isBrowser) {\n const instance = getCurrentInstance();\n if (instance) {\n const linkContextDevtools = {\n route: route.value,\n isActive: isActive.value,\n isExactActive: isExactActive.value,\n error: null,\n };\n // @ts-expect-error: this is internal\n instance.__vrl_devtools = instance.__vrl_devtools || [];\n // @ts-expect-error: this is internal\n instance.__vrl_devtools.push(linkContextDevtools);\n watchEffect(() => {\n linkContextDevtools.route = route.value;\n linkContextDevtools.isActive = isActive.value;\n linkContextDevtools.isExactActive = isExactActive.value;\n linkContextDevtools.error = isRouteLocation(unref(props.to))\n ? null\n : 'Invalid \"to\" value';\n }, { flush: 'post' });\n }\n }\n /**\n * NOTE: update {@link _RouterLinkI}'s `$slots` type when updating this\n */\n return {\n route,\n href: computed(() => route.value.href),\n isActive,\n isExactActive,\n navigate,\n };\n}\nconst RouterLinkImpl = /*#__PURE__*/ defineComponent({\n name: 'RouterLink',\n compatConfig: { MODE: 3 },\n props: {\n to: {\n type: [String, Object],\n required: true,\n },\n replace: Boolean,\n activeClass: String,\n // inactiveClass: String,\n exactActiveClass: String,\n custom: Boolean,\n ariaCurrentValue: {\n type: String,\n default: 'page',\n },\n },\n useLink,\n setup(props, { slots }) {\n const link = reactive(useLink(props));\n const { options } = inject(routerKey);\n const elClass = computed(() => ({\n [getLinkClass(props.activeClass, options.linkActiveClass, 'router-link-active')]: link.isActive,\n // [getLinkClass(\n // props.inactiveClass,\n // options.linkInactiveClass,\n // 'router-link-inactive'\n // )]: !link.isExactActive,\n [getLinkClass(props.exactActiveClass, options.linkExactActiveClass, 'router-link-exact-active')]: link.isExactActive,\n }));\n return () => {\n const children = slots.default && slots.default(link);\n return props.custom\n ? children\n : h('a', {\n 'aria-current': link.isExactActive\n ? props.ariaCurrentValue\n : null,\n href: link.href,\n // this would override user added attrs but Vue will still add\n // the listener, so we end up triggering both\n onClick: link.navigate,\n class: elClass.value,\n }, children);\n };\n },\n});\n// export the public type for h/tsx inference\n// also to avoid inline import() in generated d.ts files\n/**\n * Component to render a link that triggers a navigation on click.\n */\nconst RouterLink = RouterLinkImpl;\nfunction guardEvent(e) {\n // don't redirect with control keys\n if (e.metaKey || e.altKey || e.ctrlKey || e.shiftKey)\n return;\n // don't redirect when preventDefault called\n if (e.defaultPrevented)\n return;\n // don't redirect on right click\n if (e.button !== undefined && e.button !== 0)\n return;\n // don't redirect if `target=\"_blank\"`\n // @ts-expect-error getAttribute does exist\n if (e.currentTarget && e.currentTarget.getAttribute) {\n // @ts-expect-error getAttribute exists\n const target = e.currentTarget.getAttribute('target');\n if (/\\b_blank\\b/i.test(target))\n return;\n }\n // this may be a Weex event which doesn't have this method\n if (e.preventDefault)\n e.preventDefault();\n return true;\n}\nfunction includesParams(outer, inner) {\n for (const key in inner) {\n const innerValue = inner[key];\n const outerValue = outer[key];\n if (typeof innerValue === 'string') {\n if (innerValue !== outerValue)\n return false;\n }\n else {\n if (!isArray(outerValue) ||\n outerValue.length !== innerValue.length ||\n innerValue.some((value, i) => value !== outerValue[i]))\n return false;\n }\n }\n return true;\n}\n/**\n * Get the original path value of a record by following its aliasOf\n * @param record\n */\nfunction getOriginalPath(record) {\n return record ? (record.aliasOf ? record.aliasOf.path : record.path) : '';\n}\n/**\n * Utility class to get the active class based on defaults.\n * @param propClass\n * @param globalClass\n * @param defaultClass\n */\nconst getLinkClass = (propClass, globalClass, defaultClass) => propClass != null\n ? propClass\n : globalClass != null\n ? globalClass\n : defaultClass;\n\nconst RouterViewImpl = /*#__PURE__*/ defineComponent({\n name: 'RouterView',\n // #674 we manually inherit them\n inheritAttrs: false,\n props: {\n name: {\n type: String,\n default: 'default',\n },\n route: Object,\n },\n // Better compat for @vue/compat users\n // https://github.com/vuejs/router/issues/1315\n compatConfig: { MODE: 3 },\n setup(props, { attrs, slots }) {\n (process.env.NODE_ENV !== 'production') && warnDeprecatedUsage();\n const injectedRoute = inject(routerViewLocationKey);\n const routeToDisplay = computed(() => props.route || injectedRoute.value);\n const injectedDepth = inject(viewDepthKey, 0);\n // The depth changes based on empty components option, which allows passthrough routes e.g. routes with children\n // that are used to reuse the `path` property\n const depth = computed(() => {\n let initialDepth = unref(injectedDepth);\n const { matched } = routeToDisplay.value;\n let matchedRoute;\n while ((matchedRoute = matched[initialDepth]) &&\n !matchedRoute.components) {\n initialDepth++;\n }\n return initialDepth;\n });\n const matchedRouteRef = computed(() => routeToDisplay.value.matched[depth.value]);\n provide(viewDepthKey, computed(() => depth.value + 1));\n provide(matchedRouteKey, matchedRouteRef);\n provide(routerViewLocationKey, routeToDisplay);\n const viewRef = ref();\n // watch at the same time the component instance, the route record we are\n // rendering, and the name\n watch(() => [viewRef.value, matchedRouteRef.value, props.name], ([instance, to, name], [oldInstance, from, oldName]) => {\n // copy reused instances\n if (to) {\n // this will update the instance for new instances as well as reused\n // instances when navigating to a new route\n to.instances[name] = instance;\n // the component instance is reused for a different route or name, so\n // we copy any saved update or leave guards. With async setup, the\n // mounting component will mount before the matchedRoute changes,\n // making instance === oldInstance, so we check if guards have been\n // added before. This works because we remove guards when\n // unmounting/deactivating components\n if (from && from !== to && instance && instance === oldInstance) {\n if (!to.leaveGuards.size) {\n to.leaveGuards = from.leaveGuards;\n }\n if (!to.updateGuards.size) {\n to.updateGuards = from.updateGuards;\n }\n }\n }\n // trigger beforeRouteEnter next callbacks\n if (instance &&\n to &&\n // if there is no instance but to and from are the same this might be\n // the first visit\n (!from || !isSameRouteRecord(to, from) || !oldInstance)) {\n (to.enterCallbacks[name] || []).forEach(callback => callback(instance));\n }\n }, { flush: 'post' });\n return () => {\n const route = routeToDisplay.value;\n // we need the value at the time we render because when we unmount, we\n // navigated to a different location so the value is different\n const currentName = props.name;\n const matchedRoute = matchedRouteRef.value;\n const ViewComponent = matchedRoute && matchedRoute.components[currentName];\n if (!ViewComponent) {\n return normalizeSlot(slots.default, { Component: ViewComponent, route });\n }\n // props from route configuration\n const routePropsOption = matchedRoute.props[currentName];\n const routeProps = routePropsOption\n ? routePropsOption === true\n ? route.params\n : typeof routePropsOption === 'function'\n ? routePropsOption(route)\n : routePropsOption\n : null;\n const onVnodeUnmounted = vnode => {\n // remove the instance reference to prevent leak\n if (vnode.component.isUnmounted) {\n matchedRoute.instances[currentName] = null;\n }\n };\n const component = h(ViewComponent, assign({}, routeProps, attrs, {\n onVnodeUnmounted,\n ref: viewRef,\n }));\n if (((process.env.NODE_ENV !== 'production') || __VUE_PROD_DEVTOOLS__) &&\n isBrowser &&\n component.ref) {\n // TODO: can display if it's an alias, its props\n const info = {\n depth: depth.value,\n name: matchedRoute.name,\n path: matchedRoute.path,\n meta: matchedRoute.meta,\n };\n const internalInstances = isArray(component.ref)\n ? component.ref.map(r => r.i)\n : [component.ref.i];\n internalInstances.forEach(instance => {\n // @ts-expect-error\n instance.__vrv_devtools = info;\n });\n }\n return (\n // pass the vnode to the slot as a prop.\n // h and both accept vnodes\n normalizeSlot(slots.default, { Component: component, route }) ||\n component);\n };\n },\n});\nfunction normalizeSlot(slot, data) {\n if (!slot)\n return null;\n const slotContent = slot(data);\n return slotContent.length === 1 ? slotContent[0] : slotContent;\n}\n// export the public type for h/tsx inference\n// also to avoid inline import() in generated d.ts files\n/**\n * Component to display the current route the user is at.\n */\nconst RouterView = RouterViewImpl;\n// warn against deprecated usage with & \n// due to functional component being no longer eager in Vue 3\nfunction warnDeprecatedUsage() {\n const instance = getCurrentInstance();\n const parentName = instance.parent && instance.parent.type.name;\n const parentSubTreeType = instance.parent && instance.parent.subTree && instance.parent.subTree.type;\n if (parentName &&\n (parentName === 'KeepAlive' || parentName.includes('Transition')) &&\n typeof parentSubTreeType === 'object' &&\n parentSubTreeType.name === 'RouterView') {\n const comp = parentName === 'KeepAlive' ? 'keep-alive' : 'transition';\n warn(` can no longer be used directly inside or .\\n` +\n `Use slot props instead:\\n\\n` +\n `\\n` +\n ` <${comp}>\\n` +\n ` \\n` +\n ` \\n` +\n ``);\n }\n}\n\n/**\n * Copies a route location and removes any problematic properties that cannot be shown in devtools (e.g. Vue instances).\n *\n * @param routeLocation - routeLocation to format\n * @param tooltip - optional tooltip\n * @returns a copy of the routeLocation\n */\nfunction formatRouteLocation(routeLocation, tooltip) {\n const copy = assign({}, routeLocation, {\n // remove variables that can contain vue instances\n matched: routeLocation.matched.map(matched => omit(matched, ['instances', 'children', 'aliasOf'])),\n });\n return {\n _custom: {\n type: null,\n readOnly: true,\n display: routeLocation.fullPath,\n tooltip,\n value: copy,\n },\n };\n}\nfunction formatDisplay(display) {\n return {\n _custom: {\n display,\n },\n };\n}\n// to support multiple router instances\nlet routerId = 0;\nfunction addDevtools(app, router, matcher) {\n // Take over router.beforeEach and afterEach\n // make sure we are not registering the devtool twice\n if (router.__hasDevtools)\n return;\n router.__hasDevtools = true;\n // increment to support multiple router instances\n const id = routerId++;\n setupDevtoolsPlugin({\n id: 'org.vuejs.router' + (id ? '.' + id : ''),\n label: 'Vue Router',\n packageName: 'vue-router',\n homepage: 'https://router.vuejs.org',\n logo: 'https://router.vuejs.org/logo.png',\n componentStateTypes: ['Routing'],\n app,\n }, api => {\n if (typeof api.now !== 'function') {\n console.warn('[Vue Router]: You seem to be using an outdated version of Vue Devtools. Are you still using the Beta release instead of the stable one? You can find the links at https://devtools.vuejs.org/guide/installation.html.');\n }\n // display state added by the router\n api.on.inspectComponent((payload, ctx) => {\n if (payload.instanceData) {\n payload.instanceData.state.push({\n type: 'Routing',\n key: '$route',\n editable: false,\n value: formatRouteLocation(router.currentRoute.value, 'Current Route'),\n });\n }\n });\n // mark router-link as active and display tags on router views\n api.on.visitComponentTree(({ treeNode: node, componentInstance }) => {\n if (componentInstance.__vrv_devtools) {\n const info = componentInstance.__vrv_devtools;\n node.tags.push({\n label: (info.name ? `${info.name.toString()}: ` : '') + info.path,\n textColor: 0,\n tooltip: 'This component is rendered by <router-view>',\n backgroundColor: PINK_500,\n });\n }\n // if multiple useLink are used\n if (isArray(componentInstance.__vrl_devtools)) {\n componentInstance.__devtoolsApi = api;\n componentInstance.__vrl_devtools.forEach(devtoolsData => {\n let label = devtoolsData.route.path;\n let backgroundColor = ORANGE_400;\n let tooltip = '';\n let textColor = 0;\n if (devtoolsData.error) {\n label = devtoolsData.error;\n backgroundColor = RED_100;\n textColor = RED_700;\n }\n else if (devtoolsData.isExactActive) {\n backgroundColor = LIME_500;\n tooltip = 'This is exactly active';\n }\n else if (devtoolsData.isActive) {\n backgroundColor = BLUE_600;\n tooltip = 'This link is active';\n }\n node.tags.push({\n label,\n textColor,\n tooltip,\n backgroundColor,\n });\n });\n }\n });\n watch(router.currentRoute, () => {\n // refresh active state\n refreshRoutesView();\n api.notifyComponentUpdate();\n api.sendInspectorTree(routerInspectorId);\n api.sendInspectorState(routerInspectorId);\n });\n const navigationsLayerId = 'router:navigations:' + id;\n api.addTimelineLayer({\n id: navigationsLayerId,\n label: `Router${id ? ' ' + id : ''} Navigations`,\n color: 0x40a8c4,\n });\n // const errorsLayerId = 'router:errors'\n // api.addTimelineLayer({\n // id: errorsLayerId,\n // label: 'Router Errors',\n // color: 0xea5455,\n // })\n router.onError((error, to) => {\n api.addTimelineEvent({\n layerId: navigationsLayerId,\n event: {\n title: 'Error during Navigation',\n subtitle: to.fullPath,\n logType: 'error',\n time: api.now(),\n data: { error },\n groupId: to.meta.__navigationId,\n },\n });\n });\n // attached to `meta` and used to group events\n let navigationId = 0;\n router.beforeEach((to, from) => {\n const data = {\n guard: formatDisplay('beforeEach'),\n from: formatRouteLocation(from, 'Current Location during this navigation'),\n to: formatRouteLocation(to, 'Target location'),\n };\n // Used to group navigations together, hide from devtools\n Object.defineProperty(to.meta, '__navigationId', {\n value: navigationId++,\n });\n api.addTimelineEvent({\n layerId: navigationsLayerId,\n event: {\n time: api.now(),\n title: 'Start of navigation',\n subtitle: to.fullPath,\n data,\n groupId: to.meta.__navigationId,\n },\n });\n });\n router.afterEach((to, from, failure) => {\n const data = {\n guard: formatDisplay('afterEach'),\n };\n if (failure) {\n data.failure = {\n _custom: {\n type: Error,\n readOnly: true,\n display: failure ? failure.message : '',\n tooltip: 'Navigation Failure',\n value: failure,\n },\n };\n data.status = formatDisplay('❌');\n }\n else {\n data.status = formatDisplay('✅');\n }\n // we set here to have the right order\n data.from = formatRouteLocation(from, 'Current Location during this navigation');\n data.to = formatRouteLocation(to, 'Target location');\n api.addTimelineEvent({\n layerId: navigationsLayerId,\n event: {\n title: 'End of navigation',\n subtitle: to.fullPath,\n time: api.now(),\n data,\n logType: failure ? 'warning' : 'default',\n groupId: to.meta.__navigationId,\n },\n });\n });\n /**\n * Inspector of Existing routes\n */\n const routerInspectorId = 'router-inspector:' + id;\n api.addInspector({\n id: routerInspectorId,\n label: 'Routes' + (id ? ' ' + id : ''),\n icon: 'book',\n treeFilterPlaceholder: 'Search routes',\n });\n function refreshRoutesView() {\n // the routes view isn't active\n if (!activeRoutesPayload)\n return;\n const payload = activeRoutesPayload;\n // children routes will appear as nested\n let routes = matcher.getRoutes().filter(route => !route.parent ||\n // these routes have a parent with no component which will not appear in the view\n // therefore we still need to include them\n !route.parent.record.components);\n // reset match state to false\n routes.forEach(resetMatchStateOnRouteRecord);\n // apply a match state if there is a payload\n if (payload.filter) {\n routes = routes.filter(route => \n // save matches state based on the payload\n isRouteMatching(route, payload.filter.toLowerCase()));\n }\n // mark active routes\n routes.forEach(route => markRouteRecordActive(route, router.currentRoute.value));\n payload.rootNodes = routes.map(formatRouteRecordForInspector);\n }\n let activeRoutesPayload;\n api.on.getInspectorTree(payload => {\n activeRoutesPayload = payload;\n if (payload.app === app && payload.inspectorId === routerInspectorId) {\n refreshRoutesView();\n }\n });\n /**\n * Display information about the currently selected route record\n */\n api.on.getInspectorState(payload => {\n if (payload.app === app && payload.inspectorId === routerInspectorId) {\n const routes = matcher.getRoutes();\n const route = routes.find(route => route.record.__vd_id === payload.nodeId);\n if (route) {\n payload.state = {\n options: formatRouteRecordMatcherForStateInspector(route),\n };\n }\n }\n });\n api.sendInspectorTree(routerInspectorId);\n api.sendInspectorState(routerInspectorId);\n });\n}\nfunction modifierForKey(key) {\n if (key.optional) {\n return key.repeatable ? '*' : '?';\n }\n else {\n return key.repeatable ? '+' : '';\n }\n}\nfunction formatRouteRecordMatcherForStateInspector(route) {\n const { record } = route;\n const fields = [\n { editable: false, key: 'path', value: record.path },\n ];\n if (record.name != null) {\n fields.push({\n editable: false,\n key: 'name',\n value: record.name,\n });\n }\n fields.push({ editable: false, key: 'regexp', value: route.re });\n if (route.keys.length) {\n fields.push({\n editable: false,\n key: 'keys',\n value: {\n _custom: {\n type: null,\n readOnly: true,\n display: route.keys\n .map(key => `${key.name}${modifierForKey(key)}`)\n .join(' '),\n tooltip: 'Param keys',\n value: route.keys,\n },\n },\n });\n }\n if (record.redirect != null) {\n fields.push({\n editable: false,\n key: 'redirect',\n value: record.redirect,\n });\n }\n if (route.alias.length) {\n fields.push({\n editable: false,\n key: 'aliases',\n value: route.alias.map(alias => alias.record.path),\n });\n }\n if (Object.keys(route.record.meta).length) {\n fields.push({\n editable: false,\n key: 'meta',\n value: route.record.meta,\n });\n }\n fields.push({\n key: 'score',\n editable: false,\n value: {\n _custom: {\n type: null,\n readOnly: true,\n display: route.score.map(score => score.join(', ')).join(' | '),\n tooltip: 'Score used to sort routes',\n value: route.score,\n },\n },\n });\n return fields;\n}\n/**\n * Extracted from tailwind palette\n */\nconst PINK_500 = 0xec4899;\nconst BLUE_600 = 0x2563eb;\nconst LIME_500 = 0x84cc16;\nconst CYAN_400 = 0x22d3ee;\nconst ORANGE_400 = 0xfb923c;\n// const GRAY_100 = 0xf4f4f5\nconst DARK = 0x666666;\nconst RED_100 = 0xfee2e2;\nconst RED_700 = 0xb91c1c;\nfunction formatRouteRecordForInspector(route) {\n const tags = [];\n const { record } = route;\n if (record.name != null) {\n tags.push({\n label: String(record.name),\n textColor: 0,\n backgroundColor: CYAN_400,\n });\n }\n if (record.aliasOf) {\n tags.push({\n label: 'alias',\n textColor: 0,\n backgroundColor: ORANGE_400,\n });\n }\n if (route.__vd_match) {\n tags.push({\n label: 'matches',\n textColor: 0,\n backgroundColor: PINK_500,\n });\n }\n if (route.__vd_exactActive) {\n tags.push({\n label: 'exact',\n textColor: 0,\n backgroundColor: LIME_500,\n });\n }\n if (route.__vd_active) {\n tags.push({\n label: 'active',\n textColor: 0,\n backgroundColor: BLUE_600,\n });\n }\n if (record.redirect) {\n tags.push({\n label: typeof record.redirect === 'string'\n ? `redirect: ${record.redirect}`\n : 'redirects',\n textColor: 0xffffff,\n backgroundColor: DARK,\n });\n }\n // add an id to be able to select it. Using the `path` is not possible because\n // empty path children would collide with their parents\n let id = record.__vd_id;\n if (id == null) {\n id = String(routeRecordId++);\n record.__vd_id = id;\n }\n return {\n id,\n label: record.path,\n tags,\n children: route.children.map(formatRouteRecordForInspector),\n };\n}\n// incremental id for route records and inspector state\nlet routeRecordId = 0;\nconst EXTRACT_REGEXP_RE = /^\\/(.*)\\/([a-z]*)$/;\nfunction markRouteRecordActive(route, currentRoute) {\n // no route will be active if matched is empty\n // reset the matching state\n const isExactActive = currentRoute.matched.length &&\n isSameRouteRecord(currentRoute.matched[currentRoute.matched.length - 1], route.record);\n route.__vd_exactActive = route.__vd_active = isExactActive;\n if (!isExactActive) {\n route.__vd_active = currentRoute.matched.some(match => isSameRouteRecord(match, route.record));\n }\n route.children.forEach(childRoute => markRouteRecordActive(childRoute, currentRoute));\n}\nfunction resetMatchStateOnRouteRecord(route) {\n route.__vd_match = false;\n route.children.forEach(resetMatchStateOnRouteRecord);\n}\nfunction isRouteMatching(route, filter) {\n const found = String(route.re).match(EXTRACT_REGEXP_RE);\n route.__vd_match = false;\n if (!found || found.length < 3) {\n return false;\n }\n // use a regexp without $ at the end to match nested routes better\n const nonEndingRE = new RegExp(found[1].replace(/\\$$/, ''), found[2]);\n if (nonEndingRE.test(filter)) {\n // mark children as matches\n route.children.forEach(child => isRouteMatching(child, filter));\n // exception case: `/`\n if (route.record.path !== '/' || filter === '/') {\n route.__vd_match = route.re.test(filter);\n return true;\n }\n // hide the / route\n return false;\n }\n const path = route.record.path.toLowerCase();\n const decodedPath = decode(path);\n // also allow partial matching on the path\n if (!filter.startsWith('/') &&\n (decodedPath.includes(filter) || path.includes(filter)))\n return true;\n if (decodedPath.startsWith(filter) || path.startsWith(filter))\n return true;\n if (route.record.name && String(route.record.name).includes(filter))\n return true;\n return route.children.some(child => isRouteMatching(child, filter));\n}\nfunction omit(obj, keys) {\n const ret = {};\n for (const key in obj) {\n if (!keys.includes(key)) {\n // @ts-expect-error\n ret[key] = obj[key];\n }\n }\n return ret;\n}\n\n/**\n * Creates a Router instance that can be used by a Vue app.\n *\n * @param options - {@link RouterOptions}\n */\nfunction createRouter(options) {\n const matcher = createRouterMatcher(options.routes, options);\n const parseQuery$1 = options.parseQuery || parseQuery;\n const stringifyQuery$1 = options.stringifyQuery || stringifyQuery;\n const routerHistory = options.history;\n if ((process.env.NODE_ENV !== 'production') && !routerHistory)\n throw new Error('Provide the \"history\" option when calling \"createRouter()\":' +\n ' https://next.router.vuejs.org/api/#history.');\n const beforeGuards = useCallbacks();\n const beforeResolveGuards = useCallbacks();\n const afterGuards = useCallbacks();\n const currentRoute = shallowRef(START_LOCATION_NORMALIZED);\n let pendingLocation = START_LOCATION_NORMALIZED;\n // leave the scrollRestoration if no scrollBehavior is provided\n if (isBrowser && options.scrollBehavior && 'scrollRestoration' in history) {\n history.scrollRestoration = 'manual';\n }\n const normalizeParams = applyToParams.bind(null, paramValue => '' + paramValue);\n const encodeParams = applyToParams.bind(null, encodeParam);\n const decodeParams = \n // @ts-expect-error: intentionally avoid the type check\n applyToParams.bind(null, decode);\n function addRoute(parentOrRoute, route) {\n let parent;\n let record;\n if (isRouteName(parentOrRoute)) {\n parent = matcher.getRecordMatcher(parentOrRoute);\n if ((process.env.NODE_ENV !== 'production') && !parent) {\n warn(`Parent route \"${String(parentOrRoute)}\" not found when adding child route`, route);\n }\n record = route;\n }\n else {\n record = parentOrRoute;\n }\n return matcher.addRoute(record, parent);\n }\n function removeRoute(name) {\n const recordMatcher = matcher.getRecordMatcher(name);\n if (recordMatcher) {\n matcher.removeRoute(recordMatcher);\n }\n else if ((process.env.NODE_ENV !== 'production')) {\n warn(`Cannot remove non-existent route \"${String(name)}\"`);\n }\n }\n function getRoutes() {\n return matcher.getRoutes().map(routeMatcher => routeMatcher.record);\n }\n function hasRoute(name) {\n return !!matcher.getRecordMatcher(name);\n }\n function resolve(rawLocation, currentLocation) {\n // const resolve: Router['resolve'] = (rawLocation: RouteLocationRaw, currentLocation) => {\n // const objectLocation = routerLocationAsObject(rawLocation)\n // we create a copy to modify it later\n currentLocation = assign({}, currentLocation || currentRoute.value);\n if (typeof rawLocation === 'string') {\n const locationNormalized = parseURL(parseQuery$1, rawLocation, currentLocation.path);\n const matchedRoute = matcher.resolve({ path: locationNormalized.path }, currentLocation);\n const href = routerHistory.createHref(locationNormalized.fullPath);\n if ((process.env.NODE_ENV !== 'production')) {\n if (href.startsWith('//'))\n warn(`Location \"${rawLocation}\" resolved to \"${href}\". A resolved location cannot start with multiple slashes.`);\n else if (!matchedRoute.matched.length) {\n warn(`No match found for location with path \"${rawLocation}\"`);\n }\n }\n // locationNormalized is always a new object\n return assign(locationNormalized, matchedRoute, {\n params: decodeParams(matchedRoute.params),\n hash: decode(locationNormalized.hash),\n redirectedFrom: undefined,\n href,\n });\n }\n if ((process.env.NODE_ENV !== 'production') && !isRouteLocation(rawLocation)) {\n warn(`router.resolve() was passed an invalid location. This will fail in production.\\n- Location:`, rawLocation);\n return resolve({});\n }\n let matcherLocation;\n // path could be relative in object as well\n if (rawLocation.path != null) {\n if ((process.env.NODE_ENV !== 'production') &&\n 'params' in rawLocation &&\n !('name' in rawLocation) &&\n // @ts-expect-error: the type is never\n Object.keys(rawLocation.params).length) {\n warn(`Path \"${rawLocation.path}\" was passed with params but they will be ignored. Use a named route alongside params instead.`);\n }\n matcherLocation = assign({}, rawLocation, {\n path: parseURL(parseQuery$1, rawLocation.path, currentLocation.path).path,\n });\n }\n else {\n // remove any nullish param\n const targetParams = assign({}, rawLocation.params);\n for (const key in targetParams) {\n if (targetParams[key] == null) {\n delete targetParams[key];\n }\n }\n // pass encoded values to the matcher, so it can produce encoded path and fullPath\n matcherLocation = assign({}, rawLocation, {\n params: encodeParams(targetParams),\n });\n // current location params are decoded, we need to encode them in case the\n // matcher merges the params\n currentLocation.params = encodeParams(currentLocation.params);\n }\n const matchedRoute = matcher.resolve(matcherLocation, currentLocation);\n const hash = rawLocation.hash || '';\n if ((process.env.NODE_ENV !== 'production') && hash && !hash.startsWith('#')) {\n warn(`A \\`hash\\` should always start with the character \"#\". Replace \"${hash}\" with \"#${hash}\".`);\n }\n // the matcher might have merged current location params, so\n // we need to run the decoding again\n matchedRoute.params = normalizeParams(decodeParams(matchedRoute.params));\n const fullPath = stringifyURL(stringifyQuery$1, assign({}, rawLocation, {\n hash: encodeHash(hash),\n path: matchedRoute.path,\n }));\n const href = routerHistory.createHref(fullPath);\n if ((process.env.NODE_ENV !== 'production')) {\n if (href.startsWith('//')) {\n warn(`Location \"${rawLocation}\" resolved to \"${href}\". A resolved location cannot start with multiple slashes.`);\n }\n else if (!matchedRoute.matched.length) {\n warn(`No match found for location with path \"${rawLocation.path != null ? rawLocation.path : rawLocation}\"`);\n }\n }\n return assign({\n fullPath,\n // keep the hash encoded so fullPath is effectively path + encodedQuery +\n // hash\n hash,\n query: \n // if the user is using a custom query lib like qs, we might have\n // nested objects, so we keep the query as is, meaning it can contain\n // numbers at `$route.query`, but at the point, the user will have to\n // use their own type anyway.\n // https://github.com/vuejs/router/issues/328#issuecomment-649481567\n stringifyQuery$1 === stringifyQuery\n ? normalizeQuery(rawLocation.query)\n : (rawLocation.query || {}),\n }, matchedRoute, {\n redirectedFrom: undefined,\n href,\n });\n }\n function locationAsObject(to) {\n return typeof to === 'string'\n ? parseURL(parseQuery$1, to, currentRoute.value.path)\n : assign({}, to);\n }\n function checkCanceledNavigation(to, from) {\n if (pendingLocation !== to) {\n return createRouterError(8 /* ErrorTypes.NAVIGATION_CANCELLED */, {\n from,\n to,\n });\n }\n }\n function push(to) {\n return pushWithRedirect(to);\n }\n function replace(to) {\n return push(assign(locationAsObject(to), { replace: true }));\n }\n function handleRedirectRecord(to) {\n const lastMatched = to.matched[to.matched.length - 1];\n if (lastMatched && lastMatched.redirect) {\n const { redirect } = lastMatched;\n let newTargetLocation = typeof redirect === 'function' ? redirect(to) : redirect;\n if (typeof newTargetLocation === 'string') {\n newTargetLocation =\n newTargetLocation.includes('?') || newTargetLocation.includes('#')\n ? (newTargetLocation = locationAsObject(newTargetLocation))\n : // force empty params\n { path: newTargetLocation };\n // @ts-expect-error: force empty params when a string is passed to let\n // the router parse them again\n newTargetLocation.params = {};\n }\n if ((process.env.NODE_ENV !== 'production') &&\n newTargetLocation.path == null &&\n !('name' in newTargetLocation)) {\n warn(`Invalid redirect found:\\n${JSON.stringify(newTargetLocation, null, 2)}\\n when navigating to \"${to.fullPath}\". A redirect must contain a name or path. This will break in production.`);\n throw new Error('Invalid redirect');\n }\n return assign({\n query: to.query,\n hash: to.hash,\n // avoid transferring params if the redirect has a path\n params: newTargetLocation.path != null ? {} : to.params,\n }, newTargetLocation);\n }\n }\n function pushWithRedirect(to, redirectedFrom) {\n const targetLocation = (pendingLocation = resolve(to));\n const from = currentRoute.value;\n const data = to.state;\n const force = to.force;\n // to could be a string where `replace` is a function\n const replace = to.replace === true;\n const shouldRedirect = handleRedirectRecord(targetLocation);\n if (shouldRedirect)\n return pushWithRedirect(assign(locationAsObject(shouldRedirect), {\n state: typeof shouldRedirect === 'object'\n ? assign({}, data, shouldRedirect.state)\n : data,\n force,\n replace,\n }), \n // keep original redirectedFrom if it exists\n redirectedFrom || targetLocation);\n // if it was a redirect we already called `pushWithRedirect` above\n const toLocation = targetLocation;\n toLocation.redirectedFrom = redirectedFrom;\n let failure;\n if (!force && isSameRouteLocation(stringifyQuery$1, from, targetLocation)) {\n failure = createRouterError(16 /* ErrorTypes.NAVIGATION_DUPLICATED */, { to: toLocation, from });\n // trigger scroll to allow scrolling to the same anchor\n handleScroll(from, from, \n // this is a push, the only way for it to be triggered from a\n // history.listen is with a redirect, which makes it become a push\n true, \n // This cannot be the first navigation because the initial location\n // cannot be manually navigated to\n false);\n }\n return (failure ? Promise.resolve(failure) : navigate(toLocation, from))\n .catch((error) => isNavigationFailure(error)\n ? // navigation redirects still mark the router as ready\n isNavigationFailure(error, 2 /* ErrorTypes.NAVIGATION_GUARD_REDIRECT */)\n ? error\n : markAsReady(error) // also returns the error\n : // reject any unknown error\n triggerError(error, toLocation, from))\n .then((failure) => {\n if (failure) {\n if (isNavigationFailure(failure, 2 /* ErrorTypes.NAVIGATION_GUARD_REDIRECT */)) {\n if ((process.env.NODE_ENV !== 'production') &&\n // we are redirecting to the same location we were already at\n isSameRouteLocation(stringifyQuery$1, resolve(failure.to), toLocation) &&\n // and we have done it a couple of times\n redirectedFrom &&\n // @ts-expect-error: added only in dev\n (redirectedFrom._count = redirectedFrom._count\n ? // @ts-expect-error\n redirectedFrom._count + 1\n : 1) > 30) {\n warn(`Detected a possibly infinite redirection in a navigation guard when going from \"${from.fullPath}\" to \"${toLocation.fullPath}\". Aborting to avoid a Stack Overflow.\\n Are you always returning a new location within a navigation guard? That would lead to this error. Only return when redirecting or aborting, that should fix this. This might break in production if not fixed.`);\n return Promise.reject(new Error('Infinite redirect in navigation guard'));\n }\n return pushWithRedirect(\n // keep options\n assign({\n // preserve an existing replacement but allow the redirect to override it\n replace,\n }, locationAsObject(failure.to), {\n state: typeof failure.to === 'object'\n ? assign({}, data, failure.to.state)\n : data,\n force,\n }), \n // preserve the original redirectedFrom if any\n redirectedFrom || toLocation);\n }\n }\n else {\n // if we fail we don't finalize the navigation\n failure = finalizeNavigation(toLocation, from, true, replace, data);\n }\n triggerAfterEach(toLocation, from, failure);\n return failure;\n });\n }\n /**\n * Helper to reject and skip all navigation guards if a new navigation happened\n * @param to\n * @param from\n */\n function checkCanceledNavigationAndReject(to, from) {\n const error = checkCanceledNavigation(to, from);\n return error ? Promise.reject(error) : Promise.resolve();\n }\n function runWithContext(fn) {\n const app = installedApps.values().next().value;\n // support Vue < 3.3\n return app && typeof app.runWithContext === 'function'\n ? app.runWithContext(fn)\n : fn();\n }\n // TODO: refactor the whole before guards by internally using router.beforeEach\n function navigate(to, from) {\n let guards;\n const [leavingRecords, updatingRecords, enteringRecords] = extractChangingRecords(to, from);\n // all components here have been resolved once because we are leaving\n guards = extractComponentsGuards(leavingRecords.reverse(), 'beforeRouteLeave', to, from);\n // leavingRecords is already reversed\n for (const record of leavingRecords) {\n record.leaveGuards.forEach(guard => {\n guards.push(guardToPromiseFn(guard, to, from));\n });\n }\n const canceledNavigationCheck = checkCanceledNavigationAndReject.bind(null, to, from);\n guards.push(canceledNavigationCheck);\n // run the queue of per route beforeRouteLeave guards\n return (runGuardQueue(guards)\n .then(() => {\n // check global guards beforeEach\n guards = [];\n for (const guard of beforeGuards.list()) {\n guards.push(guardToPromiseFn(guard, to, from));\n }\n guards.push(canceledNavigationCheck);\n return runGuardQueue(guards);\n })\n .then(() => {\n // check in components beforeRouteUpdate\n guards = extractComponentsGuards(updatingRecords, 'beforeRouteUpdate', to, from);\n for (const record of updatingRecords) {\n record.updateGuards.forEach(guard => {\n guards.push(guardToPromiseFn(guard, to, from));\n });\n }\n guards.push(canceledNavigationCheck);\n // run the queue of per route beforeEnter guards\n return runGuardQueue(guards);\n })\n .then(() => {\n // check the route beforeEnter\n guards = [];\n for (const record of enteringRecords) {\n // do not trigger beforeEnter on reused views\n if (record.beforeEnter) {\n if (isArray(record.beforeEnter)) {\n for (const beforeEnter of record.beforeEnter)\n guards.push(guardToPromiseFn(beforeEnter, to, from));\n }\n else {\n guards.push(guardToPromiseFn(record.beforeEnter, to, from));\n }\n }\n }\n guards.push(canceledNavigationCheck);\n // run the queue of per route beforeEnter guards\n return runGuardQueue(guards);\n })\n .then(() => {\n // NOTE: at this point to.matched is normalized and does not contain any () => Promise\n // clear existing enterCallbacks, these are added by extractComponentsGuards\n to.matched.forEach(record => (record.enterCallbacks = {}));\n // check in-component beforeRouteEnter\n guards = extractComponentsGuards(enteringRecords, 'beforeRouteEnter', to, from, runWithContext);\n guards.push(canceledNavigationCheck);\n // run the queue of per route beforeEnter guards\n return runGuardQueue(guards);\n })\n .then(() => {\n // check global guards beforeResolve\n guards = [];\n for (const guard of beforeResolveGuards.list()) {\n guards.push(guardToPromiseFn(guard, to, from));\n }\n guards.push(canceledNavigationCheck);\n return runGuardQueue(guards);\n })\n // catch any navigation canceled\n .catch(err => isNavigationFailure(err, 8 /* ErrorTypes.NAVIGATION_CANCELLED */)\n ? err\n : Promise.reject(err)));\n }\n function triggerAfterEach(to, from, failure) {\n // navigation is confirmed, call afterGuards\n // TODO: wrap with error handlers\n afterGuards\n .list()\n .forEach(guard => runWithContext(() => guard(to, from, failure)));\n }\n /**\n * - Cleans up any navigation guards\n * - Changes the url if necessary\n * - Calls the scrollBehavior\n */\n function finalizeNavigation(toLocation, from, isPush, replace, data) {\n // a more recent navigation took place\n const error = checkCanceledNavigation(toLocation, from);\n if (error)\n return error;\n // only consider as push if it's not the first navigation\n const isFirstNavigation = from === START_LOCATION_NORMALIZED;\n const state = !isBrowser ? {} : history.state;\n // change URL only if the user did a push/replace and if it's not the initial navigation because\n // it's just reflecting the url\n if (isPush) {\n // on the initial navigation, we want to reuse the scroll position from\n // history state if it exists\n if (replace || isFirstNavigation)\n routerHistory.replace(toLocation.fullPath, assign({\n scroll: isFirstNavigation && state && state.scroll,\n }, data));\n else\n routerHistory.push(toLocation.fullPath, data);\n }\n // accept current navigation\n currentRoute.value = toLocation;\n handleScroll(toLocation, from, isPush, isFirstNavigation);\n markAsReady();\n }\n let removeHistoryListener;\n // attach listener to history to trigger navigations\n function setupListeners() {\n // avoid setting up listeners twice due to an invalid first navigation\n if (removeHistoryListener)\n return;\n removeHistoryListener = routerHistory.listen((to, _from, info) => {\n if (!router.listening)\n return;\n // cannot be a redirect route because it was in history\n const toLocation = resolve(to);\n // due to dynamic routing, and to hash history with manual navigation\n // (manually changing the url or calling history.hash = '#/somewhere'),\n // there could be a redirect record in history\n const shouldRedirect = handleRedirectRecord(toLocation);\n if (shouldRedirect) {\n pushWithRedirect(assign(shouldRedirect, { replace: true }), toLocation).catch(noop);\n return;\n }\n pendingLocation = toLocation;\n const from = currentRoute.value;\n // TODO: should be moved to web history?\n if (isBrowser) {\n saveScrollPosition(getScrollKey(from.fullPath, info.delta), computeScrollPosition());\n }\n navigate(toLocation, from)\n .catch((error) => {\n if (isNavigationFailure(error, 4 /* ErrorTypes.NAVIGATION_ABORTED */ | 8 /* ErrorTypes.NAVIGATION_CANCELLED */)) {\n return error;\n }\n if (isNavigationFailure(error, 2 /* ErrorTypes.NAVIGATION_GUARD_REDIRECT */)) {\n // Here we could call if (info.delta) routerHistory.go(-info.delta,\n // false) but this is bug prone as we have no way to wait the\n // navigation to be finished before calling pushWithRedirect. Using\n // a setTimeout of 16ms seems to work but there is no guarantee for\n // it to work on every browser. So instead we do not restore the\n // history entry and trigger a new navigation as requested by the\n // navigation guard.\n // the error is already handled by router.push we just want to avoid\n // logging the error\n pushWithRedirect(error.to, toLocation\n // avoid an uncaught rejection, let push call triggerError\n )\n .then(failure => {\n // manual change in hash history #916 ending up in the URL not\n // changing, but it was changed by the manual url change, so we\n // need to manually change it ourselves\n if (isNavigationFailure(failure, 4 /* ErrorTypes.NAVIGATION_ABORTED */ |\n 16 /* ErrorTypes.NAVIGATION_DUPLICATED */) &&\n !info.delta &&\n info.type === NavigationType.pop) {\n routerHistory.go(-1, false);\n }\n })\n .catch(noop);\n // avoid the then branch\n return Promise.reject();\n }\n // do not restore history on unknown direction\n if (info.delta) {\n routerHistory.go(-info.delta, false);\n }\n // unrecognized error, transfer to the global handler\n return triggerError(error, toLocation, from);\n })\n .then((failure) => {\n failure =\n failure ||\n finalizeNavigation(\n // after navigation, all matched components are resolved\n toLocation, from, false);\n // revert the navigation\n if (failure) {\n if (info.delta &&\n // a new navigation has been triggered, so we do not want to revert, that will change the current history\n // entry while a different route is displayed\n !isNavigationFailure(failure, 8 /* ErrorTypes.NAVIGATION_CANCELLED */)) {\n routerHistory.go(-info.delta, false);\n }\n else if (info.type === NavigationType.pop &&\n isNavigationFailure(failure, 4 /* ErrorTypes.NAVIGATION_ABORTED */ | 16 /* ErrorTypes.NAVIGATION_DUPLICATED */)) {\n // manual change in hash history #916\n // it's like a push but lacks the information of the direction\n routerHistory.go(-1, false);\n }\n }\n triggerAfterEach(toLocation, from, failure);\n })\n // avoid warnings in the console about uncaught rejections, they are logged by triggerErrors\n .catch(noop);\n });\n }\n // Initialization and Errors\n let readyHandlers = useCallbacks();\n let errorListeners = useCallbacks();\n let ready;\n /**\n * Trigger errorListeners added via onError and throws the error as well\n *\n * @param error - error to throw\n * @param to - location we were navigating to when the error happened\n * @param from - location we were navigating from when the error happened\n * @returns the error as a rejected promise\n */\n function triggerError(error, to, from) {\n markAsReady(error);\n const list = errorListeners.list();\n if (list.length) {\n list.forEach(handler => handler(error, to, from));\n }\n else {\n if ((process.env.NODE_ENV !== 'production')) {\n warn('uncaught error during route navigation:');\n }\n console.error(error);\n }\n // reject the error no matter there were error listeners or not\n return Promise.reject(error);\n }\n function isReady() {\n if (ready && currentRoute.value !== START_LOCATION_NORMALIZED)\n return Promise.resolve();\n return new Promise((resolve, reject) => {\n readyHandlers.add([resolve, reject]);\n });\n }\n function markAsReady(err) {\n if (!ready) {\n // still not ready if an error happened\n ready = !err;\n setupListeners();\n readyHandlers\n .list()\n .forEach(([resolve, reject]) => (err ? reject(err) : resolve()));\n readyHandlers.reset();\n }\n return err;\n }\n // Scroll behavior\n function handleScroll(to, from, isPush, isFirstNavigation) {\n const { scrollBehavior } = options;\n if (!isBrowser || !scrollBehavior)\n return Promise.resolve();\n const scrollPosition = (!isPush && getSavedScrollPosition(getScrollKey(to.fullPath, 0))) ||\n ((isFirstNavigation || !isPush) &&\n history.state &&\n history.state.scroll) ||\n null;\n return nextTick()\n .then(() => scrollBehavior(to, from, scrollPosition))\n .then(position => position && scrollToPosition(position))\n .catch(err => triggerError(err, to, from));\n }\n const go = (delta) => routerHistory.go(delta);\n let started;\n const installedApps = new Set();\n const router = {\n currentRoute,\n listening: true,\n addRoute,\n removeRoute,\n clearRoutes: matcher.clearRoutes,\n hasRoute,\n getRoutes,\n resolve,\n options,\n push,\n replace,\n go,\n back: () => go(-1),\n forward: () => go(1),\n beforeEach: beforeGuards.add,\n beforeResolve: beforeResolveGuards.add,\n afterEach: afterGuards.add,\n onError: errorListeners.add,\n isReady,\n install(app) {\n const router = this;\n app.component('RouterLink', RouterLink);\n app.component('RouterView', RouterView);\n app.config.globalProperties.$router = router;\n Object.defineProperty(app.config.globalProperties, '$route', {\n enumerable: true,\n get: () => unref(currentRoute),\n });\n // this initial navigation is only necessary on client, on server it doesn't\n // make sense because it will create an extra unnecessary navigation and could\n // lead to problems\n if (isBrowser &&\n // used for the initial navigation client side to avoid pushing\n // multiple times when the router is used in multiple apps\n !started &&\n currentRoute.value === START_LOCATION_NORMALIZED) {\n // see above\n started = true;\n push(routerHistory.location).catch(err => {\n if ((process.env.NODE_ENV !== 'production'))\n warn('Unexpected error when starting the router:', err);\n });\n }\n const reactiveRoute = {};\n for (const key in START_LOCATION_NORMALIZED) {\n Object.defineProperty(reactiveRoute, key, {\n get: () => currentRoute.value[key],\n enumerable: true,\n });\n }\n app.provide(routerKey, router);\n app.provide(routeLocationKey, shallowReactive(reactiveRoute));\n app.provide(routerViewLocationKey, currentRoute);\n const unmountApp = app.unmount;\n installedApps.add(app);\n app.unmount = function () {\n installedApps.delete(app);\n // the router is not attached to an app anymore\n if (installedApps.size < 1) {\n // invalidate the current navigation\n pendingLocation = START_LOCATION_NORMALIZED;\n removeHistoryListener && removeHistoryListener();\n removeHistoryListener = null;\n currentRoute.value = START_LOCATION_NORMALIZED;\n started = false;\n ready = false;\n }\n unmountApp();\n };\n // TODO: this probably needs to be updated so it can be used by vue-termui\n if (((process.env.NODE_ENV !== 'production') || __VUE_PROD_DEVTOOLS__) && isBrowser) {\n addDevtools(app, router, matcher);\n }\n },\n };\n // TODO: type this as NavigationGuardReturn or similar instead of any\n function runGuardQueue(guards) {\n return guards.reduce((promise, guard) => promise.then(() => runWithContext(guard)), Promise.resolve());\n }\n return router;\n}\nfunction extractChangingRecords(to, from) {\n const leavingRecords = [];\n const updatingRecords = [];\n const enteringRecords = [];\n const len = Math.max(from.matched.length, to.matched.length);\n for (let i = 0; i < len; i++) {\n const recordFrom = from.matched[i];\n if (recordFrom) {\n if (to.matched.find(record => isSameRouteRecord(record, recordFrom)))\n updatingRecords.push(recordFrom);\n else\n leavingRecords.push(recordFrom);\n }\n const recordTo = to.matched[i];\n if (recordTo) {\n // the type doesn't matter because we are comparing per reference\n if (!from.matched.find(record => isSameRouteRecord(record, recordTo))) {\n enteringRecords.push(recordTo);\n }\n }\n }\n return [leavingRecords, updatingRecords, enteringRecords];\n}\n\n/**\n * Returns the router instance. Equivalent to using `$router` inside\n * templates.\n */\nfunction useRouter() {\n return inject(routerKey);\n}\n/**\n * Returns the current route location. Equivalent to using `$route` inside\n * templates.\n */\nfunction useRoute(_name) {\n return inject(routeLocationKey);\n}\n\nexport { NavigationFailureType, RouterLink, RouterView, START_LOCATION_NORMALIZED as START_LOCATION, createMemoryHistory, createRouter, createRouterMatcher, createWebHashHistory, createWebHistory, isNavigationFailure, loadRouteLocation, matchedRouteKey, onBeforeRouteLeave, onBeforeRouteUpdate, parseQuery, routeLocationKey, routerKey, routerViewLocationKey, stringifyQuery, useLink, useRoute, useRouter, viewDepthKey };\n","//! moment.js\n//! version : 2.30.1\n//! authors : Tim Wood, Iskren Chernev, Moment.js contributors\n//! license : MIT\n//! momentjs.com\n\nvar hookCallback;\n\nfunction hooks() {\n return hookCallback.apply(null, arguments);\n}\n\n// This is done to register the method called with moment()\n// without creating circular dependencies.\nfunction setHookCallback(callback) {\n hookCallback = callback;\n}\n\nfunction isArray(input) {\n return (\n input instanceof Array ||\n Object.prototype.toString.call(input) === '[object Array]'\n );\n}\n\nfunction isObject(input) {\n // IE8 will treat undefined and null as object if it wasn't for\n // input != null\n return (\n input != null &&\n Object.prototype.toString.call(input) === '[object Object]'\n );\n}\n\nfunction hasOwnProp(a, b) {\n return Object.prototype.hasOwnProperty.call(a, b);\n}\n\nfunction isObjectEmpty(obj) {\n if (Object.getOwnPropertyNames) {\n return Object.getOwnPropertyNames(obj).length === 0;\n } else {\n var k;\n for (k in obj) {\n if (hasOwnProp(obj, k)) {\n return false;\n }\n }\n return true;\n }\n}\n\nfunction isUndefined(input) {\n return input === void 0;\n}\n\nfunction isNumber(input) {\n return (\n typeof input === 'number' ||\n Object.prototype.toString.call(input) === '[object Number]'\n );\n}\n\nfunction isDate(input) {\n return (\n input instanceof Date ||\n Object.prototype.toString.call(input) === '[object Date]'\n );\n}\n\nfunction map(arr, fn) {\n var res = [],\n i,\n arrLen = arr.length;\n for (i = 0; i < arrLen; ++i) {\n res.push(fn(arr[i], i));\n }\n return res;\n}\n\nfunction extend(a, b) {\n for (var i in b) {\n if (hasOwnProp(b, i)) {\n a[i] = b[i];\n }\n }\n\n if (hasOwnProp(b, 'toString')) {\n a.toString = b.toString;\n }\n\n if (hasOwnProp(b, 'valueOf')) {\n a.valueOf = b.valueOf;\n }\n\n return a;\n}\n\nfunction createUTC(input, format, locale, strict) {\n return createLocalOrUTC(input, format, locale, strict, true).utc();\n}\n\nfunction defaultParsingFlags() {\n // We need to deep clone this object.\n return {\n empty: false,\n unusedTokens: [],\n unusedInput: [],\n overflow: -2,\n charsLeftOver: 0,\n nullInput: false,\n invalidEra: null,\n invalidMonth: null,\n invalidFormat: false,\n userInvalidated: false,\n iso: false,\n parsedDateParts: [],\n era: null,\n meridiem: null,\n rfc2822: false,\n weekdayMismatch: false,\n };\n}\n\nfunction getParsingFlags(m) {\n if (m._pf == null) {\n m._pf = defaultParsingFlags();\n }\n return m._pf;\n}\n\nvar some;\nif (Array.prototype.some) {\n some = Array.prototype.some;\n} else {\n some = function (fun) {\n var t = Object(this),\n len = t.length >>> 0,\n i;\n\n for (i = 0; i < len; i++) {\n if (i in t && fun.call(this, t[i], i, t)) {\n return true;\n }\n }\n\n return false;\n };\n}\n\nfunction isValid(m) {\n var flags = null,\n parsedParts = false,\n isNowValid = m._d && !isNaN(m._d.getTime());\n if (isNowValid) {\n flags = getParsingFlags(m);\n parsedParts = some.call(flags.parsedDateParts, function (i) {\n return i != null;\n });\n isNowValid =\n flags.overflow < 0 &&\n !flags.empty &&\n !flags.invalidEra &&\n !flags.invalidMonth &&\n !flags.invalidWeekday &&\n !flags.weekdayMismatch &&\n !flags.nullInput &&\n !flags.invalidFormat &&\n !flags.userInvalidated &&\n (!flags.meridiem || (flags.meridiem && parsedParts));\n if (m._strict) {\n isNowValid =\n isNowValid &&\n flags.charsLeftOver === 0 &&\n flags.unusedTokens.length === 0 &&\n flags.bigHour === undefined;\n }\n }\n if (Object.isFrozen == null || !Object.isFrozen(m)) {\n m._isValid = isNowValid;\n } else {\n return isNowValid;\n }\n return m._isValid;\n}\n\nfunction createInvalid(flags) {\n var m = createUTC(NaN);\n if (flags != null) {\n extend(getParsingFlags(m), flags);\n } else {\n getParsingFlags(m).userInvalidated = true;\n }\n\n return m;\n}\n\n// Plugins that add properties should also add the key here (null value),\n// so we can properly clone ourselves.\nvar momentProperties = (hooks.momentProperties = []),\n updateInProgress = false;\n\nfunction copyConfig(to, from) {\n var i,\n prop,\n val,\n momentPropertiesLen = momentProperties.length;\n\n if (!isUndefined(from._isAMomentObject)) {\n to._isAMomentObject = from._isAMomentObject;\n }\n if (!isUndefined(from._i)) {\n to._i = from._i;\n }\n if (!isUndefined(from._f)) {\n to._f = from._f;\n }\n if (!isUndefined(from._l)) {\n to._l = from._l;\n }\n if (!isUndefined(from._strict)) {\n to._strict = from._strict;\n }\n if (!isUndefined(from._tzm)) {\n to._tzm = from._tzm;\n }\n if (!isUndefined(from._isUTC)) {\n to._isUTC = from._isUTC;\n }\n if (!isUndefined(from._offset)) {\n to._offset = from._offset;\n }\n if (!isUndefined(from._pf)) {\n to._pf = getParsingFlags(from);\n }\n if (!isUndefined(from._locale)) {\n to._locale = from._locale;\n }\n\n if (momentPropertiesLen > 0) {\n for (i = 0; i < momentPropertiesLen; i++) {\n prop = momentProperties[i];\n val = from[prop];\n if (!isUndefined(val)) {\n to[prop] = val;\n }\n }\n }\n\n return to;\n}\n\n// Moment prototype object\nfunction Moment(config) {\n copyConfig(this, config);\n this._d = new Date(config._d != null ? config._d.getTime() : NaN);\n if (!this.isValid()) {\n this._d = new Date(NaN);\n }\n // Prevent infinite loop in case updateOffset creates new moment\n // objects.\n if (updateInProgress === false) {\n updateInProgress = true;\n hooks.updateOffset(this);\n updateInProgress = false;\n }\n}\n\nfunction isMoment(obj) {\n return (\n obj instanceof Moment || (obj != null && obj._isAMomentObject != null)\n );\n}\n\nfunction warn(msg) {\n if (\n hooks.suppressDeprecationWarnings === false &&\n typeof console !== 'undefined' &&\n console.warn\n ) {\n console.warn('Deprecation warning: ' + msg);\n }\n}\n\nfunction deprecate(msg, fn) {\n var firstTime = true;\n\n return extend(function () {\n if (hooks.deprecationHandler != null) {\n hooks.deprecationHandler(null, msg);\n }\n if (firstTime) {\n var args = [],\n arg,\n i,\n key,\n argLen = arguments.length;\n for (i = 0; i < argLen; i++) {\n arg = '';\n if (typeof arguments[i] === 'object') {\n arg += '\\n[' + i + '] ';\n for (key in arguments[0]) {\n if (hasOwnProp(arguments[0], key)) {\n arg += key + ': ' + arguments[0][key] + ', ';\n }\n }\n arg = arg.slice(0, -2); // Remove trailing comma and space\n } else {\n arg = arguments[i];\n }\n args.push(arg);\n }\n warn(\n msg +\n '\\nArguments: ' +\n Array.prototype.slice.call(args).join('') +\n '\\n' +\n new Error().stack\n );\n firstTime = false;\n }\n return fn.apply(this, arguments);\n }, fn);\n}\n\nvar deprecations = {};\n\nfunction deprecateSimple(name, msg) {\n if (hooks.deprecationHandler != null) {\n hooks.deprecationHandler(name, msg);\n }\n if (!deprecations[name]) {\n warn(msg);\n deprecations[name] = true;\n }\n}\n\nhooks.suppressDeprecationWarnings = false;\nhooks.deprecationHandler = null;\n\nfunction isFunction(input) {\n return (\n (typeof Function !== 'undefined' && input instanceof Function) ||\n Object.prototype.toString.call(input) === '[object Function]'\n );\n}\n\nfunction set(config) {\n var prop, i;\n for (i in config) {\n if (hasOwnProp(config, i)) {\n prop = config[i];\n if (isFunction(prop)) {\n this[i] = prop;\n } else {\n this['_' + i] = prop;\n }\n }\n }\n this._config = config;\n // Lenient ordinal parsing accepts just a number in addition to\n // number + (possibly) stuff coming from _dayOfMonthOrdinalParse.\n // TODO: Remove \"ordinalParse\" fallback in next major release.\n this._dayOfMonthOrdinalParseLenient = new RegExp(\n (this._dayOfMonthOrdinalParse.source || this._ordinalParse.source) +\n '|' +\n /\\d{1,2}/.source\n );\n}\n\nfunction mergeConfigs(parentConfig, childConfig) {\n var res = extend({}, parentConfig),\n prop;\n for (prop in childConfig) {\n if (hasOwnProp(childConfig, prop)) {\n if (isObject(parentConfig[prop]) && isObject(childConfig[prop])) {\n res[prop] = {};\n extend(res[prop], parentConfig[prop]);\n extend(res[prop], childConfig[prop]);\n } else if (childConfig[prop] != null) {\n res[prop] = childConfig[prop];\n } else {\n delete res[prop];\n }\n }\n }\n for (prop in parentConfig) {\n if (\n hasOwnProp(parentConfig, prop) &&\n !hasOwnProp(childConfig, prop) &&\n isObject(parentConfig[prop])\n ) {\n // make sure changes to properties don't modify parent config\n res[prop] = extend({}, res[prop]);\n }\n }\n return res;\n}\n\nfunction Locale(config) {\n if (config != null) {\n this.set(config);\n }\n}\n\nvar keys;\n\nif (Object.keys) {\n keys = Object.keys;\n} else {\n keys = function (obj) {\n var i,\n res = [];\n for (i in obj) {\n if (hasOwnProp(obj, i)) {\n res.push(i);\n }\n }\n return res;\n };\n}\n\nvar defaultCalendar = {\n sameDay: '[Today at] LT',\n nextDay: '[Tomorrow at] LT',\n nextWeek: 'dddd [at] LT',\n lastDay: '[Yesterday at] LT',\n lastWeek: '[Last] dddd [at] LT',\n sameElse: 'L',\n};\n\nfunction calendar(key, mom, now) {\n var output = this._calendar[key] || this._calendar['sameElse'];\n return isFunction(output) ? output.call(mom, now) : output;\n}\n\nfunction zeroFill(number, targetLength, forceSign) {\n var absNumber = '' + Math.abs(number),\n zerosToFill = targetLength - absNumber.length,\n sign = number >= 0;\n return (\n (sign ? (forceSign ? '+' : '') : '-') +\n Math.pow(10, Math.max(0, zerosToFill)).toString().substr(1) +\n absNumber\n );\n}\n\nvar formattingTokens =\n /(\\[[^\\[]*\\])|(\\\\)?([Hh]mm(ss)?|Mo|MM?M?M?|Do|DDDo|DD?D?D?|ddd?d?|do?|w[o|w]?|W[o|W]?|Qo?|N{1,5}|YYYYYY|YYYYY|YYYY|YY|y{2,4}|yo?|gg(ggg?)?|GG(GGG?)?|e|E|a|A|hh?|HH?|kk?|mm?|ss?|S{1,9}|x|X|zz?|ZZ?|.)/g,\n localFormattingTokens = /(\\[[^\\[]*\\])|(\\\\)?(LTS|LT|LL?L?L?|l{1,4})/g,\n formatFunctions = {},\n formatTokenFunctions = {};\n\n// token: 'M'\n// padded: ['MM', 2]\n// ordinal: 'Mo'\n// callback: function () { this.month() + 1 }\nfunction addFormatToken(token, padded, ordinal, callback) {\n var func = callback;\n if (typeof callback === 'string') {\n func = function () {\n return this[callback]();\n };\n }\n if (token) {\n formatTokenFunctions[token] = func;\n }\n if (padded) {\n formatTokenFunctions[padded[0]] = function () {\n return zeroFill(func.apply(this, arguments), padded[1], padded[2]);\n };\n }\n if (ordinal) {\n formatTokenFunctions[ordinal] = function () {\n return this.localeData().ordinal(\n func.apply(this, arguments),\n token\n );\n };\n }\n}\n\nfunction removeFormattingTokens(input) {\n if (input.match(/\\[[\\s\\S]/)) {\n return input.replace(/^\\[|\\]$/g, '');\n }\n return input.replace(/\\\\/g, '');\n}\n\nfunction makeFormatFunction(format) {\n var array = format.match(formattingTokens),\n i,\n length;\n\n for (i = 0, length = array.length; i < length; i++) {\n if (formatTokenFunctions[array[i]]) {\n array[i] = formatTokenFunctions[array[i]];\n } else {\n array[i] = removeFormattingTokens(array[i]);\n }\n }\n\n return function (mom) {\n var output = '',\n i;\n for (i = 0; i < length; i++) {\n output += isFunction(array[i])\n ? array[i].call(mom, format)\n : array[i];\n }\n return output;\n };\n}\n\n// format date using native date object\nfunction formatMoment(m, format) {\n if (!m.isValid()) {\n return m.localeData().invalidDate();\n }\n\n format = expandFormat(format, m.localeData());\n formatFunctions[format] =\n formatFunctions[format] || makeFormatFunction(format);\n\n return formatFunctions[format](m);\n}\n\nfunction expandFormat(format, locale) {\n var i = 5;\n\n function replaceLongDateFormatTokens(input) {\n return locale.longDateFormat(input) || input;\n }\n\n localFormattingTokens.lastIndex = 0;\n while (i >= 0 && localFormattingTokens.test(format)) {\n format = format.replace(\n localFormattingTokens,\n replaceLongDateFormatTokens\n );\n localFormattingTokens.lastIndex = 0;\n i -= 1;\n }\n\n return format;\n}\n\nvar defaultLongDateFormat = {\n LTS: 'h:mm:ss A',\n LT: 'h:mm A',\n L: 'MM/DD/YYYY',\n LL: 'MMMM D, YYYY',\n LLL: 'MMMM D, YYYY h:mm A',\n LLLL: 'dddd, MMMM D, YYYY h:mm A',\n};\n\nfunction longDateFormat(key) {\n var format = this._longDateFormat[key],\n formatUpper = this._longDateFormat[key.toUpperCase()];\n\n if (format || !formatUpper) {\n return format;\n }\n\n this._longDateFormat[key] = formatUpper\n .match(formattingTokens)\n .map(function (tok) {\n if (\n tok === 'MMMM' ||\n tok === 'MM' ||\n tok === 'DD' ||\n tok === 'dddd'\n ) {\n return tok.slice(1);\n }\n return tok;\n })\n .join('');\n\n return this._longDateFormat[key];\n}\n\nvar defaultInvalidDate = 'Invalid date';\n\nfunction invalidDate() {\n return this._invalidDate;\n}\n\nvar defaultOrdinal = '%d',\n defaultDayOfMonthOrdinalParse = /\\d{1,2}/;\n\nfunction ordinal(number) {\n return this._ordinal.replace('%d', number);\n}\n\nvar defaultRelativeTime = {\n future: 'in %s',\n past: '%s ago',\n s: 'a few seconds',\n ss: '%d seconds',\n m: 'a minute',\n mm: '%d minutes',\n h: 'an hour',\n hh: '%d hours',\n d: 'a day',\n dd: '%d days',\n w: 'a week',\n ww: '%d weeks',\n M: 'a month',\n MM: '%d months',\n y: 'a year',\n yy: '%d years',\n};\n\nfunction relativeTime(number, withoutSuffix, string, isFuture) {\n var output = this._relativeTime[string];\n return isFunction(output)\n ? output(number, withoutSuffix, string, isFuture)\n : output.replace(/%d/i, number);\n}\n\nfunction pastFuture(diff, output) {\n var format = this._relativeTime[diff > 0 ? 'future' : 'past'];\n return isFunction(format) ? format(output) : format.replace(/%s/i, output);\n}\n\nvar aliases = {\n D: 'date',\n dates: 'date',\n date: 'date',\n d: 'day',\n days: 'day',\n day: 'day',\n e: 'weekday',\n weekdays: 'weekday',\n weekday: 'weekday',\n E: 'isoWeekday',\n isoweekdays: 'isoWeekday',\n isoweekday: 'isoWeekday',\n DDD: 'dayOfYear',\n dayofyears: 'dayOfYear',\n dayofyear: 'dayOfYear',\n h: 'hour',\n hours: 'hour',\n hour: 'hour',\n ms: 'millisecond',\n milliseconds: 'millisecond',\n millisecond: 'millisecond',\n m: 'minute',\n minutes: 'minute',\n minute: 'minute',\n M: 'month',\n months: 'month',\n month: 'month',\n Q: 'quarter',\n quarters: 'quarter',\n quarter: 'quarter',\n s: 'second',\n seconds: 'second',\n second: 'second',\n gg: 'weekYear',\n weekyears: 'weekYear',\n weekyear: 'weekYear',\n GG: 'isoWeekYear',\n isoweekyears: 'isoWeekYear',\n isoweekyear: 'isoWeekYear',\n w: 'week',\n weeks: 'week',\n week: 'week',\n W: 'isoWeek',\n isoweeks: 'isoWeek',\n isoweek: 'isoWeek',\n y: 'year',\n years: 'year',\n year: 'year',\n};\n\nfunction normalizeUnits(units) {\n return typeof units === 'string'\n ? aliases[units] || aliases[units.toLowerCase()]\n : undefined;\n}\n\nfunction normalizeObjectUnits(inputObject) {\n var normalizedInput = {},\n normalizedProp,\n prop;\n\n for (prop in inputObject) {\n if (hasOwnProp(inputObject, prop)) {\n normalizedProp = normalizeUnits(prop);\n if (normalizedProp) {\n normalizedInput[normalizedProp] = inputObject[prop];\n }\n }\n }\n\n return normalizedInput;\n}\n\nvar priorities = {\n date: 9,\n day: 11,\n weekday: 11,\n isoWeekday: 11,\n dayOfYear: 4,\n hour: 13,\n millisecond: 16,\n minute: 14,\n month: 8,\n quarter: 7,\n second: 15,\n weekYear: 1,\n isoWeekYear: 1,\n week: 5,\n isoWeek: 5,\n year: 1,\n};\n\nfunction getPrioritizedUnits(unitsObj) {\n var units = [],\n u;\n for (u in unitsObj) {\n if (hasOwnProp(unitsObj, u)) {\n units.push({ unit: u, priority: priorities[u] });\n }\n }\n units.sort(function (a, b) {\n return a.priority - b.priority;\n });\n return units;\n}\n\nvar match1 = /\\d/, // 0 - 9\n match2 = /\\d\\d/, // 00 - 99\n match3 = /\\d{3}/, // 000 - 999\n match4 = /\\d{4}/, // 0000 - 9999\n match6 = /[+-]?\\d{6}/, // -999999 - 999999\n match1to2 = /\\d\\d?/, // 0 - 99\n match3to4 = /\\d\\d\\d\\d?/, // 999 - 9999\n match5to6 = /\\d\\d\\d\\d\\d\\d?/, // 99999 - 999999\n match1to3 = /\\d{1,3}/, // 0 - 999\n match1to4 = /\\d{1,4}/, // 0 - 9999\n match1to6 = /[+-]?\\d{1,6}/, // -999999 - 999999\n matchUnsigned = /\\d+/, // 0 - inf\n matchSigned = /[+-]?\\d+/, // -inf - inf\n matchOffset = /Z|[+-]\\d\\d:?\\d\\d/gi, // +00:00 -00:00 +0000 -0000 or Z\n matchShortOffset = /Z|[+-]\\d\\d(?::?\\d\\d)?/gi, // +00 -00 +00:00 -00:00 +0000 -0000 or Z\n matchTimestamp = /[+-]?\\d+(\\.\\d{1,3})?/, // 123456789 123456789.123\n // any word (or two) characters or numbers including two/three word month in arabic.\n // includes scottish gaelic two word and hyphenated months\n matchWord =\n /[0-9]{0,256}['a-z\\u00A0-\\u05FF\\u0700-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFF07\\uFF10-\\uFFEF]{1,256}|[\\u0600-\\u06FF\\/]{1,256}(\\s*?[\\u0600-\\u06FF]{1,256}){1,2}/i,\n match1to2NoLeadingZero = /^[1-9]\\d?/, // 1-99\n match1to2HasZero = /^([1-9]\\d|\\d)/, // 0-99\n regexes;\n\nregexes = {};\n\nfunction addRegexToken(token, regex, strictRegex) {\n regexes[token] = isFunction(regex)\n ? regex\n : function (isStrict, localeData) {\n return isStrict && strictRegex ? strictRegex : regex;\n };\n}\n\nfunction getParseRegexForToken(token, config) {\n if (!hasOwnProp(regexes, token)) {\n return new RegExp(unescapeFormat(token));\n }\n\n return regexes[token](config._strict, config._locale);\n}\n\n// Code from http://stackoverflow.com/questions/3561493/is-there-a-regexp-escape-function-in-javascript\nfunction unescapeFormat(s) {\n return regexEscape(\n s\n .replace('\\\\', '')\n .replace(\n /\\\\(\\[)|\\\\(\\])|\\[([^\\]\\[]*)\\]|\\\\(.)/g,\n function (matched, p1, p2, p3, p4) {\n return p1 || p2 || p3 || p4;\n }\n )\n );\n}\n\nfunction regexEscape(s) {\n return s.replace(/[-\\/\\\\^$*+?.()|[\\]{}]/g, '\\\\$&');\n}\n\nfunction absFloor(number) {\n if (number < 0) {\n // -0 -> 0\n return Math.ceil(number) || 0;\n } else {\n return Math.floor(number);\n }\n}\n\nfunction toInt(argumentForCoercion) {\n var coercedNumber = +argumentForCoercion,\n value = 0;\n\n if (coercedNumber !== 0 && isFinite(coercedNumber)) {\n value = absFloor(coercedNumber);\n }\n\n return value;\n}\n\nvar tokens = {};\n\nfunction addParseToken(token, callback) {\n var i,\n func = callback,\n tokenLen;\n if (typeof token === 'string') {\n token = [token];\n }\n if (isNumber(callback)) {\n func = function (input, array) {\n array[callback] = toInt(input);\n };\n }\n tokenLen = token.length;\n for (i = 0; i < tokenLen; i++) {\n tokens[token[i]] = func;\n }\n}\n\nfunction addWeekParseToken(token, callback) {\n addParseToken(token, function (input, array, config, token) {\n config._w = config._w || {};\n callback(input, config._w, config, token);\n });\n}\n\nfunction addTimeToArrayFromToken(token, input, config) {\n if (input != null && hasOwnProp(tokens, token)) {\n tokens[token](input, config._a, config, token);\n }\n}\n\nfunction isLeapYear(year) {\n return (year % 4 === 0 && year % 100 !== 0) || year % 400 === 0;\n}\n\nvar YEAR = 0,\n MONTH = 1,\n DATE = 2,\n HOUR = 3,\n MINUTE = 4,\n SECOND = 5,\n MILLISECOND = 6,\n WEEK = 7,\n WEEKDAY = 8;\n\n// FORMATTING\n\naddFormatToken('Y', 0, 0, function () {\n var y = this.year();\n return y <= 9999 ? zeroFill(y, 4) : '+' + y;\n});\n\naddFormatToken(0, ['YY', 2], 0, function () {\n return this.year() % 100;\n});\n\naddFormatToken(0, ['YYYY', 4], 0, 'year');\naddFormatToken(0, ['YYYYY', 5], 0, 'year');\naddFormatToken(0, ['YYYYYY', 6, true], 0, 'year');\n\n// PARSING\n\naddRegexToken('Y', matchSigned);\naddRegexToken('YY', match1to2, match2);\naddRegexToken('YYYY', match1to4, match4);\naddRegexToken('YYYYY', match1to6, match6);\naddRegexToken('YYYYYY', match1to6, match6);\n\naddParseToken(['YYYYY', 'YYYYYY'], YEAR);\naddParseToken('YYYY', function (input, array) {\n array[YEAR] =\n input.length === 2 ? hooks.parseTwoDigitYear(input) : toInt(input);\n});\naddParseToken('YY', function (input, array) {\n array[YEAR] = hooks.parseTwoDigitYear(input);\n});\naddParseToken('Y', function (input, array) {\n array[YEAR] = parseInt(input, 10);\n});\n\n// HELPERS\n\nfunction daysInYear(year) {\n return isLeapYear(year) ? 366 : 365;\n}\n\n// HOOKS\n\nhooks.parseTwoDigitYear = function (input) {\n return toInt(input) + (toInt(input) > 68 ? 1900 : 2000);\n};\n\n// MOMENTS\n\nvar getSetYear = makeGetSet('FullYear', true);\n\nfunction getIsLeapYear() {\n return isLeapYear(this.year());\n}\n\nfunction makeGetSet(unit, keepTime) {\n return function (value) {\n if (value != null) {\n set$1(this, unit, value);\n hooks.updateOffset(this, keepTime);\n return this;\n } else {\n return get(this, unit);\n }\n };\n}\n\nfunction get(mom, unit) {\n if (!mom.isValid()) {\n return NaN;\n }\n\n var d = mom._d,\n isUTC = mom._isUTC;\n\n switch (unit) {\n case 'Milliseconds':\n return isUTC ? d.getUTCMilliseconds() : d.getMilliseconds();\n case 'Seconds':\n return isUTC ? d.getUTCSeconds() : d.getSeconds();\n case 'Minutes':\n return isUTC ? d.getUTCMinutes() : d.getMinutes();\n case 'Hours':\n return isUTC ? d.getUTCHours() : d.getHours();\n case 'Date':\n return isUTC ? d.getUTCDate() : d.getDate();\n case 'Day':\n return isUTC ? d.getUTCDay() : d.getDay();\n case 'Month':\n return isUTC ? d.getUTCMonth() : d.getMonth();\n case 'FullYear':\n return isUTC ? d.getUTCFullYear() : d.getFullYear();\n default:\n return NaN; // Just in case\n }\n}\n\nfunction set$1(mom, unit, value) {\n var d, isUTC, year, month, date;\n\n if (!mom.isValid() || isNaN(value)) {\n return;\n }\n\n d = mom._d;\n isUTC = mom._isUTC;\n\n switch (unit) {\n case 'Milliseconds':\n return void (isUTC\n ? d.setUTCMilliseconds(value)\n : d.setMilliseconds(value));\n case 'Seconds':\n return void (isUTC ? d.setUTCSeconds(value) : d.setSeconds(value));\n case 'Minutes':\n return void (isUTC ? d.setUTCMinutes(value) : d.setMinutes(value));\n case 'Hours':\n return void (isUTC ? d.setUTCHours(value) : d.setHours(value));\n case 'Date':\n return void (isUTC ? d.setUTCDate(value) : d.setDate(value));\n // case 'Day': // Not real\n // return void (isUTC ? d.setUTCDay(value) : d.setDay(value));\n // case 'Month': // Not used because we need to pass two variables\n // return void (isUTC ? d.setUTCMonth(value) : d.setMonth(value));\n case 'FullYear':\n break; // See below ...\n default:\n return; // Just in case\n }\n\n year = value;\n month = mom.month();\n date = mom.date();\n date = date === 29 && month === 1 && !isLeapYear(year) ? 28 : date;\n void (isUTC\n ? d.setUTCFullYear(year, month, date)\n : d.setFullYear(year, month, date));\n}\n\n// MOMENTS\n\nfunction stringGet(units) {\n units = normalizeUnits(units);\n if (isFunction(this[units])) {\n return this[units]();\n }\n return this;\n}\n\nfunction stringSet(units, value) {\n if (typeof units === 'object') {\n units = normalizeObjectUnits(units);\n var prioritized = getPrioritizedUnits(units),\n i,\n prioritizedLen = prioritized.length;\n for (i = 0; i < prioritizedLen; i++) {\n this[prioritized[i].unit](units[prioritized[i].unit]);\n }\n } else {\n units = normalizeUnits(units);\n if (isFunction(this[units])) {\n return this[units](value);\n }\n }\n return this;\n}\n\nfunction mod(n, x) {\n return ((n % x) + x) % x;\n}\n\nvar indexOf;\n\nif (Array.prototype.indexOf) {\n indexOf = Array.prototype.indexOf;\n} else {\n indexOf = function (o) {\n // I know\n var i;\n for (i = 0; i < this.length; ++i) {\n if (this[i] === o) {\n return i;\n }\n }\n return -1;\n };\n}\n\nfunction daysInMonth(year, month) {\n if (isNaN(year) || isNaN(month)) {\n return NaN;\n }\n var modMonth = mod(month, 12);\n year += (month - modMonth) / 12;\n return modMonth === 1\n ? isLeapYear(year)\n ? 29\n : 28\n : 31 - ((modMonth % 7) % 2);\n}\n\n// FORMATTING\n\naddFormatToken('M', ['MM', 2], 'Mo', function () {\n return this.month() + 1;\n});\n\naddFormatToken('MMM', 0, 0, function (format) {\n return this.localeData().monthsShort(this, format);\n});\n\naddFormatToken('MMMM', 0, 0, function (format) {\n return this.localeData().months(this, format);\n});\n\n// PARSING\n\naddRegexToken('M', match1to2, match1to2NoLeadingZero);\naddRegexToken('MM', match1to2, match2);\naddRegexToken('MMM', function (isStrict, locale) {\n return locale.monthsShortRegex(isStrict);\n});\naddRegexToken('MMMM', function (isStrict, locale) {\n return locale.monthsRegex(isStrict);\n});\n\naddParseToken(['M', 'MM'], function (input, array) {\n array[MONTH] = toInt(input) - 1;\n});\n\naddParseToken(['MMM', 'MMMM'], function (input, array, config, token) {\n var month = config._locale.monthsParse(input, token, config._strict);\n // if we didn't find a month name, mark the date as invalid.\n if (month != null) {\n array[MONTH] = month;\n } else {\n getParsingFlags(config).invalidMonth = input;\n }\n});\n\n// LOCALES\n\nvar defaultLocaleMonths =\n 'January_February_March_April_May_June_July_August_September_October_November_December'.split(\n '_'\n ),\n defaultLocaleMonthsShort =\n 'Jan_Feb_Mar_Apr_May_Jun_Jul_Aug_Sep_Oct_Nov_Dec'.split('_'),\n MONTHS_IN_FORMAT = /D[oD]?(\\[[^\\[\\]]*\\]|\\s)+MMMM?/,\n defaultMonthsShortRegex = matchWord,\n defaultMonthsRegex = matchWord;\n\nfunction localeMonths(m, format) {\n if (!m) {\n return isArray(this._months)\n ? this._months\n : this._months['standalone'];\n }\n return isArray(this._months)\n ? this._months[m.month()]\n : this._months[\n (this._months.isFormat || MONTHS_IN_FORMAT).test(format)\n ? 'format'\n : 'standalone'\n ][m.month()];\n}\n\nfunction localeMonthsShort(m, format) {\n if (!m) {\n return isArray(this._monthsShort)\n ? this._monthsShort\n : this._monthsShort['standalone'];\n }\n return isArray(this._monthsShort)\n ? this._monthsShort[m.month()]\n : this._monthsShort[\n MONTHS_IN_FORMAT.test(format) ? 'format' : 'standalone'\n ][m.month()];\n}\n\nfunction handleStrictParse(monthName, format, strict) {\n var i,\n ii,\n mom,\n llc = monthName.toLocaleLowerCase();\n if (!this._monthsParse) {\n // this is not used\n this._monthsParse = [];\n this._longMonthsParse = [];\n this._shortMonthsParse = [];\n for (i = 0; i < 12; ++i) {\n mom = createUTC([2000, i]);\n this._shortMonthsParse[i] = this.monthsShort(\n mom,\n ''\n ).toLocaleLowerCase();\n this._longMonthsParse[i] = this.months(mom, '').toLocaleLowerCase();\n }\n }\n\n if (strict) {\n if (format === 'MMM') {\n ii = indexOf.call(this._shortMonthsParse, llc);\n return ii !== -1 ? ii : null;\n } else {\n ii = indexOf.call(this._longMonthsParse, llc);\n return ii !== -1 ? ii : null;\n }\n } else {\n if (format === 'MMM') {\n ii = indexOf.call(this._shortMonthsParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._longMonthsParse, llc);\n return ii !== -1 ? ii : null;\n } else {\n ii = indexOf.call(this._longMonthsParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._shortMonthsParse, llc);\n return ii !== -1 ? ii : null;\n }\n }\n}\n\nfunction localeMonthsParse(monthName, format, strict) {\n var i, mom, regex;\n\n if (this._monthsParseExact) {\n return handleStrictParse.call(this, monthName, format, strict);\n }\n\n if (!this._monthsParse) {\n this._monthsParse = [];\n this._longMonthsParse = [];\n this._shortMonthsParse = [];\n }\n\n // TODO: add sorting\n // Sorting makes sure if one month (or abbr) is a prefix of another\n // see sorting in computeMonthsParse\n for (i = 0; i < 12; i++) {\n // make the regex if we don't have it already\n mom = createUTC([2000, i]);\n if (strict && !this._longMonthsParse[i]) {\n this._longMonthsParse[i] = new RegExp(\n '^' + this.months(mom, '').replace('.', '') + '$',\n 'i'\n );\n this._shortMonthsParse[i] = new RegExp(\n '^' + this.monthsShort(mom, '').replace('.', '') + '$',\n 'i'\n );\n }\n if (!strict && !this._monthsParse[i]) {\n regex =\n '^' + this.months(mom, '') + '|^' + this.monthsShort(mom, '');\n this._monthsParse[i] = new RegExp(regex.replace('.', ''), 'i');\n }\n // test the regex\n if (\n strict &&\n format === 'MMMM' &&\n this._longMonthsParse[i].test(monthName)\n ) {\n return i;\n } else if (\n strict &&\n format === 'MMM' &&\n this._shortMonthsParse[i].test(monthName)\n ) {\n return i;\n } else if (!strict && this._monthsParse[i].test(monthName)) {\n return i;\n }\n }\n}\n\n// MOMENTS\n\nfunction setMonth(mom, value) {\n if (!mom.isValid()) {\n // No op\n return mom;\n }\n\n if (typeof value === 'string') {\n if (/^\\d+$/.test(value)) {\n value = toInt(value);\n } else {\n value = mom.localeData().monthsParse(value);\n // TODO: Another silent failure?\n if (!isNumber(value)) {\n return mom;\n }\n }\n }\n\n var month = value,\n date = mom.date();\n\n date = date < 29 ? date : Math.min(date, daysInMonth(mom.year(), month));\n void (mom._isUTC\n ? mom._d.setUTCMonth(month, date)\n : mom._d.setMonth(month, date));\n return mom;\n}\n\nfunction getSetMonth(value) {\n if (value != null) {\n setMonth(this, value);\n hooks.updateOffset(this, true);\n return this;\n } else {\n return get(this, 'Month');\n }\n}\n\nfunction getDaysInMonth() {\n return daysInMonth(this.year(), this.month());\n}\n\nfunction monthsShortRegex(isStrict) {\n if (this._monthsParseExact) {\n if (!hasOwnProp(this, '_monthsRegex')) {\n computeMonthsParse.call(this);\n }\n if (isStrict) {\n return this._monthsShortStrictRegex;\n } else {\n return this._monthsShortRegex;\n }\n } else {\n if (!hasOwnProp(this, '_monthsShortRegex')) {\n this._monthsShortRegex = defaultMonthsShortRegex;\n }\n return this._monthsShortStrictRegex && isStrict\n ? this._monthsShortStrictRegex\n : this._monthsShortRegex;\n }\n}\n\nfunction monthsRegex(isStrict) {\n if (this._monthsParseExact) {\n if (!hasOwnProp(this, '_monthsRegex')) {\n computeMonthsParse.call(this);\n }\n if (isStrict) {\n return this._monthsStrictRegex;\n } else {\n return this._monthsRegex;\n }\n } else {\n if (!hasOwnProp(this, '_monthsRegex')) {\n this._monthsRegex = defaultMonthsRegex;\n }\n return this._monthsStrictRegex && isStrict\n ? this._monthsStrictRegex\n : this._monthsRegex;\n }\n}\n\nfunction computeMonthsParse() {\n function cmpLenRev(a, b) {\n return b.length - a.length;\n }\n\n var shortPieces = [],\n longPieces = [],\n mixedPieces = [],\n i,\n mom,\n shortP,\n longP;\n for (i = 0; i < 12; i++) {\n // make the regex if we don't have it already\n mom = createUTC([2000, i]);\n shortP = regexEscape(this.monthsShort(mom, ''));\n longP = regexEscape(this.months(mom, ''));\n shortPieces.push(shortP);\n longPieces.push(longP);\n mixedPieces.push(longP);\n mixedPieces.push(shortP);\n }\n // Sorting makes sure if one month (or abbr) is a prefix of another it\n // will match the longer piece.\n shortPieces.sort(cmpLenRev);\n longPieces.sort(cmpLenRev);\n mixedPieces.sort(cmpLenRev);\n\n this._monthsRegex = new RegExp('^(' + mixedPieces.join('|') + ')', 'i');\n this._monthsShortRegex = this._monthsRegex;\n this._monthsStrictRegex = new RegExp(\n '^(' + longPieces.join('|') + ')',\n 'i'\n );\n this._monthsShortStrictRegex = new RegExp(\n '^(' + shortPieces.join('|') + ')',\n 'i'\n );\n}\n\nfunction createDate(y, m, d, h, M, s, ms) {\n // can't just apply() to create a date:\n // https://stackoverflow.com/q/181348\n var date;\n // the date constructor remaps years 0-99 to 1900-1999\n if (y < 100 && y >= 0) {\n // preserve leap years using a full 400 year cycle, then reset\n date = new Date(y + 400, m, d, h, M, s, ms);\n if (isFinite(date.getFullYear())) {\n date.setFullYear(y);\n }\n } else {\n date = new Date(y, m, d, h, M, s, ms);\n }\n\n return date;\n}\n\nfunction createUTCDate(y) {\n var date, args;\n // the Date.UTC function remaps years 0-99 to 1900-1999\n if (y < 100 && y >= 0) {\n args = Array.prototype.slice.call(arguments);\n // preserve leap years using a full 400 year cycle, then reset\n args[0] = y + 400;\n date = new Date(Date.UTC.apply(null, args));\n if (isFinite(date.getUTCFullYear())) {\n date.setUTCFullYear(y);\n }\n } else {\n date = new Date(Date.UTC.apply(null, arguments));\n }\n\n return date;\n}\n\n// start-of-first-week - start-of-year\nfunction firstWeekOffset(year, dow, doy) {\n var // first-week day -- which january is always in the first week (4 for iso, 1 for other)\n fwd = 7 + dow - doy,\n // first-week day local weekday -- which local weekday is fwd\n fwdlw = (7 + createUTCDate(year, 0, fwd).getUTCDay() - dow) % 7;\n\n return -fwdlw + fwd - 1;\n}\n\n// https://en.wikipedia.org/wiki/ISO_week_date#Calculating_a_date_given_the_year.2C_week_number_and_weekday\nfunction dayOfYearFromWeeks(year, week, weekday, dow, doy) {\n var localWeekday = (7 + weekday - dow) % 7,\n weekOffset = firstWeekOffset(year, dow, doy),\n dayOfYear = 1 + 7 * (week - 1) + localWeekday + weekOffset,\n resYear,\n resDayOfYear;\n\n if (dayOfYear <= 0) {\n resYear = year - 1;\n resDayOfYear = daysInYear(resYear) + dayOfYear;\n } else if (dayOfYear > daysInYear(year)) {\n resYear = year + 1;\n resDayOfYear = dayOfYear - daysInYear(year);\n } else {\n resYear = year;\n resDayOfYear = dayOfYear;\n }\n\n return {\n year: resYear,\n dayOfYear: resDayOfYear,\n };\n}\n\nfunction weekOfYear(mom, dow, doy) {\n var weekOffset = firstWeekOffset(mom.year(), dow, doy),\n week = Math.floor((mom.dayOfYear() - weekOffset - 1) / 7) + 1,\n resWeek,\n resYear;\n\n if (week < 1) {\n resYear = mom.year() - 1;\n resWeek = week + weeksInYear(resYear, dow, doy);\n } else if (week > weeksInYear(mom.year(), dow, doy)) {\n resWeek = week - weeksInYear(mom.year(), dow, doy);\n resYear = mom.year() + 1;\n } else {\n resYear = mom.year();\n resWeek = week;\n }\n\n return {\n week: resWeek,\n year: resYear,\n };\n}\n\nfunction weeksInYear(year, dow, doy) {\n var weekOffset = firstWeekOffset(year, dow, doy),\n weekOffsetNext = firstWeekOffset(year + 1, dow, doy);\n return (daysInYear(year) - weekOffset + weekOffsetNext) / 7;\n}\n\n// FORMATTING\n\naddFormatToken('w', ['ww', 2], 'wo', 'week');\naddFormatToken('W', ['WW', 2], 'Wo', 'isoWeek');\n\n// PARSING\n\naddRegexToken('w', match1to2, match1to2NoLeadingZero);\naddRegexToken('ww', match1to2, match2);\naddRegexToken('W', match1to2, match1to2NoLeadingZero);\naddRegexToken('WW', match1to2, match2);\n\naddWeekParseToken(\n ['w', 'ww', 'W', 'WW'],\n function (input, week, config, token) {\n week[token.substr(0, 1)] = toInt(input);\n }\n);\n\n// HELPERS\n\n// LOCALES\n\nfunction localeWeek(mom) {\n return weekOfYear(mom, this._week.dow, this._week.doy).week;\n}\n\nvar defaultLocaleWeek = {\n dow: 0, // Sunday is the first day of the week.\n doy: 6, // The week that contains Jan 6th is the first week of the year.\n};\n\nfunction localeFirstDayOfWeek() {\n return this._week.dow;\n}\n\nfunction localeFirstDayOfYear() {\n return this._week.doy;\n}\n\n// MOMENTS\n\nfunction getSetWeek(input) {\n var week = this.localeData().week(this);\n return input == null ? week : this.add((input - week) * 7, 'd');\n}\n\nfunction getSetISOWeek(input) {\n var week = weekOfYear(this, 1, 4).week;\n return input == null ? week : this.add((input - week) * 7, 'd');\n}\n\n// FORMATTING\n\naddFormatToken('d', 0, 'do', 'day');\n\naddFormatToken('dd', 0, 0, function (format) {\n return this.localeData().weekdaysMin(this, format);\n});\n\naddFormatToken('ddd', 0, 0, function (format) {\n return this.localeData().weekdaysShort(this, format);\n});\n\naddFormatToken('dddd', 0, 0, function (format) {\n return this.localeData().weekdays(this, format);\n});\n\naddFormatToken('e', 0, 0, 'weekday');\naddFormatToken('E', 0, 0, 'isoWeekday');\n\n// PARSING\n\naddRegexToken('d', match1to2);\naddRegexToken('e', match1to2);\naddRegexToken('E', match1to2);\naddRegexToken('dd', function (isStrict, locale) {\n return locale.weekdaysMinRegex(isStrict);\n});\naddRegexToken('ddd', function (isStrict, locale) {\n return locale.weekdaysShortRegex(isStrict);\n});\naddRegexToken('dddd', function (isStrict, locale) {\n return locale.weekdaysRegex(isStrict);\n});\n\naddWeekParseToken(['dd', 'ddd', 'dddd'], function (input, week, config, token) {\n var weekday = config._locale.weekdaysParse(input, token, config._strict);\n // if we didn't get a weekday name, mark the date as invalid\n if (weekday != null) {\n week.d = weekday;\n } else {\n getParsingFlags(config).invalidWeekday = input;\n }\n});\n\naddWeekParseToken(['d', 'e', 'E'], function (input, week, config, token) {\n week[token] = toInt(input);\n});\n\n// HELPERS\n\nfunction parseWeekday(input, locale) {\n if (typeof input !== 'string') {\n return input;\n }\n\n if (!isNaN(input)) {\n return parseInt(input, 10);\n }\n\n input = locale.weekdaysParse(input);\n if (typeof input === 'number') {\n return input;\n }\n\n return null;\n}\n\nfunction parseIsoWeekday(input, locale) {\n if (typeof input === 'string') {\n return locale.weekdaysParse(input) % 7 || 7;\n }\n return isNaN(input) ? null : input;\n}\n\n// LOCALES\nfunction shiftWeekdays(ws, n) {\n return ws.slice(n, 7).concat(ws.slice(0, n));\n}\n\nvar defaultLocaleWeekdays =\n 'Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday'.split('_'),\n defaultLocaleWeekdaysShort = 'Sun_Mon_Tue_Wed_Thu_Fri_Sat'.split('_'),\n defaultLocaleWeekdaysMin = 'Su_Mo_Tu_We_Th_Fr_Sa'.split('_'),\n defaultWeekdaysRegex = matchWord,\n defaultWeekdaysShortRegex = matchWord,\n defaultWeekdaysMinRegex = matchWord;\n\nfunction localeWeekdays(m, format) {\n var weekdays = isArray(this._weekdays)\n ? this._weekdays\n : this._weekdays[\n m && m !== true && this._weekdays.isFormat.test(format)\n ? 'format'\n : 'standalone'\n ];\n return m === true\n ? shiftWeekdays(weekdays, this._week.dow)\n : m\n ? weekdays[m.day()]\n : weekdays;\n}\n\nfunction localeWeekdaysShort(m) {\n return m === true\n ? shiftWeekdays(this._weekdaysShort, this._week.dow)\n : m\n ? this._weekdaysShort[m.day()]\n : this._weekdaysShort;\n}\n\nfunction localeWeekdaysMin(m) {\n return m === true\n ? shiftWeekdays(this._weekdaysMin, this._week.dow)\n : m\n ? this._weekdaysMin[m.day()]\n : this._weekdaysMin;\n}\n\nfunction handleStrictParse$1(weekdayName, format, strict) {\n var i,\n ii,\n mom,\n llc = weekdayName.toLocaleLowerCase();\n if (!this._weekdaysParse) {\n this._weekdaysParse = [];\n this._shortWeekdaysParse = [];\n this._minWeekdaysParse = [];\n\n for (i = 0; i < 7; ++i) {\n mom = createUTC([2000, 1]).day(i);\n this._minWeekdaysParse[i] = this.weekdaysMin(\n mom,\n ''\n ).toLocaleLowerCase();\n this._shortWeekdaysParse[i] = this.weekdaysShort(\n mom,\n ''\n ).toLocaleLowerCase();\n this._weekdaysParse[i] = this.weekdays(mom, '').toLocaleLowerCase();\n }\n }\n\n if (strict) {\n if (format === 'dddd') {\n ii = indexOf.call(this._weekdaysParse, llc);\n return ii !== -1 ? ii : null;\n } else if (format === 'ddd') {\n ii = indexOf.call(this._shortWeekdaysParse, llc);\n return ii !== -1 ? ii : null;\n } else {\n ii = indexOf.call(this._minWeekdaysParse, llc);\n return ii !== -1 ? ii : null;\n }\n } else {\n if (format === 'dddd') {\n ii = indexOf.call(this._weekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._shortWeekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._minWeekdaysParse, llc);\n return ii !== -1 ? ii : null;\n } else if (format === 'ddd') {\n ii = indexOf.call(this._shortWeekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._weekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._minWeekdaysParse, llc);\n return ii !== -1 ? ii : null;\n } else {\n ii = indexOf.call(this._minWeekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._weekdaysParse, llc);\n if (ii !== -1) {\n return ii;\n }\n ii = indexOf.call(this._shortWeekdaysParse, llc);\n return ii !== -1 ? ii : null;\n }\n }\n}\n\nfunction localeWeekdaysParse(weekdayName, format, strict) {\n var i, mom, regex;\n\n if (this._weekdaysParseExact) {\n return handleStrictParse$1.call(this, weekdayName, format, strict);\n }\n\n if (!this._weekdaysParse) {\n this._weekdaysParse = [];\n this._minWeekdaysParse = [];\n this._shortWeekdaysParse = [];\n this._fullWeekdaysParse = [];\n }\n\n for (i = 0; i < 7; i++) {\n // make the regex if we don't have it already\n\n mom = createUTC([2000, 1]).day(i);\n if (strict && !this._fullWeekdaysParse[i]) {\n this._fullWeekdaysParse[i] = new RegExp(\n '^' + this.weekdays(mom, '').replace('.', '\\\\.?') + '$',\n 'i'\n );\n this._shortWeekdaysParse[i] = new RegExp(\n '^' + this.weekdaysShort(mom, '').replace('.', '\\\\.?') + '$',\n 'i'\n );\n this._minWeekdaysParse[i] = new RegExp(\n '^' + this.weekdaysMin(mom, '').replace('.', '\\\\.?') + '$',\n 'i'\n );\n }\n if (!this._weekdaysParse[i]) {\n regex =\n '^' +\n this.weekdays(mom, '') +\n '|^' +\n this.weekdaysShort(mom, '') +\n '|^' +\n this.weekdaysMin(mom, '');\n this._weekdaysParse[i] = new RegExp(regex.replace('.', ''), 'i');\n }\n // test the regex\n if (\n strict &&\n format === 'dddd' &&\n this._fullWeekdaysParse[i].test(weekdayName)\n ) {\n return i;\n } else if (\n strict &&\n format === 'ddd' &&\n this._shortWeekdaysParse[i].test(weekdayName)\n ) {\n return i;\n } else if (\n strict &&\n format === 'dd' &&\n this._minWeekdaysParse[i].test(weekdayName)\n ) {\n return i;\n } else if (!strict && this._weekdaysParse[i].test(weekdayName)) {\n return i;\n }\n }\n}\n\n// MOMENTS\n\nfunction getSetDayOfWeek(input) {\n if (!this.isValid()) {\n return input != null ? this : NaN;\n }\n\n var day = get(this, 'Day');\n if (input != null) {\n input = parseWeekday(input, this.localeData());\n return this.add(input - day, 'd');\n } else {\n return day;\n }\n}\n\nfunction getSetLocaleDayOfWeek(input) {\n if (!this.isValid()) {\n return input != null ? this : NaN;\n }\n var weekday = (this.day() + 7 - this.localeData()._week.dow) % 7;\n return input == null ? weekday : this.add(input - weekday, 'd');\n}\n\nfunction getSetISODayOfWeek(input) {\n if (!this.isValid()) {\n return input != null ? this : NaN;\n }\n\n // behaves the same as moment#day except\n // as a getter, returns 7 instead of 0 (1-7 range instead of 0-6)\n // as a setter, sunday should belong to the previous week.\n\n if (input != null) {\n var weekday = parseIsoWeekday(input, this.localeData());\n return this.day(this.day() % 7 ? weekday : weekday - 7);\n } else {\n return this.day() || 7;\n }\n}\n\nfunction weekdaysRegex(isStrict) {\n if (this._weekdaysParseExact) {\n if (!hasOwnProp(this, '_weekdaysRegex')) {\n computeWeekdaysParse.call(this);\n }\n if (isStrict) {\n return this._weekdaysStrictRegex;\n } else {\n return this._weekdaysRegex;\n }\n } else {\n if (!hasOwnProp(this, '_weekdaysRegex')) {\n this._weekdaysRegex = defaultWeekdaysRegex;\n }\n return this._weekdaysStrictRegex && isStrict\n ? this._weekdaysStrictRegex\n : this._weekdaysRegex;\n }\n}\n\nfunction weekdaysShortRegex(isStrict) {\n if (this._weekdaysParseExact) {\n if (!hasOwnProp(this, '_weekdaysRegex')) {\n computeWeekdaysParse.call(this);\n }\n if (isStrict) {\n return this._weekdaysShortStrictRegex;\n } else {\n return this._weekdaysShortRegex;\n }\n } else {\n if (!hasOwnProp(this, '_weekdaysShortRegex')) {\n this._weekdaysShortRegex = defaultWeekdaysShortRegex;\n }\n return this._weekdaysShortStrictRegex && isStrict\n ? this._weekdaysShortStrictRegex\n : this._weekdaysShortRegex;\n }\n}\n\nfunction weekdaysMinRegex(isStrict) {\n if (this._weekdaysParseExact) {\n if (!hasOwnProp(this, '_weekdaysRegex')) {\n computeWeekdaysParse.call(this);\n }\n if (isStrict) {\n return this._weekdaysMinStrictRegex;\n } else {\n return this._weekdaysMinRegex;\n }\n } else {\n if (!hasOwnProp(this, '_weekdaysMinRegex')) {\n this._weekdaysMinRegex = defaultWeekdaysMinRegex;\n }\n return this._weekdaysMinStrictRegex && isStrict\n ? this._weekdaysMinStrictRegex\n : this._weekdaysMinRegex;\n }\n}\n\nfunction computeWeekdaysParse() {\n function cmpLenRev(a, b) {\n return b.length - a.length;\n }\n\n var minPieces = [],\n shortPieces = [],\n longPieces = [],\n mixedPieces = [],\n i,\n mom,\n minp,\n shortp,\n longp;\n for (i = 0; i < 7; i++) {\n // make the regex if we don't have it already\n mom = createUTC([2000, 1]).day(i);\n minp = regexEscape(this.weekdaysMin(mom, ''));\n shortp = regexEscape(this.weekdaysShort(mom, ''));\n longp = regexEscape(this.weekdays(mom, ''));\n minPieces.push(minp);\n shortPieces.push(shortp);\n longPieces.push(longp);\n mixedPieces.push(minp);\n mixedPieces.push(shortp);\n mixedPieces.push(longp);\n }\n // Sorting makes sure if one weekday (or abbr) is a prefix of another it\n // will match the longer piece.\n minPieces.sort(cmpLenRev);\n shortPieces.sort(cmpLenRev);\n longPieces.sort(cmpLenRev);\n mixedPieces.sort(cmpLenRev);\n\n this._weekdaysRegex = new RegExp('^(' + mixedPieces.join('|') + ')', 'i');\n this._weekdaysShortRegex = this._weekdaysRegex;\n this._weekdaysMinRegex = this._weekdaysRegex;\n\n this._weekdaysStrictRegex = new RegExp(\n '^(' + longPieces.join('|') + ')',\n 'i'\n );\n this._weekdaysShortStrictRegex = new RegExp(\n '^(' + shortPieces.join('|') + ')',\n 'i'\n );\n this._weekdaysMinStrictRegex = new RegExp(\n '^(' + minPieces.join('|') + ')',\n 'i'\n );\n}\n\n// FORMATTING\n\nfunction hFormat() {\n return this.hours() % 12 || 12;\n}\n\nfunction kFormat() {\n return this.hours() || 24;\n}\n\naddFormatToken('H', ['HH', 2], 0, 'hour');\naddFormatToken('h', ['hh', 2], 0, hFormat);\naddFormatToken('k', ['kk', 2], 0, kFormat);\n\naddFormatToken('hmm', 0, 0, function () {\n return '' + hFormat.apply(this) + zeroFill(this.minutes(), 2);\n});\n\naddFormatToken('hmmss', 0, 0, function () {\n return (\n '' +\n hFormat.apply(this) +\n zeroFill(this.minutes(), 2) +\n zeroFill(this.seconds(), 2)\n );\n});\n\naddFormatToken('Hmm', 0, 0, function () {\n return '' + this.hours() + zeroFill(this.minutes(), 2);\n});\n\naddFormatToken('Hmmss', 0, 0, function () {\n return (\n '' +\n this.hours() +\n zeroFill(this.minutes(), 2) +\n zeroFill(this.seconds(), 2)\n );\n});\n\nfunction meridiem(token, lowercase) {\n addFormatToken(token, 0, 0, function () {\n return this.localeData().meridiem(\n this.hours(),\n this.minutes(),\n lowercase\n );\n });\n}\n\nmeridiem('a', true);\nmeridiem('A', false);\n\n// PARSING\n\nfunction matchMeridiem(isStrict, locale) {\n return locale._meridiemParse;\n}\n\naddRegexToken('a', matchMeridiem);\naddRegexToken('A', matchMeridiem);\naddRegexToken('H', match1to2, match1to2HasZero);\naddRegexToken('h', match1to2, match1to2NoLeadingZero);\naddRegexToken('k', match1to2, match1to2NoLeadingZero);\naddRegexToken('HH', match1to2, match2);\naddRegexToken('hh', match1to2, match2);\naddRegexToken('kk', match1to2, match2);\n\naddRegexToken('hmm', match3to4);\naddRegexToken('hmmss', match5to6);\naddRegexToken('Hmm', match3to4);\naddRegexToken('Hmmss', match5to6);\n\naddParseToken(['H', 'HH'], HOUR);\naddParseToken(['k', 'kk'], function (input, array, config) {\n var kInput = toInt(input);\n array[HOUR] = kInput === 24 ? 0 : kInput;\n});\naddParseToken(['a', 'A'], function (input, array, config) {\n config._isPm = config._locale.isPM(input);\n config._meridiem = input;\n});\naddParseToken(['h', 'hh'], function (input, array, config) {\n array[HOUR] = toInt(input);\n getParsingFlags(config).bigHour = true;\n});\naddParseToken('hmm', function (input, array, config) {\n var pos = input.length - 2;\n array[HOUR] = toInt(input.substr(0, pos));\n array[MINUTE] = toInt(input.substr(pos));\n getParsingFlags(config).bigHour = true;\n});\naddParseToken('hmmss', function (input, array, config) {\n var pos1 = input.length - 4,\n pos2 = input.length - 2;\n array[HOUR] = toInt(input.substr(0, pos1));\n array[MINUTE] = toInt(input.substr(pos1, 2));\n array[SECOND] = toInt(input.substr(pos2));\n getParsingFlags(config).bigHour = true;\n});\naddParseToken('Hmm', function (input, array, config) {\n var pos = input.length - 2;\n array[HOUR] = toInt(input.substr(0, pos));\n array[MINUTE] = toInt(input.substr(pos));\n});\naddParseToken('Hmmss', function (input, array, config) {\n var pos1 = input.length - 4,\n pos2 = input.length - 2;\n array[HOUR] = toInt(input.substr(0, pos1));\n array[MINUTE] = toInt(input.substr(pos1, 2));\n array[SECOND] = toInt(input.substr(pos2));\n});\n\n// LOCALES\n\nfunction localeIsPM(input) {\n // IE8 Quirks Mode & IE7 Standards Mode do not allow accessing strings like arrays\n // Using charAt should be more compatible.\n return (input + '').toLowerCase().charAt(0) === 'p';\n}\n\nvar defaultLocaleMeridiemParse = /[ap]\\.?m?\\.?/i,\n // Setting the hour should keep the time, because the user explicitly\n // specified which hour they want. So trying to maintain the same hour (in\n // a new timezone) makes sense. Adding/subtracting hours does not follow\n // this rule.\n getSetHour = makeGetSet('Hours', true);\n\nfunction localeMeridiem(hours, minutes, isLower) {\n if (hours > 11) {\n return isLower ? 'pm' : 'PM';\n } else {\n return isLower ? 'am' : 'AM';\n }\n}\n\nvar baseConfig = {\n calendar: defaultCalendar,\n longDateFormat: defaultLongDateFormat,\n invalidDate: defaultInvalidDate,\n ordinal: defaultOrdinal,\n dayOfMonthOrdinalParse: defaultDayOfMonthOrdinalParse,\n relativeTime: defaultRelativeTime,\n\n months: defaultLocaleMonths,\n monthsShort: defaultLocaleMonthsShort,\n\n week: defaultLocaleWeek,\n\n weekdays: defaultLocaleWeekdays,\n weekdaysMin: defaultLocaleWeekdaysMin,\n weekdaysShort: defaultLocaleWeekdaysShort,\n\n meridiemParse: defaultLocaleMeridiemParse,\n};\n\n// internal storage for locale config files\nvar locales = {},\n localeFamilies = {},\n globalLocale;\n\nfunction commonPrefix(arr1, arr2) {\n var i,\n minl = Math.min(arr1.length, arr2.length);\n for (i = 0; i < minl; i += 1) {\n if (arr1[i] !== arr2[i]) {\n return i;\n }\n }\n return minl;\n}\n\nfunction normalizeLocale(key) {\n return key ? key.toLowerCase().replace('_', '-') : key;\n}\n\n// pick the locale from the array\n// try ['en-au', 'en-gb'] as 'en-au', 'en-gb', 'en', as in move through the list trying each\n// substring from most specific to least, but move to the next array item if it's a more specific variant than the current root\nfunction chooseLocale(names) {\n var i = 0,\n j,\n next,\n locale,\n split;\n\n while (i < names.length) {\n split = normalizeLocale(names[i]).split('-');\n j = split.length;\n next = normalizeLocale(names[i + 1]);\n next = next ? next.split('-') : null;\n while (j > 0) {\n locale = loadLocale(split.slice(0, j).join('-'));\n if (locale) {\n return locale;\n }\n if (\n next &&\n next.length >= j &&\n commonPrefix(split, next) >= j - 1\n ) {\n //the next array item is better than a shallower substring of this one\n break;\n }\n j--;\n }\n i++;\n }\n return globalLocale;\n}\n\nfunction isLocaleNameSane(name) {\n // Prevent names that look like filesystem paths, i.e contain '/' or '\\'\n // Ensure name is available and function returns boolean\n return !!(name && name.match('^[^/\\\\\\\\]*$'));\n}\n\nfunction loadLocale(name) {\n var oldLocale = null,\n aliasedRequire;\n // TODO: Find a better way to register and load all the locales in Node\n if (\n locales[name] === undefined &&\n typeof module !== 'undefined' &&\n module &&\n module.exports &&\n isLocaleNameSane(name)\n ) {\n try {\n oldLocale = globalLocale._abbr;\n aliasedRequire = require;\n aliasedRequire('./locale/' + name);\n getSetGlobalLocale(oldLocale);\n } catch (e) {\n // mark as not found to avoid repeating expensive file require call causing high CPU\n // when trying to find en-US, en_US, en-us for every format call\n locales[name] = null; // null means not found\n }\n }\n return locales[name];\n}\n\n// This function will load locale and then set the global locale. If\n// no arguments are passed in, it will simply return the current global\n// locale key.\nfunction getSetGlobalLocale(key, values) {\n var data;\n if (key) {\n if (isUndefined(values)) {\n data = getLocale(key);\n } else {\n data = defineLocale(key, values);\n }\n\n if (data) {\n // moment.duration._locale = moment._locale = data;\n globalLocale = data;\n } else {\n if (typeof console !== 'undefined' && console.warn) {\n //warn user if arguments are passed but the locale could not be set\n console.warn(\n 'Locale ' + key + ' not found. Did you forget to load it?'\n );\n }\n }\n }\n\n return globalLocale._abbr;\n}\n\nfunction defineLocale(name, config) {\n if (config !== null) {\n var locale,\n parentConfig = baseConfig;\n config.abbr = name;\n if (locales[name] != null) {\n deprecateSimple(\n 'defineLocaleOverride',\n 'use moment.updateLocale(localeName, config) to change ' +\n 'an existing locale. moment.defineLocale(localeName, ' +\n 'config) should only be used for creating a new locale ' +\n 'See http://momentjs.com/guides/#/warnings/define-locale/ for more info.'\n );\n parentConfig = locales[name]._config;\n } else if (config.parentLocale != null) {\n if (locales[config.parentLocale] != null) {\n parentConfig = locales[config.parentLocale]._config;\n } else {\n locale = loadLocale(config.parentLocale);\n if (locale != null) {\n parentConfig = locale._config;\n } else {\n if (!localeFamilies[config.parentLocale]) {\n localeFamilies[config.parentLocale] = [];\n }\n localeFamilies[config.parentLocale].push({\n name: name,\n config: config,\n });\n return null;\n }\n }\n }\n locales[name] = new Locale(mergeConfigs(parentConfig, config));\n\n if (localeFamilies[name]) {\n localeFamilies[name].forEach(function (x) {\n defineLocale(x.name, x.config);\n });\n }\n\n // backwards compat for now: also set the locale\n // make sure we set the locale AFTER all child locales have been\n // created, so we won't end up with the child locale set.\n getSetGlobalLocale(name);\n\n return locales[name];\n } else {\n // useful for testing\n delete locales[name];\n return null;\n }\n}\n\nfunction updateLocale(name, config) {\n if (config != null) {\n var locale,\n tmpLocale,\n parentConfig = baseConfig;\n\n if (locales[name] != null && locales[name].parentLocale != null) {\n // Update existing child locale in-place to avoid memory-leaks\n locales[name].set(mergeConfigs(locales[name]._config, config));\n } else {\n // MERGE\n tmpLocale = loadLocale(name);\n if (tmpLocale != null) {\n parentConfig = tmpLocale._config;\n }\n config = mergeConfigs(parentConfig, config);\n if (tmpLocale == null) {\n // updateLocale is called for creating a new locale\n // Set abbr so it will have a name (getters return\n // undefined otherwise).\n config.abbr = name;\n }\n locale = new Locale(config);\n locale.parentLocale = locales[name];\n locales[name] = locale;\n }\n\n // backwards compat for now: also set the locale\n getSetGlobalLocale(name);\n } else {\n // pass null for config to unupdate, useful for tests\n if (locales[name] != null) {\n if (locales[name].parentLocale != null) {\n locales[name] = locales[name].parentLocale;\n if (name === getSetGlobalLocale()) {\n getSetGlobalLocale(name);\n }\n } else if (locales[name] != null) {\n delete locales[name];\n }\n }\n }\n return locales[name];\n}\n\n// returns locale data\nfunction getLocale(key) {\n var locale;\n\n if (key && key._locale && key._locale._abbr) {\n key = key._locale._abbr;\n }\n\n if (!key) {\n return globalLocale;\n }\n\n if (!isArray(key)) {\n //short-circuit everything else\n locale = loadLocale(key);\n if (locale) {\n return locale;\n }\n key = [key];\n }\n\n return chooseLocale(key);\n}\n\nfunction listLocales() {\n return keys(locales);\n}\n\nfunction checkOverflow(m) {\n var overflow,\n a = m._a;\n\n if (a && getParsingFlags(m).overflow === -2) {\n overflow =\n a[MONTH] < 0 || a[MONTH] > 11\n ? MONTH\n : a[DATE] < 1 || a[DATE] > daysInMonth(a[YEAR], a[MONTH])\n ? DATE\n : a[HOUR] < 0 ||\n a[HOUR] > 24 ||\n (a[HOUR] === 24 &&\n (a[MINUTE] !== 0 ||\n a[SECOND] !== 0 ||\n a[MILLISECOND] !== 0))\n ? HOUR\n : a[MINUTE] < 0 || a[MINUTE] > 59\n ? MINUTE\n : a[SECOND] < 0 || a[SECOND] > 59\n ? SECOND\n : a[MILLISECOND] < 0 || a[MILLISECOND] > 999\n ? MILLISECOND\n : -1;\n\n if (\n getParsingFlags(m)._overflowDayOfYear &&\n (overflow < YEAR || overflow > DATE)\n ) {\n overflow = DATE;\n }\n if (getParsingFlags(m)._overflowWeeks && overflow === -1) {\n overflow = WEEK;\n }\n if (getParsingFlags(m)._overflowWeekday && overflow === -1) {\n overflow = WEEKDAY;\n }\n\n getParsingFlags(m).overflow = overflow;\n }\n\n return m;\n}\n\n// iso 8601 regex\n// 0000-00-00 0000-W00 or 0000-W00-0 + T + 00 or 00:00 or 00:00:00 or 00:00:00.000 + +00:00 or +0000 or +00)\nvar extendedIsoRegex =\n /^\\s*((?:[+-]\\d{6}|\\d{4})-(?:\\d\\d-\\d\\d|W\\d\\d-\\d|W\\d\\d|\\d\\d\\d|\\d\\d))(?:(T| )(\\d\\d(?::\\d\\d(?::\\d\\d(?:[.,]\\d+)?)?)?)([+-]\\d\\d(?::?\\d\\d)?|\\s*Z)?)?$/,\n basicIsoRegex =\n /^\\s*((?:[+-]\\d{6}|\\d{4})(?:\\d\\d\\d\\d|W\\d\\d\\d|W\\d\\d|\\d\\d\\d|\\d\\d|))(?:(T| )(\\d\\d(?:\\d\\d(?:\\d\\d(?:[.,]\\d+)?)?)?)([+-]\\d\\d(?::?\\d\\d)?|\\s*Z)?)?$/,\n tzRegex = /Z|[+-]\\d\\d(?::?\\d\\d)?/,\n isoDates = [\n ['YYYYYY-MM-DD', /[+-]\\d{6}-\\d\\d-\\d\\d/],\n ['YYYY-MM-DD', /\\d{4}-\\d\\d-\\d\\d/],\n ['GGGG-[W]WW-E', /\\d{4}-W\\d\\d-\\d/],\n ['GGGG-[W]WW', /\\d{4}-W\\d\\d/, false],\n ['YYYY-DDD', /\\d{4}-\\d{3}/],\n ['YYYY-MM', /\\d{4}-\\d\\d/, false],\n ['YYYYYYMMDD', /[+-]\\d{10}/],\n ['YYYYMMDD', /\\d{8}/],\n ['GGGG[W]WWE', /\\d{4}W\\d{3}/],\n ['GGGG[W]WW', /\\d{4}W\\d{2}/, false],\n ['YYYYDDD', /\\d{7}/],\n ['YYYYMM', /\\d{6}/, false],\n ['YYYY', /\\d{4}/, false],\n ],\n // iso time formats and regexes\n isoTimes = [\n ['HH:mm:ss.SSSS', /\\d\\d:\\d\\d:\\d\\d\\.\\d+/],\n ['HH:mm:ss,SSSS', /\\d\\d:\\d\\d:\\d\\d,\\d+/],\n ['HH:mm:ss', /\\d\\d:\\d\\d:\\d\\d/],\n ['HH:mm', /\\d\\d:\\d\\d/],\n ['HHmmss.SSSS', /\\d\\d\\d\\d\\d\\d\\.\\d+/],\n ['HHmmss,SSSS', /\\d\\d\\d\\d\\d\\d,\\d+/],\n ['HHmmss', /\\d\\d\\d\\d\\d\\d/],\n ['HHmm', /\\d\\d\\d\\d/],\n ['HH', /\\d\\d/],\n ],\n aspNetJsonRegex = /^\\/?Date\\((-?\\d+)/i,\n // RFC 2822 regex: For details see https://tools.ietf.org/html/rfc2822#section-3.3\n rfc2822 =\n /^(?:(Mon|Tue|Wed|Thu|Fri|Sat|Sun),?\\s)?(\\d{1,2})\\s(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)\\s(\\d{2,4})\\s(\\d\\d):(\\d\\d)(?::(\\d\\d))?\\s(?:(UT|GMT|[ECMP][SD]T)|([Zz])|([+-]\\d{4}))$/,\n obsOffsets = {\n UT: 0,\n GMT: 0,\n EDT: -4 * 60,\n EST: -5 * 60,\n CDT: -5 * 60,\n CST: -6 * 60,\n MDT: -6 * 60,\n MST: -7 * 60,\n PDT: -7 * 60,\n PST: -8 * 60,\n };\n\n// date from iso format\nfunction configFromISO(config) {\n var i,\n l,\n string = config._i,\n match = extendedIsoRegex.exec(string) || basicIsoRegex.exec(string),\n allowTime,\n dateFormat,\n timeFormat,\n tzFormat,\n isoDatesLen = isoDates.length,\n isoTimesLen = isoTimes.length;\n\n if (match) {\n getParsingFlags(config).iso = true;\n for (i = 0, l = isoDatesLen; i < l; i++) {\n if (isoDates[i][1].exec(match[1])) {\n dateFormat = isoDates[i][0];\n allowTime = isoDates[i][2] !== false;\n break;\n }\n }\n if (dateFormat == null) {\n config._isValid = false;\n return;\n }\n if (match[3]) {\n for (i = 0, l = isoTimesLen; i < l; i++) {\n if (isoTimes[i][1].exec(match[3])) {\n // match[2] should be 'T' or space\n timeFormat = (match[2] || ' ') + isoTimes[i][0];\n break;\n }\n }\n if (timeFormat == null) {\n config._isValid = false;\n return;\n }\n }\n if (!allowTime && timeFormat != null) {\n config._isValid = false;\n return;\n }\n if (match[4]) {\n if (tzRegex.exec(match[4])) {\n tzFormat = 'Z';\n } else {\n config._isValid = false;\n return;\n }\n }\n config._f = dateFormat + (timeFormat || '') + (tzFormat || '');\n configFromStringAndFormat(config);\n } else {\n config._isValid = false;\n }\n}\n\nfunction extractFromRFC2822Strings(\n yearStr,\n monthStr,\n dayStr,\n hourStr,\n minuteStr,\n secondStr\n) {\n var result = [\n untruncateYear(yearStr),\n defaultLocaleMonthsShort.indexOf(monthStr),\n parseInt(dayStr, 10),\n parseInt(hourStr, 10),\n parseInt(minuteStr, 10),\n ];\n\n if (secondStr) {\n result.push(parseInt(secondStr, 10));\n }\n\n return result;\n}\n\nfunction untruncateYear(yearStr) {\n var year = parseInt(yearStr, 10);\n if (year <= 49) {\n return 2000 + year;\n } else if (year <= 999) {\n return 1900 + year;\n }\n return year;\n}\n\nfunction preprocessRFC2822(s) {\n // Remove comments and folding whitespace and replace multiple-spaces with a single space\n return s\n .replace(/\\([^()]*\\)|[\\n\\t]/g, ' ')\n .replace(/(\\s\\s+)/g, ' ')\n .replace(/^\\s\\s*/, '')\n .replace(/\\s\\s*$/, '');\n}\n\nfunction checkWeekday(weekdayStr, parsedInput, config) {\n if (weekdayStr) {\n // TODO: Replace the vanilla JS Date object with an independent day-of-week check.\n var weekdayProvided = defaultLocaleWeekdaysShort.indexOf(weekdayStr),\n weekdayActual = new Date(\n parsedInput[0],\n parsedInput[1],\n parsedInput[2]\n ).getDay();\n if (weekdayProvided !== weekdayActual) {\n getParsingFlags(config).weekdayMismatch = true;\n config._isValid = false;\n return false;\n }\n }\n return true;\n}\n\nfunction calculateOffset(obsOffset, militaryOffset, numOffset) {\n if (obsOffset) {\n return obsOffsets[obsOffset];\n } else if (militaryOffset) {\n // the only allowed military tz is Z\n return 0;\n } else {\n var hm = parseInt(numOffset, 10),\n m = hm % 100,\n h = (hm - m) / 100;\n return h * 60 + m;\n }\n}\n\n// date and time from ref 2822 format\nfunction configFromRFC2822(config) {\n var match = rfc2822.exec(preprocessRFC2822(config._i)),\n parsedArray;\n if (match) {\n parsedArray = extractFromRFC2822Strings(\n match[4],\n match[3],\n match[2],\n match[5],\n match[6],\n match[7]\n );\n if (!checkWeekday(match[1], parsedArray, config)) {\n return;\n }\n\n config._a = parsedArray;\n config._tzm = calculateOffset(match[8], match[9], match[10]);\n\n config._d = createUTCDate.apply(null, config._a);\n config._d.setUTCMinutes(config._d.getUTCMinutes() - config._tzm);\n\n getParsingFlags(config).rfc2822 = true;\n } else {\n config._isValid = false;\n }\n}\n\n// date from 1) ASP.NET, 2) ISO, 3) RFC 2822 formats, or 4) optional fallback if parsing isn't strict\nfunction configFromString(config) {\n var matched = aspNetJsonRegex.exec(config._i);\n if (matched !== null) {\n config._d = new Date(+matched[1]);\n return;\n }\n\n configFromISO(config);\n if (config._isValid === false) {\n delete config._isValid;\n } else {\n return;\n }\n\n configFromRFC2822(config);\n if (config._isValid === false) {\n delete config._isValid;\n } else {\n return;\n }\n\n if (config._strict) {\n config._isValid = false;\n } else {\n // Final attempt, use Input Fallback\n hooks.createFromInputFallback(config);\n }\n}\n\nhooks.createFromInputFallback = deprecate(\n 'value provided is not in a recognized RFC2822 or ISO format. moment construction falls back to js Date(), ' +\n 'which is not reliable across all browsers and versions. Non RFC2822/ISO date formats are ' +\n 'discouraged. Please refer to http://momentjs.com/guides/#/warnings/js-date/ for more info.',\n function (config) {\n config._d = new Date(config._i + (config._useUTC ? ' UTC' : ''));\n }\n);\n\n// Pick the first defined of two or three arguments.\nfunction defaults(a, b, c) {\n if (a != null) {\n return a;\n }\n if (b != null) {\n return b;\n }\n return c;\n}\n\nfunction currentDateArray(config) {\n // hooks is actually the exported moment object\n var nowValue = new Date(hooks.now());\n if (config._useUTC) {\n return [\n nowValue.getUTCFullYear(),\n nowValue.getUTCMonth(),\n nowValue.getUTCDate(),\n ];\n }\n return [nowValue.getFullYear(), nowValue.getMonth(), nowValue.getDate()];\n}\n\n// convert an array to a date.\n// the array should mirror the parameters below\n// note: all values past the year are optional and will default to the lowest possible value.\n// [year, month, day , hour, minute, second, millisecond]\nfunction configFromArray(config) {\n var i,\n date,\n input = [],\n currentDate,\n expectedWeekday,\n yearToUse;\n\n if (config._d) {\n return;\n }\n\n currentDate = currentDateArray(config);\n\n //compute day of the year from weeks and weekdays\n if (config._w && config._a[DATE] == null && config._a[MONTH] == null) {\n dayOfYearFromWeekInfo(config);\n }\n\n //if the day of the year is set, figure out what it is\n if (config._dayOfYear != null) {\n yearToUse = defaults(config._a[YEAR], currentDate[YEAR]);\n\n if (\n config._dayOfYear > daysInYear(yearToUse) ||\n config._dayOfYear === 0\n ) {\n getParsingFlags(config)._overflowDayOfYear = true;\n }\n\n date = createUTCDate(yearToUse, 0, config._dayOfYear);\n config._a[MONTH] = date.getUTCMonth();\n config._a[DATE] = date.getUTCDate();\n }\n\n // Default to current date.\n // * if no year, month, day of month are given, default to today\n // * if day of month is given, default month and year\n // * if month is given, default only year\n // * if year is given, don't default anything\n for (i = 0; i < 3 && config._a[i] == null; ++i) {\n config._a[i] = input[i] = currentDate[i];\n }\n\n // Zero out whatever was not defaulted, including time\n for (; i < 7; i++) {\n config._a[i] = input[i] =\n config._a[i] == null ? (i === 2 ? 1 : 0) : config._a[i];\n }\n\n // Check for 24:00:00.000\n if (\n config._a[HOUR] === 24 &&\n config._a[MINUTE] === 0 &&\n config._a[SECOND] === 0 &&\n config._a[MILLISECOND] === 0\n ) {\n config._nextDay = true;\n config._a[HOUR] = 0;\n }\n\n config._d = (config._useUTC ? createUTCDate : createDate).apply(\n null,\n input\n );\n expectedWeekday = config._useUTC\n ? config._d.getUTCDay()\n : config._d.getDay();\n\n // Apply timezone offset from input. The actual utcOffset can be changed\n // with parseZone.\n if (config._tzm != null) {\n config._d.setUTCMinutes(config._d.getUTCMinutes() - config._tzm);\n }\n\n if (config._nextDay) {\n config._a[HOUR] = 24;\n }\n\n // check for mismatching day of week\n if (\n config._w &&\n typeof config._w.d !== 'undefined' &&\n config._w.d !== expectedWeekday\n ) {\n getParsingFlags(config).weekdayMismatch = true;\n }\n}\n\nfunction dayOfYearFromWeekInfo(config) {\n var w, weekYear, week, weekday, dow, doy, temp, weekdayOverflow, curWeek;\n\n w = config._w;\n if (w.GG != null || w.W != null || w.E != null) {\n dow = 1;\n doy = 4;\n\n // TODO: We need to take the current isoWeekYear, but that depends on\n // how we interpret now (local, utc, fixed offset). So create\n // a now version of current config (take local/utc/offset flags, and\n // create now).\n weekYear = defaults(\n w.GG,\n config._a[YEAR],\n weekOfYear(createLocal(), 1, 4).year\n );\n week = defaults(w.W, 1);\n weekday = defaults(w.E, 1);\n if (weekday < 1 || weekday > 7) {\n weekdayOverflow = true;\n }\n } else {\n dow = config._locale._week.dow;\n doy = config._locale._week.doy;\n\n curWeek = weekOfYear(createLocal(), dow, doy);\n\n weekYear = defaults(w.gg, config._a[YEAR], curWeek.year);\n\n // Default to current week.\n week = defaults(w.w, curWeek.week);\n\n if (w.d != null) {\n // weekday -- low day numbers are considered next week\n weekday = w.d;\n if (weekday < 0 || weekday > 6) {\n weekdayOverflow = true;\n }\n } else if (w.e != null) {\n // local weekday -- counting starts from beginning of week\n weekday = w.e + dow;\n if (w.e < 0 || w.e > 6) {\n weekdayOverflow = true;\n }\n } else {\n // default to beginning of week\n weekday = dow;\n }\n }\n if (week < 1 || week > weeksInYear(weekYear, dow, doy)) {\n getParsingFlags(config)._overflowWeeks = true;\n } else if (weekdayOverflow != null) {\n getParsingFlags(config)._overflowWeekday = true;\n } else {\n temp = dayOfYearFromWeeks(weekYear, week, weekday, dow, doy);\n config._a[YEAR] = temp.year;\n config._dayOfYear = temp.dayOfYear;\n }\n}\n\n// constant that refers to the ISO standard\nhooks.ISO_8601 = function () {};\n\n// constant that refers to the RFC 2822 form\nhooks.RFC_2822 = function () {};\n\n// date from string and format string\nfunction configFromStringAndFormat(config) {\n // TODO: Move this to another part of the creation flow to prevent circular deps\n if (config._f === hooks.ISO_8601) {\n configFromISO(config);\n return;\n }\n if (config._f === hooks.RFC_2822) {\n configFromRFC2822(config);\n return;\n }\n config._a = [];\n getParsingFlags(config).empty = true;\n\n // This array is used to make a Date, either with `new Date` or `Date.UTC`\n var string = '' + config._i,\n i,\n parsedInput,\n tokens,\n token,\n skipped,\n stringLength = string.length,\n totalParsedInputLength = 0,\n era,\n tokenLen;\n\n tokens =\n expandFormat(config._f, config._locale).match(formattingTokens) || [];\n tokenLen = tokens.length;\n for (i = 0; i < tokenLen; i++) {\n token = tokens[i];\n parsedInput = (string.match(getParseRegexForToken(token, config)) ||\n [])[0];\n if (parsedInput) {\n skipped = string.substr(0, string.indexOf(parsedInput));\n if (skipped.length > 0) {\n getParsingFlags(config).unusedInput.push(skipped);\n }\n string = string.slice(\n string.indexOf(parsedInput) + parsedInput.length\n );\n totalParsedInputLength += parsedInput.length;\n }\n // don't parse if it's not a known token\n if (formatTokenFunctions[token]) {\n if (parsedInput) {\n getParsingFlags(config).empty = false;\n } else {\n getParsingFlags(config).unusedTokens.push(token);\n }\n addTimeToArrayFromToken(token, parsedInput, config);\n } else if (config._strict && !parsedInput) {\n getParsingFlags(config).unusedTokens.push(token);\n }\n }\n\n // add remaining unparsed input length to the string\n getParsingFlags(config).charsLeftOver =\n stringLength - totalParsedInputLength;\n if (string.length > 0) {\n getParsingFlags(config).unusedInput.push(string);\n }\n\n // clear _12h flag if hour is <= 12\n if (\n config._a[HOUR] <= 12 &&\n getParsingFlags(config).bigHour === true &&\n config._a[HOUR] > 0\n ) {\n getParsingFlags(config).bigHour = undefined;\n }\n\n getParsingFlags(config).parsedDateParts = config._a.slice(0);\n getParsingFlags(config).meridiem = config._meridiem;\n // handle meridiem\n config._a[HOUR] = meridiemFixWrap(\n config._locale,\n config._a[HOUR],\n config._meridiem\n );\n\n // handle era\n era = getParsingFlags(config).era;\n if (era !== null) {\n config._a[YEAR] = config._locale.erasConvertYear(era, config._a[YEAR]);\n }\n\n configFromArray(config);\n checkOverflow(config);\n}\n\nfunction meridiemFixWrap(locale, hour, meridiem) {\n var isPm;\n\n if (meridiem == null) {\n // nothing to do\n return hour;\n }\n if (locale.meridiemHour != null) {\n return locale.meridiemHour(hour, meridiem);\n } else if (locale.isPM != null) {\n // Fallback\n isPm = locale.isPM(meridiem);\n if (isPm && hour < 12) {\n hour += 12;\n }\n if (!isPm && hour === 12) {\n hour = 0;\n }\n return hour;\n } else {\n // this is not supposed to happen\n return hour;\n }\n}\n\n// date from string and array of format strings\nfunction configFromStringAndArray(config) {\n var tempConfig,\n bestMoment,\n scoreToBeat,\n i,\n currentScore,\n validFormatFound,\n bestFormatIsValid = false,\n configfLen = config._f.length;\n\n if (configfLen === 0) {\n getParsingFlags(config).invalidFormat = true;\n config._d = new Date(NaN);\n return;\n }\n\n for (i = 0; i < configfLen; i++) {\n currentScore = 0;\n validFormatFound = false;\n tempConfig = copyConfig({}, config);\n if (config._useUTC != null) {\n tempConfig._useUTC = config._useUTC;\n }\n tempConfig._f = config._f[i];\n configFromStringAndFormat(tempConfig);\n\n if (isValid(tempConfig)) {\n validFormatFound = true;\n }\n\n // if there is any input that was not parsed add a penalty for that format\n currentScore += getParsingFlags(tempConfig).charsLeftOver;\n\n //or tokens\n currentScore += getParsingFlags(tempConfig).unusedTokens.length * 10;\n\n getParsingFlags(tempConfig).score = currentScore;\n\n if (!bestFormatIsValid) {\n if (\n scoreToBeat == null ||\n currentScore < scoreToBeat ||\n validFormatFound\n ) {\n scoreToBeat = currentScore;\n bestMoment = tempConfig;\n if (validFormatFound) {\n bestFormatIsValid = true;\n }\n }\n } else {\n if (currentScore < scoreToBeat) {\n scoreToBeat = currentScore;\n bestMoment = tempConfig;\n }\n }\n }\n\n extend(config, bestMoment || tempConfig);\n}\n\nfunction configFromObject(config) {\n if (config._d) {\n return;\n }\n\n var i = normalizeObjectUnits(config._i),\n dayOrDate = i.day === undefined ? i.date : i.day;\n config._a = map(\n [i.year, i.month, dayOrDate, i.hour, i.minute, i.second, i.millisecond],\n function (obj) {\n return obj && parseInt(obj, 10);\n }\n );\n\n configFromArray(config);\n}\n\nfunction createFromConfig(config) {\n var res = new Moment(checkOverflow(prepareConfig(config)));\n if (res._nextDay) {\n // Adding is smart enough around DST\n res.add(1, 'd');\n res._nextDay = undefined;\n }\n\n return res;\n}\n\nfunction prepareConfig(config) {\n var input = config._i,\n format = config._f;\n\n config._locale = config._locale || getLocale(config._l);\n\n if (input === null || (format === undefined && input === '')) {\n return createInvalid({ nullInput: true });\n }\n\n if (typeof input === 'string') {\n config._i = input = config._locale.preparse(input);\n }\n\n if (isMoment(input)) {\n return new Moment(checkOverflow(input));\n } else if (isDate(input)) {\n config._d = input;\n } else if (isArray(format)) {\n configFromStringAndArray(config);\n } else if (format) {\n configFromStringAndFormat(config);\n } else {\n configFromInput(config);\n }\n\n if (!isValid(config)) {\n config._d = null;\n }\n\n return config;\n}\n\nfunction configFromInput(config) {\n var input = config._i;\n if (isUndefined(input)) {\n config._d = new Date(hooks.now());\n } else if (isDate(input)) {\n config._d = new Date(input.valueOf());\n } else if (typeof input === 'string') {\n configFromString(config);\n } else if (isArray(input)) {\n config._a = map(input.slice(0), function (obj) {\n return parseInt(obj, 10);\n });\n configFromArray(config);\n } else if (isObject(input)) {\n configFromObject(config);\n } else if (isNumber(input)) {\n // from milliseconds\n config._d = new Date(input);\n } else {\n hooks.createFromInputFallback(config);\n }\n}\n\nfunction createLocalOrUTC(input, format, locale, strict, isUTC) {\n var c = {};\n\n if (format === true || format === false) {\n strict = format;\n format = undefined;\n }\n\n if (locale === true || locale === false) {\n strict = locale;\n locale = undefined;\n }\n\n if (\n (isObject(input) && isObjectEmpty(input)) ||\n (isArray(input) && input.length === 0)\n ) {\n input = undefined;\n }\n // object construction must be done this way.\n // https://github.com/moment/moment/issues/1423\n c._isAMomentObject = true;\n c._useUTC = c._isUTC = isUTC;\n c._l = locale;\n c._i = input;\n c._f = format;\n c._strict = strict;\n\n return createFromConfig(c);\n}\n\nfunction createLocal(input, format, locale, strict) {\n return createLocalOrUTC(input, format, locale, strict, false);\n}\n\nvar prototypeMin = deprecate(\n 'moment().min is deprecated, use moment.max instead. http://momentjs.com/guides/#/warnings/min-max/',\n function () {\n var other = createLocal.apply(null, arguments);\n if (this.isValid() && other.isValid()) {\n return other < this ? this : other;\n } else {\n return createInvalid();\n }\n }\n ),\n prototypeMax = deprecate(\n 'moment().max is deprecated, use moment.min instead. http://momentjs.com/guides/#/warnings/min-max/',\n function () {\n var other = createLocal.apply(null, arguments);\n if (this.isValid() && other.isValid()) {\n return other > this ? this : other;\n } else {\n return createInvalid();\n }\n }\n );\n\n// Pick a moment m from moments so that m[fn](other) is true for all\n// other. This relies on the function fn to be transitive.\n//\n// moments should either be an array of moment objects or an array, whose\n// first element is an array of moment objects.\nfunction pickBy(fn, moments) {\n var res, i;\n if (moments.length === 1 && isArray(moments[0])) {\n moments = moments[0];\n }\n if (!moments.length) {\n return createLocal();\n }\n res = moments[0];\n for (i = 1; i < moments.length; ++i) {\n if (!moments[i].isValid() || moments[i][fn](res)) {\n res = moments[i];\n }\n }\n return res;\n}\n\n// TODO: Use [].sort instead?\nfunction min() {\n var args = [].slice.call(arguments, 0);\n\n return pickBy('isBefore', args);\n}\n\nfunction max() {\n var args = [].slice.call(arguments, 0);\n\n return pickBy('isAfter', args);\n}\n\nvar now = function () {\n return Date.now ? Date.now() : +new Date();\n};\n\nvar ordering = [\n 'year',\n 'quarter',\n 'month',\n 'week',\n 'day',\n 'hour',\n 'minute',\n 'second',\n 'millisecond',\n];\n\nfunction isDurationValid(m) {\n var key,\n unitHasDecimal = false,\n i,\n orderLen = ordering.length;\n for (key in m) {\n if (\n hasOwnProp(m, key) &&\n !(\n indexOf.call(ordering, key) !== -1 &&\n (m[key] == null || !isNaN(m[key]))\n )\n ) {\n return false;\n }\n }\n\n for (i = 0; i < orderLen; ++i) {\n if (m[ordering[i]]) {\n if (unitHasDecimal) {\n return false; // only allow non-integers for smallest unit\n }\n if (parseFloat(m[ordering[i]]) !== toInt(m[ordering[i]])) {\n unitHasDecimal = true;\n }\n }\n }\n\n return true;\n}\n\nfunction isValid$1() {\n return this._isValid;\n}\n\nfunction createInvalid$1() {\n return createDuration(NaN);\n}\n\nfunction Duration(duration) {\n var normalizedInput = normalizeObjectUnits(duration),\n years = normalizedInput.year || 0,\n quarters = normalizedInput.quarter || 0,\n months = normalizedInput.month || 0,\n weeks = normalizedInput.week || normalizedInput.isoWeek || 0,\n days = normalizedInput.day || 0,\n hours = normalizedInput.hour || 0,\n minutes = normalizedInput.minute || 0,\n seconds = normalizedInput.second || 0,\n milliseconds = normalizedInput.millisecond || 0;\n\n this._isValid = isDurationValid(normalizedInput);\n\n // representation for dateAddRemove\n this._milliseconds =\n +milliseconds +\n seconds * 1e3 + // 1000\n minutes * 6e4 + // 1000 * 60\n hours * 1000 * 60 * 60; //using 1000 * 60 * 60 instead of 36e5 to avoid floating point rounding errors https://github.com/moment/moment/issues/2978\n // Because of dateAddRemove treats 24 hours as different from a\n // day when working around DST, we need to store them separately\n this._days = +days + weeks * 7;\n // It is impossible to translate months into days without knowing\n // which months you are are talking about, so we have to store\n // it separately.\n this._months = +months + quarters * 3 + years * 12;\n\n this._data = {};\n\n this._locale = getLocale();\n\n this._bubble();\n}\n\nfunction isDuration(obj) {\n return obj instanceof Duration;\n}\n\nfunction absRound(number) {\n if (number < 0) {\n return Math.round(-1 * number) * -1;\n } else {\n return Math.round(number);\n }\n}\n\n// compare two arrays, return the number of differences\nfunction compareArrays(array1, array2, dontConvert) {\n var len = Math.min(array1.length, array2.length),\n lengthDiff = Math.abs(array1.length - array2.length),\n diffs = 0,\n i;\n for (i = 0; i < len; i++) {\n if (\n (dontConvert && array1[i] !== array2[i]) ||\n (!dontConvert && toInt(array1[i]) !== toInt(array2[i]))\n ) {\n diffs++;\n }\n }\n return diffs + lengthDiff;\n}\n\n// FORMATTING\n\nfunction offset(token, separator) {\n addFormatToken(token, 0, 0, function () {\n var offset = this.utcOffset(),\n sign = '+';\n if (offset < 0) {\n offset = -offset;\n sign = '-';\n }\n return (\n sign +\n zeroFill(~~(offset / 60), 2) +\n separator +\n zeroFill(~~offset % 60, 2)\n );\n });\n}\n\noffset('Z', ':');\noffset('ZZ', '');\n\n// PARSING\n\naddRegexToken('Z', matchShortOffset);\naddRegexToken('ZZ', matchShortOffset);\naddParseToken(['Z', 'ZZ'], function (input, array, config) {\n config._useUTC = true;\n config._tzm = offsetFromString(matchShortOffset, input);\n});\n\n// HELPERS\n\n// timezone chunker\n// '+10:00' > ['10', '00']\n// '-1530' > ['-15', '30']\nvar chunkOffset = /([\\+\\-]|\\d\\d)/gi;\n\nfunction offsetFromString(matcher, string) {\n var matches = (string || '').match(matcher),\n chunk,\n parts,\n minutes;\n\n if (matches === null) {\n return null;\n }\n\n chunk = matches[matches.length - 1] || [];\n parts = (chunk + '').match(chunkOffset) || ['-', 0, 0];\n minutes = +(parts[1] * 60) + toInt(parts[2]);\n\n return minutes === 0 ? 0 : parts[0] === '+' ? minutes : -minutes;\n}\n\n// Return a moment from input, that is local/utc/zone equivalent to model.\nfunction cloneWithOffset(input, model) {\n var res, diff;\n if (model._isUTC) {\n res = model.clone();\n diff =\n (isMoment(input) || isDate(input)\n ? input.valueOf()\n : createLocal(input).valueOf()) - res.valueOf();\n // Use low-level api, because this fn is low-level api.\n res._d.setTime(res._d.valueOf() + diff);\n hooks.updateOffset(res, false);\n return res;\n } else {\n return createLocal(input).local();\n }\n}\n\nfunction getDateOffset(m) {\n // On Firefox.24 Date#getTimezoneOffset returns a floating point.\n // https://github.com/moment/moment/pull/1871\n return -Math.round(m._d.getTimezoneOffset());\n}\n\n// HOOKS\n\n// This function will be called whenever a moment is mutated.\n// It is intended to keep the offset in sync with the timezone.\nhooks.updateOffset = function () {};\n\n// MOMENTS\n\n// keepLocalTime = true means only change the timezone, without\n// affecting the local hour. So 5:31:26 +0300 --[utcOffset(2, true)]-->\n// 5:31:26 +0200 It is possible that 5:31:26 doesn't exist with offset\n// +0200, so we adjust the time as needed, to be valid.\n//\n// Keeping the time actually adds/subtracts (one hour)\n// from the actual represented time. That is why we call updateOffset\n// a second time. In case it wants us to change the offset again\n// _changeInProgress == true case, then we have to adjust, because\n// there is no such time in the given timezone.\nfunction getSetOffset(input, keepLocalTime, keepMinutes) {\n var offset = this._offset || 0,\n localAdjust;\n if (!this.isValid()) {\n return input != null ? this : NaN;\n }\n if (input != null) {\n if (typeof input === 'string') {\n input = offsetFromString(matchShortOffset, input);\n if (input === null) {\n return this;\n }\n } else if (Math.abs(input) < 16 && !keepMinutes) {\n input = input * 60;\n }\n if (!this._isUTC && keepLocalTime) {\n localAdjust = getDateOffset(this);\n }\n this._offset = input;\n this._isUTC = true;\n if (localAdjust != null) {\n this.add(localAdjust, 'm');\n }\n if (offset !== input) {\n if (!keepLocalTime || this._changeInProgress) {\n addSubtract(\n this,\n createDuration(input - offset, 'm'),\n 1,\n false\n );\n } else if (!this._changeInProgress) {\n this._changeInProgress = true;\n hooks.updateOffset(this, true);\n this._changeInProgress = null;\n }\n }\n return this;\n } else {\n return this._isUTC ? offset : getDateOffset(this);\n }\n}\n\nfunction getSetZone(input, keepLocalTime) {\n if (input != null) {\n if (typeof input !== 'string') {\n input = -input;\n }\n\n this.utcOffset(input, keepLocalTime);\n\n return this;\n } else {\n return -this.utcOffset();\n }\n}\n\nfunction setOffsetToUTC(keepLocalTime) {\n return this.utcOffset(0, keepLocalTime);\n}\n\nfunction setOffsetToLocal(keepLocalTime) {\n if (this._isUTC) {\n this.utcOffset(0, keepLocalTime);\n this._isUTC = false;\n\n if (keepLocalTime) {\n this.subtract(getDateOffset(this), 'm');\n }\n }\n return this;\n}\n\nfunction setOffsetToParsedOffset() {\n if (this._tzm != null) {\n this.utcOffset(this._tzm, false, true);\n } else if (typeof this._i === 'string') {\n var tZone = offsetFromString(matchOffset, this._i);\n if (tZone != null) {\n this.utcOffset(tZone);\n } else {\n this.utcOffset(0, true);\n }\n }\n return this;\n}\n\nfunction hasAlignedHourOffset(input) {\n if (!this.isValid()) {\n return false;\n }\n input = input ? createLocal(input).utcOffset() : 0;\n\n return (this.utcOffset() - input) % 60 === 0;\n}\n\nfunction isDaylightSavingTime() {\n return (\n this.utcOffset() > this.clone().month(0).utcOffset() ||\n this.utcOffset() > this.clone().month(5).utcOffset()\n );\n}\n\nfunction isDaylightSavingTimeShifted() {\n if (!isUndefined(this._isDSTShifted)) {\n return this._isDSTShifted;\n }\n\n var c = {},\n other;\n\n copyConfig(c, this);\n c = prepareConfig(c);\n\n if (c._a) {\n other = c._isUTC ? createUTC(c._a) : createLocal(c._a);\n this._isDSTShifted =\n this.isValid() && compareArrays(c._a, other.toArray()) > 0;\n } else {\n this._isDSTShifted = false;\n }\n\n return this._isDSTShifted;\n}\n\nfunction isLocal() {\n return this.isValid() ? !this._isUTC : false;\n}\n\nfunction isUtcOffset() {\n return this.isValid() ? this._isUTC : false;\n}\n\nfunction isUtc() {\n return this.isValid() ? this._isUTC && this._offset === 0 : false;\n}\n\n// ASP.NET json date format regex\nvar aspNetRegex = /^(-|\\+)?(?:(\\d*)[. ])?(\\d+):(\\d+)(?::(\\d+)(\\.\\d*)?)?$/,\n // from http://docs.closure-library.googlecode.com/git/closure_goog_date_date.js.source.html\n // somewhat more in line with 4.4.3.2 2004 spec, but allows decimal anywhere\n // and further modified to allow for strings containing both week and day\n isoRegex =\n /^(-|\\+)?P(?:([-+]?[0-9,.]*)Y)?(?:([-+]?[0-9,.]*)M)?(?:([-+]?[0-9,.]*)W)?(?:([-+]?[0-9,.]*)D)?(?:T(?:([-+]?[0-9,.]*)H)?(?:([-+]?[0-9,.]*)M)?(?:([-+]?[0-9,.]*)S)?)?$/;\n\nfunction createDuration(input, key) {\n var duration = input,\n // matching against regexp is expensive, do it on demand\n match = null,\n sign,\n ret,\n diffRes;\n\n if (isDuration(input)) {\n duration = {\n ms: input._milliseconds,\n d: input._days,\n M: input._months,\n };\n } else if (isNumber(input) || !isNaN(+input)) {\n duration = {};\n if (key) {\n duration[key] = +input;\n } else {\n duration.milliseconds = +input;\n }\n } else if ((match = aspNetRegex.exec(input))) {\n sign = match[1] === '-' ? -1 : 1;\n duration = {\n y: 0,\n d: toInt(match[DATE]) * sign,\n h: toInt(match[HOUR]) * sign,\n m: toInt(match[MINUTE]) * sign,\n s: toInt(match[SECOND]) * sign,\n ms: toInt(absRound(match[MILLISECOND] * 1000)) * sign, // the millisecond decimal point is included in the match\n };\n } else if ((match = isoRegex.exec(input))) {\n sign = match[1] === '-' ? -1 : 1;\n duration = {\n y: parseIso(match[2], sign),\n M: parseIso(match[3], sign),\n w: parseIso(match[4], sign),\n d: parseIso(match[5], sign),\n h: parseIso(match[6], sign),\n m: parseIso(match[7], sign),\n s: parseIso(match[8], sign),\n };\n } else if (duration == null) {\n // checks for null or undefined\n duration = {};\n } else if (\n typeof duration === 'object' &&\n ('from' in duration || 'to' in duration)\n ) {\n diffRes = momentsDifference(\n createLocal(duration.from),\n createLocal(duration.to)\n );\n\n duration = {};\n duration.ms = diffRes.milliseconds;\n duration.M = diffRes.months;\n }\n\n ret = new Duration(duration);\n\n if (isDuration(input) && hasOwnProp(input, '_locale')) {\n ret._locale = input._locale;\n }\n\n if (isDuration(input) && hasOwnProp(input, '_isValid')) {\n ret._isValid = input._isValid;\n }\n\n return ret;\n}\n\ncreateDuration.fn = Duration.prototype;\ncreateDuration.invalid = createInvalid$1;\n\nfunction parseIso(inp, sign) {\n // We'd normally use ~~inp for this, but unfortunately it also\n // converts floats to ints.\n // inp may be undefined, so careful calling replace on it.\n var res = inp && parseFloat(inp.replace(',', '.'));\n // apply sign while we're at it\n return (isNaN(res) ? 0 : res) * sign;\n}\n\nfunction positiveMomentsDifference(base, other) {\n var res = {};\n\n res.months =\n other.month() - base.month() + (other.year() - base.year()) * 12;\n if (base.clone().add(res.months, 'M').isAfter(other)) {\n --res.months;\n }\n\n res.milliseconds = +other - +base.clone().add(res.months, 'M');\n\n return res;\n}\n\nfunction momentsDifference(base, other) {\n var res;\n if (!(base.isValid() && other.isValid())) {\n return { milliseconds: 0, months: 0 };\n }\n\n other = cloneWithOffset(other, base);\n if (base.isBefore(other)) {\n res = positiveMomentsDifference(base, other);\n } else {\n res = positiveMomentsDifference(other, base);\n res.milliseconds = -res.milliseconds;\n res.months = -res.months;\n }\n\n return res;\n}\n\n// TODO: remove 'name' arg after deprecation is removed\nfunction createAdder(direction, name) {\n return function (val, period) {\n var dur, tmp;\n //invert the arguments, but complain about it\n if (period !== null && !isNaN(+period)) {\n deprecateSimple(\n name,\n 'moment().' +\n name +\n '(period, number) is deprecated. Please use moment().' +\n name +\n '(number, period). ' +\n 'See http://momentjs.com/guides/#/warnings/add-inverted-param/ for more info.'\n );\n tmp = val;\n val = period;\n period = tmp;\n }\n\n dur = createDuration(val, period);\n addSubtract(this, dur, direction);\n return this;\n };\n}\n\nfunction addSubtract(mom, duration, isAdding, updateOffset) {\n var milliseconds = duration._milliseconds,\n days = absRound(duration._days),\n months = absRound(duration._months);\n\n if (!mom.isValid()) {\n // No op\n return;\n }\n\n updateOffset = updateOffset == null ? true : updateOffset;\n\n if (months) {\n setMonth(mom, get(mom, 'Month') + months * isAdding);\n }\n if (days) {\n set$1(mom, 'Date', get(mom, 'Date') + days * isAdding);\n }\n if (milliseconds) {\n mom._d.setTime(mom._d.valueOf() + milliseconds * isAdding);\n }\n if (updateOffset) {\n hooks.updateOffset(mom, days || months);\n }\n}\n\nvar add = createAdder(1, 'add'),\n subtract = createAdder(-1, 'subtract');\n\nfunction isString(input) {\n return typeof input === 'string' || input instanceof String;\n}\n\n// type MomentInput = Moment | Date | string | number | (number | string)[] | MomentInputObject | void; // null | undefined\nfunction isMomentInput(input) {\n return (\n isMoment(input) ||\n isDate(input) ||\n isString(input) ||\n isNumber(input) ||\n isNumberOrStringArray(input) ||\n isMomentInputObject(input) ||\n input === null ||\n input === undefined\n );\n}\n\nfunction isMomentInputObject(input) {\n var objectTest = isObject(input) && !isObjectEmpty(input),\n propertyTest = false,\n properties = [\n 'years',\n 'year',\n 'y',\n 'months',\n 'month',\n 'M',\n 'days',\n 'day',\n 'd',\n 'dates',\n 'date',\n 'D',\n 'hours',\n 'hour',\n 'h',\n 'minutes',\n 'minute',\n 'm',\n 'seconds',\n 'second',\n 's',\n 'milliseconds',\n 'millisecond',\n 'ms',\n ],\n i,\n property,\n propertyLen = properties.length;\n\n for (i = 0; i < propertyLen; i += 1) {\n property = properties[i];\n propertyTest = propertyTest || hasOwnProp(input, property);\n }\n\n return objectTest && propertyTest;\n}\n\nfunction isNumberOrStringArray(input) {\n var arrayTest = isArray(input),\n dataTypeTest = false;\n if (arrayTest) {\n dataTypeTest =\n input.filter(function (item) {\n return !isNumber(item) && isString(input);\n }).length === 0;\n }\n return arrayTest && dataTypeTest;\n}\n\nfunction isCalendarSpec(input) {\n var objectTest = isObject(input) && !isObjectEmpty(input),\n propertyTest = false,\n properties = [\n 'sameDay',\n 'nextDay',\n 'lastDay',\n 'nextWeek',\n 'lastWeek',\n 'sameElse',\n ],\n i,\n property;\n\n for (i = 0; i < properties.length; i += 1) {\n property = properties[i];\n propertyTest = propertyTest || hasOwnProp(input, property);\n }\n\n return objectTest && propertyTest;\n}\n\nfunction getCalendarFormat(myMoment, now) {\n var diff = myMoment.diff(now, 'days', true);\n return diff < -6\n ? 'sameElse'\n : diff < -1\n ? 'lastWeek'\n : diff < 0\n ? 'lastDay'\n : diff < 1\n ? 'sameDay'\n : diff < 2\n ? 'nextDay'\n : diff < 7\n ? 'nextWeek'\n : 'sameElse';\n}\n\nfunction calendar$1(time, formats) {\n // Support for single parameter, formats only overload to the calendar function\n if (arguments.length === 1) {\n if (!arguments[0]) {\n time = undefined;\n formats = undefined;\n } else if (isMomentInput(arguments[0])) {\n time = arguments[0];\n formats = undefined;\n } else if (isCalendarSpec(arguments[0])) {\n formats = arguments[0];\n time = undefined;\n }\n }\n // We want to compare the start of today, vs this.\n // Getting start-of-today depends on whether we're local/utc/offset or not.\n var now = time || createLocal(),\n sod = cloneWithOffset(now, this).startOf('day'),\n format = hooks.calendarFormat(this, sod) || 'sameElse',\n output =\n formats &&\n (isFunction(formats[format])\n ? formats[format].call(this, now)\n : formats[format]);\n\n return this.format(\n output || this.localeData().calendar(format, this, createLocal(now))\n );\n}\n\nfunction clone() {\n return new Moment(this);\n}\n\nfunction isAfter(input, units) {\n var localInput = isMoment(input) ? input : createLocal(input);\n if (!(this.isValid() && localInput.isValid())) {\n return false;\n }\n units = normalizeUnits(units) || 'millisecond';\n if (units === 'millisecond') {\n return this.valueOf() > localInput.valueOf();\n } else {\n return localInput.valueOf() < this.clone().startOf(units).valueOf();\n }\n}\n\nfunction isBefore(input, units) {\n var localInput = isMoment(input) ? input : createLocal(input);\n if (!(this.isValid() && localInput.isValid())) {\n return false;\n }\n units = normalizeUnits(units) || 'millisecond';\n if (units === 'millisecond') {\n return this.valueOf() < localInput.valueOf();\n } else {\n return this.clone().endOf(units).valueOf() < localInput.valueOf();\n }\n}\n\nfunction isBetween(from, to, units, inclusivity) {\n var localFrom = isMoment(from) ? from : createLocal(from),\n localTo = isMoment(to) ? to : createLocal(to);\n if (!(this.isValid() && localFrom.isValid() && localTo.isValid())) {\n return false;\n }\n inclusivity = inclusivity || '()';\n return (\n (inclusivity[0] === '('\n ? this.isAfter(localFrom, units)\n : !this.isBefore(localFrom, units)) &&\n (inclusivity[1] === ')'\n ? this.isBefore(localTo, units)\n : !this.isAfter(localTo, units))\n );\n}\n\nfunction isSame(input, units) {\n var localInput = isMoment(input) ? input : createLocal(input),\n inputMs;\n if (!(this.isValid() && localInput.isValid())) {\n return false;\n }\n units = normalizeUnits(units) || 'millisecond';\n if (units === 'millisecond') {\n return this.valueOf() === localInput.valueOf();\n } else {\n inputMs = localInput.valueOf();\n return (\n this.clone().startOf(units).valueOf() <= inputMs &&\n inputMs <= this.clone().endOf(units).valueOf()\n );\n }\n}\n\nfunction isSameOrAfter(input, units) {\n return this.isSame(input, units) || this.isAfter(input, units);\n}\n\nfunction isSameOrBefore(input, units) {\n return this.isSame(input, units) || this.isBefore(input, units);\n}\n\nfunction diff(input, units, asFloat) {\n var that, zoneDelta, output;\n\n if (!this.isValid()) {\n return NaN;\n }\n\n that = cloneWithOffset(input, this);\n\n if (!that.isValid()) {\n return NaN;\n }\n\n zoneDelta = (that.utcOffset() - this.utcOffset()) * 6e4;\n\n units = normalizeUnits(units);\n\n switch (units) {\n case 'year':\n output = monthDiff(this, that) / 12;\n break;\n case 'month':\n output = monthDiff(this, that);\n break;\n case 'quarter':\n output = monthDiff(this, that) / 3;\n break;\n case 'second':\n output = (this - that) / 1e3;\n break; // 1000\n case 'minute':\n output = (this - that) / 6e4;\n break; // 1000 * 60\n case 'hour':\n output = (this - that) / 36e5;\n break; // 1000 * 60 * 60\n case 'day':\n output = (this - that - zoneDelta) / 864e5;\n break; // 1000 * 60 * 60 * 24, negate dst\n case 'week':\n output = (this - that - zoneDelta) / 6048e5;\n break; // 1000 * 60 * 60 * 24 * 7, negate dst\n default:\n output = this - that;\n }\n\n return asFloat ? output : absFloor(output);\n}\n\nfunction monthDiff(a, b) {\n if (a.date() < b.date()) {\n // end-of-month calculations work correct when the start month has more\n // days than the end month.\n return -monthDiff(b, a);\n }\n // difference in months\n var wholeMonthDiff = (b.year() - a.year()) * 12 + (b.month() - a.month()),\n // b is in (anchor - 1 month, anchor + 1 month)\n anchor = a.clone().add(wholeMonthDiff, 'months'),\n anchor2,\n adjust;\n\n if (b - anchor < 0) {\n anchor2 = a.clone().add(wholeMonthDiff - 1, 'months');\n // linear across the month\n adjust = (b - anchor) / (anchor - anchor2);\n } else {\n anchor2 = a.clone().add(wholeMonthDiff + 1, 'months');\n // linear across the month\n adjust = (b - anchor) / (anchor2 - anchor);\n }\n\n //check for negative zero, return zero if negative zero\n return -(wholeMonthDiff + adjust) || 0;\n}\n\nhooks.defaultFormat = 'YYYY-MM-DDTHH:mm:ssZ';\nhooks.defaultFormatUtc = 'YYYY-MM-DDTHH:mm:ss[Z]';\n\nfunction toString() {\n return this.clone().locale('en').format('ddd MMM DD YYYY HH:mm:ss [GMT]ZZ');\n}\n\nfunction toISOString(keepOffset) {\n if (!this.isValid()) {\n return null;\n }\n var utc = keepOffset !== true,\n m = utc ? this.clone().utc() : this;\n if (m.year() < 0 || m.year() > 9999) {\n return formatMoment(\n m,\n utc\n ? 'YYYYYY-MM-DD[T]HH:mm:ss.SSS[Z]'\n : 'YYYYYY-MM-DD[T]HH:mm:ss.SSSZ'\n );\n }\n if (isFunction(Date.prototype.toISOString)) {\n // native implementation is ~50x faster, use it when we can\n if (utc) {\n return this.toDate().toISOString();\n } else {\n return new Date(this.valueOf() + this.utcOffset() * 60 * 1000)\n .toISOString()\n .replace('Z', formatMoment(m, 'Z'));\n }\n }\n return formatMoment(\n m,\n utc ? 'YYYY-MM-DD[T]HH:mm:ss.SSS[Z]' : 'YYYY-MM-DD[T]HH:mm:ss.SSSZ'\n );\n}\n\n/**\n * Return a human readable representation of a moment that can\n * also be evaluated to get a new moment which is the same\n *\n * @link https://nodejs.org/dist/latest/docs/api/util.html#util_custom_inspect_function_on_objects\n */\nfunction inspect() {\n if (!this.isValid()) {\n return 'moment.invalid(/* ' + this._i + ' */)';\n }\n var func = 'moment',\n zone = '',\n prefix,\n year,\n datetime,\n suffix;\n if (!this.isLocal()) {\n func = this.utcOffset() === 0 ? 'moment.utc' : 'moment.parseZone';\n zone = 'Z';\n }\n prefix = '[' + func + '(\"]';\n year = 0 <= this.year() && this.year() <= 9999 ? 'YYYY' : 'YYYYYY';\n datetime = '-MM-DD[T]HH:mm:ss.SSS';\n suffix = zone + '[\")]';\n\n return this.format(prefix + year + datetime + suffix);\n}\n\nfunction format(inputString) {\n if (!inputString) {\n inputString = this.isUtc()\n ? hooks.defaultFormatUtc\n : hooks.defaultFormat;\n }\n var output = formatMoment(this, inputString);\n return this.localeData().postformat(output);\n}\n\nfunction from(time, withoutSuffix) {\n if (\n this.isValid() &&\n ((isMoment(time) && time.isValid()) || createLocal(time).isValid())\n ) {\n return createDuration({ to: this, from: time })\n .locale(this.locale())\n .humanize(!withoutSuffix);\n } else {\n return this.localeData().invalidDate();\n }\n}\n\nfunction fromNow(withoutSuffix) {\n return this.from(createLocal(), withoutSuffix);\n}\n\nfunction to(time, withoutSuffix) {\n if (\n this.isValid() &&\n ((isMoment(time) && time.isValid()) || createLocal(time).isValid())\n ) {\n return createDuration({ from: this, to: time })\n .locale(this.locale())\n .humanize(!withoutSuffix);\n } else {\n return this.localeData().invalidDate();\n }\n}\n\nfunction toNow(withoutSuffix) {\n return this.to(createLocal(), withoutSuffix);\n}\n\n// If passed a locale key, it will set the locale for this\n// instance. Otherwise, it will return the locale configuration\n// variables for this instance.\nfunction locale(key) {\n var newLocaleData;\n\n if (key === undefined) {\n return this._locale._abbr;\n } else {\n newLocaleData = getLocale(key);\n if (newLocaleData != null) {\n this._locale = newLocaleData;\n }\n return this;\n }\n}\n\nvar lang = deprecate(\n 'moment().lang() is deprecated. Instead, use moment().localeData() to get the language configuration. Use moment().locale() to change languages.',\n function (key) {\n if (key === undefined) {\n return this.localeData();\n } else {\n return this.locale(key);\n }\n }\n);\n\nfunction localeData() {\n return this._locale;\n}\n\nvar MS_PER_SECOND = 1000,\n MS_PER_MINUTE = 60 * MS_PER_SECOND,\n MS_PER_HOUR = 60 * MS_PER_MINUTE,\n MS_PER_400_YEARS = (365 * 400 + 97) * 24 * MS_PER_HOUR;\n\n// actual modulo - handles negative numbers (for dates before 1970):\nfunction mod$1(dividend, divisor) {\n return ((dividend % divisor) + divisor) % divisor;\n}\n\nfunction localStartOfDate(y, m, d) {\n // the date constructor remaps years 0-99 to 1900-1999\n if (y < 100 && y >= 0) {\n // preserve leap years using a full 400 year cycle, then reset\n return new Date(y + 400, m, d) - MS_PER_400_YEARS;\n } else {\n return new Date(y, m, d).valueOf();\n }\n}\n\nfunction utcStartOfDate(y, m, d) {\n // Date.UTC remaps years 0-99 to 1900-1999\n if (y < 100 && y >= 0) {\n // preserve leap years using a full 400 year cycle, then reset\n return Date.UTC(y + 400, m, d) - MS_PER_400_YEARS;\n } else {\n return Date.UTC(y, m, d);\n }\n}\n\nfunction startOf(units) {\n var time, startOfDate;\n units = normalizeUnits(units);\n if (units === undefined || units === 'millisecond' || !this.isValid()) {\n return this;\n }\n\n startOfDate = this._isUTC ? utcStartOfDate : localStartOfDate;\n\n switch (units) {\n case 'year':\n time = startOfDate(this.year(), 0, 1);\n break;\n case 'quarter':\n time = startOfDate(\n this.year(),\n this.month() - (this.month() % 3),\n 1\n );\n break;\n case 'month':\n time = startOfDate(this.year(), this.month(), 1);\n break;\n case 'week':\n time = startOfDate(\n this.year(),\n this.month(),\n this.date() - this.weekday()\n );\n break;\n case 'isoWeek':\n time = startOfDate(\n this.year(),\n this.month(),\n this.date() - (this.isoWeekday() - 1)\n );\n break;\n case 'day':\n case 'date':\n time = startOfDate(this.year(), this.month(), this.date());\n break;\n case 'hour':\n time = this._d.valueOf();\n time -= mod$1(\n time + (this._isUTC ? 0 : this.utcOffset() * MS_PER_MINUTE),\n MS_PER_HOUR\n );\n break;\n case 'minute':\n time = this._d.valueOf();\n time -= mod$1(time, MS_PER_MINUTE);\n break;\n case 'second':\n time = this._d.valueOf();\n time -= mod$1(time, MS_PER_SECOND);\n break;\n }\n\n this._d.setTime(time);\n hooks.updateOffset(this, true);\n return this;\n}\n\nfunction endOf(units) {\n var time, startOfDate;\n units = normalizeUnits(units);\n if (units === undefined || units === 'millisecond' || !this.isValid()) {\n return this;\n }\n\n startOfDate = this._isUTC ? utcStartOfDate : localStartOfDate;\n\n switch (units) {\n case 'year':\n time = startOfDate(this.year() + 1, 0, 1) - 1;\n break;\n case 'quarter':\n time =\n startOfDate(\n this.year(),\n this.month() - (this.month() % 3) + 3,\n 1\n ) - 1;\n break;\n case 'month':\n time = startOfDate(this.year(), this.month() + 1, 1) - 1;\n break;\n case 'week':\n time =\n startOfDate(\n this.year(),\n this.month(),\n this.date() - this.weekday() + 7\n ) - 1;\n break;\n case 'isoWeek':\n time =\n startOfDate(\n this.year(),\n this.month(),\n this.date() - (this.isoWeekday() - 1) + 7\n ) - 1;\n break;\n case 'day':\n case 'date':\n time = startOfDate(this.year(), this.month(), this.date() + 1) - 1;\n break;\n case 'hour':\n time = this._d.valueOf();\n time +=\n MS_PER_HOUR -\n mod$1(\n time + (this._isUTC ? 0 : this.utcOffset() * MS_PER_MINUTE),\n MS_PER_HOUR\n ) -\n 1;\n break;\n case 'minute':\n time = this._d.valueOf();\n time += MS_PER_MINUTE - mod$1(time, MS_PER_MINUTE) - 1;\n break;\n case 'second':\n time = this._d.valueOf();\n time += MS_PER_SECOND - mod$1(time, MS_PER_SECOND) - 1;\n break;\n }\n\n this._d.setTime(time);\n hooks.updateOffset(this, true);\n return this;\n}\n\nfunction valueOf() {\n return this._d.valueOf() - (this._offset || 0) * 60000;\n}\n\nfunction unix() {\n return Math.floor(this.valueOf() / 1000);\n}\n\nfunction toDate() {\n return new Date(this.valueOf());\n}\n\nfunction toArray() {\n var m = this;\n return [\n m.year(),\n m.month(),\n m.date(),\n m.hour(),\n m.minute(),\n m.second(),\n m.millisecond(),\n ];\n}\n\nfunction toObject() {\n var m = this;\n return {\n years: m.year(),\n months: m.month(),\n date: m.date(),\n hours: m.hours(),\n minutes: m.minutes(),\n seconds: m.seconds(),\n milliseconds: m.milliseconds(),\n };\n}\n\nfunction toJSON() {\n // new Date(NaN).toJSON() === null\n return this.isValid() ? this.toISOString() : null;\n}\n\nfunction isValid$2() {\n return isValid(this);\n}\n\nfunction parsingFlags() {\n return extend({}, getParsingFlags(this));\n}\n\nfunction invalidAt() {\n return getParsingFlags(this).overflow;\n}\n\nfunction creationData() {\n return {\n input: this._i,\n format: this._f,\n locale: this._locale,\n isUTC: this._isUTC,\n strict: this._strict,\n };\n}\n\naddFormatToken('N', 0, 0, 'eraAbbr');\naddFormatToken('NN', 0, 0, 'eraAbbr');\naddFormatToken('NNN', 0, 0, 'eraAbbr');\naddFormatToken('NNNN', 0, 0, 'eraName');\naddFormatToken('NNNNN', 0, 0, 'eraNarrow');\n\naddFormatToken('y', ['y', 1], 'yo', 'eraYear');\naddFormatToken('y', ['yy', 2], 0, 'eraYear');\naddFormatToken('y', ['yyy', 3], 0, 'eraYear');\naddFormatToken('y', ['yyyy', 4], 0, 'eraYear');\n\naddRegexToken('N', matchEraAbbr);\naddRegexToken('NN', matchEraAbbr);\naddRegexToken('NNN', matchEraAbbr);\naddRegexToken('NNNN', matchEraName);\naddRegexToken('NNNNN', matchEraNarrow);\n\naddParseToken(\n ['N', 'NN', 'NNN', 'NNNN', 'NNNNN'],\n function (input, array, config, token) {\n var era = config._locale.erasParse(input, token, config._strict);\n if (era) {\n getParsingFlags(config).era = era;\n } else {\n getParsingFlags(config).invalidEra = input;\n }\n }\n);\n\naddRegexToken('y', matchUnsigned);\naddRegexToken('yy', matchUnsigned);\naddRegexToken('yyy', matchUnsigned);\naddRegexToken('yyyy', matchUnsigned);\naddRegexToken('yo', matchEraYearOrdinal);\n\naddParseToken(['y', 'yy', 'yyy', 'yyyy'], YEAR);\naddParseToken(['yo'], function (input, array, config, token) {\n var match;\n if (config._locale._eraYearOrdinalRegex) {\n match = input.match(config._locale._eraYearOrdinalRegex);\n }\n\n if (config._locale.eraYearOrdinalParse) {\n array[YEAR] = config._locale.eraYearOrdinalParse(input, match);\n } else {\n array[YEAR] = parseInt(input, 10);\n }\n});\n\nfunction localeEras(m, format) {\n var i,\n l,\n date,\n eras = this._eras || getLocale('en')._eras;\n for (i = 0, l = eras.length; i < l; ++i) {\n switch (typeof eras[i].since) {\n case 'string':\n // truncate time\n date = hooks(eras[i].since).startOf('day');\n eras[i].since = date.valueOf();\n break;\n }\n\n switch (typeof eras[i].until) {\n case 'undefined':\n eras[i].until = +Infinity;\n break;\n case 'string':\n // truncate time\n date = hooks(eras[i].until).startOf('day').valueOf();\n eras[i].until = date.valueOf();\n break;\n }\n }\n return eras;\n}\n\nfunction localeErasParse(eraName, format, strict) {\n var i,\n l,\n eras = this.eras(),\n name,\n abbr,\n narrow;\n eraName = eraName.toUpperCase();\n\n for (i = 0, l = eras.length; i < l; ++i) {\n name = eras[i].name.toUpperCase();\n abbr = eras[i].abbr.toUpperCase();\n narrow = eras[i].narrow.toUpperCase();\n\n if (strict) {\n switch (format) {\n case 'N':\n case 'NN':\n case 'NNN':\n if (abbr === eraName) {\n return eras[i];\n }\n break;\n\n case 'NNNN':\n if (name === eraName) {\n return eras[i];\n }\n break;\n\n case 'NNNNN':\n if (narrow === eraName) {\n return eras[i];\n }\n break;\n }\n } else if ([name, abbr, narrow].indexOf(eraName) >= 0) {\n return eras[i];\n }\n }\n}\n\nfunction localeErasConvertYear(era, year) {\n var dir = era.since <= era.until ? +1 : -1;\n if (year === undefined) {\n return hooks(era.since).year();\n } else {\n return hooks(era.since).year() + (year - era.offset) * dir;\n }\n}\n\nfunction getEraName() {\n var i,\n l,\n val,\n eras = this.localeData().eras();\n for (i = 0, l = eras.length; i < l; ++i) {\n // truncate time\n val = this.clone().startOf('day').valueOf();\n\n if (eras[i].since <= val && val <= eras[i].until) {\n return eras[i].name;\n }\n if (eras[i].until <= val && val <= eras[i].since) {\n return eras[i].name;\n }\n }\n\n return '';\n}\n\nfunction getEraNarrow() {\n var i,\n l,\n val,\n eras = this.localeData().eras();\n for (i = 0, l = eras.length; i < l; ++i) {\n // truncate time\n val = this.clone().startOf('day').valueOf();\n\n if (eras[i].since <= val && val <= eras[i].until) {\n return eras[i].narrow;\n }\n if (eras[i].until <= val && val <= eras[i].since) {\n return eras[i].narrow;\n }\n }\n\n return '';\n}\n\nfunction getEraAbbr() {\n var i,\n l,\n val,\n eras = this.localeData().eras();\n for (i = 0, l = eras.length; i < l; ++i) {\n // truncate time\n val = this.clone().startOf('day').valueOf();\n\n if (eras[i].since <= val && val <= eras[i].until) {\n return eras[i].abbr;\n }\n if (eras[i].until <= val && val <= eras[i].since) {\n return eras[i].abbr;\n }\n }\n\n return '';\n}\n\nfunction getEraYear() {\n var i,\n l,\n dir,\n val,\n eras = this.localeData().eras();\n for (i = 0, l = eras.length; i < l; ++i) {\n dir = eras[i].since <= eras[i].until ? +1 : -1;\n\n // truncate time\n val = this.clone().startOf('day').valueOf();\n\n if (\n (eras[i].since <= val && val <= eras[i].until) ||\n (eras[i].until <= val && val <= eras[i].since)\n ) {\n return (\n (this.year() - hooks(eras[i].since).year()) * dir +\n eras[i].offset\n );\n }\n }\n\n return this.year();\n}\n\nfunction erasNameRegex(isStrict) {\n if (!hasOwnProp(this, '_erasNameRegex')) {\n computeErasParse.call(this);\n }\n return isStrict ? this._erasNameRegex : this._erasRegex;\n}\n\nfunction erasAbbrRegex(isStrict) {\n if (!hasOwnProp(this, '_erasAbbrRegex')) {\n computeErasParse.call(this);\n }\n return isStrict ? this._erasAbbrRegex : this._erasRegex;\n}\n\nfunction erasNarrowRegex(isStrict) {\n if (!hasOwnProp(this, '_erasNarrowRegex')) {\n computeErasParse.call(this);\n }\n return isStrict ? this._erasNarrowRegex : this._erasRegex;\n}\n\nfunction matchEraAbbr(isStrict, locale) {\n return locale.erasAbbrRegex(isStrict);\n}\n\nfunction matchEraName(isStrict, locale) {\n return locale.erasNameRegex(isStrict);\n}\n\nfunction matchEraNarrow(isStrict, locale) {\n return locale.erasNarrowRegex(isStrict);\n}\n\nfunction matchEraYearOrdinal(isStrict, locale) {\n return locale._eraYearOrdinalRegex || matchUnsigned;\n}\n\nfunction computeErasParse() {\n var abbrPieces = [],\n namePieces = [],\n narrowPieces = [],\n mixedPieces = [],\n i,\n l,\n erasName,\n erasAbbr,\n erasNarrow,\n eras = this.eras();\n\n for (i = 0, l = eras.length; i < l; ++i) {\n erasName = regexEscape(eras[i].name);\n erasAbbr = regexEscape(eras[i].abbr);\n erasNarrow = regexEscape(eras[i].narrow);\n\n namePieces.push(erasName);\n abbrPieces.push(erasAbbr);\n narrowPieces.push(erasNarrow);\n mixedPieces.push(erasName);\n mixedPieces.push(erasAbbr);\n mixedPieces.push(erasNarrow);\n }\n\n this._erasRegex = new RegExp('^(' + mixedPieces.join('|') + ')', 'i');\n this._erasNameRegex = new RegExp('^(' + namePieces.join('|') + ')', 'i');\n this._erasAbbrRegex = new RegExp('^(' + abbrPieces.join('|') + ')', 'i');\n this._erasNarrowRegex = new RegExp(\n '^(' + narrowPieces.join('|') + ')',\n 'i'\n );\n}\n\n// FORMATTING\n\naddFormatToken(0, ['gg', 2], 0, function () {\n return this.weekYear() % 100;\n});\n\naddFormatToken(0, ['GG', 2], 0, function () {\n return this.isoWeekYear() % 100;\n});\n\nfunction addWeekYearFormatToken(token, getter) {\n addFormatToken(0, [token, token.length], 0, getter);\n}\n\naddWeekYearFormatToken('gggg', 'weekYear');\naddWeekYearFormatToken('ggggg', 'weekYear');\naddWeekYearFormatToken('GGGG', 'isoWeekYear');\naddWeekYearFormatToken('GGGGG', 'isoWeekYear');\n\n// ALIASES\n\n// PARSING\n\naddRegexToken('G', matchSigned);\naddRegexToken('g', matchSigned);\naddRegexToken('GG', match1to2, match2);\naddRegexToken('gg', match1to2, match2);\naddRegexToken('GGGG', match1to4, match4);\naddRegexToken('gggg', match1to4, match4);\naddRegexToken('GGGGG', match1to6, match6);\naddRegexToken('ggggg', match1to6, match6);\n\naddWeekParseToken(\n ['gggg', 'ggggg', 'GGGG', 'GGGGG'],\n function (input, week, config, token) {\n week[token.substr(0, 2)] = toInt(input);\n }\n);\n\naddWeekParseToken(['gg', 'GG'], function (input, week, config, token) {\n week[token] = hooks.parseTwoDigitYear(input);\n});\n\n// MOMENTS\n\nfunction getSetWeekYear(input) {\n return getSetWeekYearHelper.call(\n this,\n input,\n this.week(),\n this.weekday() + this.localeData()._week.dow,\n this.localeData()._week.dow,\n this.localeData()._week.doy\n );\n}\n\nfunction getSetISOWeekYear(input) {\n return getSetWeekYearHelper.call(\n this,\n input,\n this.isoWeek(),\n this.isoWeekday(),\n 1,\n 4\n );\n}\n\nfunction getISOWeeksInYear() {\n return weeksInYear(this.year(), 1, 4);\n}\n\nfunction getISOWeeksInISOWeekYear() {\n return weeksInYear(this.isoWeekYear(), 1, 4);\n}\n\nfunction getWeeksInYear() {\n var weekInfo = this.localeData()._week;\n return weeksInYear(this.year(), weekInfo.dow, weekInfo.doy);\n}\n\nfunction getWeeksInWeekYear() {\n var weekInfo = this.localeData()._week;\n return weeksInYear(this.weekYear(), weekInfo.dow, weekInfo.doy);\n}\n\nfunction getSetWeekYearHelper(input, week, weekday, dow, doy) {\n var weeksTarget;\n if (input == null) {\n return weekOfYear(this, dow, doy).year;\n } else {\n weeksTarget = weeksInYear(input, dow, doy);\n if (week > weeksTarget) {\n week = weeksTarget;\n }\n return setWeekAll.call(this, input, week, weekday, dow, doy);\n }\n}\n\nfunction setWeekAll(weekYear, week, weekday, dow, doy) {\n var dayOfYearData = dayOfYearFromWeeks(weekYear, week, weekday, dow, doy),\n date = createUTCDate(dayOfYearData.year, 0, dayOfYearData.dayOfYear);\n\n this.year(date.getUTCFullYear());\n this.month(date.getUTCMonth());\n this.date(date.getUTCDate());\n return this;\n}\n\n// FORMATTING\n\naddFormatToken('Q', 0, 'Qo', 'quarter');\n\n// PARSING\n\naddRegexToken('Q', match1);\naddParseToken('Q', function (input, array) {\n array[MONTH] = (toInt(input) - 1) * 3;\n});\n\n// MOMENTS\n\nfunction getSetQuarter(input) {\n return input == null\n ? Math.ceil((this.month() + 1) / 3)\n : this.month((input - 1) * 3 + (this.month() % 3));\n}\n\n// FORMATTING\n\naddFormatToken('D', ['DD', 2], 'Do', 'date');\n\n// PARSING\n\naddRegexToken('D', match1to2, match1to2NoLeadingZero);\naddRegexToken('DD', match1to2, match2);\naddRegexToken('Do', function (isStrict, locale) {\n // TODO: Remove \"ordinalParse\" fallback in next major release.\n return isStrict\n ? locale._dayOfMonthOrdinalParse || locale._ordinalParse\n : locale._dayOfMonthOrdinalParseLenient;\n});\n\naddParseToken(['D', 'DD'], DATE);\naddParseToken('Do', function (input, array) {\n array[DATE] = toInt(input.match(match1to2)[0]);\n});\n\n// MOMENTS\n\nvar getSetDayOfMonth = makeGetSet('Date', true);\n\n// FORMATTING\n\naddFormatToken('DDD', ['DDDD', 3], 'DDDo', 'dayOfYear');\n\n// PARSING\n\naddRegexToken('DDD', match1to3);\naddRegexToken('DDDD', match3);\naddParseToken(['DDD', 'DDDD'], function (input, array, config) {\n config._dayOfYear = toInt(input);\n});\n\n// HELPERS\n\n// MOMENTS\n\nfunction getSetDayOfYear(input) {\n var dayOfYear =\n Math.round(\n (this.clone().startOf('day') - this.clone().startOf('year')) / 864e5\n ) + 1;\n return input == null ? dayOfYear : this.add(input - dayOfYear, 'd');\n}\n\n// FORMATTING\n\naddFormatToken('m', ['mm', 2], 0, 'minute');\n\n// PARSING\n\naddRegexToken('m', match1to2, match1to2HasZero);\naddRegexToken('mm', match1to2, match2);\naddParseToken(['m', 'mm'], MINUTE);\n\n// MOMENTS\n\nvar getSetMinute = makeGetSet('Minutes', false);\n\n// FORMATTING\n\naddFormatToken('s', ['ss', 2], 0, 'second');\n\n// PARSING\n\naddRegexToken('s', match1to2, match1to2HasZero);\naddRegexToken('ss', match1to2, match2);\naddParseToken(['s', 'ss'], SECOND);\n\n// MOMENTS\n\nvar getSetSecond = makeGetSet('Seconds', false);\n\n// FORMATTING\n\naddFormatToken('S', 0, 0, function () {\n return ~~(this.millisecond() / 100);\n});\n\naddFormatToken(0, ['SS', 2], 0, function () {\n return ~~(this.millisecond() / 10);\n});\n\naddFormatToken(0, ['SSS', 3], 0, 'millisecond');\naddFormatToken(0, ['SSSS', 4], 0, function () {\n return this.millisecond() * 10;\n});\naddFormatToken(0, ['SSSSS', 5], 0, function () {\n return this.millisecond() * 100;\n});\naddFormatToken(0, ['SSSSSS', 6], 0, function () {\n return this.millisecond() * 1000;\n});\naddFormatToken(0, ['SSSSSSS', 7], 0, function () {\n return this.millisecond() * 10000;\n});\naddFormatToken(0, ['SSSSSSSS', 8], 0, function () {\n return this.millisecond() * 100000;\n});\naddFormatToken(0, ['SSSSSSSSS', 9], 0, function () {\n return this.millisecond() * 1000000;\n});\n\n// PARSING\n\naddRegexToken('S', match1to3, match1);\naddRegexToken('SS', match1to3, match2);\naddRegexToken('SSS', match1to3, match3);\n\nvar token, getSetMillisecond;\nfor (token = 'SSSS'; token.length <= 9; token += 'S') {\n addRegexToken(token, matchUnsigned);\n}\n\nfunction parseMs(input, array) {\n array[MILLISECOND] = toInt(('0.' + input) * 1000);\n}\n\nfor (token = 'S'; token.length <= 9; token += 'S') {\n addParseToken(token, parseMs);\n}\n\ngetSetMillisecond = makeGetSet('Milliseconds', false);\n\n// FORMATTING\n\naddFormatToken('z', 0, 0, 'zoneAbbr');\naddFormatToken('zz', 0, 0, 'zoneName');\n\n// MOMENTS\n\nfunction getZoneAbbr() {\n return this._isUTC ? 'UTC' : '';\n}\n\nfunction getZoneName() {\n return this._isUTC ? 'Coordinated Universal Time' : '';\n}\n\nvar proto = Moment.prototype;\n\nproto.add = add;\nproto.calendar = calendar$1;\nproto.clone = clone;\nproto.diff = diff;\nproto.endOf = endOf;\nproto.format = format;\nproto.from = from;\nproto.fromNow = fromNow;\nproto.to = to;\nproto.toNow = toNow;\nproto.get = stringGet;\nproto.invalidAt = invalidAt;\nproto.isAfter = isAfter;\nproto.isBefore = isBefore;\nproto.isBetween = isBetween;\nproto.isSame = isSame;\nproto.isSameOrAfter = isSameOrAfter;\nproto.isSameOrBefore = isSameOrBefore;\nproto.isValid = isValid$2;\nproto.lang = lang;\nproto.locale = locale;\nproto.localeData = localeData;\nproto.max = prototypeMax;\nproto.min = prototypeMin;\nproto.parsingFlags = parsingFlags;\nproto.set = stringSet;\nproto.startOf = startOf;\nproto.subtract = subtract;\nproto.toArray = toArray;\nproto.toObject = toObject;\nproto.toDate = toDate;\nproto.toISOString = toISOString;\nproto.inspect = inspect;\nif (typeof Symbol !== 'undefined' && Symbol.for != null) {\n proto[Symbol.for('nodejs.util.inspect.custom')] = function () {\n return 'Moment<' + this.format() + '>';\n };\n}\nproto.toJSON = toJSON;\nproto.toString = toString;\nproto.unix = unix;\nproto.valueOf = valueOf;\nproto.creationData = creationData;\nproto.eraName = getEraName;\nproto.eraNarrow = getEraNarrow;\nproto.eraAbbr = getEraAbbr;\nproto.eraYear = getEraYear;\nproto.year = getSetYear;\nproto.isLeapYear = getIsLeapYear;\nproto.weekYear = getSetWeekYear;\nproto.isoWeekYear = getSetISOWeekYear;\nproto.quarter = proto.quarters = getSetQuarter;\nproto.month = getSetMonth;\nproto.daysInMonth = getDaysInMonth;\nproto.week = proto.weeks = getSetWeek;\nproto.isoWeek = proto.isoWeeks = getSetISOWeek;\nproto.weeksInYear = getWeeksInYear;\nproto.weeksInWeekYear = getWeeksInWeekYear;\nproto.isoWeeksInYear = getISOWeeksInYear;\nproto.isoWeeksInISOWeekYear = getISOWeeksInISOWeekYear;\nproto.date = getSetDayOfMonth;\nproto.day = proto.days = getSetDayOfWeek;\nproto.weekday = getSetLocaleDayOfWeek;\nproto.isoWeekday = getSetISODayOfWeek;\nproto.dayOfYear = getSetDayOfYear;\nproto.hour = proto.hours = getSetHour;\nproto.minute = proto.minutes = getSetMinute;\nproto.second = proto.seconds = getSetSecond;\nproto.millisecond = proto.milliseconds = getSetMillisecond;\nproto.utcOffset = getSetOffset;\nproto.utc = setOffsetToUTC;\nproto.local = setOffsetToLocal;\nproto.parseZone = setOffsetToParsedOffset;\nproto.hasAlignedHourOffset = hasAlignedHourOffset;\nproto.isDST = isDaylightSavingTime;\nproto.isLocal = isLocal;\nproto.isUtcOffset = isUtcOffset;\nproto.isUtc = isUtc;\nproto.isUTC = isUtc;\nproto.zoneAbbr = getZoneAbbr;\nproto.zoneName = getZoneName;\nproto.dates = deprecate(\n 'dates accessor is deprecated. Use date instead.',\n getSetDayOfMonth\n);\nproto.months = deprecate(\n 'months accessor is deprecated. Use month instead',\n getSetMonth\n);\nproto.years = deprecate(\n 'years accessor is deprecated. Use year instead',\n getSetYear\n);\nproto.zone = deprecate(\n 'moment().zone is deprecated, use moment().utcOffset instead. http://momentjs.com/guides/#/warnings/zone/',\n getSetZone\n);\nproto.isDSTShifted = deprecate(\n 'isDSTShifted is deprecated. See http://momentjs.com/guides/#/warnings/dst-shifted/ for more information',\n isDaylightSavingTimeShifted\n);\n\nfunction createUnix(input) {\n return createLocal(input * 1000);\n}\n\nfunction createInZone() {\n return createLocal.apply(null, arguments).parseZone();\n}\n\nfunction preParsePostFormat(string) {\n return string;\n}\n\nvar proto$1 = Locale.prototype;\n\nproto$1.calendar = calendar;\nproto$1.longDateFormat = longDateFormat;\nproto$1.invalidDate = invalidDate;\nproto$1.ordinal = ordinal;\nproto$1.preparse = preParsePostFormat;\nproto$1.postformat = preParsePostFormat;\nproto$1.relativeTime = relativeTime;\nproto$1.pastFuture = pastFuture;\nproto$1.set = set;\nproto$1.eras = localeEras;\nproto$1.erasParse = localeErasParse;\nproto$1.erasConvertYear = localeErasConvertYear;\nproto$1.erasAbbrRegex = erasAbbrRegex;\nproto$1.erasNameRegex = erasNameRegex;\nproto$1.erasNarrowRegex = erasNarrowRegex;\n\nproto$1.months = localeMonths;\nproto$1.monthsShort = localeMonthsShort;\nproto$1.monthsParse = localeMonthsParse;\nproto$1.monthsRegex = monthsRegex;\nproto$1.monthsShortRegex = monthsShortRegex;\nproto$1.week = localeWeek;\nproto$1.firstDayOfYear = localeFirstDayOfYear;\nproto$1.firstDayOfWeek = localeFirstDayOfWeek;\n\nproto$1.weekdays = localeWeekdays;\nproto$1.weekdaysMin = localeWeekdaysMin;\nproto$1.weekdaysShort = localeWeekdaysShort;\nproto$1.weekdaysParse = localeWeekdaysParse;\n\nproto$1.weekdaysRegex = weekdaysRegex;\nproto$1.weekdaysShortRegex = weekdaysShortRegex;\nproto$1.weekdaysMinRegex = weekdaysMinRegex;\n\nproto$1.isPM = localeIsPM;\nproto$1.meridiem = localeMeridiem;\n\nfunction get$1(format, index, field, setter) {\n var locale = getLocale(),\n utc = createUTC().set(setter, index);\n return locale[field](utc, format);\n}\n\nfunction listMonthsImpl(format, index, field) {\n if (isNumber(format)) {\n index = format;\n format = undefined;\n }\n\n format = format || '';\n\n if (index != null) {\n return get$1(format, index, field, 'month');\n }\n\n var i,\n out = [];\n for (i = 0; i < 12; i++) {\n out[i] = get$1(format, i, field, 'month');\n }\n return out;\n}\n\n// ()\n// (5)\n// (fmt, 5)\n// (fmt)\n// (true)\n// (true, 5)\n// (true, fmt, 5)\n// (true, fmt)\nfunction listWeekdaysImpl(localeSorted, format, index, field) {\n if (typeof localeSorted === 'boolean') {\n if (isNumber(format)) {\n index = format;\n format = undefined;\n }\n\n format = format || '';\n } else {\n format = localeSorted;\n index = format;\n localeSorted = false;\n\n if (isNumber(format)) {\n index = format;\n format = undefined;\n }\n\n format = format || '';\n }\n\n var locale = getLocale(),\n shift = localeSorted ? locale._week.dow : 0,\n i,\n out = [];\n\n if (index != null) {\n return get$1(format, (index + shift) % 7, field, 'day');\n }\n\n for (i = 0; i < 7; i++) {\n out[i] = get$1(format, (i + shift) % 7, field, 'day');\n }\n return out;\n}\n\nfunction listMonths(format, index) {\n return listMonthsImpl(format, index, 'months');\n}\n\nfunction listMonthsShort(format, index) {\n return listMonthsImpl(format, index, 'monthsShort');\n}\n\nfunction listWeekdays(localeSorted, format, index) {\n return listWeekdaysImpl(localeSorted, format, index, 'weekdays');\n}\n\nfunction listWeekdaysShort(localeSorted, format, index) {\n return listWeekdaysImpl(localeSorted, format, index, 'weekdaysShort');\n}\n\nfunction listWeekdaysMin(localeSorted, format, index) {\n return listWeekdaysImpl(localeSorted, format, index, 'weekdaysMin');\n}\n\ngetSetGlobalLocale('en', {\n eras: [\n {\n since: '0001-01-01',\n until: +Infinity,\n offset: 1,\n name: 'Anno Domini',\n narrow: 'AD',\n abbr: 'AD',\n },\n {\n since: '0000-12-31',\n until: -Infinity,\n offset: 1,\n name: 'Before Christ',\n narrow: 'BC',\n abbr: 'BC',\n },\n ],\n dayOfMonthOrdinalParse: /\\d{1,2}(th|st|nd|rd)/,\n ordinal: function (number) {\n var b = number % 10,\n output =\n toInt((number % 100) / 10) === 1\n ? 'th'\n : b === 1\n ? 'st'\n : b === 2\n ? 'nd'\n : b === 3\n ? 'rd'\n : 'th';\n return number + output;\n },\n});\n\n// Side effect imports\n\nhooks.lang = deprecate(\n 'moment.lang is deprecated. Use moment.locale instead.',\n getSetGlobalLocale\n);\nhooks.langData = deprecate(\n 'moment.langData is deprecated. Use moment.localeData instead.',\n getLocale\n);\n\nvar mathAbs = Math.abs;\n\nfunction abs() {\n var data = this._data;\n\n this._milliseconds = mathAbs(this._milliseconds);\n this._days = mathAbs(this._days);\n this._months = mathAbs(this._months);\n\n data.milliseconds = mathAbs(data.milliseconds);\n data.seconds = mathAbs(data.seconds);\n data.minutes = mathAbs(data.minutes);\n data.hours = mathAbs(data.hours);\n data.months = mathAbs(data.months);\n data.years = mathAbs(data.years);\n\n return this;\n}\n\nfunction addSubtract$1(duration, input, value, direction) {\n var other = createDuration(input, value);\n\n duration._milliseconds += direction * other._milliseconds;\n duration._days += direction * other._days;\n duration._months += direction * other._months;\n\n return duration._bubble();\n}\n\n// supports only 2.0-style add(1, 's') or add(duration)\nfunction add$1(input, value) {\n return addSubtract$1(this, input, value, 1);\n}\n\n// supports only 2.0-style subtract(1, 's') or subtract(duration)\nfunction subtract$1(input, value) {\n return addSubtract$1(this, input, value, -1);\n}\n\nfunction absCeil(number) {\n if (number < 0) {\n return Math.floor(number);\n } else {\n return Math.ceil(number);\n }\n}\n\nfunction bubble() {\n var milliseconds = this._milliseconds,\n days = this._days,\n months = this._months,\n data = this._data,\n seconds,\n minutes,\n hours,\n years,\n monthsFromDays;\n\n // if we have a mix of positive and negative values, bubble down first\n // check: https://github.com/moment/moment/issues/2166\n if (\n !(\n (milliseconds >= 0 && days >= 0 && months >= 0) ||\n (milliseconds <= 0 && days <= 0 && months <= 0)\n )\n ) {\n milliseconds += absCeil(monthsToDays(months) + days) * 864e5;\n days = 0;\n months = 0;\n }\n\n // The following code bubbles up values, see the tests for\n // examples of what that means.\n data.milliseconds = milliseconds % 1000;\n\n seconds = absFloor(milliseconds / 1000);\n data.seconds = seconds % 60;\n\n minutes = absFloor(seconds / 60);\n data.minutes = minutes % 60;\n\n hours = absFloor(minutes / 60);\n data.hours = hours % 24;\n\n days += absFloor(hours / 24);\n\n // convert days to months\n monthsFromDays = absFloor(daysToMonths(days));\n months += monthsFromDays;\n days -= absCeil(monthsToDays(monthsFromDays));\n\n // 12 months -> 1 year\n years = absFloor(months / 12);\n months %= 12;\n\n data.days = days;\n data.months = months;\n data.years = years;\n\n return this;\n}\n\nfunction daysToMonths(days) {\n // 400 years have 146097 days (taking into account leap year rules)\n // 400 years have 12 months === 4800\n return (days * 4800) / 146097;\n}\n\nfunction monthsToDays(months) {\n // the reverse of daysToMonths\n return (months * 146097) / 4800;\n}\n\nfunction as(units) {\n if (!this.isValid()) {\n return NaN;\n }\n var days,\n months,\n milliseconds = this._milliseconds;\n\n units = normalizeUnits(units);\n\n if (units === 'month' || units === 'quarter' || units === 'year') {\n days = this._days + milliseconds / 864e5;\n months = this._months + daysToMonths(days);\n switch (units) {\n case 'month':\n return months;\n case 'quarter':\n return months / 3;\n case 'year':\n return months / 12;\n }\n } else {\n // handle milliseconds separately because of floating point math errors (issue #1867)\n days = this._days + Math.round(monthsToDays(this._months));\n switch (units) {\n case 'week':\n return days / 7 + milliseconds / 6048e5;\n case 'day':\n return days + milliseconds / 864e5;\n case 'hour':\n return days * 24 + milliseconds / 36e5;\n case 'minute':\n return days * 1440 + milliseconds / 6e4;\n case 'second':\n return days * 86400 + milliseconds / 1000;\n // Math.floor prevents floating point math errors here\n case 'millisecond':\n return Math.floor(days * 864e5) + milliseconds;\n default:\n throw new Error('Unknown unit ' + units);\n }\n }\n}\n\nfunction makeAs(alias) {\n return function () {\n return this.as(alias);\n };\n}\n\nvar asMilliseconds = makeAs('ms'),\n asSeconds = makeAs('s'),\n asMinutes = makeAs('m'),\n asHours = makeAs('h'),\n asDays = makeAs('d'),\n asWeeks = makeAs('w'),\n asMonths = makeAs('M'),\n asQuarters = makeAs('Q'),\n asYears = makeAs('y'),\n valueOf$1 = asMilliseconds;\n\nfunction clone$1() {\n return createDuration(this);\n}\n\nfunction get$2(units) {\n units = normalizeUnits(units);\n return this.isValid() ? this[units + 's']() : NaN;\n}\n\nfunction makeGetter(name) {\n return function () {\n return this.isValid() ? this._data[name] : NaN;\n };\n}\n\nvar milliseconds = makeGetter('milliseconds'),\n seconds = makeGetter('seconds'),\n minutes = makeGetter('minutes'),\n hours = makeGetter('hours'),\n days = makeGetter('days'),\n months = makeGetter('months'),\n years = makeGetter('years');\n\nfunction weeks() {\n return absFloor(this.days() / 7);\n}\n\nvar round = Math.round,\n thresholds = {\n ss: 44, // a few seconds to seconds\n s: 45, // seconds to minute\n m: 45, // minutes to hour\n h: 22, // hours to day\n d: 26, // days to month/week\n w: null, // weeks to month\n M: 11, // months to year\n };\n\n// helper function for moment.fn.from, moment.fn.fromNow, and moment.duration.fn.humanize\nfunction substituteTimeAgo(string, number, withoutSuffix, isFuture, locale) {\n return locale.relativeTime(number || 1, !!withoutSuffix, string, isFuture);\n}\n\nfunction relativeTime$1(posNegDuration, withoutSuffix, thresholds, locale) {\n var duration = createDuration(posNegDuration).abs(),\n seconds = round(duration.as('s')),\n minutes = round(duration.as('m')),\n hours = round(duration.as('h')),\n days = round(duration.as('d')),\n months = round(duration.as('M')),\n weeks = round(duration.as('w')),\n years = round(duration.as('y')),\n a =\n (seconds <= thresholds.ss && ['s', seconds]) ||\n (seconds < thresholds.s && ['ss', seconds]) ||\n (minutes <= 1 && ['m']) ||\n (minutes < thresholds.m && ['mm', minutes]) ||\n (hours <= 1 && ['h']) ||\n (hours < thresholds.h && ['hh', hours]) ||\n (days <= 1 && ['d']) ||\n (days < thresholds.d && ['dd', days]);\n\n if (thresholds.w != null) {\n a =\n a ||\n (weeks <= 1 && ['w']) ||\n (weeks < thresholds.w && ['ww', weeks]);\n }\n a = a ||\n (months <= 1 && ['M']) ||\n (months < thresholds.M && ['MM', months]) ||\n (years <= 1 && ['y']) || ['yy', years];\n\n a[2] = withoutSuffix;\n a[3] = +posNegDuration > 0;\n a[4] = locale;\n return substituteTimeAgo.apply(null, a);\n}\n\n// This function allows you to set the rounding function for relative time strings\nfunction getSetRelativeTimeRounding(roundingFunction) {\n if (roundingFunction === undefined) {\n return round;\n }\n if (typeof roundingFunction === 'function') {\n round = roundingFunction;\n return true;\n }\n return false;\n}\n\n// This function allows you to set a threshold for relative time strings\nfunction getSetRelativeTimeThreshold(threshold, limit) {\n if (thresholds[threshold] === undefined) {\n return false;\n }\n if (limit === undefined) {\n return thresholds[threshold];\n }\n thresholds[threshold] = limit;\n if (threshold === 's') {\n thresholds.ss = limit - 1;\n }\n return true;\n}\n\nfunction humanize(argWithSuffix, argThresholds) {\n if (!this.isValid()) {\n return this.localeData().invalidDate();\n }\n\n var withSuffix = false,\n th = thresholds,\n locale,\n output;\n\n if (typeof argWithSuffix === 'object') {\n argThresholds = argWithSuffix;\n argWithSuffix = false;\n }\n if (typeof argWithSuffix === 'boolean') {\n withSuffix = argWithSuffix;\n }\n if (typeof argThresholds === 'object') {\n th = Object.assign({}, thresholds, argThresholds);\n if (argThresholds.s != null && argThresholds.ss == null) {\n th.ss = argThresholds.s - 1;\n }\n }\n\n locale = this.localeData();\n output = relativeTime$1(this, !withSuffix, th, locale);\n\n if (withSuffix) {\n output = locale.pastFuture(+this, output);\n }\n\n return locale.postformat(output);\n}\n\nvar abs$1 = Math.abs;\n\nfunction sign(x) {\n return (x > 0) - (x < 0) || +x;\n}\n\nfunction toISOString$1() {\n // for ISO strings we do not use the normal bubbling rules:\n // * milliseconds bubble up until they become hours\n // * days do not bubble at all\n // * months bubble up until they become years\n // This is because there is no context-free conversion between hours and days\n // (think of clock changes)\n // and also not between days and months (28-31 days per month)\n if (!this.isValid()) {\n return this.localeData().invalidDate();\n }\n\n var seconds = abs$1(this._milliseconds) / 1000,\n days = abs$1(this._days),\n months = abs$1(this._months),\n minutes,\n hours,\n years,\n s,\n total = this.asSeconds(),\n totalSign,\n ymSign,\n daysSign,\n hmsSign;\n\n if (!total) {\n // this is the same as C#'s (Noda) and python (isodate)...\n // but not other JS (goog.date)\n return 'P0D';\n }\n\n // 3600 seconds -> 60 minutes -> 1 hour\n minutes = absFloor(seconds / 60);\n hours = absFloor(minutes / 60);\n seconds %= 60;\n minutes %= 60;\n\n // 12 months -> 1 year\n years = absFloor(months / 12);\n months %= 12;\n\n // inspired by https://github.com/dordille/moment-isoduration/blob/master/moment.isoduration.js\n s = seconds ? seconds.toFixed(3).replace(/\\.?0+$/, '') : '';\n\n totalSign = total < 0 ? '-' : '';\n ymSign = sign(this._months) !== sign(total) ? '-' : '';\n daysSign = sign(this._days) !== sign(total) ? '-' : '';\n hmsSign = sign(this._milliseconds) !== sign(total) ? '-' : '';\n\n return (\n totalSign +\n 'P' +\n (years ? ymSign + years + 'Y' : '') +\n (months ? ymSign + months + 'M' : '') +\n (days ? daysSign + days + 'D' : '') +\n (hours || minutes || seconds ? 'T' : '') +\n (hours ? hmsSign + hours + 'H' : '') +\n (minutes ? hmsSign + minutes + 'M' : '') +\n (seconds ? hmsSign + s + 'S' : '')\n );\n}\n\nvar proto$2 = Duration.prototype;\n\nproto$2.isValid = isValid$1;\nproto$2.abs = abs;\nproto$2.add = add$1;\nproto$2.subtract = subtract$1;\nproto$2.as = as;\nproto$2.asMilliseconds = asMilliseconds;\nproto$2.asSeconds = asSeconds;\nproto$2.asMinutes = asMinutes;\nproto$2.asHours = asHours;\nproto$2.asDays = asDays;\nproto$2.asWeeks = asWeeks;\nproto$2.asMonths = asMonths;\nproto$2.asQuarters = asQuarters;\nproto$2.asYears = asYears;\nproto$2.valueOf = valueOf$1;\nproto$2._bubble = bubble;\nproto$2.clone = clone$1;\nproto$2.get = get$2;\nproto$2.milliseconds = milliseconds;\nproto$2.seconds = seconds;\nproto$2.minutes = minutes;\nproto$2.hours = hours;\nproto$2.days = days;\nproto$2.weeks = weeks;\nproto$2.months = months;\nproto$2.years = years;\nproto$2.humanize = humanize;\nproto$2.toISOString = toISOString$1;\nproto$2.toString = toISOString$1;\nproto$2.toJSON = toISOString$1;\nproto$2.locale = locale;\nproto$2.localeData = localeData;\n\nproto$2.toIsoString = deprecate(\n 'toIsoString() is deprecated. Please use toISOString() instead (notice the capitals)',\n toISOString$1\n);\nproto$2.lang = lang;\n\n// FORMATTING\n\naddFormatToken('X', 0, 0, 'unix');\naddFormatToken('x', 0, 0, 'valueOf');\n\n// PARSING\n\naddRegexToken('x', matchSigned);\naddRegexToken('X', matchTimestamp);\naddParseToken('X', function (input, array, config) {\n config._d = new Date(parseFloat(input) * 1000);\n});\naddParseToken('x', function (input, array, config) {\n config._d = new Date(toInt(input));\n});\n\n//! moment.js\n\nhooks.version = '2.30.1';\n\nsetHookCallback(createLocal);\n\nhooks.fn = proto;\nhooks.min = min;\nhooks.max = max;\nhooks.now = now;\nhooks.utc = createUTC;\nhooks.unix = createUnix;\nhooks.months = listMonths;\nhooks.isDate = isDate;\nhooks.locale = getSetGlobalLocale;\nhooks.invalid = createInvalid;\nhooks.duration = createDuration;\nhooks.isMoment = isMoment;\nhooks.weekdays = listWeekdays;\nhooks.parseZone = createInZone;\nhooks.localeData = getLocale;\nhooks.isDuration = isDuration;\nhooks.monthsShort = listMonthsShort;\nhooks.weekdaysMin = listWeekdaysMin;\nhooks.defineLocale = defineLocale;\nhooks.updateLocale = updateLocale;\nhooks.locales = listLocales;\nhooks.weekdaysShort = listWeekdaysShort;\nhooks.normalizeUnits = normalizeUnits;\nhooks.relativeTimeRounding = getSetRelativeTimeRounding;\nhooks.relativeTimeThreshold = getSetRelativeTimeThreshold;\nhooks.calendarFormat = getCalendarFormat;\nhooks.prototype = proto;\n\n// currently HTML5 input type only supports 24-hour formats\nhooks.HTML5_FMT = {\n DATETIME_LOCAL: 'YYYY-MM-DDTHH:mm', // \n DATETIME_LOCAL_SECONDS: 'YYYY-MM-DDTHH:mm:ss', // \n DATETIME_LOCAL_MS: 'YYYY-MM-DDTHH:mm:ss.SSS', // \n DATE: 'YYYY-MM-DD', // \n TIME: 'HH:mm', // \n TIME_SECONDS: 'HH:mm:ss', // \n TIME_MS: 'HH:mm:ss.SSS', // \n WEEK: 'GGGG-[W]WW', // \n MONTH: 'YYYY-MM', // \n};\n\nexport default hooks;\n","import { useRoute } from \"vue-router\"\r\nimport PageLinkUtils from \"../helpers/pageLinkUtils\"\r\nimport i18n from '@/i18n'\r\nimport moment from \"moment\"\r\n\r\nconst route = useRoute()\r\nconst t = i18n.global.t\r\n\r\nexport default class Utils {\r\n static getCurrentSubdomain(): string {\r\n const permittedSubdomains = [\"2Monitori\", \"Monitori2\", \"TIKU-Kartat\", \"TIKUKartat\"]\r\n const splittedSubDomains = window.location.pathname.split(\"/\")\r\n\r\n // Palautetaan subdomainin ensimmäinen alikansio tai tyhjä\r\n if (splittedSubDomains.length > 1 && splittedSubDomains[1].length > 0) {\r\n const subdomain = splittedSubDomains[1]\r\n\r\n // Tarkistetaan onko subdomain sallituissa subdomaineissa\r\n const permitted: boolean = permittedSubdomains.findIndex(element => {\r\n return element.toLowerCase() === subdomain.toLowerCase()\r\n }) > -1\r\n\r\n // Jos subdomain on sallittu, käytetään sitä\r\n if (permitted) {\r\n return subdomain + \"/\"\r\n }\r\n }\r\n\r\n return \"\"\r\n }\r\n\r\n // Muutetaan sivunvaihdon yhteydessä sivuston title kohdesivun mukaan (to).\r\n // Mikäli kyseessä kielenvaihto tai sivun ensimmäinen lataus,\r\n // käytetään senhetkisen sivun nimeä valitulla kielellä(pageName)\r\n static changePageTitle(to?: typeof route, pageName?: string): void {\r\n const defaultTitle = t(\"App.Home.Title\") !== \"App.Home.Title\" ? t(\"App.Home.Title\") : document.title\r\n const pageLinkUtils = new PageLinkUtils()\r\n // yhdistetään Liikenteen ja Viestinnän puolen linkit samaksi arrayksi\r\n const pageLinks: Array = pageLinkUtils.getLiikenneLinks().concat(pageLinkUtils.getViestintaLinks())\r\n let targetPageName = \"\"\r\n let pageNameTranslated = \"\"\r\n\r\n if (to && to.params.pageName) {\r\n targetPageName = to.params.pageName as string\r\n }\r\n else if (pageName) {\r\n targetPageName = pageName\r\n }\r\n\r\n if (targetPageName && pageLinks.length > 0) { /* katsotaan sivuston linkkilistasta senhetkistä sivua vastaava kielitermi */\r\n pageLinks.forEach((link) => {\r\n if (link.pageName === targetPageName) {\r\n pageNameTranslated = t(link.textTerm) ?? \"\"\r\n }\r\n })\r\n\r\n if (pageNameTranslated !== \"\") {\r\n document.title = pageNameTranslated + \" | \" + defaultTitle\r\n }\r\n }\r\n else { /* etusivulla ja mikäli sivun nimeä ei ole saatavilla, näytetään titlessä pelkästään sivuston nimi */\r\n document.title = defaultTitle\r\n }\r\n }\r\n\r\n static getLinkOpensNewTabSpan(): string {\r\n return \"\" + t(\"App.Link.LinkOpensNewTab\") + \"\"\r\n }\r\n\r\n static isNullOrEmptyString(value: string): boolean {\r\n return value === null || value === \"\"\r\n }\r\n\r\n formatDateShort(value: string | undefined): string {\r\n if (value === undefined) {\r\n return \"\"\r\n }\r\n return moment(new Date(String(value))).format(\"DD.MM.YYYY\")\r\n }\r\n\r\n formatDateTime(value: string | undefined): string {\r\n if (value === undefined) {\r\n return \"\"\r\n }\r\n return moment(new Date(String(value))).format(\"DD.MM.YYYY HH:mm\")\r\n }\r\n\r\n formatPrice(value: number | undefined): string {\r\n if (value === undefined) {\r\n return \"\"\r\n }\r\n return (Math.round(value * 100) / 100).toFixed(2).replace(\".\", \",\")\r\n }\r\n}\r\n","import PageWhitelistUtils from \"./pageWhitelistUtils\"\r\nimport utils from \"../utils/utils\"\r\nimport { store } from '@/store/store'\r\n\r\nexport default class PageLinkUtils {\r\n getViestintaLinks(): Array {\r\n const pageUtils = new PageWhitelistUtils()\r\n const linkArray: Array = []\r\n\r\n if (pageUtils.isMenuOnWhiteList(\"LaajakaistaJaPuhelin\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/LaajakaistaJaPuhelin\",\r\n pageName: \"LaajakaistaJaPuhelin\",\r\n textTerm: \"App.Header.Viestinta.LaajakaistaJaPuhelin\"\r\n })\r\n }\r\n\r\n if (pageUtils.isMenuOnWhiteList(\"Posti\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/Posti\",\r\n pageName: \"Posti\",\r\n textTerm: \"App.Header.Viestinta.Posti\"\r\n })\r\n }\r\n\r\n if (pageUtils.isMenuOnWhiteList(\"TVJaRadio\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/TVJaRadio\",\r\n pageName: \"TVJaRadio\",\r\n textTerm: \"App.Header.Viestinta.TVJaRadio\"\r\n })\r\n }\r\n\r\n if (pageUtils.isMenuOnWhiteList(\"ViatJaHairiot\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/ViatJaHairiot\",\r\n pageName: \"ViatJaHairiot\",\r\n textTerm: \"App.Header.Viestinta.ViatJaHairiot\"\r\n })\r\n }\r\n\r\n if (pageUtils.isMenuOnWhiteList(\"Radiomikrofonitaajuudet\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/Radiomikrofonitaajuudet\",\r\n pageName: \"Radiomikrofonitaajuudet\",\r\n textTerm: \"App.Header.Viestinta.Radiomikrofonitaajuudet\"\r\n })\r\n }\r\n\r\n if (pageUtils.isMenuOnWhiteList(\"Bittimittari\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/Bittimittari\",\r\n pageName: \"Bittimittari\",\r\n textTerm: \"App.Header.Viestinta.Bittimittari\"\r\n })\r\n }\r\n\r\n return linkArray\r\n }\r\n\r\n getLiikenneLinks(): Array {\r\n const pageUtils = new PageWhitelistUtils()\r\n const linkArray: Array = []\r\n\r\n if (pageUtils.isMenuOnWhiteList(\"Tieliikenne\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/Tieliikenne\",\r\n pageName: \"Tieliikenne\",\r\n textTerm: \"App.Header.Liikenne.Tieliikenne\"\r\n })\r\n }\r\n\r\n if (pageUtils.isMenuOnWhiteList(\"Vesiliikenne\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/Vesiliikenne\",\r\n pageName: \"Vesiliikenne\",\r\n textTerm: \"App.Header.Liikenne.VesiLiikenne\"\r\n })\r\n }\r\n\r\n if (pageUtils.isMenuOnWhiteList(\"Infokartat\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/Infokartat\",\r\n pageName: \"Infokartat\",\r\n textTerm: \"App.LeftSlot.Header.Infokartat\"\r\n })\r\n }\r\n\r\n return linkArray\r\n }\r\n\r\n getEtusivuLinkObject(): Array {\r\n const linkArray: Array = []\r\n\r\n linkArray.push({\r\n to: \"/\",\r\n pageName: \"\",\r\n textTerm: \"App.Header.Etusivu\"\r\n })\r\n\r\n return linkArray\r\n }\r\n\r\n getViestintaLinksWithSubtopics(): Array {\r\n const pageUtils = new PageWhitelistUtils()\r\n const linkArray: Array = []\r\n\r\n // LAAJAKAISTA JA PUHELIN\r\n if (pageUtils.isMenuOnWhiteList(\"LaajakaistaJaPuhelin\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/LaajakaistaJaPuhelin\",\r\n pageName: \"LaajakaistaJaPuhelin\",\r\n textTerm: \"App.Header.Viestinta.LaajakaistaJaPuhelin\"\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"KiinteanLaajakaistanSaatavuus\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/LaajakaistaJaPuhelin\",\r\n pageName: \"LaajakaistaJaPuhelin\",\r\n textTerm: \"App.LaajakaistaJaPuhelin.RadioList.KiinteänLaajakaistaverkonNopeus\",\r\n subTopic: \"KiinteanLaajakaistanSaatavuus\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"MobiiliverkonKattavuus\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/LaajakaistaJaPuhelin\",\r\n pageName: \"LaajakaistaJaPuhelin\",\r\n textTerm: \"App.LaajakaistaJaPuhelin.RadioList.MobiiliverkonKattavuus\",\r\n subTopic: \"MobiiliverkonKattavuus\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"KiinteanVerkonSaatavuusRuuduilla\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/LaajakaistaJaPuhelin\",\r\n pageName: \"LaajakaistaJaPuhelin\",\r\n textTerm: \"App.RightSlotHeaderTemplate.KiinteanVerkonSaatavuusRuuduillaHeader\",\r\n subTopic: \"KiinteanVerkonSaatavuusRuuduilla\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"OikeusPuhelinJaLaajakaistaLiittymaan\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/LaajakaistaJaPuhelin\",\r\n pageName: \"LaajakaistaJaPuhelin\",\r\n textTerm: \"App.LaajakaistaJaPuhelin.RadioList.OikeusPuhelinJaLaajakaistaLiittymaan\",\r\n subTopic: \"OikeusPuhelinJaLaajakaistaLiittymaanPalvelutyypinMukaan\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"Laajakaistahankkeet\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/LaajakaistaJaPuhelin\",\r\n pageName: \"LaajakaistaJaPuhelin\",\r\n textTerm: \"App.LaajakaistaJaPuhelin.RadioList.Laajakaistahankkeet\",\r\n subTopic: \"Laajakaistahankkeet\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n // LAAJAKAISTAJAPUHELIN INFOKARTAT\r\n const laajakaistaJaPuhelinInfokartat = store.getters.laajakaistaJaPuhelinInfokarttaRadioValues\r\n\r\n for (let i = 0; i < laajakaistaJaPuhelinInfokartat.length; i++) {\r\n linkArray.push({\r\n to: \"/Viestinta/LaajakaistaJaPuhelin\",\r\n pageName: \"LaajakaistaJaPuhelin\",\r\n textTerm: this.getInfokarttaLocalizedName(laajakaistaJaPuhelinInfokartat[i]),\r\n subTopic: laajakaistaJaPuhelinInfokartat[i].tunniste,\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n // POSTI\r\n if (pageUtils.isMenuOnWhiteList(\"Posti\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/Posti\",\r\n pageName: \"Posti\",\r\n textTerm: \"App.Header.Viestinta.Posti\"\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"PostiHaeToimipaikkoja\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/Posti\",\r\n pageName: \"Posti\",\r\n textTerm: \"App.RadioList.SearchLocations\",\r\n subTopic: \"PostiHaeToimipaikkoja\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"PostiTarkasteleMaaraa\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/Posti\",\r\n pageName: \"Posti\",\r\n textTerm: \"App.RadioList.NumberOfServicePoints\",\r\n subTopic: \"PostiTarkasteleMaaraa\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n // POSTI INFOKARTAT\r\n const postiInfokartat = store.getters.postiInfokarttaRadioValues\r\n for (let i = 0; i < postiInfokartat.length; i++) {\r\n linkArray.push({\r\n to: \"/Viestinta/Posti\",\r\n pageName: \"Posti\",\r\n textTerm: this.getInfokarttaLocalizedName(postiInfokartat[i]),\r\n subTopic: postiInfokartat[i].tunniste,\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n // TV JA RADIO\r\n if (pageUtils.isMenuOnWhiteList(\"TVJaRadio\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/TVJaRadio\",\r\n pageName: \"TVJaRadio\",\r\n textTerm: \"App.Header.Viestinta.TVJaRadio\"\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"TVPeittoalueet\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/TVJaRadio\",\r\n pageName: \"TVJaRadio\",\r\n textTerm: \"App.TVJaRadio.RadioList.AntenniTVLahetintenPeittoalueet\",\r\n subTopic: \"TVPeittoalueet\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"RadioPeittoalueet\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/TVJaRadio\",\r\n pageName: \"TVJaRadio\",\r\n textTerm: \"App.TVJaRadio.RadioList.RadiokanavienPeittoalueet\",\r\n subTopic: \"RadioPeittoalueet\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"AntenniTVSaatavuus\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/TVJaRadio\",\r\n pageName: \"TVJaRadio\",\r\n textTerm: \"App.TVJaRadio.RadioList.AntenniTVSaatavuusTietyssaPaikassa\",\r\n subTopic: \"AntenniTVSaatavuus\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"RadioasemienKuuluvuus\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/TVJaRadio\",\r\n pageName: \"TVJaRadio\",\r\n textTerm: \"App.TVJaRadio.RadioList.RadioasemienKuuluvuusTietyssaPaikassa\",\r\n subTopic: \"RadioasemienKuuluvuus\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n // VIAT JA HÄIRIÖT\r\n if (pageUtils.isMenuOnWhiteList(\"ViatJaHairiot\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/ViatJaHairiot\",\r\n pageName: \"ViatJaHairiot\",\r\n textTerm: \"App.Header.Viestinta.ViatJaHairiot\"\r\n })\r\n }\r\n\r\n // RADIOMIKROFONITAAJUUDET\r\n if (pageUtils.isMenuOnWhiteList(\"Radiomikrofonitaajuudet\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/Radiomikrofonitaajuudet\",\r\n pageName: \"Radiomikrofonitaajuudet\",\r\n textTerm: \"App.Header.Viestinta.Radiomikrofonitaajuudet\"\r\n })\r\n }\r\n\r\n // BITTIMITTARI\r\n if (pageUtils.isMenuOnWhiteList(\"Bittimittari\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/Bittimittari\",\r\n pageName: \"Bittimittari\",\r\n textTerm: \"App.Header.Viestinta.Bittimittari\"\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"BittimittariVuorokaudenaikaanPohjautuvatTiedot\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/Bittimittari\",\r\n pageName: \"Bittimittari\",\r\n textTerm: \"App.RightSlotHeaderTemplate.BittimittariVuorokaudenaikaanPohjautuvatTiedotHeader\",\r\n subTopic: \"BittimittariVuorokaudenaikaanPohjautuvatTiedot\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"BittimittariOperaattorikohtaisetTiedot\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/Bittimittari\",\r\n pageName: \"Bittimittari\",\r\n textTerm: \"App.RightSlotHeaderTemplate.BittimittariOperaattorikohtaisetTiedotHeader\",\r\n subTopic: \"BittimittariOperaattorikohtaisetTiedot\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"BittimittariVuorokaudenaikaanPohjautuvatRuudut\")) {\r\n linkArray.push({\r\n to: \"/Viestinta/Bittimittari\",\r\n pageName: \"Bittimittari\",\r\n textTerm: \"App.RightSlotHeaderTemplate.BittimittariVuorokaudenaikaanPohjautuvatRuudutHeader\",\r\n subTopic: \"BittimittariVuorokaudenaikaanPohjautuvatRuudut\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n return linkArray\r\n }\r\n\r\n getLiikenneLinksWithSubtopics(): Array {\r\n const pageUtils = new PageWhitelistUtils()\r\n const linkArray: Array = []\r\n\r\n // TIELIIKENNE\r\n if (pageUtils.isMenuOnWhiteList(\"Tieliikenne\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/Tieliikenne\",\r\n pageName: \"Tieliikenne\",\r\n textTerm: \"App.Header.Liikenne.Tieliikenne\"\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"LupaJaRekisterointitoimipaikat\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/Tieliikenne\",\r\n pageName: \"Tieliikenne\",\r\n textTerm: \"App.TieLiikenne.RadioList.LupaJaRekisterointiPaikat\",\r\n subTopic: \"LupaJaRekisterointitoimipaikat\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"EnsirekisteroidytHenkiloAutot\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/Tieliikenne\",\r\n pageName: \"Tieliikenne\",\r\n textTerm: \"App.TieLiikenne.RadioList.EnsirekisteroidytHenkiloAutot\",\r\n subTopic: \"EnsirekisteroidytHenkiloAutot\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"EnsirekisteroidytHenkiloAutotPaastot\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/Tieliikenne\",\r\n pageName: \"Tieliikenne\",\r\n textTerm: \"App.TieLiikenne.RadioList.EnsirekisteroidytHenkiloAutotPaastot\",\r\n subTopic: \"EnsirekisteroidytHenkiloAutotPaastot\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"LiikennekaytossaHenkiloAutot\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/Tieliikenne\",\r\n pageName: \"Tieliikenne\",\r\n textTerm: \"App.TieLiikenne.RadioList.LiikennekaytossaHenkiloAutot\",\r\n subTopic: \"LiikennekaytossaHenkiloAutot\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"LiikennekaytossaHenkiloAutotKeskiIka\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/Tieliikenne\",\r\n pageName: \"Tieliikenne\",\r\n textTerm: \"App.TieLiikenne.RadioList.LiikennekaytossaHenkiloAutotKeskiIka\",\r\n subTopic: \"LiikennekaytossaHenkiloAutotKeskiIka\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"Liikenneonnettomuudet\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/Tieliikenne\",\r\n pageName: \"Tieliikenne\",\r\n textTerm: \"App.TieLiikenne.RadioList.Liikenneonnettomuudet\",\r\n subTopic: \"Liikenneonnettomuudet\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"MyonnetytTaksiluvat\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/Tieliikenne\",\r\n pageName: \"Tieliikenne\",\r\n textTerm: \"App.TieLiikenne.RadioList.Taksiluvat\",\r\n subTopic: \"MyonnetytTaksiluvat\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"VoimassaOlevatAjokortit\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/Tieliikenne\",\r\n pageName: \"Tieliikenne\",\r\n textTerm: \"App.TieLiikenne.RadioList.VoimassaOlevatAjokortit\",\r\n subTopic: \"VoimassaOlevatAjokortit\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n // VESILIIKENNE\r\n if (pageUtils.isMenuOnWhiteList(\"Vesiliikenne\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/Vesiliikenne\",\r\n pageName: \"Vesiliikenne\",\r\n textTerm: \"App.Header.Liikenne.VesiLiikenne\"\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"Rekisterointitoimipaikat\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/Vesiliikenne\",\r\n pageName: \"Vesiliikenne\",\r\n textTerm: \"App.VesiLiikenne.SubjectRadioList.LupaJaRekisterointiPaikat\",\r\n subTopic: \"Rekisterointitoimipaikat\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n if (pageUtils.isSubjectOnWhiteList(\"RekisteroidytVesikulkuneuvot\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/Vesiliikenne\",\r\n pageName: \"Vesiliikenne\",\r\n textTerm: \"App.VesiLiikenne.SubjectRadioList.RekisteroidytVesikulkuneuvot\",\r\n subTopic: \"RekisteroidytVesikulkuneuvot\",\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n // INFOKARTAT\r\n if (pageUtils.isMenuOnWhiteList(\"Infokartat\")) {\r\n linkArray.push({\r\n to: \"/Liikenne/Infokartat\",\r\n pageName: \"Infokartat\",\r\n textTerm: \"App.LeftSlot.Header.Infokartat\"\r\n })\r\n }\r\n\r\n const infokartat = store.getters.liikenneInfokarttaRadioValues\r\n for (let i = 0; i < infokartat.length; i++) {\r\n linkArray.push({\r\n to: \"/Liikenne/Infokartat\",\r\n pageName: \"Infokartat\",\r\n textTerm: this.getInfokarttaLocalizedName(infokartat[i]),\r\n subTopic: infokartat[i].tunniste,\r\n isSubTopic: true\r\n })\r\n }\r\n\r\n return linkArray\r\n }\r\n\r\n getEtusivuLink(): string | undefined {\r\n return \"/\" + utils.getCurrentSubdomain()\r\n }\r\n\r\n getInfokarttaLocalizedName(infokartta: any) : string {\r\n const lang = store.getters.activeLang\r\n if (lang === \"fi\") {\r\n return infokartta.nimifi\r\n }\r\n else if (lang === \"sv\") {\r\n return infokartta.nimisv\r\n }\r\n else if (lang === \"en\") {\r\n return infokartta.nimien\r\n }\r\n return \"\"\r\n }\r\n}\r\n","\r\n\r\n\r\n\r\n\r\n","\r\n\r\n\r\n\r\n\r\n","\r\n\r\n\r\n","\r\n\r\n\r\n","\r\n\r\n\r\n\r\n\r\n","\r\n\r\n\r\n\r\n\r\n","\n\n\n\n\n","'use strict';\n\nexport default function bind(fn, thisArg) {\n return function wrap() {\n return fn.apply(thisArg, arguments);\n };\n}\n","'use strict';\n\nimport bind from './helpers/bind.js';\n\n// utils is a library of generic helper functions non-specific to axios\n\nconst {toString} = Object.prototype;\nconst {getPrototypeOf} = Object;\n\nconst kindOf = (cache => thing => {\n const str = toString.call(thing);\n return cache[str] || (cache[str] = str.slice(8, -1).toLowerCase());\n})(Object.create(null));\n\nconst kindOfTest = (type) => {\n type = type.toLowerCase();\n return (thing) => kindOf(thing) === type\n}\n\nconst typeOfTest = type => thing => typeof thing === type;\n\n/**\n * Determine if a value is an Array\n *\n * @param {Object} val The value to test\n *\n * @returns {boolean} True if value is an Array, otherwise false\n */\nconst {isArray} = Array;\n\n/**\n * Determine if a value is undefined\n *\n * @param {*} val The value to test\n *\n * @returns {boolean} True if the value is undefined, otherwise false\n */\nconst isUndefined = typeOfTest('undefined');\n\n/**\n * Determine if a value is a Buffer\n *\n * @param {*} val The value to test\n *\n * @returns {boolean} True if value is a Buffer, otherwise false\n */\nfunction isBuffer(val) {\n return val !== null && !isUndefined(val) && val.constructor !== null && !isUndefined(val.constructor)\n && isFunction(val.constructor.isBuffer) && val.constructor.isBuffer(val);\n}\n\n/**\n * Determine if a value is an ArrayBuffer\n *\n * @param {*} val The value to test\n *\n * @returns {boolean} True if value is an ArrayBuffer, otherwise false\n */\nconst isArrayBuffer = kindOfTest('ArrayBuffer');\n\n\n/**\n * Determine if a value is a view on an ArrayBuffer\n *\n * @param {*} val The value to test\n *\n * @returns {boolean} True if value is a view on an ArrayBuffer, otherwise false\n */\nfunction isArrayBufferView(val) {\n let result;\n if ((typeof ArrayBuffer !== 'undefined') && (ArrayBuffer.isView)) {\n result = ArrayBuffer.isView(val);\n } else {\n result = (val) && (val.buffer) && (isArrayBuffer(val.buffer));\n }\n return result;\n}\n\n/**\n * Determine if a value is a String\n *\n * @param {*} val The value to test\n *\n * @returns {boolean} True if value is a String, otherwise false\n */\nconst isString = typeOfTest('string');\n\n/**\n * Determine if a value is a Function\n *\n * @param {*} val The value to test\n * @returns {boolean} True if value is a Function, otherwise false\n */\nconst isFunction = typeOfTest('function');\n\n/**\n * Determine if a value is a Number\n *\n * @param {*} val The value to test\n *\n * @returns {boolean} True if value is a Number, otherwise false\n */\nconst isNumber = typeOfTest('number');\n\n/**\n * Determine if a value is an Object\n *\n * @param {*} thing The value to test\n *\n * @returns {boolean} True if value is an Object, otherwise false\n */\nconst isObject = (thing) => thing !== null && typeof thing === 'object';\n\n/**\n * Determine if a value is a Boolean\n *\n * @param {*} thing The value to test\n * @returns {boolean} True if value is a Boolean, otherwise false\n */\nconst isBoolean = thing => thing === true || thing === false;\n\n/**\n * Determine if a value is a plain Object\n *\n * @param {*} val The value to test\n *\n * @returns {boolean} True if value is a plain Object, otherwise false\n */\nconst isPlainObject = (val) => {\n if (kindOf(val) !== 'object') {\n return false;\n }\n\n const prototype = getPrototypeOf(val);\n return (prototype === null || prototype === Object.prototype || Object.getPrototypeOf(prototype) === null) && !(Symbol.toStringTag in val) && !(Symbol.iterator in val);\n}\n\n/**\n * Determine if a value is a Date\n *\n * @param {*} val The value to test\n *\n * @returns {boolean} True if value is a Date, otherwise false\n */\nconst isDate = kindOfTest('Date');\n\n/**\n * Determine if a value is a File\n *\n * @param {*} val The value to test\n *\n * @returns {boolean} True if value is a File, otherwise false\n */\nconst isFile = kindOfTest('File');\n\n/**\n * Determine if a value is a Blob\n *\n * @param {*} val The value to test\n *\n * @returns {boolean} True if value is a Blob, otherwise false\n */\nconst isBlob = kindOfTest('Blob');\n\n/**\n * Determine if a value is a FileList\n *\n * @param {*} val The value to test\n *\n * @returns {boolean} True if value is a File, otherwise false\n */\nconst isFileList = kindOfTest('FileList');\n\n/**\n * Determine if a value is a Stream\n *\n * @param {*} val The value to test\n *\n * @returns {boolean} True if value is a Stream, otherwise false\n */\nconst isStream = (val) => isObject(val) && isFunction(val.pipe);\n\n/**\n * Determine if a value is a FormData\n *\n * @param {*} thing The value to test\n *\n * @returns {boolean} True if value is an FormData, otherwise false\n */\nconst isFormData = (thing) => {\n let kind;\n return thing && (\n (typeof FormData === 'function' && thing instanceof FormData) || (\n isFunction(thing.append) && (\n (kind = kindOf(thing)) === 'formdata' ||\n // detect form-data instance\n (kind === 'object' && isFunction(thing.toString) && thing.toString() === '[object FormData]')\n )\n )\n )\n}\n\n/**\n * Determine if a value is a URLSearchParams object\n *\n * @param {*} val The value to test\n *\n * @returns {boolean} True if value is a URLSearchParams object, otherwise false\n */\nconst isURLSearchParams = kindOfTest('URLSearchParams');\n\nconst [isReadableStream, isRequest, isResponse, isHeaders] = ['ReadableStream', 'Request', 'Response', 'Headers'].map(kindOfTest);\n\n/**\n * Trim excess whitespace off the beginning and end of a string\n *\n * @param {String} str The String to trim\n *\n * @returns {String} The String freed of excess whitespace\n */\nconst trim = (str) => str.trim ?\n str.trim() : str.replace(/^[\\s\\uFEFF\\xA0]+|[\\s\\uFEFF\\xA0]+$/g, '');\n\n/**\n * Iterate over an Array or an Object invoking a function for each item.\n *\n * If `obj` is an Array callback will be called passing\n * the value, index, and complete array for each item.\n *\n * If 'obj' is an Object callback will be called passing\n * the value, key, and complete object for each property.\n *\n * @param {Object|Array} obj The object to iterate\n * @param {Function} fn The callback to invoke for each item\n *\n * @param {Boolean} [allOwnKeys = false]\n * @returns {any}\n */\nfunction forEach(obj, fn, {allOwnKeys = false} = {}) {\n // Don't bother if no value provided\n if (obj === null || typeof obj === 'undefined') {\n return;\n }\n\n let i;\n let l;\n\n // Force an array if not already something iterable\n if (typeof obj !== 'object') {\n /*eslint no-param-reassign:0*/\n obj = [obj];\n }\n\n if (isArray(obj)) {\n // Iterate over array values\n for (i = 0, l = obj.length; i < l; i++) {\n fn.call(null, obj[i], i, obj);\n }\n } else {\n // Iterate over object keys\n const keys = allOwnKeys ? Object.getOwnPropertyNames(obj) : Object.keys(obj);\n const len = keys.length;\n let key;\n\n for (i = 0; i < len; i++) {\n key = keys[i];\n fn.call(null, obj[key], key, obj);\n }\n }\n}\n\nfunction findKey(obj, key) {\n key = key.toLowerCase();\n const keys = Object.keys(obj);\n let i = keys.length;\n let _key;\n while (i-- > 0) {\n _key = keys[i];\n if (key === _key.toLowerCase()) {\n return _key;\n }\n }\n return null;\n}\n\nconst _global = (() => {\n /*eslint no-undef:0*/\n if (typeof globalThis !== \"undefined\") return globalThis;\n return typeof self !== \"undefined\" ? self : (typeof window !== 'undefined' ? window : global)\n})();\n\nconst isContextDefined = (context) => !isUndefined(context) && context !== _global;\n\n/**\n * Accepts varargs expecting each argument to be an object, then\n * immutably merges the properties of each object and returns result.\n *\n * When multiple objects contain the same key the later object in\n * the arguments list will take precedence.\n *\n * Example:\n *\n * ```js\n * var result = merge({foo: 123}, {foo: 456});\n * console.log(result.foo); // outputs 456\n * ```\n *\n * @param {Object} obj1 Object to merge\n *\n * @returns {Object} Result of all merge properties\n */\nfunction merge(/* obj1, obj2, obj3, ... */) {\n const {caseless} = isContextDefined(this) && this || {};\n const result = {};\n const assignValue = (val, key) => {\n const targetKey = caseless && findKey(result, key) || key;\n if (isPlainObject(result[targetKey]) && isPlainObject(val)) {\n result[targetKey] = merge(result[targetKey], val);\n } else if (isPlainObject(val)) {\n result[targetKey] = merge({}, val);\n } else if (isArray(val)) {\n result[targetKey] = val.slice();\n } else {\n result[targetKey] = val;\n }\n }\n\n for (let i = 0, l = arguments.length; i < l; i++) {\n arguments[i] && forEach(arguments[i], assignValue);\n }\n return result;\n}\n\n/**\n * Extends object a by mutably adding to it the properties of object b.\n *\n * @param {Object} a The object to be extended\n * @param {Object} b The object to copy properties from\n * @param {Object} thisArg The object to bind function to\n *\n * @param {Boolean} [allOwnKeys]\n * @returns {Object} The resulting value of object a\n */\nconst extend = (a, b, thisArg, {allOwnKeys}= {}) => {\n forEach(b, (val, key) => {\n if (thisArg && isFunction(val)) {\n a[key] = bind(val, thisArg);\n } else {\n a[key] = val;\n }\n }, {allOwnKeys});\n return a;\n}\n\n/**\n * Remove byte order marker. This catches EF BB BF (the UTF-8 BOM)\n *\n * @param {string} content with BOM\n *\n * @returns {string} content value without BOM\n */\nconst stripBOM = (content) => {\n if (content.charCodeAt(0) === 0xFEFF) {\n content = content.slice(1);\n }\n return content;\n}\n\n/**\n * Inherit the prototype methods from one constructor into another\n * @param {function} constructor\n * @param {function} superConstructor\n * @param {object} [props]\n * @param {object} [descriptors]\n *\n * @returns {void}\n */\nconst inherits = (constructor, superConstructor, props, descriptors) => {\n constructor.prototype = Object.create(superConstructor.prototype, descriptors);\n constructor.prototype.constructor = constructor;\n Object.defineProperty(constructor, 'super', {\n value: superConstructor.prototype\n });\n props && Object.assign(constructor.prototype, props);\n}\n\n/**\n * Resolve object with deep prototype chain to a flat object\n * @param {Object} sourceObj source object\n * @param {Object} [destObj]\n * @param {Function|Boolean} [filter]\n * @param {Function} [propFilter]\n *\n * @returns {Object}\n */\nconst toFlatObject = (sourceObj, destObj, filter, propFilter) => {\n let props;\n let i;\n let prop;\n const merged = {};\n\n destObj = destObj || {};\n // eslint-disable-next-line no-eq-null,eqeqeq\n if (sourceObj == null) return destObj;\n\n do {\n props = Object.getOwnPropertyNames(sourceObj);\n i = props.length;\n while (i-- > 0) {\n prop = props[i];\n if ((!propFilter || propFilter(prop, sourceObj, destObj)) && !merged[prop]) {\n destObj[prop] = sourceObj[prop];\n merged[prop] = true;\n }\n }\n sourceObj = filter !== false && getPrototypeOf(sourceObj);\n } while (sourceObj && (!filter || filter(sourceObj, destObj)) && sourceObj !== Object.prototype);\n\n return destObj;\n}\n\n/**\n * Determines whether a string ends with the characters of a specified string\n *\n * @param {String} str\n * @param {String} searchString\n * @param {Number} [position= 0]\n *\n * @returns {boolean}\n */\nconst endsWith = (str, searchString, position) => {\n str = String(str);\n if (position === undefined || position > str.length) {\n position = str.length;\n }\n position -= searchString.length;\n const lastIndex = str.indexOf(searchString, position);\n return lastIndex !== -1 && lastIndex === position;\n}\n\n\n/**\n * Returns new array from array like object or null if failed\n *\n * @param {*} [thing]\n *\n * @returns {?Array}\n */\nconst toArray = (thing) => {\n if (!thing) return null;\n if (isArray(thing)) return thing;\n let i = thing.length;\n if (!isNumber(i)) return null;\n const arr = new Array(i);\n while (i-- > 0) {\n arr[i] = thing[i];\n }\n return arr;\n}\n\n/**\n * Checking if the Uint8Array exists and if it does, it returns a function that checks if the\n * thing passed in is an instance of Uint8Array\n *\n * @param {TypedArray}\n *\n * @returns {Array}\n */\n// eslint-disable-next-line func-names\nconst isTypedArray = (TypedArray => {\n // eslint-disable-next-line func-names\n return thing => {\n return TypedArray && thing instanceof TypedArray;\n };\n})(typeof Uint8Array !== 'undefined' && getPrototypeOf(Uint8Array));\n\n/**\n * For each entry in the object, call the function with the key and value.\n *\n * @param {Object} obj - The object to iterate over.\n * @param {Function} fn - The function to call for each entry.\n *\n * @returns {void}\n */\nconst forEachEntry = (obj, fn) => {\n const generator = obj && obj[Symbol.iterator];\n\n const iterator = generator.call(obj);\n\n let result;\n\n while ((result = iterator.next()) && !result.done) {\n const pair = result.value;\n fn.call(obj, pair[0], pair[1]);\n }\n}\n\n/**\n * It takes a regular expression and a string, and returns an array of all the matches\n *\n * @param {string} regExp - The regular expression to match against.\n * @param {string} str - The string to search.\n *\n * @returns {Array}\n */\nconst matchAll = (regExp, str) => {\n let matches;\n const arr = [];\n\n while ((matches = regExp.exec(str)) !== null) {\n arr.push(matches);\n }\n\n return arr;\n}\n\n/* Checking if the kindOfTest function returns true when passed an HTMLFormElement. */\nconst isHTMLForm = kindOfTest('HTMLFormElement');\n\nconst toCamelCase = str => {\n return str.toLowerCase().replace(/[-_\\s]([a-z\\d])(\\w*)/g,\n function replacer(m, p1, p2) {\n return p1.toUpperCase() + p2;\n }\n );\n};\n\n/* Creating a function that will check if an object has a property. */\nconst hasOwnProperty = (({hasOwnProperty}) => (obj, prop) => hasOwnProperty.call(obj, prop))(Object.prototype);\n\n/**\n * Determine if a value is a RegExp object\n *\n * @param {*} val The value to test\n *\n * @returns {boolean} True if value is a RegExp object, otherwise false\n */\nconst isRegExp = kindOfTest('RegExp');\n\nconst reduceDescriptors = (obj, reducer) => {\n const descriptors = Object.getOwnPropertyDescriptors(obj);\n const reducedDescriptors = {};\n\n forEach(descriptors, (descriptor, name) => {\n let ret;\n if ((ret = reducer(descriptor, name, obj)) !== false) {\n reducedDescriptors[name] = ret || descriptor;\n }\n });\n\n Object.defineProperties(obj, reducedDescriptors);\n}\n\n/**\n * Makes all methods read-only\n * @param {Object} obj\n */\n\nconst freezeMethods = (obj) => {\n reduceDescriptors(obj, (descriptor, name) => {\n // skip restricted props in strict mode\n if (isFunction(obj) && ['arguments', 'caller', 'callee'].indexOf(name) !== -1) {\n return false;\n }\n\n const value = obj[name];\n\n if (!isFunction(value)) return;\n\n descriptor.enumerable = false;\n\n if ('writable' in descriptor) {\n descriptor.writable = false;\n return;\n }\n\n if (!descriptor.set) {\n descriptor.set = () => {\n throw Error('Can not rewrite read-only method \\'' + name + '\\'');\n };\n }\n });\n}\n\nconst toObjectSet = (arrayOrString, delimiter) => {\n const obj = {};\n\n const define = (arr) => {\n arr.forEach(value => {\n obj[value] = true;\n });\n }\n\n isArray(arrayOrString) ? define(arrayOrString) : define(String(arrayOrString).split(delimiter));\n\n return obj;\n}\n\nconst noop = () => {}\n\nconst toFiniteNumber = (value, defaultValue) => {\n return value != null && Number.isFinite(value = +value) ? value : defaultValue;\n}\n\nconst ALPHA = 'abcdefghijklmnopqrstuvwxyz'\n\nconst DIGIT = '0123456789';\n\nconst ALPHABET = {\n DIGIT,\n ALPHA,\n ALPHA_DIGIT: ALPHA + ALPHA.toUpperCase() + DIGIT\n}\n\nconst generateString = (size = 16, alphabet = ALPHABET.ALPHA_DIGIT) => {\n let str = '';\n const {length} = alphabet;\n while (size--) {\n str += alphabet[Math.random() * length|0]\n }\n\n return str;\n}\n\n/**\n * If the thing is a FormData object, return true, otherwise return false.\n *\n * @param {unknown} thing - The thing to check.\n *\n * @returns {boolean}\n */\nfunction isSpecCompliantForm(thing) {\n return !!(thing && isFunction(thing.append) && thing[Symbol.toStringTag] === 'FormData' && thing[Symbol.iterator]);\n}\n\nconst toJSONObject = (obj) => {\n const stack = new Array(10);\n\n const visit = (source, i) => {\n\n if (isObject(source)) {\n if (stack.indexOf(source) >= 0) {\n return;\n }\n\n if(!('toJSON' in source)) {\n stack[i] = source;\n const target = isArray(source) ? [] : {};\n\n forEach(source, (value, key) => {\n const reducedValue = visit(value, i + 1);\n !isUndefined(reducedValue) && (target[key] = reducedValue);\n });\n\n stack[i] = undefined;\n\n return target;\n }\n }\n\n return source;\n }\n\n return visit(obj, 0);\n}\n\nconst isAsyncFn = kindOfTest('AsyncFunction');\n\nconst isThenable = (thing) =>\n thing && (isObject(thing) || isFunction(thing)) && isFunction(thing.then) && isFunction(thing.catch);\n\n// original code\n// https://github.com/DigitalBrainJS/AxiosPromise/blob/16deab13710ec09779922131f3fa5954320f83ab/lib/utils.js#L11-L34\n\nconst _setImmediate = ((setImmediateSupported, postMessageSupported) => {\n if (setImmediateSupported) {\n return setImmediate;\n }\n\n return postMessageSupported ? ((token, callbacks) => {\n _global.addEventListener(\"message\", ({source, data}) => {\n if (source === _global && data === token) {\n callbacks.length && callbacks.shift()();\n }\n }, false);\n\n return (cb) => {\n callbacks.push(cb);\n _global.postMessage(token, \"*\");\n }\n })(`axios@${Math.random()}`, []) : (cb) => setTimeout(cb);\n})(\n typeof setImmediate === 'function',\n isFunction(_global.postMessage)\n);\n\nconst asap = typeof queueMicrotask !== 'undefined' ?\n queueMicrotask.bind(_global) : ( typeof process !== 'undefined' && process.nextTick || _setImmediate);\n\n// *********************\n\nexport default {\n isArray,\n isArrayBuffer,\n isBuffer,\n isFormData,\n isArrayBufferView,\n isString,\n isNumber,\n isBoolean,\n isObject,\n isPlainObject,\n isReadableStream,\n isRequest,\n isResponse,\n isHeaders,\n isUndefined,\n isDate,\n isFile,\n isBlob,\n isRegExp,\n isFunction,\n isStream,\n isURLSearchParams,\n isTypedArray,\n isFileList,\n forEach,\n merge,\n extend,\n trim,\n stripBOM,\n inherits,\n toFlatObject,\n kindOf,\n kindOfTest,\n endsWith,\n toArray,\n forEachEntry,\n matchAll,\n isHTMLForm,\n hasOwnProperty,\n hasOwnProp: hasOwnProperty, // an alias to avoid ESLint no-prototype-builtins detection\n reduceDescriptors,\n freezeMethods,\n toObjectSet,\n toCamelCase,\n noop,\n toFiniteNumber,\n findKey,\n global: _global,\n isContextDefined,\n ALPHABET,\n generateString,\n isSpecCompliantForm,\n toJSONObject,\n isAsyncFn,\n isThenable,\n setImmediate: _setImmediate,\n asap\n};\n","'use strict';\n\nimport utils from '../utils.js';\n\n/**\n * Create an Error with the specified message, config, error code, request and response.\n *\n * @param {string} message The error message.\n * @param {string} [code] The error code (for example, 'ECONNABORTED').\n * @param {Object} [config] The config.\n * @param {Object} [request] The request.\n * @param {Object} [response] The response.\n *\n * @returns {Error} The created error.\n */\nfunction AxiosError(message, code, config, request, response) {\n Error.call(this);\n\n if (Error.captureStackTrace) {\n Error.captureStackTrace(this, this.constructor);\n } else {\n this.stack = (new Error()).stack;\n }\n\n this.message = message;\n this.name = 'AxiosError';\n code && (this.code = code);\n config && (this.config = config);\n request && (this.request = request);\n if (response) {\n this.response = response;\n this.status = response.status ? response.status : null;\n }\n}\n\nutils.inherits(AxiosError, Error, {\n toJSON: function toJSON() {\n return {\n // Standard\n message: this.message,\n name: this.name,\n // Microsoft\n description: this.description,\n number: this.number,\n // Mozilla\n fileName: this.fileName,\n lineNumber: this.lineNumber,\n columnNumber: this.columnNumber,\n stack: this.stack,\n // Axios\n config: utils.toJSONObject(this.config),\n code: this.code,\n status: this.status\n };\n }\n});\n\nconst prototype = AxiosError.prototype;\nconst descriptors = {};\n\n[\n 'ERR_BAD_OPTION_VALUE',\n 'ERR_BAD_OPTION',\n 'ECONNABORTED',\n 'ETIMEDOUT',\n 'ERR_NETWORK',\n 'ERR_FR_TOO_MANY_REDIRECTS',\n 'ERR_DEPRECATED',\n 'ERR_BAD_RESPONSE',\n 'ERR_BAD_REQUEST',\n 'ERR_CANCELED',\n 'ERR_NOT_SUPPORT',\n 'ERR_INVALID_URL'\n// eslint-disable-next-line func-names\n].forEach(code => {\n descriptors[code] = {value: code};\n});\n\nObject.defineProperties(AxiosError, descriptors);\nObject.defineProperty(prototype, 'isAxiosError', {value: true});\n\n// eslint-disable-next-line func-names\nAxiosError.from = (error, code, config, request, response, customProps) => {\n const axiosError = Object.create(prototype);\n\n utils.toFlatObject(error, axiosError, function filter(obj) {\n return obj !== Error.prototype;\n }, prop => {\n return prop !== 'isAxiosError';\n });\n\n AxiosError.call(axiosError, error.message, code, config, request, response);\n\n axiosError.cause = error;\n\n axiosError.name = error.name;\n\n customProps && Object.assign(axiosError, customProps);\n\n return axiosError;\n};\n\nexport default AxiosError;\n","// eslint-disable-next-line strict\nexport default null;\n","'use strict';\n\nimport utils from '../utils.js';\nimport AxiosError from '../core/AxiosError.js';\n// temporary hotfix to avoid circular references until AxiosURLSearchParams is refactored\nimport PlatformFormData from '../platform/node/classes/FormData.js';\n\n/**\n * Determines if the given thing is a array or js object.\n *\n * @param {string} thing - The object or array to be visited.\n *\n * @returns {boolean}\n */\nfunction isVisitable(thing) {\n return utils.isPlainObject(thing) || utils.isArray(thing);\n}\n\n/**\n * It removes the brackets from the end of a string\n *\n * @param {string} key - The key of the parameter.\n *\n * @returns {string} the key without the brackets.\n */\nfunction removeBrackets(key) {\n return utils.endsWith(key, '[]') ? key.slice(0, -2) : key;\n}\n\n/**\n * It takes a path, a key, and a boolean, and returns a string\n *\n * @param {string} path - The path to the current key.\n * @param {string} key - The key of the current object being iterated over.\n * @param {string} dots - If true, the key will be rendered with dots instead of brackets.\n *\n * @returns {string} The path to the current key.\n */\nfunction renderKey(path, key, dots) {\n if (!path) return key;\n return path.concat(key).map(function each(token, i) {\n // eslint-disable-next-line no-param-reassign\n token = removeBrackets(token);\n return !dots && i ? '[' + token + ']' : token;\n }).join(dots ? '.' : '');\n}\n\n/**\n * If the array is an array and none of its elements are visitable, then it's a flat array.\n *\n * @param {Array} arr - The array to check\n *\n * @returns {boolean}\n */\nfunction isFlatArray(arr) {\n return utils.isArray(arr) && !arr.some(isVisitable);\n}\n\nconst predicates = utils.toFlatObject(utils, {}, null, function filter(prop) {\n return /^is[A-Z]/.test(prop);\n});\n\n/**\n * Convert a data object to FormData\n *\n * @param {Object} obj\n * @param {?Object} [formData]\n * @param {?Object} [options]\n * @param {Function} [options.visitor]\n * @param {Boolean} [options.metaTokens = true]\n * @param {Boolean} [options.dots = false]\n * @param {?Boolean} [options.indexes = false]\n *\n * @returns {Object}\n **/\n\n/**\n * It converts an object into a FormData object\n *\n * @param {Object} obj - The object to convert to form data.\n * @param {string} formData - The FormData object to append to.\n * @param {Object} options\n *\n * @returns\n */\nfunction toFormData(obj, formData, options) {\n if (!utils.isObject(obj)) {\n throw new TypeError('target must be an object');\n }\n\n // eslint-disable-next-line no-param-reassign\n formData = formData || new (PlatformFormData || FormData)();\n\n // eslint-disable-next-line no-param-reassign\n options = utils.toFlatObject(options, {\n metaTokens: true,\n dots: false,\n indexes: false\n }, false, function defined(option, source) {\n // eslint-disable-next-line no-eq-null,eqeqeq\n return !utils.isUndefined(source[option]);\n });\n\n const metaTokens = options.metaTokens;\n // eslint-disable-next-line no-use-before-define\n const visitor = options.visitor || defaultVisitor;\n const dots = options.dots;\n const indexes = options.indexes;\n const _Blob = options.Blob || typeof Blob !== 'undefined' && Blob;\n const useBlob = _Blob && utils.isSpecCompliantForm(formData);\n\n if (!utils.isFunction(visitor)) {\n throw new TypeError('visitor must be a function');\n }\n\n function convertValue(value) {\n if (value === null) return '';\n\n if (utils.isDate(value)) {\n return value.toISOString();\n }\n\n if (!useBlob && utils.isBlob(value)) {\n throw new AxiosError('Blob is not supported. Use a Buffer instead.');\n }\n\n if (utils.isArrayBuffer(value) || utils.isTypedArray(value)) {\n return useBlob && typeof Blob === 'function' ? new Blob([value]) : Buffer.from(value);\n }\n\n return value;\n }\n\n /**\n * Default visitor.\n *\n * @param {*} value\n * @param {String|Number} key\n * @param {Array} path\n * @this {FormData}\n *\n * @returns {boolean} return true to visit the each prop of the value recursively\n */\n function defaultVisitor(value, key, path) {\n let arr = value;\n\n if (value && !path && typeof value === 'object') {\n if (utils.endsWith(key, '{}')) {\n // eslint-disable-next-line no-param-reassign\n key = metaTokens ? key : key.slice(0, -2);\n // eslint-disable-next-line no-param-reassign\n value = JSON.stringify(value);\n } else if (\n (utils.isArray(value) && isFlatArray(value)) ||\n ((utils.isFileList(value) || utils.endsWith(key, '[]')) && (arr = utils.toArray(value))\n )) {\n // eslint-disable-next-line no-param-reassign\n key = removeBrackets(key);\n\n arr.forEach(function each(el, index) {\n !(utils.isUndefined(el) || el === null) && formData.append(\n // eslint-disable-next-line no-nested-ternary\n indexes === true ? renderKey([key], index, dots) : (indexes === null ? key : key + '[]'),\n convertValue(el)\n );\n });\n return false;\n }\n }\n\n if (isVisitable(value)) {\n return true;\n }\n\n formData.append(renderKey(path, key, dots), convertValue(value));\n\n return false;\n }\n\n const stack = [];\n\n const exposedHelpers = Object.assign(predicates, {\n defaultVisitor,\n convertValue,\n isVisitable\n });\n\n function build(value, path) {\n if (utils.isUndefined(value)) return;\n\n if (stack.indexOf(value) !== -1) {\n throw Error('Circular reference detected in ' + path.join('.'));\n }\n\n stack.push(value);\n\n utils.forEach(value, function each(el, key) {\n const result = !(utils.isUndefined(el) || el === null) && visitor.call(\n formData, el, utils.isString(key) ? key.trim() : key, path, exposedHelpers\n );\n\n if (result === true) {\n build(el, path ? path.concat(key) : [key]);\n }\n });\n\n stack.pop();\n }\n\n if (!utils.isObject(obj)) {\n throw new TypeError('data must be an object');\n }\n\n build(obj);\n\n return formData;\n}\n\nexport default toFormData;\n","'use strict';\n\nimport toFormData from './toFormData.js';\n\n/**\n * It encodes a string by replacing all characters that are not in the unreserved set with\n * their percent-encoded equivalents\n *\n * @param {string} str - The string to encode.\n *\n * @returns {string} The encoded string.\n */\nfunction encode(str) {\n const charMap = {\n '!': '%21',\n \"'\": '%27',\n '(': '%28',\n ')': '%29',\n '~': '%7E',\n '%20': '+',\n '%00': '\\x00'\n };\n return encodeURIComponent(str).replace(/[!'()~]|%20|%00/g, function replacer(match) {\n return charMap[match];\n });\n}\n\n/**\n * It takes a params object and converts it to a FormData object\n *\n * @param {Object} params - The parameters to be converted to a FormData object.\n * @param {Object} options - The options object passed to the Axios constructor.\n *\n * @returns {void}\n */\nfunction AxiosURLSearchParams(params, options) {\n this._pairs = [];\n\n params && toFormData(params, this, options);\n}\n\nconst prototype = AxiosURLSearchParams.prototype;\n\nprototype.append = function append(name, value) {\n this._pairs.push([name, value]);\n};\n\nprototype.toString = function toString(encoder) {\n const _encode = encoder ? function(value) {\n return encoder.call(this, value, encode);\n } : encode;\n\n return this._pairs.map(function each(pair) {\n return _encode(pair[0]) + '=' + _encode(pair[1]);\n }, '').join('&');\n};\n\nexport default AxiosURLSearchParams;\n","'use strict';\n\nimport utils from '../utils.js';\nimport AxiosURLSearchParams from '../helpers/AxiosURLSearchParams.js';\n\n/**\n * It replaces all instances of the characters `:`, `$`, `,`, `+`, `[`, and `]` with their\n * URI encoded counterparts\n *\n * @param {string} val The value to be encoded.\n *\n * @returns {string} The encoded value.\n */\nfunction encode(val) {\n return encodeURIComponent(val).\n replace(/%3A/gi, ':').\n replace(/%24/g, '$').\n replace(/%2C/gi, ',').\n replace(/%20/g, '+').\n replace(/%5B/gi, '[').\n replace(/%5D/gi, ']');\n}\n\n/**\n * Build a URL by appending params to the end\n *\n * @param {string} url The base of the url (e.g., http://www.google.com)\n * @param {object} [params] The params to be appended\n * @param {?object} options\n *\n * @returns {string} The formatted url\n */\nexport default function buildURL(url, params, options) {\n /*eslint no-param-reassign:0*/\n if (!params) {\n return url;\n }\n \n const _encode = options && options.encode || encode;\n\n const serializeFn = options && options.serialize;\n\n let serializedParams;\n\n if (serializeFn) {\n serializedParams = serializeFn(params, options);\n } else {\n serializedParams = utils.isURLSearchParams(params) ?\n params.toString() :\n new AxiosURLSearchParams(params, options).toString(_encode);\n }\n\n if (serializedParams) {\n const hashmarkIndex = url.indexOf(\"#\");\n\n if (hashmarkIndex !== -1) {\n url = url.slice(0, hashmarkIndex);\n }\n url += (url.indexOf('?') === -1 ? '?' : '&') + serializedParams;\n }\n\n return url;\n}\n","'use strict';\n\nimport utils from './../utils.js';\n\nclass InterceptorManager {\n constructor() {\n this.handlers = [];\n }\n\n /**\n * Add a new interceptor to the stack\n *\n * @param {Function} fulfilled The function to handle `then` for a `Promise`\n * @param {Function} rejected The function to handle `reject` for a `Promise`\n *\n * @return {Number} An ID used to remove interceptor later\n */\n use(fulfilled, rejected, options) {\n this.handlers.push({\n fulfilled,\n rejected,\n synchronous: options ? options.synchronous : false,\n runWhen: options ? options.runWhen : null\n });\n return this.handlers.length - 1;\n }\n\n /**\n * Remove an interceptor from the stack\n *\n * @param {Number} id The ID that was returned by `use`\n *\n * @returns {Boolean} `true` if the interceptor was removed, `false` otherwise\n */\n eject(id) {\n if (this.handlers[id]) {\n this.handlers[id] = null;\n }\n }\n\n /**\n * Clear all interceptors from the stack\n *\n * @returns {void}\n */\n clear() {\n if (this.handlers) {\n this.handlers = [];\n }\n }\n\n /**\n * Iterate over all the registered interceptors\n *\n * This method is particularly useful for skipping over any\n * interceptors that may have become `null` calling `eject`.\n *\n * @param {Function} fn The function to call for each interceptor\n *\n * @returns {void}\n */\n forEach(fn) {\n utils.forEach(this.handlers, function forEachHandler(h) {\n if (h !== null) {\n fn(h);\n }\n });\n }\n}\n\nexport default InterceptorManager;\n","'use strict';\n\nexport default {\n silentJSONParsing: true,\n forcedJSONParsing: true,\n clarifyTimeoutError: false\n};\n","'use strict';\n\nimport AxiosURLSearchParams from '../../../helpers/AxiosURLSearchParams.js';\nexport default typeof URLSearchParams !== 'undefined' ? URLSearchParams : AxiosURLSearchParams;\n","'use strict';\n\nexport default typeof FormData !== 'undefined' ? FormData : null;\n","'use strict'\n\nexport default typeof Blob !== 'undefined' ? Blob : null\n","import URLSearchParams from './classes/URLSearchParams.js'\nimport FormData from './classes/FormData.js'\nimport Blob from './classes/Blob.js'\n\nexport default {\n isBrowser: true,\n classes: {\n URLSearchParams,\n FormData,\n Blob\n },\n protocols: ['http', 'https', 'file', 'blob', 'url', 'data']\n};\n","const hasBrowserEnv = typeof window !== 'undefined' && typeof document !== 'undefined';\n\nconst _navigator = typeof navigator === 'object' && navigator || undefined;\n\n/**\n * Determine if we're running in a standard browser environment\n *\n * This allows axios to run in a web worker, and react-native.\n * Both environments support XMLHttpRequest, but not fully standard globals.\n *\n * web workers:\n * typeof window -> undefined\n * typeof document -> undefined\n *\n * react-native:\n * navigator.product -> 'ReactNative'\n * nativescript\n * navigator.product -> 'NativeScript' or 'NS'\n *\n * @returns {boolean}\n */\nconst hasStandardBrowserEnv = hasBrowserEnv &&\n (!_navigator || ['ReactNative', 'NativeScript', 'NS'].indexOf(_navigator.product) < 0);\n\n/**\n * Determine if we're running in a standard browser webWorker environment\n *\n * Although the `isStandardBrowserEnv` method indicates that\n * `allows axios to run in a web worker`, the WebWorker will still be\n * filtered out due to its judgment standard\n * `typeof window !== 'undefined' && typeof document !== 'undefined'`.\n * This leads to a problem when axios post `FormData` in webWorker\n */\nconst hasStandardBrowserWebWorkerEnv = (() => {\n return (\n typeof WorkerGlobalScope !== 'undefined' &&\n // eslint-disable-next-line no-undef\n self instanceof WorkerGlobalScope &&\n typeof self.importScripts === 'function'\n );\n})();\n\nconst origin = hasBrowserEnv && window.location.href || 'http://localhost';\n\nexport {\n hasBrowserEnv,\n hasStandardBrowserWebWorkerEnv,\n hasStandardBrowserEnv,\n _navigator as navigator,\n origin\n}\n","import platform from './node/index.js';\nimport * as utils from './common/utils.js';\n\nexport default {\n ...utils,\n ...platform\n}\n","'use strict';\n\nimport utils from '../utils.js';\nimport toFormData from './toFormData.js';\nimport platform from '../platform/index.js';\n\nexport default function toURLEncodedForm(data, options) {\n return toFormData(data, new platform.classes.URLSearchParams(), Object.assign({\n visitor: function(value, key, path, helpers) {\n if (platform.isNode && utils.isBuffer(value)) {\n this.append(key, value.toString('base64'));\n return false;\n }\n\n return helpers.defaultVisitor.apply(this, arguments);\n }\n }, options));\n}\n","'use strict';\n\nimport utils from '../utils.js';\n\n/**\n * It takes a string like `foo[x][y][z]` and returns an array like `['foo', 'x', 'y', 'z']\n *\n * @param {string} name - The name of the property to get.\n *\n * @returns An array of strings.\n */\nfunction parsePropPath(name) {\n // foo[x][y][z]\n // foo.x.y.z\n // foo-x-y-z\n // foo x y z\n return utils.matchAll(/\\w+|\\[(\\w*)]/g, name).map(match => {\n return match[0] === '[]' ? '' : match[1] || match[0];\n });\n}\n\n/**\n * Convert an array to an object.\n *\n * @param {Array} arr - The array to convert to an object.\n *\n * @returns An object with the same keys and values as the array.\n */\nfunction arrayToObject(arr) {\n const obj = {};\n const keys = Object.keys(arr);\n let i;\n const len = keys.length;\n let key;\n for (i = 0; i < len; i++) {\n key = keys[i];\n obj[key] = arr[key];\n }\n return obj;\n}\n\n/**\n * It takes a FormData object and returns a JavaScript object\n *\n * @param {string} formData The FormData object to convert to JSON.\n *\n * @returns {Object | null} The converted object.\n */\nfunction formDataToJSON(formData) {\n function buildPath(path, value, target, index) {\n let name = path[index++];\n\n if (name === '__proto__') return true;\n\n const isNumericKey = Number.isFinite(+name);\n const isLast = index >= path.length;\n name = !name && utils.isArray(target) ? target.length : name;\n\n if (isLast) {\n if (utils.hasOwnProp(target, name)) {\n target[name] = [target[name], value];\n } else {\n target[name] = value;\n }\n\n return !isNumericKey;\n }\n\n if (!target[name] || !utils.isObject(target[name])) {\n target[name] = [];\n }\n\n const result = buildPath(path, value, target[name], index);\n\n if (result && utils.isArray(target[name])) {\n target[name] = arrayToObject(target[name]);\n }\n\n return !isNumericKey;\n }\n\n if (utils.isFormData(formData) && utils.isFunction(formData.entries)) {\n const obj = {};\n\n utils.forEachEntry(formData, (name, value) => {\n buildPath(parsePropPath(name), value, obj, 0);\n });\n\n return obj;\n }\n\n return null;\n}\n\nexport default formDataToJSON;\n","'use strict';\n\nimport utils from '../utils.js';\nimport AxiosError from '../core/AxiosError.js';\nimport transitionalDefaults from './transitional.js';\nimport toFormData from '../helpers/toFormData.js';\nimport toURLEncodedForm from '../helpers/toURLEncodedForm.js';\nimport platform from '../platform/index.js';\nimport formDataToJSON from '../helpers/formDataToJSON.js';\n\n/**\n * It takes a string, tries to parse it, and if it fails, it returns the stringified version\n * of the input\n *\n * @param {any} rawValue - The value to be stringified.\n * @param {Function} parser - A function that parses a string into a JavaScript object.\n * @param {Function} encoder - A function that takes a value and returns a string.\n *\n * @returns {string} A stringified version of the rawValue.\n */\nfunction stringifySafely(rawValue, parser, encoder) {\n if (utils.isString(rawValue)) {\n try {\n (parser || JSON.parse)(rawValue);\n return utils.trim(rawValue);\n } catch (e) {\n if (e.name !== 'SyntaxError') {\n throw e;\n }\n }\n }\n\n return (encoder || JSON.stringify)(rawValue);\n}\n\nconst defaults = {\n\n transitional: transitionalDefaults,\n\n adapter: ['xhr', 'http', 'fetch'],\n\n transformRequest: [function transformRequest(data, headers) {\n const contentType = headers.getContentType() || '';\n const hasJSONContentType = contentType.indexOf('application/json') > -1;\n const isObjectPayload = utils.isObject(data);\n\n if (isObjectPayload && utils.isHTMLForm(data)) {\n data = new FormData(data);\n }\n\n const isFormData = utils.isFormData(data);\n\n if (isFormData) {\n return hasJSONContentType ? JSON.stringify(formDataToJSON(data)) : data;\n }\n\n if (utils.isArrayBuffer(data) ||\n utils.isBuffer(data) ||\n utils.isStream(data) ||\n utils.isFile(data) ||\n utils.isBlob(data) ||\n utils.isReadableStream(data)\n ) {\n return data;\n }\n if (utils.isArrayBufferView(data)) {\n return data.buffer;\n }\n if (utils.isURLSearchParams(data)) {\n headers.setContentType('application/x-www-form-urlencoded;charset=utf-8', false);\n return data.toString();\n }\n\n let isFileList;\n\n if (isObjectPayload) {\n if (contentType.indexOf('application/x-www-form-urlencoded') > -1) {\n return toURLEncodedForm(data, this.formSerializer).toString();\n }\n\n if ((isFileList = utils.isFileList(data)) || contentType.indexOf('multipart/form-data') > -1) {\n const _FormData = this.env && this.env.FormData;\n\n return toFormData(\n isFileList ? {'files[]': data} : data,\n _FormData && new _FormData(),\n this.formSerializer\n );\n }\n }\n\n if (isObjectPayload || hasJSONContentType ) {\n headers.setContentType('application/json', false);\n return stringifySafely(data);\n }\n\n return data;\n }],\n\n transformResponse: [function transformResponse(data) {\n const transitional = this.transitional || defaults.transitional;\n const forcedJSONParsing = transitional && transitional.forcedJSONParsing;\n const JSONRequested = this.responseType === 'json';\n\n if (utils.isResponse(data) || utils.isReadableStream(data)) {\n return data;\n }\n\n if (data && utils.isString(data) && ((forcedJSONParsing && !this.responseType) || JSONRequested)) {\n const silentJSONParsing = transitional && transitional.silentJSONParsing;\n const strictJSONParsing = !silentJSONParsing && JSONRequested;\n\n try {\n return JSON.parse(data);\n } catch (e) {\n if (strictJSONParsing) {\n if (e.name === 'SyntaxError') {\n throw AxiosError.from(e, AxiosError.ERR_BAD_RESPONSE, this, null, this.response);\n }\n throw e;\n }\n }\n }\n\n return data;\n }],\n\n /**\n * A timeout in milliseconds to abort a request. If set to 0 (default) a\n * timeout is not created.\n */\n timeout: 0,\n\n xsrfCookieName: 'XSRF-TOKEN',\n xsrfHeaderName: 'X-XSRF-TOKEN',\n\n maxContentLength: -1,\n maxBodyLength: -1,\n\n env: {\n FormData: platform.classes.FormData,\n Blob: platform.classes.Blob\n },\n\n validateStatus: function validateStatus(status) {\n return status >= 200 && status < 300;\n },\n\n headers: {\n common: {\n 'Accept': 'application/json, text/plain, */*',\n 'Content-Type': undefined\n }\n }\n};\n\nutils.forEach(['delete', 'get', 'head', 'post', 'put', 'patch'], (method) => {\n defaults.headers[method] = {};\n});\n\nexport default defaults;\n","'use strict';\n\nimport utils from './../utils.js';\n\n// RawAxiosHeaders whose duplicates are ignored by node\n// c.f. https://nodejs.org/api/http.html#http_message_headers\nconst ignoreDuplicateOf = utils.toObjectSet([\n 'age', 'authorization', 'content-length', 'content-type', 'etag',\n 'expires', 'from', 'host', 'if-modified-since', 'if-unmodified-since',\n 'last-modified', 'location', 'max-forwards', 'proxy-authorization',\n 'referer', 'retry-after', 'user-agent'\n]);\n\n/**\n * Parse headers into an object\n *\n * ```\n * Date: Wed, 27 Aug 2014 08:58:49 GMT\n * Content-Type: application/json\n * Connection: keep-alive\n * Transfer-Encoding: chunked\n * ```\n *\n * @param {String} rawHeaders Headers needing to be parsed\n *\n * @returns {Object} Headers parsed into an object\n */\nexport default rawHeaders => {\n const parsed = {};\n let key;\n let val;\n let i;\n\n rawHeaders && rawHeaders.split('\\n').forEach(function parser(line) {\n i = line.indexOf(':');\n key = line.substring(0, i).trim().toLowerCase();\n val = line.substring(i + 1).trim();\n\n if (!key || (parsed[key] && ignoreDuplicateOf[key])) {\n return;\n }\n\n if (key === 'set-cookie') {\n if (parsed[key]) {\n parsed[key].push(val);\n } else {\n parsed[key] = [val];\n }\n } else {\n parsed[key] = parsed[key] ? parsed[key] + ', ' + val : val;\n }\n });\n\n return parsed;\n};\n","'use strict';\n\nimport utils from '../utils.js';\nimport parseHeaders from '../helpers/parseHeaders.js';\n\nconst $internals = Symbol('internals');\n\nfunction normalizeHeader(header) {\n return header && String(header).trim().toLowerCase();\n}\n\nfunction normalizeValue(value) {\n if (value === false || value == null) {\n return value;\n }\n\n return utils.isArray(value) ? value.map(normalizeValue) : String(value);\n}\n\nfunction parseTokens(str) {\n const tokens = Object.create(null);\n const tokensRE = /([^\\s,;=]+)\\s*(?:=\\s*([^,;]+))?/g;\n let match;\n\n while ((match = tokensRE.exec(str))) {\n tokens[match[1]] = match[2];\n }\n\n return tokens;\n}\n\nconst isValidHeaderName = (str) => /^[-_a-zA-Z0-9^`|~,!#$%&'*+.]+$/.test(str.trim());\n\nfunction matchHeaderValue(context, value, header, filter, isHeaderNameFilter) {\n if (utils.isFunction(filter)) {\n return filter.call(this, value, header);\n }\n\n if (isHeaderNameFilter) {\n value = header;\n }\n\n if (!utils.isString(value)) return;\n\n if (utils.isString(filter)) {\n return value.indexOf(filter) !== -1;\n }\n\n if (utils.isRegExp(filter)) {\n return filter.test(value);\n }\n}\n\nfunction formatHeader(header) {\n return header.trim()\n .toLowerCase().replace(/([a-z\\d])(\\w*)/g, (w, char, str) => {\n return char.toUpperCase() + str;\n });\n}\n\nfunction buildAccessors(obj, header) {\n const accessorName = utils.toCamelCase(' ' + header);\n\n ['get', 'set', 'has'].forEach(methodName => {\n Object.defineProperty(obj, methodName + accessorName, {\n value: function(arg1, arg2, arg3) {\n return this[methodName].call(this, header, arg1, arg2, arg3);\n },\n configurable: true\n });\n });\n}\n\nclass AxiosHeaders {\n constructor(headers) {\n headers && this.set(headers);\n }\n\n set(header, valueOrRewrite, rewrite) {\n const self = this;\n\n function setHeader(_value, _header, _rewrite) {\n const lHeader = normalizeHeader(_header);\n\n if (!lHeader) {\n throw new Error('header name must be a non-empty string');\n }\n\n const key = utils.findKey(self, lHeader);\n\n if(!key || self[key] === undefined || _rewrite === true || (_rewrite === undefined && self[key] !== false)) {\n self[key || _header] = normalizeValue(_value);\n }\n }\n\n const setHeaders = (headers, _rewrite) =>\n utils.forEach(headers, (_value, _header) => setHeader(_value, _header, _rewrite));\n\n if (utils.isPlainObject(header) || header instanceof this.constructor) {\n setHeaders(header, valueOrRewrite)\n } else if(utils.isString(header) && (header = header.trim()) && !isValidHeaderName(header)) {\n setHeaders(parseHeaders(header), valueOrRewrite);\n } else if (utils.isHeaders(header)) {\n for (const [key, value] of header.entries()) {\n setHeader(value, key, rewrite);\n }\n } else {\n header != null && setHeader(valueOrRewrite, header, rewrite);\n }\n\n return this;\n }\n\n get(header, parser) {\n header = normalizeHeader(header);\n\n if (header) {\n const key = utils.findKey(this, header);\n\n if (key) {\n const value = this[key];\n\n if (!parser) {\n return value;\n }\n\n if (parser === true) {\n return parseTokens(value);\n }\n\n if (utils.isFunction(parser)) {\n return parser.call(this, value, key);\n }\n\n if (utils.isRegExp(parser)) {\n return parser.exec(value);\n }\n\n throw new TypeError('parser must be boolean|regexp|function');\n }\n }\n }\n\n has(header, matcher) {\n header = normalizeHeader(header);\n\n if (header) {\n const key = utils.findKey(this, header);\n\n return !!(key && this[key] !== undefined && (!matcher || matchHeaderValue(this, this[key], key, matcher)));\n }\n\n return false;\n }\n\n delete(header, matcher) {\n const self = this;\n let deleted = false;\n\n function deleteHeader(_header) {\n _header = normalizeHeader(_header);\n\n if (_header) {\n const key = utils.findKey(self, _header);\n\n if (key && (!matcher || matchHeaderValue(self, self[key], key, matcher))) {\n delete self[key];\n\n deleted = true;\n }\n }\n }\n\n if (utils.isArray(header)) {\n header.forEach(deleteHeader);\n } else {\n deleteHeader(header);\n }\n\n return deleted;\n }\n\n clear(matcher) {\n const keys = Object.keys(this);\n let i = keys.length;\n let deleted = false;\n\n while (i--) {\n const key = keys[i];\n if(!matcher || matchHeaderValue(this, this[key], key, matcher, true)) {\n delete this[key];\n deleted = true;\n }\n }\n\n return deleted;\n }\n\n normalize(format) {\n const self = this;\n const headers = {};\n\n utils.forEach(this, (value, header) => {\n const key = utils.findKey(headers, header);\n\n if (key) {\n self[key] = normalizeValue(value);\n delete self[header];\n return;\n }\n\n const normalized = format ? formatHeader(header) : String(header).trim();\n\n if (normalized !== header) {\n delete self[header];\n }\n\n self[normalized] = normalizeValue(value);\n\n headers[normalized] = true;\n });\n\n return this;\n }\n\n concat(...targets) {\n return this.constructor.concat(this, ...targets);\n }\n\n toJSON(asStrings) {\n const obj = Object.create(null);\n\n utils.forEach(this, (value, header) => {\n value != null && value !== false && (obj[header] = asStrings && utils.isArray(value) ? value.join(', ') : value);\n });\n\n return obj;\n }\n\n [Symbol.iterator]() {\n return Object.entries(this.toJSON())[Symbol.iterator]();\n }\n\n toString() {\n return Object.entries(this.toJSON()).map(([header, value]) => header + ': ' + value).join('\\n');\n }\n\n get [Symbol.toStringTag]() {\n return 'AxiosHeaders';\n }\n\n static from(thing) {\n return thing instanceof this ? thing : new this(thing);\n }\n\n static concat(first, ...targets) {\n const computed = new this(first);\n\n targets.forEach((target) => computed.set(target));\n\n return computed;\n }\n\n static accessor(header) {\n const internals = this[$internals] = (this[$internals] = {\n accessors: {}\n });\n\n const accessors = internals.accessors;\n const prototype = this.prototype;\n\n function defineAccessor(_header) {\n const lHeader = normalizeHeader(_header);\n\n if (!accessors[lHeader]) {\n buildAccessors(prototype, _header);\n accessors[lHeader] = true;\n }\n }\n\n utils.isArray(header) ? header.forEach(defineAccessor) : defineAccessor(header);\n\n return this;\n }\n}\n\nAxiosHeaders.accessor(['Content-Type', 'Content-Length', 'Accept', 'Accept-Encoding', 'User-Agent', 'Authorization']);\n\n// reserved names hotfix\nutils.reduceDescriptors(AxiosHeaders.prototype, ({value}, key) => {\n let mapped = key[0].toUpperCase() + key.slice(1); // map `set` => `Set`\n return {\n get: () => value,\n set(headerValue) {\n this[mapped] = headerValue;\n }\n }\n});\n\nutils.freezeMethods(AxiosHeaders);\n\nexport default AxiosHeaders;\n","'use strict';\n\nimport utils from './../utils.js';\nimport defaults from '../defaults/index.js';\nimport AxiosHeaders from '../core/AxiosHeaders.js';\n\n/**\n * Transform the data for a request or a response\n *\n * @param {Array|Function} fns A single function or Array of functions\n * @param {?Object} response The response object\n *\n * @returns {*} The resulting transformed data\n */\nexport default function transformData(fns, response) {\n const config = this || defaults;\n const context = response || config;\n const headers = AxiosHeaders.from(context.headers);\n let data = context.data;\n\n utils.forEach(fns, function transform(fn) {\n data = fn.call(config, data, headers.normalize(), response ? response.status : undefined);\n });\n\n headers.normalize();\n\n return data;\n}\n","'use strict';\n\nexport default function isCancel(value) {\n return !!(value && value.__CANCEL__);\n}\n","'use strict';\n\nimport AxiosError from '../core/AxiosError.js';\nimport utils from '../utils.js';\n\n/**\n * A `CanceledError` is an object that is thrown when an operation is canceled.\n *\n * @param {string=} message The message.\n * @param {Object=} config The config.\n * @param {Object=} request The request.\n *\n * @returns {CanceledError} The created error.\n */\nfunction CanceledError(message, config, request) {\n // eslint-disable-next-line no-eq-null,eqeqeq\n AxiosError.call(this, message == null ? 'canceled' : message, AxiosError.ERR_CANCELED, config, request);\n this.name = 'CanceledError';\n}\n\nutils.inherits(CanceledError, AxiosError, {\n __CANCEL__: true\n});\n\nexport default CanceledError;\n","'use strict';\n\nimport AxiosError from './AxiosError.js';\n\n/**\n * Resolve or reject a Promise based on response status.\n *\n * @param {Function} resolve A function that resolves the promise.\n * @param {Function} reject A function that rejects the promise.\n * @param {object} response The response.\n *\n * @returns {object} The response.\n */\nexport default function settle(resolve, reject, response) {\n const validateStatus = response.config.validateStatus;\n if (!response.status || !validateStatus || validateStatus(response.status)) {\n resolve(response);\n } else {\n reject(new AxiosError(\n 'Request failed with status code ' + response.status,\n [AxiosError.ERR_BAD_REQUEST, AxiosError.ERR_BAD_RESPONSE][Math.floor(response.status / 100) - 4],\n response.config,\n response.request,\n response\n ));\n }\n}\n","'use strict';\n\nexport default function parseProtocol(url) {\n const match = /^([-+\\w]{1,25})(:?\\/\\/|:)/.exec(url);\n return match && match[1] || '';\n}\n","'use strict';\n\n/**\n * Calculate data maxRate\n * @param {Number} [samplesCount= 10]\n * @param {Number} [min= 1000]\n * @returns {Function}\n */\nfunction speedometer(samplesCount, min) {\n samplesCount = samplesCount || 10;\n const bytes = new Array(samplesCount);\n const timestamps = new Array(samplesCount);\n let head = 0;\n let tail = 0;\n let firstSampleTS;\n\n min = min !== undefined ? min : 1000;\n\n return function push(chunkLength) {\n const now = Date.now();\n\n const startedAt = timestamps[tail];\n\n if (!firstSampleTS) {\n firstSampleTS = now;\n }\n\n bytes[head] = chunkLength;\n timestamps[head] = now;\n\n let i = tail;\n let bytesCount = 0;\n\n while (i !== head) {\n bytesCount += bytes[i++];\n i = i % samplesCount;\n }\n\n head = (head + 1) % samplesCount;\n\n if (head === tail) {\n tail = (tail + 1) % samplesCount;\n }\n\n if (now - firstSampleTS < min) {\n return;\n }\n\n const passed = startedAt && now - startedAt;\n\n return passed ? Math.round(bytesCount * 1000 / passed) : undefined;\n };\n}\n\nexport default speedometer;\n","/**\n * Throttle decorator\n * @param {Function} fn\n * @param {Number} freq\n * @return {Function}\n */\nfunction throttle(fn, freq) {\n let timestamp = 0;\n let threshold = 1000 / freq;\n let lastArgs;\n let timer;\n\n const invoke = (args, now = Date.now()) => {\n timestamp = now;\n lastArgs = null;\n if (timer) {\n clearTimeout(timer);\n timer = null;\n }\n fn.apply(null, args);\n }\n\n const throttled = (...args) => {\n const now = Date.now();\n const passed = now - timestamp;\n if ( passed >= threshold) {\n invoke(args, now);\n } else {\n lastArgs = args;\n if (!timer) {\n timer = setTimeout(() => {\n timer = null;\n invoke(lastArgs)\n }, threshold - passed);\n }\n }\n }\n\n const flush = () => lastArgs && invoke(lastArgs);\n\n return [throttled, flush];\n}\n\nexport default throttle;\n","import speedometer from \"./speedometer.js\";\nimport throttle from \"./throttle.js\";\nimport utils from \"../utils.js\";\n\nexport const progressEventReducer = (listener, isDownloadStream, freq = 3) => {\n let bytesNotified = 0;\n const _speedometer = speedometer(50, 250);\n\n return throttle(e => {\n const loaded = e.loaded;\n const total = e.lengthComputable ? e.total : undefined;\n const progressBytes = loaded - bytesNotified;\n const rate = _speedometer(progressBytes);\n const inRange = loaded <= total;\n\n bytesNotified = loaded;\n\n const data = {\n loaded,\n total,\n progress: total ? (loaded / total) : undefined,\n bytes: progressBytes,\n rate: rate ? rate : undefined,\n estimated: rate && total && inRange ? (total - loaded) / rate : undefined,\n event: e,\n lengthComputable: total != null,\n [isDownloadStream ? 'download' : 'upload']: true\n };\n\n listener(data);\n }, freq);\n}\n\nexport const progressEventDecorator = (total, throttled) => {\n const lengthComputable = total != null;\n\n return [(loaded) => throttled[0]({\n lengthComputable,\n total,\n loaded\n }), throttled[1]];\n}\n\nexport const asyncDecorator = (fn) => (...args) => utils.asap(() => fn(...args));\n","'use strict';\n\nimport utils from './../utils.js';\nimport platform from '../platform/index.js';\n\nexport default platform.hasStandardBrowserEnv ?\n\n// Standard browser envs have full support of the APIs needed to test\n// whether the request URL is of the same origin as current location.\n (function standardBrowserEnv() {\n const msie = platform.navigator && /(msie|trident)/i.test(platform.navigator.userAgent);\n const urlParsingNode = document.createElement('a');\n let originURL;\n\n /**\n * Parse a URL to discover its components\n *\n * @param {String} url The URL to be parsed\n * @returns {Object}\n */\n function resolveURL(url) {\n let href = url;\n\n if (msie) {\n // IE needs attribute set twice to normalize properties\n urlParsingNode.setAttribute('href', href);\n href = urlParsingNode.href;\n }\n\n urlParsingNode.setAttribute('href', href);\n\n // urlParsingNode provides the UrlUtils interface - http://url.spec.whatwg.org/#urlutils\n return {\n href: urlParsingNode.href,\n protocol: urlParsingNode.protocol ? urlParsingNode.protocol.replace(/:$/, '') : '',\n host: urlParsingNode.host,\n search: urlParsingNode.search ? urlParsingNode.search.replace(/^\\?/, '') : '',\n hash: urlParsingNode.hash ? urlParsingNode.hash.replace(/^#/, '') : '',\n hostname: urlParsingNode.hostname,\n port: urlParsingNode.port,\n pathname: (urlParsingNode.pathname.charAt(0) === '/') ?\n urlParsingNode.pathname :\n '/' + urlParsingNode.pathname\n };\n }\n\n originURL = resolveURL(window.location.href);\n\n /**\n * Determine if a URL shares the same origin as the current location\n *\n * @param {String} requestURL The URL to test\n * @returns {boolean} True if URL shares the same origin, otherwise false\n */\n return function isURLSameOrigin(requestURL) {\n const parsed = (utils.isString(requestURL)) ? resolveURL(requestURL) : requestURL;\n return (parsed.protocol === originURL.protocol &&\n parsed.host === originURL.host);\n };\n })() :\n\n // Non standard browser envs (web workers, react-native) lack needed support.\n (function nonStandardBrowserEnv() {\n return function isURLSameOrigin() {\n return true;\n };\n })();\n","import utils from './../utils.js';\nimport platform from '../platform/index.js';\n\nexport default platform.hasStandardBrowserEnv ?\n\n // Standard browser envs support document.cookie\n {\n write(name, value, expires, path, domain, secure) {\n const cookie = [name + '=' + encodeURIComponent(value)];\n\n utils.isNumber(expires) && cookie.push('expires=' + new Date(expires).toGMTString());\n\n utils.isString(path) && cookie.push('path=' + path);\n\n utils.isString(domain) && cookie.push('domain=' + domain);\n\n secure === true && cookie.push('secure');\n\n document.cookie = cookie.join('; ');\n },\n\n read(name) {\n const match = document.cookie.match(new RegExp('(^|;\\\\s*)(' + name + ')=([^;]*)'));\n return (match ? decodeURIComponent(match[3]) : null);\n },\n\n remove(name) {\n this.write(name, '', Date.now() - 86400000);\n }\n }\n\n :\n\n // Non-standard browser env (web workers, react-native) lack needed support.\n {\n write() {},\n read() {\n return null;\n },\n remove() {}\n };\n\n","'use strict';\n\n/**\n * Determines whether the specified URL is absolute\n *\n * @param {string} url The URL to test\n *\n * @returns {boolean} True if the specified URL is absolute, otherwise false\n */\nexport default function isAbsoluteURL(url) {\n // A URL is considered absolute if it begins with \"://\" or \"//\" (protocol-relative URL).\n // RFC 3986 defines scheme name as a sequence of characters beginning with a letter and followed\n // by any combination of letters, digits, plus, period, or hyphen.\n return /^([a-z][a-z\\d+\\-.]*:)?\\/\\//i.test(url);\n}\n","'use strict';\n\n/**\n * Creates a new URL by combining the specified URLs\n *\n * @param {string} baseURL The base URL\n * @param {string} relativeURL The relative URL\n *\n * @returns {string} The combined URL\n */\nexport default function combineURLs(baseURL, relativeURL) {\n return relativeURL\n ? baseURL.replace(/\\/?\\/$/, '') + '/' + relativeURL.replace(/^\\/+/, '')\n : baseURL;\n}\n","'use strict';\n\nimport isAbsoluteURL from '../helpers/isAbsoluteURL.js';\nimport combineURLs from '../helpers/combineURLs.js';\n\n/**\n * Creates a new URL by combining the baseURL with the requestedURL,\n * only when the requestedURL is not already an absolute URL.\n * If the requestURL is absolute, this function returns the requestedURL untouched.\n *\n * @param {string} baseURL The base URL\n * @param {string} requestedURL Absolute or relative URL to combine\n *\n * @returns {string} The combined full path\n */\nexport default function buildFullPath(baseURL, requestedURL) {\n if (baseURL && !isAbsoluteURL(requestedURL)) {\n return combineURLs(baseURL, requestedURL);\n }\n return requestedURL;\n}\n","'use strict';\n\nimport utils from '../utils.js';\nimport AxiosHeaders from \"./AxiosHeaders.js\";\n\nconst headersToObject = (thing) => thing instanceof AxiosHeaders ? { ...thing } : thing;\n\n/**\n * Config-specific merge-function which creates a new config-object\n * by merging two configuration objects together.\n *\n * @param {Object} config1\n * @param {Object} config2\n *\n * @returns {Object} New object resulting from merging config2 to config1\n */\nexport default function mergeConfig(config1, config2) {\n // eslint-disable-next-line no-param-reassign\n config2 = config2 || {};\n const config = {};\n\n function getMergedValue(target, source, caseless) {\n if (utils.isPlainObject(target) && utils.isPlainObject(source)) {\n return utils.merge.call({caseless}, target, source);\n } else if (utils.isPlainObject(source)) {\n return utils.merge({}, source);\n } else if (utils.isArray(source)) {\n return source.slice();\n }\n return source;\n }\n\n // eslint-disable-next-line consistent-return\n function mergeDeepProperties(a, b, caseless) {\n if (!utils.isUndefined(b)) {\n return getMergedValue(a, b, caseless);\n } else if (!utils.isUndefined(a)) {\n return getMergedValue(undefined, a, caseless);\n }\n }\n\n // eslint-disable-next-line consistent-return\n function valueFromConfig2(a, b) {\n if (!utils.isUndefined(b)) {\n return getMergedValue(undefined, b);\n }\n }\n\n // eslint-disable-next-line consistent-return\n function defaultToConfig2(a, b) {\n if (!utils.isUndefined(b)) {\n return getMergedValue(undefined, b);\n } else if (!utils.isUndefined(a)) {\n return getMergedValue(undefined, a);\n }\n }\n\n // eslint-disable-next-line consistent-return\n function mergeDirectKeys(a, b, prop) {\n if (prop in config2) {\n return getMergedValue(a, b);\n } else if (prop in config1) {\n return getMergedValue(undefined, a);\n }\n }\n\n const mergeMap = {\n url: valueFromConfig2,\n method: valueFromConfig2,\n data: valueFromConfig2,\n baseURL: defaultToConfig2,\n transformRequest: defaultToConfig2,\n transformResponse: defaultToConfig2,\n paramsSerializer: defaultToConfig2,\n timeout: defaultToConfig2,\n timeoutMessage: defaultToConfig2,\n withCredentials: defaultToConfig2,\n withXSRFToken: defaultToConfig2,\n adapter: defaultToConfig2,\n responseType: defaultToConfig2,\n xsrfCookieName: defaultToConfig2,\n xsrfHeaderName: defaultToConfig2,\n onUploadProgress: defaultToConfig2,\n onDownloadProgress: defaultToConfig2,\n decompress: defaultToConfig2,\n maxContentLength: defaultToConfig2,\n maxBodyLength: defaultToConfig2,\n beforeRedirect: defaultToConfig2,\n transport: defaultToConfig2,\n httpAgent: defaultToConfig2,\n httpsAgent: defaultToConfig2,\n cancelToken: defaultToConfig2,\n socketPath: defaultToConfig2,\n responseEncoding: defaultToConfig2,\n validateStatus: mergeDirectKeys,\n headers: (a, b) => mergeDeepProperties(headersToObject(a), headersToObject(b), true)\n };\n\n utils.forEach(Object.keys(Object.assign({}, config1, config2)), function computeConfigValue(prop) {\n const merge = mergeMap[prop] || mergeDeepProperties;\n const configValue = merge(config1[prop], config2[prop], prop);\n (utils.isUndefined(configValue) && merge !== mergeDirectKeys) || (config[prop] = configValue);\n });\n\n return config;\n}\n","import platform from \"../platform/index.js\";\nimport utils from \"../utils.js\";\nimport isURLSameOrigin from \"./isURLSameOrigin.js\";\nimport cookies from \"./cookies.js\";\nimport buildFullPath from \"../core/buildFullPath.js\";\nimport mergeConfig from \"../core/mergeConfig.js\";\nimport AxiosHeaders from \"../core/AxiosHeaders.js\";\nimport buildURL from \"./buildURL.js\";\n\nexport default (config) => {\n const newConfig = mergeConfig({}, config);\n\n let {data, withXSRFToken, xsrfHeaderName, xsrfCookieName, headers, auth} = newConfig;\n\n newConfig.headers = headers = AxiosHeaders.from(headers);\n\n newConfig.url = buildURL(buildFullPath(newConfig.baseURL, newConfig.url), config.params, config.paramsSerializer);\n\n // HTTP basic authentication\n if (auth) {\n headers.set('Authorization', 'Basic ' +\n btoa((auth.username || '') + ':' + (auth.password ? unescape(encodeURIComponent(auth.password)) : ''))\n );\n }\n\n let contentType;\n\n if (utils.isFormData(data)) {\n if (platform.hasStandardBrowserEnv || platform.hasStandardBrowserWebWorkerEnv) {\n headers.setContentType(undefined); // Let the browser set it\n } else if ((contentType = headers.getContentType()) !== false) {\n // fix semicolon duplication issue for ReactNative FormData implementation\n const [type, ...tokens] = contentType ? contentType.split(';').map(token => token.trim()).filter(Boolean) : [];\n headers.setContentType([type || 'multipart/form-data', ...tokens].join('; '));\n }\n }\n\n // Add xsrf header\n // This is only done if running in a standard browser environment.\n // Specifically not if we're in a web worker, or react-native.\n\n if (platform.hasStandardBrowserEnv) {\n withXSRFToken && utils.isFunction(withXSRFToken) && (withXSRFToken = withXSRFToken(newConfig));\n\n if (withXSRFToken || (withXSRFToken !== false && isURLSameOrigin(newConfig.url))) {\n // Add xsrf header\n const xsrfValue = xsrfHeaderName && xsrfCookieName && cookies.read(xsrfCookieName);\n\n if (xsrfValue) {\n headers.set(xsrfHeaderName, xsrfValue);\n }\n }\n }\n\n return newConfig;\n}\n\n","import utils from './../utils.js';\nimport settle from './../core/settle.js';\nimport transitionalDefaults from '../defaults/transitional.js';\nimport AxiosError from '../core/AxiosError.js';\nimport CanceledError from '../cancel/CanceledError.js';\nimport parseProtocol from '../helpers/parseProtocol.js';\nimport platform from '../platform/index.js';\nimport AxiosHeaders from '../core/AxiosHeaders.js';\nimport {progressEventReducer} from '../helpers/progressEventReducer.js';\nimport resolveConfig from \"../helpers/resolveConfig.js\";\n\nconst isXHRAdapterSupported = typeof XMLHttpRequest !== 'undefined';\n\nexport default isXHRAdapterSupported && function (config) {\n return new Promise(function dispatchXhrRequest(resolve, reject) {\n const _config = resolveConfig(config);\n let requestData = _config.data;\n const requestHeaders = AxiosHeaders.from(_config.headers).normalize();\n let {responseType, onUploadProgress, onDownloadProgress} = _config;\n let onCanceled;\n let uploadThrottled, downloadThrottled;\n let flushUpload, flushDownload;\n\n function done() {\n flushUpload && flushUpload(); // flush events\n flushDownload && flushDownload(); // flush events\n\n _config.cancelToken && _config.cancelToken.unsubscribe(onCanceled);\n\n _config.signal && _config.signal.removeEventListener('abort', onCanceled);\n }\n\n let request = new XMLHttpRequest();\n\n request.open(_config.method.toUpperCase(), _config.url, true);\n\n // Set the request timeout in MS\n request.timeout = _config.timeout;\n\n function onloadend() {\n if (!request) {\n return;\n }\n // Prepare the response\n const responseHeaders = AxiosHeaders.from(\n 'getAllResponseHeaders' in request && request.getAllResponseHeaders()\n );\n const responseData = !responseType || responseType === 'text' || responseType === 'json' ?\n request.responseText : request.response;\n const response = {\n data: responseData,\n status: request.status,\n statusText: request.statusText,\n headers: responseHeaders,\n config,\n request\n };\n\n settle(function _resolve(value) {\n resolve(value);\n done();\n }, function _reject(err) {\n reject(err);\n done();\n }, response);\n\n // Clean up request\n request = null;\n }\n\n if ('onloadend' in request) {\n // Use onloadend if available\n request.onloadend = onloadend;\n } else {\n // Listen for ready state to emulate onloadend\n request.onreadystatechange = function handleLoad() {\n if (!request || request.readyState !== 4) {\n return;\n }\n\n // The request errored out and we didn't get a response, this will be\n // handled by onerror instead\n // With one exception: request that using file: protocol, most browsers\n // will return status as 0 even though it's a successful request\n if (request.status === 0 && !(request.responseURL && request.responseURL.indexOf('file:') === 0)) {\n return;\n }\n // readystate handler is calling before onerror or ontimeout handlers,\n // so we should call onloadend on the next 'tick'\n setTimeout(onloadend);\n };\n }\n\n // Handle browser request cancellation (as opposed to a manual cancellation)\n request.onabort = function handleAbort() {\n if (!request) {\n return;\n }\n\n reject(new AxiosError('Request aborted', AxiosError.ECONNABORTED, config, request));\n\n // Clean up request\n request = null;\n };\n\n // Handle low level network errors\n request.onerror = function handleError() {\n // Real errors are hidden from us by the browser\n // onerror should only fire if it's a network error\n reject(new AxiosError('Network Error', AxiosError.ERR_NETWORK, config, request));\n\n // Clean up request\n request = null;\n };\n\n // Handle timeout\n request.ontimeout = function handleTimeout() {\n let timeoutErrorMessage = _config.timeout ? 'timeout of ' + _config.timeout + 'ms exceeded' : 'timeout exceeded';\n const transitional = _config.transitional || transitionalDefaults;\n if (_config.timeoutErrorMessage) {\n timeoutErrorMessage = _config.timeoutErrorMessage;\n }\n reject(new AxiosError(\n timeoutErrorMessage,\n transitional.clarifyTimeoutError ? AxiosError.ETIMEDOUT : AxiosError.ECONNABORTED,\n config,\n request));\n\n // Clean up request\n request = null;\n };\n\n // Remove Content-Type if data is undefined\n requestData === undefined && requestHeaders.setContentType(null);\n\n // Add headers to the request\n if ('setRequestHeader' in request) {\n utils.forEach(requestHeaders.toJSON(), function setRequestHeader(val, key) {\n request.setRequestHeader(key, val);\n });\n }\n\n // Add withCredentials to request if needed\n if (!utils.isUndefined(_config.withCredentials)) {\n request.withCredentials = !!_config.withCredentials;\n }\n\n // Add responseType to request if needed\n if (responseType && responseType !== 'json') {\n request.responseType = _config.responseType;\n }\n\n // Handle progress if needed\n if (onDownloadProgress) {\n ([downloadThrottled, flushDownload] = progressEventReducer(onDownloadProgress, true));\n request.addEventListener('progress', downloadThrottled);\n }\n\n // Not all browsers support upload events\n if (onUploadProgress && request.upload) {\n ([uploadThrottled, flushUpload] = progressEventReducer(onUploadProgress));\n\n request.upload.addEventListener('progress', uploadThrottled);\n\n request.upload.addEventListener('loadend', flushUpload);\n }\n\n if (_config.cancelToken || _config.signal) {\n // Handle cancellation\n // eslint-disable-next-line func-names\n onCanceled = cancel => {\n if (!request) {\n return;\n }\n reject(!cancel || cancel.type ? new CanceledError(null, config, request) : cancel);\n request.abort();\n request = null;\n };\n\n _config.cancelToken && _config.cancelToken.subscribe(onCanceled);\n if (_config.signal) {\n _config.signal.aborted ? onCanceled() : _config.signal.addEventListener('abort', onCanceled);\n }\n }\n\n const protocol = parseProtocol(_config.url);\n\n if (protocol && platform.protocols.indexOf(protocol) === -1) {\n reject(new AxiosError('Unsupported protocol ' + protocol + ':', AxiosError.ERR_BAD_REQUEST, config));\n return;\n }\n\n\n // Send the request\n request.send(requestData || null);\n });\n}\n","import CanceledError from \"../cancel/CanceledError.js\";\nimport AxiosError from \"../core/AxiosError.js\";\nimport utils from '../utils.js';\n\nconst composeSignals = (signals, timeout) => {\n const {length} = (signals = signals ? signals.filter(Boolean) : []);\n\n if (timeout || length) {\n let controller = new AbortController();\n\n let aborted;\n\n const onabort = function (reason) {\n if (!aborted) {\n aborted = true;\n unsubscribe();\n const err = reason instanceof Error ? reason : this.reason;\n controller.abort(err instanceof AxiosError ? err : new CanceledError(err instanceof Error ? err.message : err));\n }\n }\n\n let timer = timeout && setTimeout(() => {\n timer = null;\n onabort(new AxiosError(`timeout ${timeout} of ms exceeded`, AxiosError.ETIMEDOUT))\n }, timeout)\n\n const unsubscribe = () => {\n if (signals) {\n timer && clearTimeout(timer);\n timer = null;\n signals.forEach(signal => {\n signal.unsubscribe ? signal.unsubscribe(onabort) : signal.removeEventListener('abort', onabort);\n });\n signals = null;\n }\n }\n\n signals.forEach((signal) => signal.addEventListener('abort', onabort));\n\n const {signal} = controller;\n\n signal.unsubscribe = () => utils.asap(unsubscribe);\n\n return signal;\n }\n}\n\nexport default composeSignals;\n","\nexport const streamChunk = function* (chunk, chunkSize) {\n let len = chunk.byteLength;\n\n if (!chunkSize || len < chunkSize) {\n yield chunk;\n return;\n }\n\n let pos = 0;\n let end;\n\n while (pos < len) {\n end = pos + chunkSize;\n yield chunk.slice(pos, end);\n pos = end;\n }\n}\n\nexport const readBytes = async function* (iterable, chunkSize) {\n for await (const chunk of readStream(iterable)) {\n yield* streamChunk(chunk, chunkSize);\n }\n}\n\nconst readStream = async function* (stream) {\n if (stream[Symbol.asyncIterator]) {\n yield* stream;\n return;\n }\n\n const reader = stream.getReader();\n try {\n for (;;) {\n const {done, value} = await reader.read();\n if (done) {\n break;\n }\n yield value;\n }\n } finally {\n await reader.cancel();\n }\n}\n\nexport const trackStream = (stream, chunkSize, onProgress, onFinish) => {\n const iterator = readBytes(stream, chunkSize);\n\n let bytes = 0;\n let done;\n let _onFinish = (e) => {\n if (!done) {\n done = true;\n onFinish && onFinish(e);\n }\n }\n\n return new ReadableStream({\n async pull(controller) {\n try {\n const {done, value} = await iterator.next();\n\n if (done) {\n _onFinish();\n controller.close();\n return;\n }\n\n let len = value.byteLength;\n if (onProgress) {\n let loadedBytes = bytes += len;\n onProgress(loadedBytes);\n }\n controller.enqueue(new Uint8Array(value));\n } catch (err) {\n _onFinish(err);\n throw err;\n }\n },\n cancel(reason) {\n _onFinish(reason);\n return iterator.return();\n }\n }, {\n highWaterMark: 2\n })\n}\n","import platform from \"../platform/index.js\";\nimport utils from \"../utils.js\";\nimport AxiosError from \"../core/AxiosError.js\";\nimport composeSignals from \"../helpers/composeSignals.js\";\nimport {trackStream} from \"../helpers/trackStream.js\";\nimport AxiosHeaders from \"../core/AxiosHeaders.js\";\nimport {progressEventReducer, progressEventDecorator, asyncDecorator} from \"../helpers/progressEventReducer.js\";\nimport resolveConfig from \"../helpers/resolveConfig.js\";\nimport settle from \"../core/settle.js\";\n\nconst isFetchSupported = typeof fetch === 'function' && typeof Request === 'function' && typeof Response === 'function';\nconst isReadableStreamSupported = isFetchSupported && typeof ReadableStream === 'function';\n\n// used only inside the fetch adapter\nconst encodeText = isFetchSupported && (typeof TextEncoder === 'function' ?\n ((encoder) => (str) => encoder.encode(str))(new TextEncoder()) :\n async (str) => new Uint8Array(await new Response(str).arrayBuffer())\n);\n\nconst test = (fn, ...args) => {\n try {\n return !!fn(...args);\n } catch (e) {\n return false\n }\n}\n\nconst supportsRequestStream = isReadableStreamSupported && test(() => {\n let duplexAccessed = false;\n\n const hasContentType = new Request(platform.origin, {\n body: new ReadableStream(),\n method: 'POST',\n get duplex() {\n duplexAccessed = true;\n return 'half';\n },\n }).headers.has('Content-Type');\n\n return duplexAccessed && !hasContentType;\n});\n\nconst DEFAULT_CHUNK_SIZE = 64 * 1024;\n\nconst supportsResponseStream = isReadableStreamSupported &&\n test(() => utils.isReadableStream(new Response('').body));\n\n\nconst resolvers = {\n stream: supportsResponseStream && ((res) => res.body)\n};\n\nisFetchSupported && (((res) => {\n ['text', 'arrayBuffer', 'blob', 'formData', 'stream'].forEach(type => {\n !resolvers[type] && (resolvers[type] = utils.isFunction(res[type]) ? (res) => res[type]() :\n (_, config) => {\n throw new AxiosError(`Response type '${type}' is not supported`, AxiosError.ERR_NOT_SUPPORT, config);\n })\n });\n})(new Response));\n\nconst getBodyLength = async (body) => {\n if (body == null) {\n return 0;\n }\n\n if(utils.isBlob(body)) {\n return body.size;\n }\n\n if(utils.isSpecCompliantForm(body)) {\n const _request = new Request(platform.origin, {\n method: 'POST',\n body,\n });\n return (await _request.arrayBuffer()).byteLength;\n }\n\n if(utils.isArrayBufferView(body) || utils.isArrayBuffer(body)) {\n return body.byteLength;\n }\n\n if(utils.isURLSearchParams(body)) {\n body = body + '';\n }\n\n if(utils.isString(body)) {\n return (await encodeText(body)).byteLength;\n }\n}\n\nconst resolveBodyLength = async (headers, body) => {\n const length = utils.toFiniteNumber(headers.getContentLength());\n\n return length == null ? getBodyLength(body) : length;\n}\n\nexport default isFetchSupported && (async (config) => {\n let {\n url,\n method,\n data,\n signal,\n cancelToken,\n timeout,\n onDownloadProgress,\n onUploadProgress,\n responseType,\n headers,\n withCredentials = 'same-origin',\n fetchOptions\n } = resolveConfig(config);\n\n responseType = responseType ? (responseType + '').toLowerCase() : 'text';\n\n let composedSignal = composeSignals([signal, cancelToken && cancelToken.toAbortSignal()], timeout);\n\n let request;\n\n const unsubscribe = composedSignal && composedSignal.unsubscribe && (() => {\n composedSignal.unsubscribe();\n });\n\n let requestContentLength;\n\n try {\n if (\n onUploadProgress && supportsRequestStream && method !== 'get' && method !== 'head' &&\n (requestContentLength = await resolveBodyLength(headers, data)) !== 0\n ) {\n let _request = new Request(url, {\n method: 'POST',\n body: data,\n duplex: \"half\"\n });\n\n let contentTypeHeader;\n\n if (utils.isFormData(data) && (contentTypeHeader = _request.headers.get('content-type'))) {\n headers.setContentType(contentTypeHeader)\n }\n\n if (_request.body) {\n const [onProgress, flush] = progressEventDecorator(\n requestContentLength,\n progressEventReducer(asyncDecorator(onUploadProgress))\n );\n\n data = trackStream(_request.body, DEFAULT_CHUNK_SIZE, onProgress, flush);\n }\n }\n\n if (!utils.isString(withCredentials)) {\n withCredentials = withCredentials ? 'include' : 'omit';\n }\n\n // Cloudflare Workers throws when credentials are defined\n // see https://github.com/cloudflare/workerd/issues/902\n const isCredentialsSupported = \"credentials\" in Request.prototype;\n request = new Request(url, {\n ...fetchOptions,\n signal: composedSignal,\n method: method.toUpperCase(),\n headers: headers.normalize().toJSON(),\n body: data,\n duplex: \"half\",\n credentials: isCredentialsSupported ? withCredentials : undefined\n });\n\n let response = await fetch(request);\n\n const isStreamResponse = supportsResponseStream && (responseType === 'stream' || responseType === 'response');\n\n if (supportsResponseStream && (onDownloadProgress || (isStreamResponse && unsubscribe))) {\n const options = {};\n\n ['status', 'statusText', 'headers'].forEach(prop => {\n options[prop] = response[prop];\n });\n\n const responseContentLength = utils.toFiniteNumber(response.headers.get('content-length'));\n\n const [onProgress, flush] = onDownloadProgress && progressEventDecorator(\n responseContentLength,\n progressEventReducer(asyncDecorator(onDownloadProgress), true)\n ) || [];\n\n response = new Response(\n trackStream(response.body, DEFAULT_CHUNK_SIZE, onProgress, () => {\n flush && flush();\n unsubscribe && unsubscribe();\n }),\n options\n );\n }\n\n responseType = responseType || 'text';\n\n let responseData = await resolvers[utils.findKey(resolvers, responseType) || 'text'](response, config);\n\n !isStreamResponse && unsubscribe && unsubscribe();\n\n return await new Promise((resolve, reject) => {\n settle(resolve, reject, {\n data: responseData,\n headers: AxiosHeaders.from(response.headers),\n status: response.status,\n statusText: response.statusText,\n config,\n request\n })\n })\n } catch (err) {\n unsubscribe && unsubscribe();\n\n if (err && err.name === 'TypeError' && /fetch/i.test(err.message)) {\n throw Object.assign(\n new AxiosError('Network Error', AxiosError.ERR_NETWORK, config, request),\n {\n cause: err.cause || err\n }\n )\n }\n\n throw AxiosError.from(err, err && err.code, config, request);\n }\n});\n\n\n","import utils from '../utils.js';\nimport httpAdapter from './http.js';\nimport xhrAdapter from './xhr.js';\nimport fetchAdapter from './fetch.js';\nimport AxiosError from \"../core/AxiosError.js\";\n\nconst knownAdapters = {\n http: httpAdapter,\n xhr: xhrAdapter,\n fetch: fetchAdapter\n}\n\nutils.forEach(knownAdapters, (fn, value) => {\n if (fn) {\n try {\n Object.defineProperty(fn, 'name', {value});\n } catch (e) {\n // eslint-disable-next-line no-empty\n }\n Object.defineProperty(fn, 'adapterName', {value});\n }\n});\n\nconst renderReason = (reason) => `- ${reason}`;\n\nconst isResolvedHandle = (adapter) => utils.isFunction(adapter) || adapter === null || adapter === false;\n\nexport default {\n getAdapter: (adapters) => {\n adapters = utils.isArray(adapters) ? adapters : [adapters];\n\n const {length} = adapters;\n let nameOrAdapter;\n let adapter;\n\n const rejectedReasons = {};\n\n for (let i = 0; i < length; i++) {\n nameOrAdapter = adapters[i];\n let id;\n\n adapter = nameOrAdapter;\n\n if (!isResolvedHandle(nameOrAdapter)) {\n adapter = knownAdapters[(id = String(nameOrAdapter)).toLowerCase()];\n\n if (adapter === undefined) {\n throw new AxiosError(`Unknown adapter '${id}'`);\n }\n }\n\n if (adapter) {\n break;\n }\n\n rejectedReasons[id || '#' + i] = adapter;\n }\n\n if (!adapter) {\n\n const reasons = Object.entries(rejectedReasons)\n .map(([id, state]) => `adapter ${id} ` +\n (state === false ? 'is not supported by the environment' : 'is not available in the build')\n );\n\n let s = length ?\n (reasons.length > 1 ? 'since :\\n' + reasons.map(renderReason).join('\\n') : ' ' + renderReason(reasons[0])) :\n 'as no adapter specified';\n\n throw new AxiosError(\n `There is no suitable adapter to dispatch the request ` + s,\n 'ERR_NOT_SUPPORT'\n );\n }\n\n return adapter;\n },\n adapters: knownAdapters\n}\n","'use strict';\n\nimport transformData from './transformData.js';\nimport isCancel from '../cancel/isCancel.js';\nimport defaults from '../defaults/index.js';\nimport CanceledError from '../cancel/CanceledError.js';\nimport AxiosHeaders from '../core/AxiosHeaders.js';\nimport adapters from \"../adapters/adapters.js\";\n\n/**\n * Throws a `CanceledError` if cancellation has been requested.\n *\n * @param {Object} config The config that is to be used for the request\n *\n * @returns {void}\n */\nfunction throwIfCancellationRequested(config) {\n if (config.cancelToken) {\n config.cancelToken.throwIfRequested();\n }\n\n if (config.signal && config.signal.aborted) {\n throw new CanceledError(null, config);\n }\n}\n\n/**\n * Dispatch a request to the server using the configured adapter.\n *\n * @param {object} config The config that is to be used for the request\n *\n * @returns {Promise} The Promise to be fulfilled\n */\nexport default function dispatchRequest(config) {\n throwIfCancellationRequested(config);\n\n config.headers = AxiosHeaders.from(config.headers);\n\n // Transform request data\n config.data = transformData.call(\n config,\n config.transformRequest\n );\n\n if (['post', 'put', 'patch'].indexOf(config.method) !== -1) {\n config.headers.setContentType('application/x-www-form-urlencoded', false);\n }\n\n const adapter = adapters.getAdapter(config.adapter || defaults.adapter);\n\n return adapter(config).then(function onAdapterResolution(response) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n response.data = transformData.call(\n config,\n config.transformResponse,\n response\n );\n\n response.headers = AxiosHeaders.from(response.headers);\n\n return response;\n }, function onAdapterRejection(reason) {\n if (!isCancel(reason)) {\n throwIfCancellationRequested(config);\n\n // Transform response data\n if (reason && reason.response) {\n reason.response.data = transformData.call(\n config,\n config.transformResponse,\n reason.response\n );\n reason.response.headers = AxiosHeaders.from(reason.response.headers);\n }\n }\n\n return Promise.reject(reason);\n });\n}\n","export const VERSION = \"1.7.7\";","'use strict';\n\nimport {VERSION} from '../env/data.js';\nimport AxiosError from '../core/AxiosError.js';\n\nconst validators = {};\n\n// eslint-disable-next-line func-names\n['object', 'boolean', 'number', 'function', 'string', 'symbol'].forEach((type, i) => {\n validators[type] = function validator(thing) {\n return typeof thing === type || 'a' + (i < 1 ? 'n ' : ' ') + type;\n };\n});\n\nconst deprecatedWarnings = {};\n\n/**\n * Transitional option validator\n *\n * @param {function|boolean?} validator - set to false if the transitional option has been removed\n * @param {string?} version - deprecated version / removed since version\n * @param {string?} message - some message with additional info\n *\n * @returns {function}\n */\nvalidators.transitional = function transitional(validator, version, message) {\n function formatMessage(opt, desc) {\n return '[Axios v' + VERSION + '] Transitional option \\'' + opt + '\\'' + desc + (message ? '. ' + message : '');\n }\n\n // eslint-disable-next-line func-names\n return (value, opt, opts) => {\n if (validator === false) {\n throw new AxiosError(\n formatMessage(opt, ' has been removed' + (version ? ' in ' + version : '')),\n AxiosError.ERR_DEPRECATED\n );\n }\n\n if (version && !deprecatedWarnings[opt]) {\n deprecatedWarnings[opt] = true;\n // eslint-disable-next-line no-console\n console.warn(\n formatMessage(\n opt,\n ' has been deprecated since v' + version + ' and will be removed in the near future'\n )\n );\n }\n\n return validator ? validator(value, opt, opts) : true;\n };\n};\n\n/**\n * Assert object's properties type\n *\n * @param {object} options\n * @param {object} schema\n * @param {boolean?} allowUnknown\n *\n * @returns {object}\n */\n\nfunction assertOptions(options, schema, allowUnknown) {\n if (typeof options !== 'object') {\n throw new AxiosError('options must be an object', AxiosError.ERR_BAD_OPTION_VALUE);\n }\n const keys = Object.keys(options);\n let i = keys.length;\n while (i-- > 0) {\n const opt = keys[i];\n const validator = schema[opt];\n if (validator) {\n const value = options[opt];\n const result = value === undefined || validator(value, opt, options);\n if (result !== true) {\n throw new AxiosError('option ' + opt + ' must be ' + result, AxiosError.ERR_BAD_OPTION_VALUE);\n }\n continue;\n }\n if (allowUnknown !== true) {\n throw new AxiosError('Unknown option ' + opt, AxiosError.ERR_BAD_OPTION);\n }\n }\n}\n\nexport default {\n assertOptions,\n validators\n};\n","'use strict';\n\nimport utils from './../utils.js';\nimport buildURL from '../helpers/buildURL.js';\nimport InterceptorManager from './InterceptorManager.js';\nimport dispatchRequest from './dispatchRequest.js';\nimport mergeConfig from './mergeConfig.js';\nimport buildFullPath from './buildFullPath.js';\nimport validator from '../helpers/validator.js';\nimport AxiosHeaders from './AxiosHeaders.js';\n\nconst validators = validator.validators;\n\n/**\n * Create a new instance of Axios\n *\n * @param {Object} instanceConfig The default config for the instance\n *\n * @return {Axios} A new instance of Axios\n */\nclass Axios {\n constructor(instanceConfig) {\n this.defaults = instanceConfig;\n this.interceptors = {\n request: new InterceptorManager(),\n response: new InterceptorManager()\n };\n }\n\n /**\n * Dispatch a request\n *\n * @param {String|Object} configOrUrl The config specific for this request (merged with this.defaults)\n * @param {?Object} config\n *\n * @returns {Promise} The Promise to be fulfilled\n */\n async request(configOrUrl, config) {\n try {\n return await this._request(configOrUrl, config);\n } catch (err) {\n if (err instanceof Error) {\n let dummy;\n\n Error.captureStackTrace ? Error.captureStackTrace(dummy = {}) : (dummy = new Error());\n\n // slice off the Error: ... line\n const stack = dummy.stack ? dummy.stack.replace(/^.+\\n/, '') : '';\n try {\n if (!err.stack) {\n err.stack = stack;\n // match without the 2 top stack lines\n } else if (stack && !String(err.stack).endsWith(stack.replace(/^.+\\n.+\\n/, ''))) {\n err.stack += '\\n' + stack\n }\n } catch (e) {\n // ignore the case where \"stack\" is an un-writable property\n }\n }\n\n throw err;\n }\n }\n\n _request(configOrUrl, config) {\n /*eslint no-param-reassign:0*/\n // Allow for axios('example/url'[, config]) a la fetch API\n if (typeof configOrUrl === 'string') {\n config = config || {};\n config.url = configOrUrl;\n } else {\n config = configOrUrl || {};\n }\n\n config = mergeConfig(this.defaults, config);\n\n const {transitional, paramsSerializer, headers} = config;\n\n if (transitional !== undefined) {\n validator.assertOptions(transitional, {\n silentJSONParsing: validators.transitional(validators.boolean),\n forcedJSONParsing: validators.transitional(validators.boolean),\n clarifyTimeoutError: validators.transitional(validators.boolean)\n }, false);\n }\n\n if (paramsSerializer != null) {\n if (utils.isFunction(paramsSerializer)) {\n config.paramsSerializer = {\n serialize: paramsSerializer\n }\n } else {\n validator.assertOptions(paramsSerializer, {\n encode: validators.function,\n serialize: validators.function\n }, true);\n }\n }\n\n // Set config.method\n config.method = (config.method || this.defaults.method || 'get').toLowerCase();\n\n // Flatten headers\n let contextHeaders = headers && utils.merge(\n headers.common,\n headers[config.method]\n );\n\n headers && utils.forEach(\n ['delete', 'get', 'head', 'post', 'put', 'patch', 'common'],\n (method) => {\n delete headers[method];\n }\n );\n\n config.headers = AxiosHeaders.concat(contextHeaders, headers);\n\n // filter out skipped interceptors\n const requestInterceptorChain = [];\n let synchronousRequestInterceptors = true;\n this.interceptors.request.forEach(function unshiftRequestInterceptors(interceptor) {\n if (typeof interceptor.runWhen === 'function' && interceptor.runWhen(config) === false) {\n return;\n }\n\n synchronousRequestInterceptors = synchronousRequestInterceptors && interceptor.synchronous;\n\n requestInterceptorChain.unshift(interceptor.fulfilled, interceptor.rejected);\n });\n\n const responseInterceptorChain = [];\n this.interceptors.response.forEach(function pushResponseInterceptors(interceptor) {\n responseInterceptorChain.push(interceptor.fulfilled, interceptor.rejected);\n });\n\n let promise;\n let i = 0;\n let len;\n\n if (!synchronousRequestInterceptors) {\n const chain = [dispatchRequest.bind(this), undefined];\n chain.unshift.apply(chain, requestInterceptorChain);\n chain.push.apply(chain, responseInterceptorChain);\n len = chain.length;\n\n promise = Promise.resolve(config);\n\n while (i < len) {\n promise = promise.then(chain[i++], chain[i++]);\n }\n\n return promise;\n }\n\n len = requestInterceptorChain.length;\n\n let newConfig = config;\n\n i = 0;\n\n while (i < len) {\n const onFulfilled = requestInterceptorChain[i++];\n const onRejected = requestInterceptorChain[i++];\n try {\n newConfig = onFulfilled(newConfig);\n } catch (error) {\n onRejected.call(this, error);\n break;\n }\n }\n\n try {\n promise = dispatchRequest.call(this, newConfig);\n } catch (error) {\n return Promise.reject(error);\n }\n\n i = 0;\n len = responseInterceptorChain.length;\n\n while (i < len) {\n promise = promise.then(responseInterceptorChain[i++], responseInterceptorChain[i++]);\n }\n\n return promise;\n }\n\n getUri(config) {\n config = mergeConfig(this.defaults, config);\n const fullPath = buildFullPath(config.baseURL, config.url);\n return buildURL(fullPath, config.params, config.paramsSerializer);\n }\n}\n\n// Provide aliases for supported request methods\nutils.forEach(['delete', 'get', 'head', 'options'], function forEachMethodNoData(method) {\n /*eslint func-names:0*/\n Axios.prototype[method] = function(url, config) {\n return this.request(mergeConfig(config || {}, {\n method,\n url,\n data: (config || {}).data\n }));\n };\n});\n\nutils.forEach(['post', 'put', 'patch'], function forEachMethodWithData(method) {\n /*eslint func-names:0*/\n\n function generateHTTPMethod(isForm) {\n return function httpMethod(url, data, config) {\n return this.request(mergeConfig(config || {}, {\n method,\n headers: isForm ? {\n 'Content-Type': 'multipart/form-data'\n } : {},\n url,\n data\n }));\n };\n }\n\n Axios.prototype[method] = generateHTTPMethod();\n\n Axios.prototype[method + 'Form'] = generateHTTPMethod(true);\n});\n\nexport default Axios;\n","'use strict';\n\nimport CanceledError from './CanceledError.js';\n\n/**\n * A `CancelToken` is an object that can be used to request cancellation of an operation.\n *\n * @param {Function} executor The executor function.\n *\n * @returns {CancelToken}\n */\nclass CancelToken {\n constructor(executor) {\n if (typeof executor !== 'function') {\n throw new TypeError('executor must be a function.');\n }\n\n let resolvePromise;\n\n this.promise = new Promise(function promiseExecutor(resolve) {\n resolvePromise = resolve;\n });\n\n const token = this;\n\n // eslint-disable-next-line func-names\n this.promise.then(cancel => {\n if (!token._listeners) return;\n\n let i = token._listeners.length;\n\n while (i-- > 0) {\n token._listeners[i](cancel);\n }\n token._listeners = null;\n });\n\n // eslint-disable-next-line func-names\n this.promise.then = onfulfilled => {\n let _resolve;\n // eslint-disable-next-line func-names\n const promise = new Promise(resolve => {\n token.subscribe(resolve);\n _resolve = resolve;\n }).then(onfulfilled);\n\n promise.cancel = function reject() {\n token.unsubscribe(_resolve);\n };\n\n return promise;\n };\n\n executor(function cancel(message, config, request) {\n if (token.reason) {\n // Cancellation has already been requested\n return;\n }\n\n token.reason = new CanceledError(message, config, request);\n resolvePromise(token.reason);\n });\n }\n\n /**\n * Throws a `CanceledError` if cancellation has been requested.\n */\n throwIfRequested() {\n if (this.reason) {\n throw this.reason;\n }\n }\n\n /**\n * Subscribe to the cancel signal\n */\n\n subscribe(listener) {\n if (this.reason) {\n listener(this.reason);\n return;\n }\n\n if (this._listeners) {\n this._listeners.push(listener);\n } else {\n this._listeners = [listener];\n }\n }\n\n /**\n * Unsubscribe from the cancel signal\n */\n\n unsubscribe(listener) {\n if (!this._listeners) {\n return;\n }\n const index = this._listeners.indexOf(listener);\n if (index !== -1) {\n this._listeners.splice(index, 1);\n }\n }\n\n toAbortSignal() {\n const controller = new AbortController();\n\n const abort = (err) => {\n controller.abort(err);\n };\n\n this.subscribe(abort);\n\n controller.signal.unsubscribe = () => this.unsubscribe(abort);\n\n return controller.signal;\n }\n\n /**\n * Returns an object that contains a new `CancelToken` and a function that, when called,\n * cancels the `CancelToken`.\n */\n static source() {\n let cancel;\n const token = new CancelToken(function executor(c) {\n cancel = c;\n });\n return {\n token,\n cancel\n };\n }\n}\n\nexport default CancelToken;\n","'use strict';\n\n/**\n * Syntactic sugar for invoking a function and expanding an array for arguments.\n *\n * Common use case would be to use `Function.prototype.apply`.\n *\n * ```js\n * function f(x, y, z) {}\n * var args = [1, 2, 3];\n * f.apply(null, args);\n * ```\n *\n * With `spread` this example can be re-written.\n *\n * ```js\n * spread(function(x, y, z) {})([1, 2, 3]);\n * ```\n *\n * @param {Function} callback\n *\n * @returns {Function}\n */\nexport default function spread(callback) {\n return function wrap(arr) {\n return callback.apply(null, arr);\n };\n}\n","'use strict';\n\nimport utils from './../utils.js';\n\n/**\n * Determines whether the payload is an error thrown by Axios\n *\n * @param {*} payload The value to test\n *\n * @returns {boolean} True if the payload is an error thrown by Axios, otherwise false\n */\nexport default function isAxiosError(payload) {\n return utils.isObject(payload) && (payload.isAxiosError === true);\n}\n","const HttpStatusCode = {\n Continue: 100,\n SwitchingProtocols: 101,\n Processing: 102,\n EarlyHints: 103,\n Ok: 200,\n Created: 201,\n Accepted: 202,\n NonAuthoritativeInformation: 203,\n NoContent: 204,\n ResetContent: 205,\n PartialContent: 206,\n MultiStatus: 207,\n AlreadyReported: 208,\n ImUsed: 226,\n MultipleChoices: 300,\n MovedPermanently: 301,\n Found: 302,\n SeeOther: 303,\n NotModified: 304,\n UseProxy: 305,\n Unused: 306,\n TemporaryRedirect: 307,\n PermanentRedirect: 308,\n BadRequest: 400,\n Unauthorized: 401,\n PaymentRequired: 402,\n Forbidden: 403,\n NotFound: 404,\n MethodNotAllowed: 405,\n NotAcceptable: 406,\n ProxyAuthenticationRequired: 407,\n RequestTimeout: 408,\n Conflict: 409,\n Gone: 410,\n LengthRequired: 411,\n PreconditionFailed: 412,\n PayloadTooLarge: 413,\n UriTooLong: 414,\n UnsupportedMediaType: 415,\n RangeNotSatisfiable: 416,\n ExpectationFailed: 417,\n ImATeapot: 418,\n MisdirectedRequest: 421,\n UnprocessableEntity: 422,\n Locked: 423,\n FailedDependency: 424,\n TooEarly: 425,\n UpgradeRequired: 426,\n PreconditionRequired: 428,\n TooManyRequests: 429,\n RequestHeaderFieldsTooLarge: 431,\n UnavailableForLegalReasons: 451,\n InternalServerError: 500,\n NotImplemented: 501,\n BadGateway: 502,\n ServiceUnavailable: 503,\n GatewayTimeout: 504,\n HttpVersionNotSupported: 505,\n VariantAlsoNegotiates: 506,\n InsufficientStorage: 507,\n LoopDetected: 508,\n NotExtended: 510,\n NetworkAuthenticationRequired: 511,\n};\n\nObject.entries(HttpStatusCode).forEach(([key, value]) => {\n HttpStatusCode[value] = key;\n});\n\nexport default HttpStatusCode;\n","'use strict';\n\nimport utils from './utils.js';\nimport bind from './helpers/bind.js';\nimport Axios from './core/Axios.js';\nimport mergeConfig from './core/mergeConfig.js';\nimport defaults from './defaults/index.js';\nimport formDataToJSON from './helpers/formDataToJSON.js';\nimport CanceledError from './cancel/CanceledError.js';\nimport CancelToken from './cancel/CancelToken.js';\nimport isCancel from './cancel/isCancel.js';\nimport {VERSION} from './env/data.js';\nimport toFormData from './helpers/toFormData.js';\nimport AxiosError from './core/AxiosError.js';\nimport spread from './helpers/spread.js';\nimport isAxiosError from './helpers/isAxiosError.js';\nimport AxiosHeaders from \"./core/AxiosHeaders.js\";\nimport adapters from './adapters/adapters.js';\nimport HttpStatusCode from './helpers/HttpStatusCode.js';\n\n/**\n * Create an instance of Axios\n *\n * @param {Object} defaultConfig The default config for the instance\n *\n * @returns {Axios} A new instance of Axios\n */\nfunction createInstance(defaultConfig) {\n const context = new Axios(defaultConfig);\n const instance = bind(Axios.prototype.request, context);\n\n // Copy axios.prototype to instance\n utils.extend(instance, Axios.prototype, context, {allOwnKeys: true});\n\n // Copy context to instance\n utils.extend(instance, context, null, {allOwnKeys: true});\n\n // Factory for creating new instances\n instance.create = function create(instanceConfig) {\n return createInstance(mergeConfig(defaultConfig, instanceConfig));\n };\n\n return instance;\n}\n\n// Create the default instance to be exported\nconst axios = createInstance(defaults);\n\n// Expose Axios class to allow class inheritance\naxios.Axios = Axios;\n\n// Expose Cancel & CancelToken\naxios.CanceledError = CanceledError;\naxios.CancelToken = CancelToken;\naxios.isCancel = isCancel;\naxios.VERSION = VERSION;\naxios.toFormData = toFormData;\n\n// Expose AxiosError class\naxios.AxiosError = AxiosError;\n\n// alias for CanceledError for backward compatibility\naxios.Cancel = axios.CanceledError;\n\n// Expose all/spread\naxios.all = function all(promises) {\n return Promise.all(promises);\n};\n\naxios.spread = spread;\n\n// Expose isAxiosError\naxios.isAxiosError = isAxiosError;\n\n// Expose mergeConfig\naxios.mergeConfig = mergeConfig;\n\naxios.AxiosHeaders = AxiosHeaders;\n\naxios.formToJSON = thing => formDataToJSON(utils.isHTMLForm(thing) ? new FormData(thing) : thing);\n\naxios.getAdapter = adapters.getAdapter;\n\naxios.HttpStatusCode = HttpStatusCode;\n\naxios.default = axios;\n\n// this module should only have a default export\nexport default axios\n","import axios from \"axios\"\r\nimport { store } from \"@/store/store\"\r\n\r\nexport default class ApiService {\r\n baseHref: string\r\n\r\n constructor(baseHref: string) {\r\n this.baseHref = baseHref\r\n }\r\n\r\n get currentLanguage() {\r\n return store.getters.activeLang\r\n }\r\n\r\n // Generate errorstring from Error\r\n generateErrorMsg(e: any): string {\r\n let errormsg: string = \"\"\r\n // Virheilmoitus vue notificationiin.\r\n if (e.response.data !== null) {\r\n errormsg = e.response.data\r\n // TODO OKo: Notify\r\n /* store.dispatch(\"setLoading\", false)*/\r\n }\r\n return errormsg\r\n }\r\n\r\n // api methods\r\n async getConfigValues(): Promise {\r\n try {\r\n const response = await axios.get(this.baseHref + \"api/Utils/GetConfigValues\")\r\n return response.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n\r\n async getPageWhitelist(): Promise {\r\n try {\r\n const response = await axios.get(this.baseHref + \"api/Utils/GetPageWhitelist\")\r\n return response.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n\r\n async getLegendLimits(): Promise {\r\n try {\r\n const response = await axios.get(this.baseHref + \"api/Utils/GetLegendLimits\")\r\n return response.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n\r\n async changeLanguage(langId: string): Promise {\r\n try {\r\n const response = await axios.post(this.baseHref + \"api/Utils/ChangeLanguage?langId=\" + langId)\r\n return response.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n\r\n // Osoitehaku\r\n async getGeocodingAddress(address: string, lang: string): Promise {\r\n try {\r\n const res = await axios.get(store.getters.mapServicesUrl + \"SearchMultipleSources?text=\" + address + \"&lang=\" + lang + \"&size=500\")\r\n return res.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n\r\n // Hae paikannetun sijainnin arvioitu katuosoite (käänteinen geokoodaus)\r\n async getReverseGeocodingLocation(lat: number, lng: number, lang: string): Promise {\r\n try {\r\n const res = await axios.get(store.getters.mapServicesUrl + \"ReverseGeocoding?point.lat=\" + lat + \"&point.lon=\" + lng + \"&lang=\" + lang + \"&sources=interpolated-road-addresses&size=1\")\r\n return res.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n\r\n async getLanguageTerms() {\r\n try {\r\n const response = await axios.get(this.baseHref + \"api/Utils/GetLanguageTerms\")\r\n return response.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n\r\n async dynamicApiCall(url: string, parameters?: URLSearchParams) {\r\n try {\r\n const response = await axios.get(store.getters.dataPublishServicesUrl + url, { params: parameters })\r\n return response.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n\r\n async getPopupDetailsPosti(markerId) {\r\n try {\r\n const response = await axios.get(store.getters.dataPublishServicesUrl + \"v1/Viestinta/Posti/Postipalvelut/\" + markerId)\r\n return response.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n\r\n async getPopupDetailsPostiTyyppi(types: number[], ids: string[] | null) {\r\n try {\r\n const response = await axios.post(store.getters.dataPublishServicesUrl + \"v1/Viestinta/Posti/Postipalvelut/tyypit\", { tyyppi: types, ids })\r\n return response.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n\r\n async getLiikenteenTilastotKuntaData(type: string, kuntanumero: string) {\r\n try {\r\n const response = await axios.get(store.getters.dataPublishServicesUrl + \"v1/TieLiikenne/TieliikenteenTilastot/LiikenteenTilastotYksittainenKunta?type=\" + type + \"&kuntanumero=\" + kuntanumero)\r\n return response.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n\r\n async getLiikenteenTilastotMaakuntaData(type: string, maakuntanumero: string) {\r\n try {\r\n const response = await axios.get(store.getters.dataPublishServicesUrl + \"v1/TieLiikenne/TieliikenteenTilastot/LiikenteenTilastotYksittainenMaakunta?type=\" + type + \"&maakuntanumero=\" + maakuntanumero)\r\n return response.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n\r\n async getBittimittariVuorokausiKuntaData(kuntanumero: string) {\r\n try {\r\n const response = await axios.get(store.getters.dataPublishServicesUrl + \"v1/Bittimittari/VuorokaudenAikaKlusteritYksittainenKunta?kuntanumero=\" + kuntanumero)\r\n\r\n return response.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n\r\n async getBittimittariVuorokausiMaakuntaData(maakuntanumero: string) {\r\n try {\r\n const response = await axios.get(store.getters.dataPublishServicesUrl + \"v1/Bittimittari/VuorokaudenAikaKlusteritYksittainenMaakunta?maakuntanumero=\" + maakuntanumero)\r\n return response.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n\r\n async getBittimittariOperaattoriKuntaData(kuntanumero: string, operaattoriId: number) {\r\n try {\r\n const response = await axios.get(store.getters.dataPublishServicesUrl + \"v1/Bittimittari/VerkkoOperaattoriKlusteritYksittainenKunta?kuntanumero=\" + kuntanumero + \"&operaattoriId=\" + operaattoriId)\r\n return response.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n\r\n async getBittimittariOperaattoriMaakuntaData(maakuntanumero: string, operaattoriId: number) {\r\n try {\r\n const response = await axios.get(store.getters.dataPublishServicesUrl + \"v1/Bittimittari/VerkkoOperaattoriKlusteritYksittainenMaakunta?maakuntanumero=\" + maakuntanumero + \"&operaattoriId=\" + operaattoriId)\r\n return response.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n\r\n async getBittimittariOperators(): Promise {\r\n try {\r\n const response = await axios.get(store.getters.dataPublishServicesUrl + \"v1/Bittimittari/VerkkoOperaattorit\")\r\n return response.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n\r\n async getMunicipalityByWGS84(lat: number, lng: number) {\r\n try {\r\n const response = await axios.get(store.getters.dataPublishServicesUrl + \"v1/AreaInfoService/KuntaWGS84?lat=\" + lat + \"&lng=\" + lng)\r\n return response.data\r\n }\r\n catch (err) {\r\n throw new Error(this.generateErrorMsg(err))\r\n }\r\n }\r\n}\r\n","\r\n\r\n\r\n\r\n\r\n","\r\n\r\n\r\n\r\n\r\n","\r\n\r\n\r\n\r\n\r\n","\r\n\r\n\r\n\r\n\r\n","import LatLngPoint from \"./latlngpoint\"\r\n\r\nexport default class SearchResultModel {\r\n constructor(\r\n region: string,\r\n subregion: string,\r\n municipality: string,\r\n placeType: string,\r\n label: string,\r\n coordinates: LatLngPoint) {\r\n this.region = region\r\n this.subregion = subregion\r\n this.municipality = municipality\r\n this.placeType = placeType\r\n this.label = label\r\n this.coordinates = coordinates\r\n }\r\n\r\n region: string\r\n subregion: string\r\n municipality: string\r\n placeType: string\r\n label: string\r\n coordinates: LatLngPoint\r\n\r\n toJsonObject(): any {\r\n return {\r\n region: this.region,\r\n subregion: this.subregion,\r\n municipality: this.municipality,\r\n placeType: this.placeType,\r\n label: this.label,\r\n coordinates: this.coordinates\r\n }\r\n }\r\n\r\n getFullName(): string {\r\n let fullName: string = this.label\r\n if (this.municipality?.length > 0) {\r\n fullName += \", \" + this.municipality\r\n }\r\n if (this.placeType?.length > 0) {\r\n fullName += \", \" + this.placeType\r\n }\r\n return fullName\r\n }\r\n\r\n getShortName(): string {\r\n return this.getStreetAddress() + \", \" + this.municipality\r\n }\r\n\r\n getStreetAddress(): string {\r\n return this.label.split(\" (\")[0]\r\n }\r\n}\r\n","export default function(defs) {\n defs('EPSG:4326', \"+title=WGS 84 (long/lat) +proj=longlat +ellps=WGS84 +datum=WGS84 +units=degrees\");\n defs('EPSG:4269', \"+title=NAD83 (long/lat) +proj=longlat +a=6378137.0 +b=6356752.31414036 +ellps=GRS80 +datum=NAD83 +units=degrees\");\n defs('EPSG:3857', \"+title=WGS 84 / Pseudo-Mercator +proj=merc +a=6378137 +b=6378137 +lat_ts=0.0 +lon_0=0.0 +x_0=0.0 +y_0=0 +k=1.0 +units=m +nadgrids=@null +no_defs\");\n\n defs.WGS84 = defs['EPSG:4326'];\n defs['EPSG:3785'] = defs['EPSG:3857']; // maintain backward compat, official code is 3857\n defs.GOOGLE = defs['EPSG:3857'];\n defs['EPSG:900913'] = defs['EPSG:3857'];\n defs['EPSG:102113'] = defs['EPSG:3857'];\n}\n","export var PJD_3PARAM = 1;\nexport var PJD_7PARAM = 2;\nexport var PJD_GRIDSHIFT = 3;\nexport var PJD_WGS84 = 4; // WGS84 or equivalent\nexport var PJD_NODATUM = 5; // WGS84 or equivalent\nexport var SRS_WGS84_SEMIMAJOR = 6378137.0; // only used in grid shift transforms\nexport var SRS_WGS84_SEMIMINOR = 6356752.314; // only used in grid shift transforms\nexport var SRS_WGS84_ESQUARED = 0.0066943799901413165; // only used in grid shift transforms\nexport var SEC_TO_RAD = 4.84813681109535993589914102357e-6;\nexport var HALF_PI = Math.PI/2;\n// ellipoid pj_set_ell.c\nexport var SIXTH = 0.1666666666666666667;\n/* 1/6 */\nexport var RA4 = 0.04722222222222222222;\n/* 17/360 */\nexport var RA6 = 0.02215608465608465608;\nexport var EPSLN = 1.0e-10;\n// you'd think you could use Number.EPSILON above but that makes\n// Mollweide get into an infinate loop.\n\nexport var D2R = 0.01745329251994329577;\nexport var R2D = 57.29577951308232088;\nexport var FORTPI = Math.PI/4;\nexport var TWO_PI = Math.PI * 2;\n// SPI is slightly greater than Math.PI, so values that exceed the -180..180\n// degree range by a tiny amount don't get wrapped. This prevents points that\n// have drifted from their original location along the 180th meridian (due to\n// floating point error) from changing their sign.\nexport var SPI = 3.14159265359;\n","var exports = {};\nexport {exports as default};\n\nexports.greenwich = 0.0; //\"0dE\",\nexports.lisbon = -9.131906111111; //\"9d07'54.862\\\"W\",\nexports.paris = 2.337229166667; //\"2d20'14.025\\\"E\",\nexports.bogota = -74.080916666667; //\"74d04'51.3\\\"W\",\nexports.madrid = -3.687938888889; //\"3d41'16.58\\\"W\",\nexports.rome = 12.452333333333; //\"12d27'8.4\\\"E\",\nexports.bern = 7.439583333333; //\"7d26'22.5\\\"E\",\nexports.jakarta = 106.807719444444; //\"106d48'27.79\\\"E\",\nexports.ferro = -17.666666666667; //\"17d40'W\",\nexports.brussels = 4.367975; //\"4d22'4.71\\\"E\",\nexports.stockholm = 18.058277777778; //\"18d3'29.8\\\"E\",\nexports.athens = 23.7163375; //\"23d42'58.815\\\"E\",\nexports.oslo = 10.722916666667; //\"10d43'22.5\\\"E\"\n","export default {\n ft: {to_meter: 0.3048},\n 'us-ft': {to_meter: 1200 / 3937}\n};\n","var ignoredChar = /[\\s_\\-\\/\\(\\)]/g;\nexport default function match(obj, key) {\n if (obj[key]) {\n return obj[key];\n }\n var keys = Object.keys(obj);\n var lkey = key.toLowerCase().replace(ignoredChar, '');\n var i = -1;\n var testkey, processedKey;\n while (++i < keys.length) {\n testkey = keys[i];\n processedKey = testkey.toLowerCase().replace(ignoredChar, '');\n if (processedKey === lkey) {\n return obj[testkey];\n }\n }\n}\n","import {D2R} from './constants/values';\nimport PrimeMeridian from './constants/PrimeMeridian';\nimport units from './constants/units';\nimport match from './match';\n\nexport default function(defData) {\n var self = {};\n var paramObj = defData.split('+').map(function(v) {\n return v.trim();\n }).filter(function(a) {\n return a;\n }).reduce(function(p, a) {\n var split = a.split('=');\n split.push(true);\n p[split[0].toLowerCase()] = split[1];\n return p;\n }, {});\n var paramName, paramVal, paramOutname;\n var params = {\n proj: 'projName',\n datum: 'datumCode',\n rf: function(v) {\n self.rf = parseFloat(v);\n },\n lat_0: function(v) {\n self.lat0 = v * D2R;\n },\n lat_1: function(v) {\n self.lat1 = v * D2R;\n },\n lat_2: function(v) {\n self.lat2 = v * D2R;\n },\n lat_ts: function(v) {\n self.lat_ts = v * D2R;\n },\n lon_0: function(v) {\n self.long0 = v * D2R;\n },\n lon_1: function(v) {\n self.long1 = v * D2R;\n },\n lon_2: function(v) {\n self.long2 = v * D2R;\n },\n alpha: function(v) {\n self.alpha = parseFloat(v) * D2R;\n },\n gamma: function(v) {\n self.rectified_grid_angle = parseFloat(v);\n },\n lonc: function(v) {\n self.longc = v * D2R;\n },\n x_0: function(v) {\n self.x0 = parseFloat(v);\n },\n y_0: function(v) {\n self.y0 = parseFloat(v);\n },\n k_0: function(v) {\n self.k0 = parseFloat(v);\n },\n k: function(v) {\n self.k0 = parseFloat(v);\n },\n a: function(v) {\n self.a = parseFloat(v);\n },\n b: function(v) {\n self.b = parseFloat(v);\n },\n r: function(v) {\n self.a = self.b = parseFloat(v);\n },\n r_a: function() {\n self.R_A = true;\n },\n zone: function(v) {\n self.zone = parseInt(v, 10);\n },\n south: function() {\n self.utmSouth = true;\n },\n towgs84: function(v) {\n self.datum_params = v.split(\",\").map(function(a) {\n return parseFloat(a);\n });\n },\n to_meter: function(v) {\n self.to_meter = parseFloat(v);\n },\n units: function(v) {\n self.units = v;\n var unit = match(units, v);\n if (unit) {\n self.to_meter = unit.to_meter;\n }\n },\n from_greenwich: function(v) {\n self.from_greenwich = v * D2R;\n },\n pm: function(v) {\n var pm = match(PrimeMeridian, v);\n self.from_greenwich = (pm ? pm : parseFloat(v)) * D2R;\n },\n nadgrids: function(v) {\n if (v === '@null') {\n self.datumCode = 'none';\n }\n else {\n self.nadgrids = v;\n }\n },\n axis: function(v) {\n var legalAxis = \"ewnsud\";\n if (v.length === 3 && legalAxis.indexOf(v.substr(0, 1)) !== -1 && legalAxis.indexOf(v.substr(1, 1)) !== -1 && legalAxis.indexOf(v.substr(2, 1)) !== -1) {\n self.axis = v;\n }\n },\n approx: function() {\n self.approx = true;\n }\n };\n for (paramName in paramObj) {\n paramVal = paramObj[paramName];\n if (paramName in params) {\n paramOutname = params[paramName];\n if (typeof paramOutname === 'function') {\n paramOutname(paramVal);\n }\n else {\n self[paramOutname] = paramVal;\n }\n }\n else {\n self[paramName] = paramVal;\n }\n }\n if(typeof self.datumCode === 'string' && self.datumCode !== \"WGS84\"){\n self.datumCode = self.datumCode.toLowerCase();\n }\n return self;\n}\n","export default parseString;\n\nvar NEUTRAL = 1;\nvar KEYWORD = 2;\nvar NUMBER = 3;\nvar QUOTED = 4;\nvar AFTERQUOTE = 5;\nvar ENDED = -1;\nvar whitespace = /\\s/;\nvar latin = /[A-Za-z]/;\nvar keyword = /[A-Za-z84_]/;\nvar endThings = /[,\\]]/;\nvar digets = /[\\d\\.E\\-\\+]/;\n// const ignoredChar = /[\\s_\\-\\/\\(\\)]/g;\nfunction Parser(text) {\n if (typeof text !== 'string') {\n throw new Error('not a string');\n }\n this.text = text.trim();\n this.level = 0;\n this.place = 0;\n this.root = null;\n this.stack = [];\n this.currentObject = null;\n this.state = NEUTRAL;\n}\nParser.prototype.readCharicter = function() {\n var char = this.text[this.place++];\n if (this.state !== QUOTED) {\n while (whitespace.test(char)) {\n if (this.place >= this.text.length) {\n return;\n }\n char = this.text[this.place++];\n }\n }\n switch (this.state) {\n case NEUTRAL:\n return this.neutral(char);\n case KEYWORD:\n return this.keyword(char)\n case QUOTED:\n return this.quoted(char);\n case AFTERQUOTE:\n return this.afterquote(char);\n case NUMBER:\n return this.number(char);\n case ENDED:\n return;\n }\n};\nParser.prototype.afterquote = function(char) {\n if (char === '\"') {\n this.word += '\"';\n this.state = QUOTED;\n return;\n }\n if (endThings.test(char)) {\n this.word = this.word.trim();\n this.afterItem(char);\n return;\n }\n throw new Error('havn\\'t handled \"' +char + '\" in afterquote yet, index ' + this.place);\n};\nParser.prototype.afterItem = function(char) {\n if (char === ',') {\n if (this.word !== null) {\n this.currentObject.push(this.word);\n }\n this.word = null;\n this.state = NEUTRAL;\n return;\n }\n if (char === ']') {\n this.level--;\n if (this.word !== null) {\n this.currentObject.push(this.word);\n this.word = null;\n }\n this.state = NEUTRAL;\n this.currentObject = this.stack.pop();\n if (!this.currentObject) {\n this.state = ENDED;\n }\n\n return;\n }\n};\nParser.prototype.number = function(char) {\n if (digets.test(char)) {\n this.word += char;\n return;\n }\n if (endThings.test(char)) {\n this.word = parseFloat(this.word);\n this.afterItem(char);\n return;\n }\n throw new Error('havn\\'t handled \"' +char + '\" in number yet, index ' + this.place);\n};\nParser.prototype.quoted = function(char) {\n if (char === '\"') {\n this.state = AFTERQUOTE;\n return;\n }\n this.word += char;\n return;\n};\nParser.prototype.keyword = function(char) {\n if (keyword.test(char)) {\n this.word += char;\n return;\n }\n if (char === '[') {\n var newObjects = [];\n newObjects.push(this.word);\n this.level++;\n if (this.root === null) {\n this.root = newObjects;\n } else {\n this.currentObject.push(newObjects);\n }\n this.stack.push(this.currentObject);\n this.currentObject = newObjects;\n this.state = NEUTRAL;\n return;\n }\n if (endThings.test(char)) {\n this.afterItem(char);\n return;\n }\n throw new Error('havn\\'t handled \"' +char + '\" in keyword yet, index ' + this.place);\n};\nParser.prototype.neutral = function(char) {\n if (latin.test(char)) {\n this.word = char;\n this.state = KEYWORD;\n return;\n }\n if (char === '\"') {\n this.word = '';\n this.state = QUOTED;\n return;\n }\n if (digets.test(char)) {\n this.word = char;\n this.state = NUMBER;\n return;\n }\n if (endThings.test(char)) {\n this.afterItem(char);\n return;\n }\n throw new Error('havn\\'t handled \"' +char + '\" in neutral yet, index ' + this.place);\n};\nParser.prototype.output = function() {\n while (this.place < this.text.length) {\n this.readCharicter();\n }\n if (this.state === ENDED) {\n return this.root;\n }\n throw new Error('unable to parse string \"' +this.text + '\". State is ' + this.state);\n};\n\nfunction parseString(txt) {\n var parser = new Parser(txt);\n return parser.output();\n}\n","\n\nfunction mapit(obj, key, value) {\n if (Array.isArray(key)) {\n value.unshift(key);\n key = null;\n }\n var thing = key ? {} : obj;\n\n var out = value.reduce(function(newObj, item) {\n sExpr(item, newObj);\n return newObj\n }, thing);\n if (key) {\n obj[key] = out;\n }\n}\n\nexport function sExpr(v, obj) {\n if (!Array.isArray(v)) {\n obj[v] = true;\n return;\n }\n var key = v.shift();\n if (key === 'PARAMETER') {\n key = v.shift();\n }\n if (v.length === 1) {\n if (Array.isArray(v[0])) {\n obj[key] = {};\n sExpr(v[0], obj[key]);\n return;\n }\n obj[key] = v[0];\n return;\n }\n if (!v.length) {\n obj[key] = true;\n return;\n }\n if (key === 'TOWGS84') {\n obj[key] = v;\n return;\n }\n if (key === 'AXIS') {\n if (!(key in obj)) {\n obj[key] = [];\n }\n obj[key].push(v);\n return;\n }\n if (!Array.isArray(key)) {\n obj[key] = {};\n }\n\n var i;\n switch (key) {\n case 'UNIT':\n case 'PRIMEM':\n case 'VERT_DATUM':\n obj[key] = {\n name: v[0].toLowerCase(),\n convert: v[1]\n };\n if (v.length === 3) {\n sExpr(v[2], obj[key]);\n }\n return;\n case 'SPHEROID':\n case 'ELLIPSOID':\n obj[key] = {\n name: v[0],\n a: v[1],\n rf: v[2]\n };\n if (v.length === 4) {\n sExpr(v[3], obj[key]);\n }\n return;\n case 'PROJECTEDCRS':\n case 'PROJCRS':\n case 'GEOGCS':\n case 'GEOCCS':\n case 'PROJCS':\n case 'LOCAL_CS':\n case 'GEODCRS':\n case 'GEODETICCRS':\n case 'GEODETICDATUM':\n case 'EDATUM':\n case 'ENGINEERINGDATUM':\n case 'VERT_CS':\n case 'VERTCRS':\n case 'VERTICALCRS':\n case 'COMPD_CS':\n case 'COMPOUNDCRS':\n case 'ENGINEERINGCRS':\n case 'ENGCRS':\n case 'FITTED_CS':\n case 'LOCAL_DATUM':\n case 'DATUM':\n v[0] = ['name', v[0]];\n mapit(obj, key, v);\n return;\n default:\n i = -1;\n while (++i < v.length) {\n if (!Array.isArray(v[i])) {\n return sExpr(v, obj[key]);\n }\n }\n return mapit(obj, key, v);\n }\n}\n","var D2R = 0.01745329251994329577;\nimport parser from './parser';\nimport {sExpr} from './process';\n\n\n\nfunction rename(obj, params) {\n var outName = params[0];\n var inName = params[1];\n if (!(outName in obj) && (inName in obj)) {\n obj[outName] = obj[inName];\n if (params.length === 3) {\n obj[outName] = params[2](obj[outName]);\n }\n }\n}\n\nfunction d2r(input) {\n return input * D2R;\n}\n\nfunction cleanWKT(wkt) {\n if (wkt.type === 'GEOGCS') {\n wkt.projName = 'longlat';\n } else if (wkt.type === 'LOCAL_CS') {\n wkt.projName = 'identity';\n wkt.local = true;\n } else {\n if (typeof wkt.PROJECTION === 'object') {\n wkt.projName = Object.keys(wkt.PROJECTION)[0];\n } else {\n wkt.projName = wkt.PROJECTION;\n }\n }\n if (wkt.AXIS) {\n var axisOrder = '';\n for (var i = 0, ii = wkt.AXIS.length; i < ii; ++i) {\n var axis = [wkt.AXIS[i][0].toLowerCase(), wkt.AXIS[i][1].toLowerCase()];\n if (axis[0].indexOf('north') !== -1 || ((axis[0] === 'y' || axis[0] === 'lat') && axis[1] === 'north')) {\n axisOrder += 'n';\n } else if (axis[0].indexOf('south') !== -1 || ((axis[0] === 'y' || axis[0] === 'lat') && axis[1] === 'south')) {\n axisOrder += 's';\n } else if (axis[0].indexOf('east') !== -1 || ((axis[0] === 'x' || axis[0] === 'lon') && axis[1] === 'east')) {\n axisOrder += 'e';\n } else if (axis[0].indexOf('west') !== -1 || ((axis[0] === 'x' || axis[0] === 'lon') && axis[1] === 'west')) {\n axisOrder += 'w';\n }\n }\n if (axisOrder.length === 2) {\n axisOrder += 'u';\n }\n if (axisOrder.length === 3) {\n wkt.axis = axisOrder;\n }\n }\n if (wkt.UNIT) {\n wkt.units = wkt.UNIT.name.toLowerCase();\n if (wkt.units === 'metre') {\n wkt.units = 'meter';\n }\n if (wkt.UNIT.convert) {\n if (wkt.type === 'GEOGCS') {\n if (wkt.DATUM && wkt.DATUM.SPHEROID) {\n wkt.to_meter = wkt.UNIT.convert*wkt.DATUM.SPHEROID.a;\n }\n } else {\n wkt.to_meter = wkt.UNIT.convert;\n }\n }\n }\n var geogcs = wkt.GEOGCS;\n if (wkt.type === 'GEOGCS') {\n geogcs = wkt;\n }\n if (geogcs) {\n //if(wkt.GEOGCS.PRIMEM&&wkt.GEOGCS.PRIMEM.convert){\n // wkt.from_greenwich=wkt.GEOGCS.PRIMEM.convert*D2R;\n //}\n if (geogcs.DATUM) {\n wkt.datumCode = geogcs.DATUM.name.toLowerCase();\n } else {\n wkt.datumCode = geogcs.name.toLowerCase();\n }\n if (wkt.datumCode.slice(0, 2) === 'd_') {\n wkt.datumCode = wkt.datumCode.slice(2);\n }\n if (wkt.datumCode === 'new_zealand_geodetic_datum_1949' || wkt.datumCode === 'new_zealand_1949') {\n wkt.datumCode = 'nzgd49';\n }\n if (wkt.datumCode === 'wgs_1984' || wkt.datumCode === 'world_geodetic_system_1984') {\n if (wkt.PROJECTION === 'Mercator_Auxiliary_Sphere') {\n wkt.sphere = true;\n }\n wkt.datumCode = 'wgs84';\n }\n if (wkt.datumCode.slice(-6) === '_ferro') {\n wkt.datumCode = wkt.datumCode.slice(0, - 6);\n }\n if (wkt.datumCode.slice(-8) === '_jakarta') {\n wkt.datumCode = wkt.datumCode.slice(0, - 8);\n }\n if (~wkt.datumCode.indexOf('belge')) {\n wkt.datumCode = 'rnb72';\n }\n if (geogcs.DATUM && geogcs.DATUM.SPHEROID) {\n wkt.ellps = geogcs.DATUM.SPHEROID.name.replace('_19', '').replace(/[Cc]larke\\_18/, 'clrk');\n if (wkt.ellps.toLowerCase().slice(0, 13) === 'international') {\n wkt.ellps = 'intl';\n }\n\n wkt.a = geogcs.DATUM.SPHEROID.a;\n wkt.rf = parseFloat(geogcs.DATUM.SPHEROID.rf, 10);\n }\n\n if (geogcs.DATUM && geogcs.DATUM.TOWGS84) {\n wkt.datum_params = geogcs.DATUM.TOWGS84;\n }\n if (~wkt.datumCode.indexOf('osgb_1936')) {\n wkt.datumCode = 'osgb36';\n }\n if (~wkt.datumCode.indexOf('osni_1952')) {\n wkt.datumCode = 'osni52';\n }\n if (~wkt.datumCode.indexOf('tm65')\n || ~wkt.datumCode.indexOf('geodetic_datum_of_1965')) {\n wkt.datumCode = 'ire65';\n }\n if (wkt.datumCode === 'ch1903+') {\n wkt.datumCode = 'ch1903';\n }\n if (~wkt.datumCode.indexOf('israel')) {\n wkt.datumCode = 'isr93';\n }\n }\n if (wkt.b && !isFinite(wkt.b)) {\n wkt.b = wkt.a;\n }\n\n function toMeter(input) {\n var ratio = wkt.to_meter || 1;\n return input * ratio;\n }\n var renamer = function(a) {\n return rename(wkt, a);\n };\n var list = [\n ['standard_parallel_1', 'Standard_Parallel_1'],\n ['standard_parallel_1', 'Latitude of 1st standard parallel'],\n ['standard_parallel_2', 'Standard_Parallel_2'],\n ['standard_parallel_2', 'Latitude of 2nd standard parallel'],\n ['false_easting', 'False_Easting'],\n ['false_easting', 'False easting'],\n ['false-easting', 'Easting at false origin'],\n ['false_northing', 'False_Northing'],\n ['false_northing', 'False northing'],\n ['false_northing', 'Northing at false origin'],\n ['central_meridian', 'Central_Meridian'],\n ['central_meridian', 'Longitude of natural origin'],\n ['central_meridian', 'Longitude of false origin'],\n ['latitude_of_origin', 'Latitude_Of_Origin'],\n ['latitude_of_origin', 'Central_Parallel'],\n ['latitude_of_origin', 'Latitude of natural origin'],\n ['latitude_of_origin', 'Latitude of false origin'],\n ['scale_factor', 'Scale_Factor'],\n ['k0', 'scale_factor'],\n ['latitude_of_center', 'Latitude_Of_Center'],\n ['latitude_of_center', 'Latitude_of_center'],\n ['lat0', 'latitude_of_center', d2r],\n ['longitude_of_center', 'Longitude_Of_Center'],\n ['longitude_of_center', 'Longitude_of_center'],\n ['longc', 'longitude_of_center', d2r],\n ['x0', 'false_easting', toMeter],\n ['y0', 'false_northing', toMeter],\n ['long0', 'central_meridian', d2r],\n ['lat0', 'latitude_of_origin', d2r],\n ['lat0', 'standard_parallel_1', d2r],\n ['lat1', 'standard_parallel_1', d2r],\n ['lat2', 'standard_parallel_2', d2r],\n ['azimuth', 'Azimuth'],\n ['alpha', 'azimuth', d2r],\n ['srsCode', 'name']\n ];\n list.forEach(renamer);\n if (!wkt.long0 && wkt.longc && (wkt.projName === 'Albers_Conic_Equal_Area' || wkt.projName === 'Lambert_Azimuthal_Equal_Area')) {\n wkt.long0 = wkt.longc;\n }\n if (!wkt.lat_ts && wkt.lat1 && (wkt.projName === 'Stereographic_South_Pole' || wkt.projName === 'Polar Stereographic (variant B)')) {\n wkt.lat0 = d2r(wkt.lat1 > 0 ? 90 : -90);\n wkt.lat_ts = wkt.lat1;\n } else if (!wkt.lat_ts && wkt.lat0 && wkt.projName === 'Polar_Stereographic') {\n wkt.lat_ts = wkt.lat0;\n wkt.lat0 = d2r(wkt.lat0 > 0 ? 90 : -90);\n }\n}\nexport default function(wkt) {\n var lisp = parser(wkt);\n var type = lisp.shift();\n var name = lisp.shift();\n lisp.unshift(['name', name]);\n lisp.unshift(['type', type]);\n var obj = {};\n sExpr(lisp, obj);\n cleanWKT(obj);\n return obj;\n}\n","import globals from './global';\nimport parseProj from './projString';\nimport wkt from 'wkt-parser';\n\nfunction defs(name) {\n /*global console*/\n var that = this;\n if (arguments.length === 2) {\n var def = arguments[1];\n if (typeof def === 'string') {\n if (def.charAt(0) === '+') {\n defs[name] = parseProj(arguments[1]);\n }\n else {\n defs[name] = wkt(arguments[1]);\n }\n } else {\n defs[name] = def;\n }\n }\n else if (arguments.length === 1) {\n if (Array.isArray(name)) {\n return name.map(function(v) {\n if (Array.isArray(v)) {\n defs.apply(that, v);\n }\n else {\n defs(v);\n }\n });\n }\n else if (typeof name === 'string') {\n if (name in defs) {\n return defs[name];\n }\n }\n else if ('EPSG' in name) {\n defs['EPSG:' + name.EPSG] = name;\n }\n else if ('ESRI' in name) {\n defs['ESRI:' + name.ESRI] = name;\n }\n else if ('IAU2000' in name) {\n defs['IAU2000:' + name.IAU2000] = name;\n }\n else {\n console.log(name);\n }\n return;\n }\n\n\n}\nglobals(defs);\nexport default defs;\n","import defs from './defs';\nimport wkt from 'wkt-parser';\nimport projStr from './projString';\nimport match from './match';\nfunction testObj(code){\n return typeof code === 'string';\n}\nfunction testDef(code){\n return code in defs;\n}\nvar codeWords = ['PROJECTEDCRS', 'PROJCRS', 'GEOGCS','GEOCCS','PROJCS','LOCAL_CS', 'GEODCRS', 'GEODETICCRS', 'GEODETICDATUM', 'ENGCRS', 'ENGINEERINGCRS'];\nfunction testWKT(code){\n return codeWords.some(function (word) {\n return code.indexOf(word) > -1;\n });\n}\nvar codes = ['3857', '900913', '3785', '102113'];\nfunction checkMercator(item) {\n var auth = match(item, 'authority');\n if (!auth) {\n return;\n }\n var code = match(auth, 'epsg');\n return code && codes.indexOf(code) > -1;\n}\nfunction checkProjStr(item) {\n var ext = match(item, 'extension');\n if (!ext) {\n return;\n }\n return match(ext, 'proj4');\n}\nfunction testProj(code){\n return code[0] === '+';\n}\nfunction parse(code){\n if (testObj(code)) {\n //check to see if this is a WKT string\n if (testDef(code)) {\n return defs[code];\n }\n if (testWKT(code)) {\n var out = wkt(code);\n // test of spetial case, due to this being a very common and often malformed\n if (checkMercator(out)) {\n return defs['EPSG:3857'];\n }\n var maybeProjStr = checkProjStr(out);\n if (maybeProjStr) {\n return projStr(maybeProjStr);\n }\n return out;\n }\n if (testProj(code)) {\n return projStr(code);\n }\n }else{\n return code;\n }\n}\n\nexport default parse;\n","export default function(destination, source) {\n destination = destination || {};\n var value, property;\n if (!source) {\n return destination;\n }\n for (property in source) {\n value = source[property];\n if (value !== undefined) {\n destination[property] = value;\n }\n }\n return destination;\n}\n","export default function(eccent, sinphi, cosphi) {\n var con = eccent * sinphi;\n return cosphi / (Math.sqrt(1 - con * con));\n}","export default function(x) {\n return x<0 ? -1 : 1;\n}","\nimport {TWO_PI, SPI} from '../constants/values';\nimport sign from './sign';\n\nexport default function(x) {\n return (Math.abs(x) <= SPI) ? x : (x - (sign(x) * TWO_PI));\n}\n","import {HALF_PI} from '../constants/values';\n\nexport default function(eccent, phi, sinphi) {\n var con = eccent * sinphi;\n var com = 0.5 * eccent;\n con = Math.pow(((1 - con) / (1 + con)), com);\n return (Math.tan(0.5 * (HALF_PI - phi)) / con);\n}\n","import {HALF_PI} from '../constants/values';\n\nexport default function(eccent, ts) {\n var eccnth = 0.5 * eccent;\n var con, dphi;\n var phi = HALF_PI - 2 * Math.atan(ts);\n for (var i = 0; i <= 15; i++) {\n con = eccent * Math.sin(phi);\n dphi = HALF_PI - 2 * Math.atan(ts * (Math.pow(((1 - con) / (1 + con)), eccnth))) - phi;\n phi += dphi;\n if (Math.abs(dphi) <= 0.0000000001) {\n return phi;\n }\n }\n //console.log(\"phi2z has NoConvergence\");\n return -9999;\n}\n","import msfnz from '../common/msfnz';\n\nimport adjust_lon from '../common/adjust_lon';\nimport tsfnz from '../common/tsfnz';\nimport phi2z from '../common/phi2z';\nimport {FORTPI, R2D, EPSLN, HALF_PI} from '../constants/values';\nexport function init() {\n var con = this.b / this.a;\n this.es = 1 - con * con;\n if(!('x0' in this)){\n this.x0 = 0;\n }\n if(!('y0' in this)){\n this.y0 = 0;\n }\n this.e = Math.sqrt(this.es);\n if (this.lat_ts) {\n if (this.sphere) {\n this.k0 = Math.cos(this.lat_ts);\n }\n else {\n this.k0 = msfnz(this.e, Math.sin(this.lat_ts), Math.cos(this.lat_ts));\n }\n }\n else {\n if (!this.k0) {\n if (this.k) {\n this.k0 = this.k;\n }\n else {\n this.k0 = 1;\n }\n }\n }\n}\n\n/* Mercator forward equations--mapping lat,long to x,y\n --------------------------------------------------*/\n\nexport function forward(p) {\n var lon = p.x;\n var lat = p.y;\n // convert to radians\n if (lat * R2D > 90 && lat * R2D < -90 && lon * R2D > 180 && lon * R2D < -180) {\n return null;\n }\n\n var x, y;\n if (Math.abs(Math.abs(lat) - HALF_PI) <= EPSLN) {\n return null;\n }\n else {\n if (this.sphere) {\n x = this.x0 + this.a * this.k0 * adjust_lon(lon - this.long0);\n y = this.y0 + this.a * this.k0 * Math.log(Math.tan(FORTPI + 0.5 * lat));\n }\n else {\n var sinphi = Math.sin(lat);\n var ts = tsfnz(this.e, lat, sinphi);\n x = this.x0 + this.a * this.k0 * adjust_lon(lon - this.long0);\n y = this.y0 - this.a * this.k0 * Math.log(ts);\n }\n p.x = x;\n p.y = y;\n return p;\n }\n}\n\n/* Mercator inverse equations--mapping x,y to lat/long\n --------------------------------------------------*/\nexport function inverse(p) {\n\n var x = p.x - this.x0;\n var y = p.y - this.y0;\n var lon, lat;\n\n if (this.sphere) {\n lat = HALF_PI - 2 * Math.atan(Math.exp(-y / (this.a * this.k0)));\n }\n else {\n var ts = Math.exp(-y / (this.a * this.k0));\n lat = phi2z(this.e, ts);\n if (lat === -9999) {\n return null;\n }\n }\n lon = adjust_lon(this.long0 + x / (this.a * this.k0));\n\n p.x = lon;\n p.y = lat;\n return p;\n}\n\nexport var names = [\"Mercator\", \"Popular Visualisation Pseudo Mercator\", \"Mercator_1SP\", \"Mercator_Auxiliary_Sphere\", \"merc\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","export function init() {\n //no-op for longlat\n}\n\nfunction identity(pt) {\n return pt;\n}\nexport {identity as forward};\nexport {identity as inverse};\nexport var names = [\"longlat\", \"identity\"];\nexport default {\n init: init,\n forward: identity,\n inverse: identity,\n names: names\n};\n","import merc from \"./projections/merc\";\nimport longlat from \"./projections/longlat\";\nvar projs = [merc, longlat];\nvar names = {};\nvar projStore = [];\n\nfunction add(proj, i) {\n var len = projStore.length;\n if (!proj.names) {\n console.log(i);\n return true;\n }\n projStore[len] = proj;\n proj.names.forEach(function(n) {\n names[n.toLowerCase()] = len;\n });\n return this;\n}\n\nexport {add};\n\nexport function get(name) {\n if (!name) {\n return false;\n }\n var n = name.toLowerCase();\n if (typeof names[n] !== 'undefined' && projStore[names[n]]) {\n return projStore[names[n]];\n }\n}\n\nexport function start() {\n projs.forEach(add);\n}\nexport default {\n start: start,\n add: add,\n get: get\n};\n","var exports = {};\nexport {exports as default};\nexports.MERIT = {\n a: 6378137.0,\n rf: 298.257,\n ellipseName: \"MERIT 1983\"\n};\n\nexports.SGS85 = {\n a: 6378136.0,\n rf: 298.257,\n ellipseName: \"Soviet Geodetic System 85\"\n};\n\nexports.GRS80 = {\n a: 6378137.0,\n rf: 298.257222101,\n ellipseName: \"GRS 1980(IUGG, 1980)\"\n};\n\nexports.IAU76 = {\n a: 6378140.0,\n rf: 298.257,\n ellipseName: \"IAU 1976\"\n};\n\nexports.airy = {\n a: 6377563.396,\n b: 6356256.910,\n ellipseName: \"Airy 1830\"\n};\n\nexports.APL4 = {\n a: 6378137,\n rf: 298.25,\n ellipseName: \"Appl. Physics. 1965\"\n};\n\nexports.NWL9D = {\n a: 6378145.0,\n rf: 298.25,\n ellipseName: \"Naval Weapons Lab., 1965\"\n};\n\nexports.mod_airy = {\n a: 6377340.189,\n b: 6356034.446,\n ellipseName: \"Modified Airy\"\n};\n\nexports.andrae = {\n a: 6377104.43,\n rf: 300.0,\n ellipseName: \"Andrae 1876 (Den., Iclnd.)\"\n};\n\nexports.aust_SA = {\n a: 6378160.0,\n rf: 298.25,\n ellipseName: \"Australian Natl & S. Amer. 1969\"\n};\n\nexports.GRS67 = {\n a: 6378160.0,\n rf: 298.2471674270,\n ellipseName: \"GRS 67(IUGG 1967)\"\n};\n\nexports.bessel = {\n a: 6377397.155,\n rf: 299.1528128,\n ellipseName: \"Bessel 1841\"\n};\n\nexports.bess_nam = {\n a: 6377483.865,\n rf: 299.1528128,\n ellipseName: \"Bessel 1841 (Namibia)\"\n};\n\nexports.clrk66 = {\n a: 6378206.4,\n b: 6356583.8,\n ellipseName: \"Clarke 1866\"\n};\n\nexports.clrk80 = {\n a: 6378249.145,\n rf: 293.4663,\n ellipseName: \"Clarke 1880 mod.\"\n};\n\nexports.clrk80ign = {\n a: 6378249.2,\n b: 6356515,\n rf: 293.4660213,\n ellipseName: \"Clarke 1880 (IGN)\"\n};\n\nexports.clrk58 = {\n a: 6378293.645208759,\n rf: 294.2606763692654,\n ellipseName: \"Clarke 1858\"\n};\n\nexports.CPM = {\n a: 6375738.7,\n rf: 334.29,\n ellipseName: \"Comm. des Poids et Mesures 1799\"\n};\n\nexports.delmbr = {\n a: 6376428.0,\n rf: 311.5,\n ellipseName: \"Delambre 1810 (Belgium)\"\n};\n\nexports.engelis = {\n a: 6378136.05,\n rf: 298.2566,\n ellipseName: \"Engelis 1985\"\n};\n\nexports.evrst30 = {\n a: 6377276.345,\n rf: 300.8017,\n ellipseName: \"Everest 1830\"\n};\n\nexports.evrst48 = {\n a: 6377304.063,\n rf: 300.8017,\n ellipseName: \"Everest 1948\"\n};\n\nexports.evrst56 = {\n a: 6377301.243,\n rf: 300.8017,\n ellipseName: \"Everest 1956\"\n};\n\nexports.evrst69 = {\n a: 6377295.664,\n rf: 300.8017,\n ellipseName: \"Everest 1969\"\n};\n\nexports.evrstSS = {\n a: 6377298.556,\n rf: 300.8017,\n ellipseName: \"Everest (Sabah & Sarawak)\"\n};\n\nexports.fschr60 = {\n a: 6378166.0,\n rf: 298.3,\n ellipseName: \"Fischer (Mercury Datum) 1960\"\n};\n\nexports.fschr60m = {\n a: 6378155.0,\n rf: 298.3,\n ellipseName: \"Fischer 1960\"\n};\n\nexports.fschr68 = {\n a: 6378150.0,\n rf: 298.3,\n ellipseName: \"Fischer 1968\"\n};\n\nexports.helmert = {\n a: 6378200.0,\n rf: 298.3,\n ellipseName: \"Helmert 1906\"\n};\n\nexports.hough = {\n a: 6378270.0,\n rf: 297.0,\n ellipseName: \"Hough\"\n};\n\nexports.intl = {\n a: 6378388.0,\n rf: 297.0,\n ellipseName: \"International 1909 (Hayford)\"\n};\n\nexports.kaula = {\n a: 6378163.0,\n rf: 298.24,\n ellipseName: \"Kaula 1961\"\n};\n\nexports.lerch = {\n a: 6378139.0,\n rf: 298.257,\n ellipseName: \"Lerch 1979\"\n};\n\nexports.mprts = {\n a: 6397300.0,\n rf: 191.0,\n ellipseName: \"Maupertius 1738\"\n};\n\nexports.new_intl = {\n a: 6378157.5,\n b: 6356772.2,\n ellipseName: \"New International 1967\"\n};\n\nexports.plessis = {\n a: 6376523.0,\n rf: 6355863.0,\n ellipseName: \"Plessis 1817 (France)\"\n};\n\nexports.krass = {\n a: 6378245.0,\n rf: 298.3,\n ellipseName: \"Krassovsky, 1942\"\n};\n\nexports.SEasia = {\n a: 6378155.0,\n b: 6356773.3205,\n ellipseName: \"Southeast Asia\"\n};\n\nexports.walbeck = {\n a: 6376896.0,\n b: 6355834.8467,\n ellipseName: \"Walbeck\"\n};\n\nexports.WGS60 = {\n a: 6378165.0,\n rf: 298.3,\n ellipseName: \"WGS 60\"\n};\n\nexports.WGS66 = {\n a: 6378145.0,\n rf: 298.25,\n ellipseName: \"WGS 66\"\n};\n\nexports.WGS7 = {\n a: 6378135.0,\n rf: 298.26,\n ellipseName: \"WGS 72\"\n};\n\nexport var WGS84 = exports.WGS84 = {\n a: 6378137.0,\n rf: 298.257223563,\n ellipseName: \"WGS 84\"\n};\n\nexports.sphere = {\n a: 6370997.0,\n b: 6370997.0,\n ellipseName: \"Normal Sphere (r=6370997)\"\n};\n","import {SIXTH, RA4, RA6, EPSLN} from './constants/values';\nimport {default as Ellipsoid, WGS84} from './constants/Ellipsoid';\nimport match from './match';\n\nexport function eccentricity(a, b, rf, R_A) {\n var a2 = a * a; // used in geocentric\n var b2 = b * b; // used in geocentric\n var es = (a2 - b2) / a2; // e ^ 2\n var e = 0;\n if (R_A) {\n a *= 1 - es * (SIXTH + es * (RA4 + es * RA6));\n a2 = a * a;\n es = 0;\n } else {\n e = Math.sqrt(es); // eccentricity\n }\n var ep2 = (a2 - b2) / b2; // used in geocentric\n return {\n es: es,\n e: e,\n ep2: ep2\n };\n}\nexport function sphere(a, b, rf, ellps, sphere) {\n if (!a) { // do we have an ellipsoid?\n var ellipse = match(Ellipsoid, ellps);\n if (!ellipse) {\n ellipse = WGS84;\n }\n a = ellipse.a;\n b = ellipse.b;\n rf = ellipse.rf;\n }\n\n if (rf && !b) {\n b = (1.0 - 1.0 / rf) * a;\n }\n if (rf === 0 || Math.abs(a - b) < EPSLN) {\n sphere = true;\n b = a;\n }\n return {\n a: a,\n b: b,\n rf: rf,\n sphere: sphere\n };\n}\n","var exports = {};\nexport {exports as default};\nexports.wgs84 = {\n towgs84: \"0,0,0\",\n ellipse: \"WGS84\",\n datumName: \"WGS84\"\n};\n\nexports.ch1903 = {\n towgs84: \"674.374,15.056,405.346\",\n ellipse: \"bessel\",\n datumName: \"swiss\"\n};\n\nexports.ggrs87 = {\n towgs84: \"-199.87,74.79,246.62\",\n ellipse: \"GRS80\",\n datumName: \"Greek_Geodetic_Reference_System_1987\"\n};\n\nexports.nad83 = {\n towgs84: \"0,0,0\",\n ellipse: \"GRS80\",\n datumName: \"North_American_Datum_1983\"\n};\n\nexports.nad27 = {\n nadgrids: \"@conus,@alaska,@ntv2_0.gsb,@ntv1_can.dat\",\n ellipse: \"clrk66\",\n datumName: \"North_American_Datum_1927\"\n};\n\nexports.potsdam = {\n towgs84: \"598.1,73.7,418.2,0.202,0.045,-2.455,6.7\",\n ellipse: \"bessel\",\n datumName: \"Potsdam Rauenberg 1950 DHDN\"\n};\n\nexports.carthage = {\n towgs84: \"-263.0,6.0,431.0\",\n ellipse: \"clark80\",\n datumName: \"Carthage 1934 Tunisia\"\n};\n\nexports.hermannskogel = {\n towgs84: \"577.326,90.129,463.919,5.137,1.474,5.297,2.4232\",\n ellipse: \"bessel\",\n datumName: \"Hermannskogel\"\n};\n\nexports.militargeographische_institut = {\n towgs84: \"577.326,90.129,463.919,5.137,1.474,5.297,2.4232\",\n ellipse: \"bessel\",\n datumName: \"Militar-Geographische Institut\"\n};\n\nexports.osni52 = {\n towgs84: \"482.530,-130.596,564.557,-1.042,-0.214,-0.631,8.15\",\n ellipse: \"airy\",\n datumName: \"Irish National\"\n};\n\nexports.ire65 = {\n towgs84: \"482.530,-130.596,564.557,-1.042,-0.214,-0.631,8.15\",\n ellipse: \"mod_airy\",\n datumName: \"Ireland 1965\"\n};\n\nexports.rassadiran = {\n towgs84: \"-133.63,-157.5,-158.62\",\n ellipse: \"intl\",\n datumName: \"Rassadiran\"\n};\n\nexports.nzgd49 = {\n towgs84: \"59.47,-5.04,187.44,0.47,-0.1,1.024,-4.5993\",\n ellipse: \"intl\",\n datumName: \"New Zealand Geodetic Datum 1949\"\n};\n\nexports.osgb36 = {\n towgs84: \"446.448,-125.157,542.060,0.1502,0.2470,0.8421,-20.4894\",\n ellipse: \"airy\",\n datumName: \"Airy 1830\"\n};\n\nexports.s_jtsk = {\n towgs84: \"589,76,480\",\n ellipse: 'bessel',\n datumName: 'S-JTSK (Ferro)'\n};\n\nexports.beduaram = {\n towgs84: '-106,-87,188',\n ellipse: 'clrk80',\n datumName: 'Beduaram'\n};\n\nexports.gunung_segara = {\n towgs84: '-403,684,41',\n ellipse: 'bessel',\n datumName: 'Gunung Segara Jakarta'\n};\n\nexports.rnb72 = {\n towgs84: \"106.869,-52.2978,103.724,-0.33657,0.456955,-1.84218,1\",\n ellipse: \"intl\",\n datumName: \"Reseau National Belge 1972\"\n};\n","import {PJD_3PARAM, PJD_7PARAM, PJD_GRIDSHIFT, PJD_WGS84, PJD_NODATUM, SEC_TO_RAD} from './constants/values';\n\nfunction datum(datumCode, datum_params, a, b, es, ep2, nadgrids) {\n var out = {};\n\n if (datumCode === undefined || datumCode === 'none') {\n out.datum_type = PJD_NODATUM;\n } else {\n out.datum_type = PJD_WGS84;\n }\n\n if (datum_params) {\n out.datum_params = datum_params.map(parseFloat);\n if (out.datum_params[0] !== 0 || out.datum_params[1] !== 0 || out.datum_params[2] !== 0) {\n out.datum_type = PJD_3PARAM;\n }\n if (out.datum_params.length > 3) {\n if (out.datum_params[3] !== 0 || out.datum_params[4] !== 0 || out.datum_params[5] !== 0 || out.datum_params[6] !== 0) {\n out.datum_type = PJD_7PARAM;\n out.datum_params[3] *= SEC_TO_RAD;\n out.datum_params[4] *= SEC_TO_RAD;\n out.datum_params[5] *= SEC_TO_RAD;\n out.datum_params[6] = (out.datum_params[6] / 1000000.0) + 1.0;\n }\n }\n }\n\n if (nadgrids) {\n out.datum_type = PJD_GRIDSHIFT;\n out.grids = nadgrids;\n }\n out.a = a; //datum object also uses these values\n out.b = b;\n out.es = es;\n out.ep2 = ep2;\n return out;\n}\n\nexport default datum;\n","/**\n * Resources for details of NTv2 file formats:\n * - https://web.archive.org/web/20140127204822if_/http://www.mgs.gov.on.ca:80/stdprodconsume/groups/content/@mgs/@iandit/documents/resourcelist/stel02_047447.pdf\n * - http://mimaka.com/help/gs/html/004_NTV2%20Data%20Format.htm\n */\n\nvar loadedNadgrids = {};\n\n/**\n * Load a binary NTv2 file (.gsb) to a key that can be used in a proj string like +nadgrids=. Pass the NTv2 file\n * as an ArrayBuffer.\n */\nexport default function nadgrid(key, data) {\n var view = new DataView(data);\n var isLittleEndian = detectLittleEndian(view);\n var header = readHeader(view, isLittleEndian);\n var subgrids = readSubgrids(view, header, isLittleEndian);\n var nadgrid = {header: header, subgrids: subgrids};\n loadedNadgrids[key] = nadgrid;\n return nadgrid;\n}\n\n/**\n * Given a proj4 value for nadgrids, return an array of loaded grids\n */\nexport function getNadgrids(nadgrids) {\n // Format details: http://proj.maptools.org/gen_parms.html\n if (nadgrids === undefined) { return null; }\n var grids = nadgrids.split(',');\n return grids.map(parseNadgridString);\n}\n\nfunction parseNadgridString(value) {\n if (value.length === 0) {\n return null;\n }\n var optional = value[0] === '@';\n if (optional) {\n value = value.slice(1);\n }\n if (value === 'null') {\n return {name: 'null', mandatory: !optional, grid: null, isNull: true};\n }\n return {\n name: value,\n mandatory: !optional,\n grid: loadedNadgrids[value] || null,\n isNull: false\n };\n}\n\nfunction secondsToRadians(seconds) {\n return (seconds / 3600) * Math.PI / 180;\n}\n\nfunction detectLittleEndian(view) {\n var nFields = view.getInt32(8, false);\n if (nFields === 11) {\n return false;\n }\n nFields = view.getInt32(8, true);\n if (nFields !== 11) {\n console.warn('Failed to detect nadgrid endian-ness, defaulting to little-endian');\n }\n return true;\n}\n\nfunction readHeader(view, isLittleEndian) {\n return {\n nFields: view.getInt32(8, isLittleEndian),\n nSubgridFields: view.getInt32(24, isLittleEndian),\n nSubgrids: view.getInt32(40, isLittleEndian),\n shiftType: decodeString(view, 56, 56 + 8).trim(),\n fromSemiMajorAxis: view.getFloat64(120, isLittleEndian),\n fromSemiMinorAxis: view.getFloat64(136, isLittleEndian),\n toSemiMajorAxis: view.getFloat64(152, isLittleEndian),\n toSemiMinorAxis: view.getFloat64(168, isLittleEndian),\n };\n}\n\nfunction decodeString(view, start, end) {\n return String.fromCharCode.apply(null, new Uint8Array(view.buffer.slice(start, end)));\n}\n\nfunction readSubgrids(view, header, isLittleEndian) {\n var gridOffset = 176;\n var grids = [];\n for (var i = 0; i < header.nSubgrids; i++) {\n var subHeader = readGridHeader(view, gridOffset, isLittleEndian);\n var nodes = readGridNodes(view, gridOffset, subHeader, isLittleEndian);\n var lngColumnCount = Math.round(\n 1 + (subHeader.upperLongitude - subHeader.lowerLongitude) / subHeader.longitudeInterval);\n var latColumnCount = Math.round(\n 1 + (subHeader.upperLatitude - subHeader.lowerLatitude) / subHeader.latitudeInterval);\n // Proj4 operates on radians whereas the coordinates are in seconds in the grid\n grids.push({\n ll: [secondsToRadians(subHeader.lowerLongitude), secondsToRadians(subHeader.lowerLatitude)],\n del: [secondsToRadians(subHeader.longitudeInterval), secondsToRadians(subHeader.latitudeInterval)],\n lim: [lngColumnCount, latColumnCount],\n count: subHeader.gridNodeCount,\n cvs: mapNodes(nodes)\n });\n gridOffset += 176 + subHeader.gridNodeCount * 16;\n }\n return grids;\n}\n\nfunction mapNodes(nodes) {\n return nodes.map(function (r) {return [secondsToRadians(r.longitudeShift), secondsToRadians(r.latitudeShift)];});\n}\n\nfunction readGridHeader(view, offset, isLittleEndian) {\n return {\n name: decodeString(view, offset + 8, offset + 16).trim(),\n parent: decodeString(view, offset + 24, offset + 24 + 8).trim(),\n lowerLatitude: view.getFloat64(offset + 72, isLittleEndian),\n upperLatitude: view.getFloat64(offset + 88, isLittleEndian),\n lowerLongitude: view.getFloat64(offset + 104, isLittleEndian),\n upperLongitude: view.getFloat64(offset + 120, isLittleEndian),\n latitudeInterval: view.getFloat64(offset + 136, isLittleEndian),\n longitudeInterval: view.getFloat64(offset + 152, isLittleEndian),\n gridNodeCount: view.getInt32(offset + 168, isLittleEndian)\n };\n}\n\nfunction readGridNodes(view, offset, gridHeader, isLittleEndian) {\n var nodesOffset = offset + 176;\n var gridRecordLength = 16;\n var gridShiftRecords = [];\n for (var i = 0; i < gridHeader.gridNodeCount; i++) {\n var record = {\n latitudeShift: view.getFloat32(nodesOffset + i * gridRecordLength, isLittleEndian),\n longitudeShift: view.getFloat32(nodesOffset + i * gridRecordLength + 4, isLittleEndian),\n latitudeAccuracy: view.getFloat32(nodesOffset + i * gridRecordLength + 8, isLittleEndian),\n longitudeAccuracy: view.getFloat32(nodesOffset + i * gridRecordLength + 12, isLittleEndian),\n };\n gridShiftRecords.push(record);\n }\n return gridShiftRecords;\n}\n","import parseCode from './parseCode';\nimport extend from './extend';\nimport projections from './projections';\nimport {sphere as dc_sphere, eccentricity as dc_eccentricity} from './deriveConstants';\nimport Datum from './constants/Datum';\nimport datum from './datum';\nimport match from './match';\nimport {getNadgrids} from \"./nadgrid\";\n\nfunction Projection(srsCode,callback) {\n if (!(this instanceof Projection)) {\n return new Projection(srsCode);\n }\n callback = callback || function(error){\n if(error){\n throw error;\n }\n };\n var json = parseCode(srsCode);\n if(typeof json !== 'object'){\n callback(srsCode);\n return;\n }\n var ourProj = Projection.projections.get(json.projName);\n if(!ourProj){\n callback(srsCode);\n return;\n }\n if (json.datumCode && json.datumCode !== 'none') {\n var datumDef = match(Datum, json.datumCode);\n if (datumDef) {\n json.datum_params = json.datum_params || (datumDef.towgs84 ? datumDef.towgs84.split(',') : null);\n json.ellps = datumDef.ellipse;\n json.datumName = datumDef.datumName ? datumDef.datumName : json.datumCode;\n }\n }\n json.k0 = json.k0 || 1.0;\n json.axis = json.axis || 'enu';\n json.ellps = json.ellps || 'wgs84';\n json.lat1 = json.lat1 || json.lat0; // Lambert_Conformal_Conic_1SP, for example, needs this\n\n var sphere_ = dc_sphere(json.a, json.b, json.rf, json.ellps, json.sphere);\n var ecc = dc_eccentricity(sphere_.a, sphere_.b, sphere_.rf, json.R_A);\n var nadgrids = getNadgrids(json.nadgrids);\n var datumObj = json.datum || datum(json.datumCode, json.datum_params, sphere_.a, sphere_.b, ecc.es, ecc.ep2,\n nadgrids);\n\n extend(this, json); // transfer everything over from the projection because we don't know what we'll need\n extend(this, ourProj); // transfer all the methods from the projection\n\n // copy the 4 things over we calculated in deriveConstants.sphere\n this.a = sphere_.a;\n this.b = sphere_.b;\n this.rf = sphere_.rf;\n this.sphere = sphere_.sphere;\n\n // copy the 3 things we calculated in deriveConstants.eccentricity\n this.es = ecc.es;\n this.e = ecc.e;\n this.ep2 = ecc.ep2;\n\n // add in the datum object\n this.datum = datumObj;\n\n // init the projection\n this.init();\n\n // legecy callback from back in the day when it went to spatialreference.org\n callback(null, this);\n\n}\nProjection.projections = projections;\nProjection.projections.start();\nexport default Projection;\n","'use strict';\nimport {PJD_3PARAM, PJD_7PARAM, HALF_PI} from './constants/values';\nexport function compareDatums(source, dest) {\n if (source.datum_type !== dest.datum_type) {\n return false; // false, datums are not equal\n } else if (source.a !== dest.a || Math.abs(source.es - dest.es) > 0.000000000050) {\n // the tolerance for es is to ensure that GRS80 and WGS84\n // are considered identical\n return false;\n } else if (source.datum_type === PJD_3PARAM) {\n return (source.datum_params[0] === dest.datum_params[0] && source.datum_params[1] === dest.datum_params[1] && source.datum_params[2] === dest.datum_params[2]);\n } else if (source.datum_type === PJD_7PARAM) {\n return (source.datum_params[0] === dest.datum_params[0] && source.datum_params[1] === dest.datum_params[1] && source.datum_params[2] === dest.datum_params[2] && source.datum_params[3] === dest.datum_params[3] && source.datum_params[4] === dest.datum_params[4] && source.datum_params[5] === dest.datum_params[5] && source.datum_params[6] === dest.datum_params[6]);\n } else {\n return true; // datums are equal\n }\n} // cs_compare_datums()\n\n/*\n * The function Convert_Geodetic_To_Geocentric converts geodetic coordinates\n * (latitude, longitude, and height) to geocentric coordinates (X, Y, Z),\n * according to the current ellipsoid parameters.\n *\n * Latitude : Geodetic latitude in radians (input)\n * Longitude : Geodetic longitude in radians (input)\n * Height : Geodetic height, in meters (input)\n * X : Calculated Geocentric X coordinate, in meters (output)\n * Y : Calculated Geocentric Y coordinate, in meters (output)\n * Z : Calculated Geocentric Z coordinate, in meters (output)\n *\n */\nexport function geodeticToGeocentric(p, es, a) {\n var Longitude = p.x;\n var Latitude = p.y;\n var Height = p.z ? p.z : 0; //Z value not always supplied\n\n var Rn; /* Earth radius at location */\n var Sin_Lat; /* Math.sin(Latitude) */\n var Sin2_Lat; /* Square of Math.sin(Latitude) */\n var Cos_Lat; /* Math.cos(Latitude) */\n\n /*\n ** Don't blow up if Latitude is just a little out of the value\n ** range as it may just be a rounding issue. Also removed longitude\n ** test, it should be wrapped by Math.cos() and Math.sin(). NFW for PROJ.4, Sep/2001.\n */\n if (Latitude < -HALF_PI && Latitude > -1.001 * HALF_PI) {\n Latitude = -HALF_PI;\n } else if (Latitude > HALF_PI && Latitude < 1.001 * HALF_PI) {\n Latitude = HALF_PI;\n } else if (Latitude < -HALF_PI) {\n /* Latitude out of range */\n //..reportError('geocent:lat out of range:' + Latitude);\n return { x: -Infinity, y: -Infinity, z: p.z };\n } else if (Latitude > HALF_PI) {\n /* Latitude out of range */\n return { x: Infinity, y: Infinity, z: p.z };\n }\n\n if (Longitude > Math.PI) {\n Longitude -= (2 * Math.PI);\n }\n Sin_Lat = Math.sin(Latitude);\n Cos_Lat = Math.cos(Latitude);\n Sin2_Lat = Sin_Lat * Sin_Lat;\n Rn = a / (Math.sqrt(1.0e0 - es * Sin2_Lat));\n return {\n x: (Rn + Height) * Cos_Lat * Math.cos(Longitude),\n y: (Rn + Height) * Cos_Lat * Math.sin(Longitude),\n z: ((Rn * (1 - es)) + Height) * Sin_Lat\n };\n} // cs_geodetic_to_geocentric()\n\nexport function geocentricToGeodetic(p, es, a, b) {\n /* local defintions and variables */\n /* end-criterium of loop, accuracy of sin(Latitude) */\n var genau = 1e-12;\n var genau2 = (genau * genau);\n var maxiter = 30;\n\n var P; /* distance between semi-minor axis and location */\n var RR; /* distance between center and location */\n var CT; /* sin of geocentric latitude */\n var ST; /* cos of geocentric latitude */\n var RX;\n var RK;\n var RN; /* Earth radius at location */\n var CPHI0; /* cos of start or old geodetic latitude in iterations */\n var SPHI0; /* sin of start or old geodetic latitude in iterations */\n var CPHI; /* cos of searched geodetic latitude */\n var SPHI; /* sin of searched geodetic latitude */\n var SDPHI; /* end-criterium: addition-theorem of sin(Latitude(iter)-Latitude(iter-1)) */\n var iter; /* # of continous iteration, max. 30 is always enough (s.a.) */\n\n var X = p.x;\n var Y = p.y;\n var Z = p.z ? p.z : 0.0; //Z value not always supplied\n var Longitude;\n var Latitude;\n var Height;\n\n P = Math.sqrt(X * X + Y * Y);\n RR = Math.sqrt(X * X + Y * Y + Z * Z);\n\n /* special cases for latitude and longitude */\n if (P / a < genau) {\n\n /* special case, if P=0. (X=0., Y=0.) */\n Longitude = 0.0;\n\n /* if (X,Y,Z)=(0.,0.,0.) then Height becomes semi-minor axis\n * of ellipsoid (=center of mass), Latitude becomes PI/2 */\n if (RR / a < genau) {\n Latitude = HALF_PI;\n Height = -b;\n return {\n x: p.x,\n y: p.y,\n z: p.z\n };\n }\n } else {\n /* ellipsoidal (geodetic) longitude\n * interval: -PI < Longitude <= +PI */\n Longitude = Math.atan2(Y, X);\n }\n\n /* --------------------------------------------------------------\n * Following iterative algorithm was developped by\n * \"Institut for Erdmessung\", University of Hannover, July 1988.\n * Internet: www.ife.uni-hannover.de\n * Iterative computation of CPHI,SPHI and Height.\n * Iteration of CPHI and SPHI to 10**-12 radian resp.\n * 2*10**-7 arcsec.\n * --------------------------------------------------------------\n */\n CT = Z / RR;\n ST = P / RR;\n RX = 1.0 / Math.sqrt(1.0 - es * (2.0 - es) * ST * ST);\n CPHI0 = ST * (1.0 - es) * RX;\n SPHI0 = CT * RX;\n iter = 0;\n\n /* loop to find sin(Latitude) resp. Latitude\n * until |sin(Latitude(iter)-Latitude(iter-1))| < genau */\n do {\n iter++;\n RN = a / Math.sqrt(1.0 - es * SPHI0 * SPHI0);\n\n /* ellipsoidal (geodetic) height */\n Height = P * CPHI0 + Z * SPHI0 - RN * (1.0 - es * SPHI0 * SPHI0);\n\n RK = es * RN / (RN + Height);\n RX = 1.0 / Math.sqrt(1.0 - RK * (2.0 - RK) * ST * ST);\n CPHI = ST * (1.0 - RK) * RX;\n SPHI = CT * RX;\n SDPHI = SPHI * CPHI0 - CPHI * SPHI0;\n CPHI0 = CPHI;\n SPHI0 = SPHI;\n }\n while (SDPHI * SDPHI > genau2 && iter < maxiter);\n\n /* ellipsoidal (geodetic) latitude */\n Latitude = Math.atan(SPHI / Math.abs(CPHI));\n return {\n x: Longitude,\n y: Latitude,\n z: Height\n };\n} // cs_geocentric_to_geodetic()\n\n/****************************************************************/\n// pj_geocentic_to_wgs84( p )\n// p = point to transform in geocentric coordinates (x,y,z)\n\n\n/** point object, nothing fancy, just allows values to be\n passed back and forth by reference rather than by value.\n Other point classes may be used as long as they have\n x and y properties, which will get modified in the transform method.\n*/\nexport function geocentricToWgs84(p, datum_type, datum_params) {\n\n if (datum_type === PJD_3PARAM) {\n // if( x[io] === HUGE_VAL )\n // continue;\n return {\n x: p.x + datum_params[0],\n y: p.y + datum_params[1],\n z: p.z + datum_params[2],\n };\n } else if (datum_type === PJD_7PARAM) {\n var Dx_BF = datum_params[0];\n var Dy_BF = datum_params[1];\n var Dz_BF = datum_params[2];\n var Rx_BF = datum_params[3];\n var Ry_BF = datum_params[4];\n var Rz_BF = datum_params[5];\n var M_BF = datum_params[6];\n // if( x[io] === HUGE_VAL )\n // continue;\n return {\n x: M_BF * (p.x - Rz_BF * p.y + Ry_BF * p.z) + Dx_BF,\n y: M_BF * (Rz_BF * p.x + p.y - Rx_BF * p.z) + Dy_BF,\n z: M_BF * (-Ry_BF * p.x + Rx_BF * p.y + p.z) + Dz_BF\n };\n }\n} // cs_geocentric_to_wgs84\n\n/****************************************************************/\n// pj_geocentic_from_wgs84()\n// coordinate system definition,\n// point to transform in geocentric coordinates (x,y,z)\nexport function geocentricFromWgs84(p, datum_type, datum_params) {\n\n if (datum_type === PJD_3PARAM) {\n //if( x[io] === HUGE_VAL )\n // continue;\n return {\n x: p.x - datum_params[0],\n y: p.y - datum_params[1],\n z: p.z - datum_params[2],\n };\n\n } else if (datum_type === PJD_7PARAM) {\n var Dx_BF = datum_params[0];\n var Dy_BF = datum_params[1];\n var Dz_BF = datum_params[2];\n var Rx_BF = datum_params[3];\n var Ry_BF = datum_params[4];\n var Rz_BF = datum_params[5];\n var M_BF = datum_params[6];\n var x_tmp = (p.x - Dx_BF) / M_BF;\n var y_tmp = (p.y - Dy_BF) / M_BF;\n var z_tmp = (p.z - Dz_BF) / M_BF;\n //if( x[io] === HUGE_VAL )\n // continue;\n\n return {\n x: x_tmp + Rz_BF * y_tmp - Ry_BF * z_tmp,\n y: -Rz_BF * x_tmp + y_tmp + Rx_BF * z_tmp,\n z: Ry_BF * x_tmp - Rx_BF * y_tmp + z_tmp\n };\n } //cs_geocentric_from_wgs84()\n}\n","import {\n PJD_3PARAM,\n PJD_7PARAM,\n PJD_GRIDSHIFT,\n PJD_NODATUM,\n R2D,\n SRS_WGS84_ESQUARED,\n SRS_WGS84_SEMIMAJOR, SRS_WGS84_SEMIMINOR\n} from './constants/values';\n\nimport {geodeticToGeocentric, geocentricToGeodetic, geocentricToWgs84, geocentricFromWgs84, compareDatums} from './datumUtils';\nimport adjust_lon from \"./common/adjust_lon\";\nfunction checkParams(type) {\n return (type === PJD_3PARAM || type === PJD_7PARAM);\n}\n\nexport default function(source, dest, point) {\n // Short cut if the datums are identical.\n if (compareDatums(source, dest)) {\n return point; // in this case, zero is sucess,\n // whereas cs_compare_datums returns 1 to indicate TRUE\n // confusing, should fix this\n }\n\n // Explicitly skip datum transform by setting 'datum=none' as parameter for either source or dest\n if (source.datum_type === PJD_NODATUM || dest.datum_type === PJD_NODATUM) {\n return point;\n }\n\n // If this datum requires grid shifts, then apply it to geodetic coordinates.\n var source_a = source.a;\n var source_es = source.es;\n if (source.datum_type === PJD_GRIDSHIFT) {\n var gridShiftCode = applyGridShift(source, false, point);\n if (gridShiftCode !== 0) {\n return undefined;\n }\n source_a = SRS_WGS84_SEMIMAJOR;\n source_es = SRS_WGS84_ESQUARED;\n }\n\n var dest_a = dest.a;\n var dest_b = dest.b;\n var dest_es = dest.es;\n if (dest.datum_type === PJD_GRIDSHIFT) {\n dest_a = SRS_WGS84_SEMIMAJOR;\n dest_b = SRS_WGS84_SEMIMINOR;\n dest_es = SRS_WGS84_ESQUARED;\n }\n\n // Do we need to go through geocentric coordinates?\n if (source_es === dest_es && source_a === dest_a && !checkParams(source.datum_type) && !checkParams(dest.datum_type)) {\n return point;\n }\n\n // Convert to geocentric coordinates.\n point = geodeticToGeocentric(point, source_es, source_a);\n // Convert between datums\n if (checkParams(source.datum_type)) {\n point = geocentricToWgs84(point, source.datum_type, source.datum_params);\n }\n if (checkParams(dest.datum_type)) {\n point = geocentricFromWgs84(point, dest.datum_type, dest.datum_params);\n }\n point = geocentricToGeodetic(point, dest_es, dest_a, dest_b);\n\n if (dest.datum_type === PJD_GRIDSHIFT) {\n var destGridShiftResult = applyGridShift(dest, true, point);\n if (destGridShiftResult !== 0) {\n return undefined;\n }\n }\n\n return point;\n}\n\nexport function applyGridShift(source, inverse, point) {\n if (source.grids === null || source.grids.length === 0) {\n console.log('Grid shift grids not found');\n return -1;\n }\n var input = {x: -point.x, y: point.y};\n var output = {x: Number.NaN, y: Number.NaN};\n var onlyMandatoryGrids = false;\n var attemptedGrids = [];\n outer:\n for (var i = 0; i < source.grids.length; i++) {\n var grid = source.grids[i];\n attemptedGrids.push(grid.name);\n if (grid.isNull) {\n output = input;\n break;\n }\n onlyMandatoryGrids = grid.mandatory;\n if (grid.grid === null) {\n if (grid.mandatory) {\n console.log(\"Unable to find mandatory grid '\" + grid.name + \"'\");\n return -1;\n }\n continue;\n }\n var subgrids = grid.grid.subgrids;\n for (var j = 0, jj = subgrids.length; j < jj; j++) {\n var subgrid = subgrids[j];\n // skip tables that don't match our point at all\n var epsilon = (Math.abs(subgrid.del[1]) + Math.abs(subgrid.del[0])) / 10000.0;\n var minX = subgrid.ll[0] - epsilon;\n var minY = subgrid.ll[1] - epsilon;\n var maxX = subgrid.ll[0] + (subgrid.lim[0] - 1) * subgrid.del[0] + epsilon;\n var maxY = subgrid.ll[1] + (subgrid.lim[1] - 1) * subgrid.del[1] + epsilon;\n if (minY > input.y || minX > input.x || maxY < input.y || maxX < input.x ) {\n continue;\n }\n output = applySubgridShift(input, inverse, subgrid);\n if (!isNaN(output.x)) {\n break outer;\n }\n }\n }\n if (isNaN(output.x)) {\n console.log(\"Failed to find a grid shift table for location '\"+\n -input.x * R2D + \" \" + input.y * R2D + \" tried: '\" + attemptedGrids + \"'\");\n return -1;\n }\n point.x = -output.x;\n point.y = output.y;\n return 0;\n}\n\nfunction applySubgridShift(pin, inverse, ct) {\n var val = {x: Number.NaN, y: Number.NaN};\n if (isNaN(pin.x)) { return val; }\n var tb = {x: pin.x, y: pin.y};\n tb.x -= ct.ll[0];\n tb.y -= ct.ll[1];\n tb.x = adjust_lon(tb.x - Math.PI) + Math.PI;\n var t = nadInterpolate(tb, ct);\n if (inverse) {\n if (isNaN(t.x)) {\n return val;\n }\n t.x = tb.x - t.x;\n t.y = tb.y - t.y;\n var i = 9, tol = 1e-12;\n var dif, del;\n do {\n del = nadInterpolate(t, ct);\n if (isNaN(del.x)) {\n console.log(\"Inverse grid shift iteration failed, presumably at grid edge. Using first approximation.\");\n break;\n }\n dif = {x: tb.x - (del.x + t.x), y: tb.y - (del.y + t.y)};\n t.x += dif.x;\n t.y += dif.y;\n } while (i-- && Math.abs(dif.x) > tol && Math.abs(dif.y) > tol);\n if (i < 0) {\n console.log(\"Inverse grid shift iterator failed to converge.\");\n return val;\n }\n val.x = adjust_lon(t.x + ct.ll[0]);\n val.y = t.y + ct.ll[1];\n } else {\n if (!isNaN(t.x)) {\n val.x = pin.x + t.x;\n val.y = pin.y + t.y;\n }\n }\n return val;\n}\n\nfunction nadInterpolate(pin, ct) {\n var t = {x: pin.x / ct.del[0], y: pin.y / ct.del[1]};\n var indx = {x: Math.floor(t.x), y: Math.floor(t.y)};\n var frct = {x: t.x - 1.0 * indx.x, y: t.y - 1.0 * indx.y};\n var val= {x: Number.NaN, y: Number.NaN};\n var inx;\n if (indx.x < 0 || indx.x >= ct.lim[0]) {\n return val;\n }\n if (indx.y < 0 || indx.y >= ct.lim[1]) {\n return val;\n }\n inx = (indx.y * ct.lim[0]) + indx.x;\n var f00 = {x: ct.cvs[inx][0], y: ct.cvs[inx][1]};\n inx++;\n var f10= {x: ct.cvs[inx][0], y: ct.cvs[inx][1]};\n inx += ct.lim[0];\n var f11 = {x: ct.cvs[inx][0], y: ct.cvs[inx][1]};\n inx--;\n var f01 = {x: ct.cvs[inx][0], y: ct.cvs[inx][1]};\n var m11 = frct.x * frct.y, m10 = frct.x * (1.0 - frct.y),\n m00 = (1.0 - frct.x) * (1.0 - frct.y), m01 = (1.0 - frct.x) * frct.y;\n val.x = (m00 * f00.x + m10 * f10.x + m01 * f01.x + m11 * f11.x);\n val.y = (m00 * f00.y + m10 * f10.y + m01 * f01.y + m11 * f11.y);\n return val;\n}\n","export default function(crs, denorm, point) {\n var xin = point.x,\n yin = point.y,\n zin = point.z || 0.0;\n var v, t, i;\n var out = {};\n for (i = 0; i < 3; i++) {\n if (denorm && i === 2 && point.z === undefined) {\n continue;\n }\n if (i === 0) {\n v = xin;\n if (\"ew\".indexOf(crs.axis[i]) !== -1) {\n t = 'x';\n } else {\n t = 'y';\n }\n\n }\n else if (i === 1) {\n v = yin;\n if (\"ns\".indexOf(crs.axis[i]) !== -1) {\n t = 'y';\n } else {\n t = 'x';\n }\n }\n else {\n v = zin;\n t = 'z';\n }\n switch (crs.axis[i]) {\n case 'e':\n out[t] = v;\n break;\n case 'w':\n out[t] = -v;\n break;\n case 'n':\n out[t] = v;\n break;\n case 's':\n out[t] = -v;\n break;\n case 'u':\n if (point[t] !== undefined) {\n out.z = v;\n }\n break;\n case 'd':\n if (point[t] !== undefined) {\n out.z = -v;\n }\n break;\n default:\n //console.log(\"ERROR: unknow axis (\"+crs.axis[i]+\") - check definition of \"+crs.projName);\n return null;\n }\n }\n return out;\n}\n","export default function (array){\n var out = {\n x: array[0],\n y: array[1]\n };\n if (array.length>2) {\n out.z = array[2];\n }\n if (array.length>3) {\n out.m = array[3];\n }\n return out;\n}","export default function (point) {\n checkCoord(point.x);\n checkCoord(point.y);\n}\nfunction checkCoord(num) {\n if (typeof Number.isFinite === 'function') {\n if (Number.isFinite(num)) {\n return;\n }\n throw new TypeError('coordinates must be finite numbers');\n }\n if (typeof num !== 'number' || num !== num || !isFinite(num)) {\n throw new TypeError('coordinates must be finite numbers');\n }\n}\n","import {D2R, R2D, PJD_3PARAM, PJD_7PARAM, PJD_GRIDSHIFT} from './constants/values';\nimport datum_transform from './datum_transform';\nimport adjust_axis from './adjust_axis';\nimport proj from './Proj';\nimport toPoint from './common/toPoint';\nimport checkSanity from './checkSanity';\n\nfunction checkNotWGS(source, dest) {\n return (\n (source.datum.datum_type === PJD_3PARAM || source.datum.datum_type === PJD_7PARAM || source.datum.datum_type === PJD_GRIDSHIFT) && dest.datumCode !== 'WGS84') ||\n ((dest.datum.datum_type === PJD_3PARAM || dest.datum.datum_type === PJD_7PARAM || dest.datum.datum_type === PJD_GRIDSHIFT) && source.datumCode !== 'WGS84');\n}\n\nexport default function transform(source, dest, point, enforceAxis) {\n var wgs84;\n if (Array.isArray(point)) {\n point = toPoint(point);\n } else {\n // Clone the point object so inputs don't get modified\n point = {\n x: point.x,\n y: point.y,\n z: point.z,\n m: point.m\n };\n }\n var hasZ = point.z !== undefined;\n checkSanity(point);\n // Workaround for datum shifts towgs84, if either source or destination projection is not wgs84\n if (source.datum && dest.datum && checkNotWGS(source, dest)) {\n wgs84 = new proj('WGS84');\n point = transform(source, wgs84, point, enforceAxis);\n source = wgs84;\n }\n // DGR, 2010/11/12\n if (enforceAxis && source.axis !== 'enu') {\n point = adjust_axis(source, false, point);\n }\n // Transform source points to long/lat, if they aren't already.\n if (source.projName === 'longlat') {\n point = {\n x: point.x * D2R,\n y: point.y * D2R,\n z: point.z || 0\n };\n } else {\n if (source.to_meter) {\n point = {\n x: point.x * source.to_meter,\n y: point.y * source.to_meter,\n z: point.z || 0\n };\n }\n point = source.inverse(point); // Convert Cartesian to longlat\n if (!point) {\n return;\n }\n }\n // Adjust for the prime meridian if necessary\n if (source.from_greenwich) {\n point.x += source.from_greenwich;\n }\n\n // Convert datums if needed, and if possible.\n point = datum_transform(source.datum, dest.datum, point);\n if (!point) {\n return;\n }\n\n // Adjust for the prime meridian if necessary\n if (dest.from_greenwich) {\n point = {\n x: point.x - dest.from_greenwich,\n y: point.y,\n z: point.z || 0\n };\n }\n\n if (dest.projName === 'longlat') {\n // convert radians to decimal degrees\n point = {\n x: point.x * R2D,\n y: point.y * R2D,\n z: point.z || 0\n };\n } else { // else project\n point = dest.forward(point);\n if (dest.to_meter) {\n point = {\n x: point.x / dest.to_meter,\n y: point.y / dest.to_meter,\n z: point.z || 0\n };\n }\n }\n\n // DGR, 2010/11/12\n if (enforceAxis && dest.axis !== 'enu') {\n return adjust_axis(dest, true, point);\n }\n\n if (point && !hasZ) {\n delete point.z;\n }\n return point;\n}\n","import proj from './Proj';\nimport transform from './transform';\nvar wgs84 = proj('WGS84');\n\nfunction transformer(from, to, coords, enforceAxis) {\n var transformedArray, out, keys;\n if (Array.isArray(coords)) {\n transformedArray = transform(from, to, coords, enforceAxis) || {x: NaN, y: NaN};\n if (coords.length > 2) {\n if ((typeof from.name !== 'undefined' && from.name === 'geocent') || (typeof to.name !== 'undefined' && to.name === 'geocent')) {\n if (typeof transformedArray.z === 'number') {\n return [transformedArray.x, transformedArray.y, transformedArray.z].concat(coords.splice(3));\n } else {\n return [transformedArray.x, transformedArray.y, coords[2]].concat(coords.splice(3));\n }\n } else {\n return [transformedArray.x, transformedArray.y].concat(coords.splice(2));\n }\n } else {\n return [transformedArray.x, transformedArray.y];\n }\n } else {\n out = transform(from, to, coords, enforceAxis);\n keys = Object.keys(coords);\n if (keys.length === 2) {\n return out;\n }\n keys.forEach(function (key) {\n if ((typeof from.name !== 'undefined' && from.name === 'geocent') || (typeof to.name !== 'undefined' && to.name === 'geocent')) {\n if (key === 'x' || key === 'y' || key === 'z') {\n return;\n }\n } else {\n if (key === 'x' || key === 'y') {\n return;\n }\n }\n out[key] = coords[key];\n });\n return out;\n }\n}\n\nfunction checkProj(item) {\n if (item instanceof proj) {\n return item;\n }\n if (item.oProj) {\n return item.oProj;\n }\n return proj(item);\n}\n\nfunction proj4(fromProj, toProj, coord) {\n fromProj = checkProj(fromProj);\n var single = false;\n var obj;\n if (typeof toProj === 'undefined') {\n toProj = fromProj;\n fromProj = wgs84;\n single = true;\n } else if (typeof toProj.x !== 'undefined' || Array.isArray(toProj)) {\n coord = toProj;\n toProj = fromProj;\n fromProj = wgs84;\n single = true;\n }\n toProj = checkProj(toProj);\n if (coord) {\n return transformer(fromProj, toProj, coord);\n } else {\n obj = {\n forward: function (coords, enforceAxis) {\n return transformer(fromProj, toProj, coords, enforceAxis);\n },\n inverse: function (coords, enforceAxis) {\n return transformer(toProj, fromProj, coords, enforceAxis);\n }\n };\n if (single) {\n obj.oProj = toProj;\n }\n return obj;\n }\n}\nexport default proj4;","\n\n\n/**\n * UTM zones are grouped, and assigned to one of a group of 6\n * sets.\n *\n * {int} @private\n */\nvar NUM_100K_SETS = 6;\n\n/**\n * The column letters (for easting) of the lower left value, per\n * set.\n *\n * {string} @private\n */\nvar SET_ORIGIN_COLUMN_LETTERS = 'AJSAJS';\n\n/**\n * The row letters (for northing) of the lower left value, per\n * set.\n *\n * {string} @private\n */\nvar SET_ORIGIN_ROW_LETTERS = 'AFAFAF';\n\nvar A = 65; // A\nvar I = 73; // I\nvar O = 79; // O\nvar V = 86; // V\nvar Z = 90; // Z\nexport default {\n forward: forward,\n inverse: inverse,\n toPoint: toPoint\n};\n/**\n * Conversion of lat/lon to MGRS.\n *\n * @param {object} ll Object literal with lat and lon properties on a\n * WGS84 ellipsoid.\n * @param {int} accuracy Accuracy in digits (5 for 1 m, 4 for 10 m, 3 for\n * 100 m, 2 for 1000 m or 1 for 10000 m). Optional, default is 5.\n * @return {string} the MGRS string for the given location and accuracy.\n */\nexport function forward(ll, accuracy) {\n accuracy = accuracy || 5; // default accuracy 1m\n return encode(LLtoUTM({\n lat: ll[1],\n lon: ll[0]\n }), accuracy);\n};\n\n/**\n * Conversion of MGRS to lat/lon.\n *\n * @param {string} mgrs MGRS string.\n * @return {array} An array with left (longitude), bottom (latitude), right\n * (longitude) and top (latitude) values in WGS84, representing the\n * bounding box for the provided MGRS reference.\n */\nexport function inverse(mgrs) {\n var bbox = UTMtoLL(decode(mgrs.toUpperCase()));\n if (bbox.lat && bbox.lon) {\n return [bbox.lon, bbox.lat, bbox.lon, bbox.lat];\n }\n return [bbox.left, bbox.bottom, bbox.right, bbox.top];\n};\n\nexport function toPoint(mgrs) {\n var bbox = UTMtoLL(decode(mgrs.toUpperCase()));\n if (bbox.lat && bbox.lon) {\n return [bbox.lon, bbox.lat];\n }\n return [(bbox.left + bbox.right) / 2, (bbox.top + bbox.bottom) / 2];\n};\n/**\n * Conversion from degrees to radians.\n *\n * @private\n * @param {number} deg the angle in degrees.\n * @return {number} the angle in radians.\n */\nfunction degToRad(deg) {\n return (deg * (Math.PI / 180.0));\n}\n\n/**\n * Conversion from radians to degrees.\n *\n * @private\n * @param {number} rad the angle in radians.\n * @return {number} the angle in degrees.\n */\nfunction radToDeg(rad) {\n return (180.0 * (rad / Math.PI));\n}\n\n/**\n * Converts a set of Longitude and Latitude co-ordinates to UTM\n * using the WGS84 ellipsoid.\n *\n * @private\n * @param {object} ll Object literal with lat and lon properties\n * representing the WGS84 coordinate to be converted.\n * @return {object} Object literal containing the UTM value with easting,\n * northing, zoneNumber and zoneLetter properties, and an optional\n * accuracy property in digits. Returns null if the conversion failed.\n */\nfunction LLtoUTM(ll) {\n var Lat = ll.lat;\n var Long = ll.lon;\n var a = 6378137.0; //ellip.radius;\n var eccSquared = 0.00669438; //ellip.eccsq;\n var k0 = 0.9996;\n var LongOrigin;\n var eccPrimeSquared;\n var N, T, C, A, M;\n var LatRad = degToRad(Lat);\n var LongRad = degToRad(Long);\n var LongOriginRad;\n var ZoneNumber;\n // (int)\n ZoneNumber = Math.floor((Long + 180) / 6) + 1;\n\n //Make sure the longitude 180.00 is in Zone 60\n if (Long === 180) {\n ZoneNumber = 60;\n }\n\n // Special zone for Norway\n if (Lat >= 56.0 && Lat < 64.0 && Long >= 3.0 && Long < 12.0) {\n ZoneNumber = 32;\n }\n\n // Special zones for Svalbard\n if (Lat >= 72.0 && Lat < 84.0) {\n if (Long >= 0.0 && Long < 9.0) {\n ZoneNumber = 31;\n }\n else if (Long >= 9.0 && Long < 21.0) {\n ZoneNumber = 33;\n }\n else if (Long >= 21.0 && Long < 33.0) {\n ZoneNumber = 35;\n }\n else if (Long >= 33.0 && Long < 42.0) {\n ZoneNumber = 37;\n }\n }\n\n LongOrigin = (ZoneNumber - 1) * 6 - 180 + 3; //+3 puts origin\n // in middle of\n // zone\n LongOriginRad = degToRad(LongOrigin);\n\n eccPrimeSquared = (eccSquared) / (1 - eccSquared);\n\n N = a / Math.sqrt(1 - eccSquared * Math.sin(LatRad) * Math.sin(LatRad));\n T = Math.tan(LatRad) * Math.tan(LatRad);\n C = eccPrimeSquared * Math.cos(LatRad) * Math.cos(LatRad);\n A = Math.cos(LatRad) * (LongRad - LongOriginRad);\n\n M = a * ((1 - eccSquared / 4 - 3 * eccSquared * eccSquared / 64 - 5 * eccSquared * eccSquared * eccSquared / 256) * LatRad - (3 * eccSquared / 8 + 3 * eccSquared * eccSquared / 32 + 45 * eccSquared * eccSquared * eccSquared / 1024) * Math.sin(2 * LatRad) + (15 * eccSquared * eccSquared / 256 + 45 * eccSquared * eccSquared * eccSquared / 1024) * Math.sin(4 * LatRad) - (35 * eccSquared * eccSquared * eccSquared / 3072) * Math.sin(6 * LatRad));\n\n var UTMEasting = (k0 * N * (A + (1 - T + C) * A * A * A / 6.0 + (5 - 18 * T + T * T + 72 * C - 58 * eccPrimeSquared) * A * A * A * A * A / 120.0) + 500000.0);\n\n var UTMNorthing = (k0 * (M + N * Math.tan(LatRad) * (A * A / 2 + (5 - T + 9 * C + 4 * C * C) * A * A * A * A / 24.0 + (61 - 58 * T + T * T + 600 * C - 330 * eccPrimeSquared) * A * A * A * A * A * A / 720.0)));\n if (Lat < 0.0) {\n UTMNorthing += 10000000.0; //10000000 meter offset for\n // southern hemisphere\n }\n\n return {\n northing: Math.round(UTMNorthing),\n easting: Math.round(UTMEasting),\n zoneNumber: ZoneNumber,\n zoneLetter: getLetterDesignator(Lat)\n };\n}\n\n/**\n * Converts UTM coords to lat/long, using the WGS84 ellipsoid. This is a convenience\n * class where the Zone can be specified as a single string eg.\"60N\" which\n * is then broken down into the ZoneNumber and ZoneLetter.\n *\n * @private\n * @param {object} utm An object literal with northing, easting, zoneNumber\n * and zoneLetter properties. If an optional accuracy property is\n * provided (in meters), a bounding box will be returned instead of\n * latitude and longitude.\n * @return {object} An object literal containing either lat and lon values\n * (if no accuracy was provided), or top, right, bottom and left values\n * for the bounding box calculated according to the provided accuracy.\n * Returns null if the conversion failed.\n */\nfunction UTMtoLL(utm) {\n\n var UTMNorthing = utm.northing;\n var UTMEasting = utm.easting;\n var zoneLetter = utm.zoneLetter;\n var zoneNumber = utm.zoneNumber;\n // check the ZoneNummber is valid\n if (zoneNumber < 0 || zoneNumber > 60) {\n return null;\n }\n\n var k0 = 0.9996;\n var a = 6378137.0; //ellip.radius;\n var eccSquared = 0.00669438; //ellip.eccsq;\n var eccPrimeSquared;\n var e1 = (1 - Math.sqrt(1 - eccSquared)) / (1 + Math.sqrt(1 - eccSquared));\n var N1, T1, C1, R1, D, M;\n var LongOrigin;\n var mu, phi1Rad;\n\n // remove 500,000 meter offset for longitude\n var x = UTMEasting - 500000.0;\n var y = UTMNorthing;\n\n // We must know somehow if we are in the Northern or Southern\n // hemisphere, this is the only time we use the letter So even\n // if the Zone letter isn't exactly correct it should indicate\n // the hemisphere correctly\n if (zoneLetter < 'N') {\n y -= 10000000.0; // remove 10,000,000 meter offset used\n // for southern hemisphere\n }\n\n // There are 60 zones with zone 1 being at West -180 to -174\n LongOrigin = (zoneNumber - 1) * 6 - 180 + 3; // +3 puts origin\n // in middle of\n // zone\n\n eccPrimeSquared = (eccSquared) / (1 - eccSquared);\n\n M = y / k0;\n mu = M / (a * (1 - eccSquared / 4 - 3 * eccSquared * eccSquared / 64 - 5 * eccSquared * eccSquared * eccSquared / 256));\n\n phi1Rad = mu + (3 * e1 / 2 - 27 * e1 * e1 * e1 / 32) * Math.sin(2 * mu) + (21 * e1 * e1 / 16 - 55 * e1 * e1 * e1 * e1 / 32) * Math.sin(4 * mu) + (151 * e1 * e1 * e1 / 96) * Math.sin(6 * mu);\n // double phi1 = ProjMath.radToDeg(phi1Rad);\n\n N1 = a / Math.sqrt(1 - eccSquared * Math.sin(phi1Rad) * Math.sin(phi1Rad));\n T1 = Math.tan(phi1Rad) * Math.tan(phi1Rad);\n C1 = eccPrimeSquared * Math.cos(phi1Rad) * Math.cos(phi1Rad);\n R1 = a * (1 - eccSquared) / Math.pow(1 - eccSquared * Math.sin(phi1Rad) * Math.sin(phi1Rad), 1.5);\n D = x / (N1 * k0);\n\n var lat = phi1Rad - (N1 * Math.tan(phi1Rad) / R1) * (D * D / 2 - (5 + 3 * T1 + 10 * C1 - 4 * C1 * C1 - 9 * eccPrimeSquared) * D * D * D * D / 24 + (61 + 90 * T1 + 298 * C1 + 45 * T1 * T1 - 252 * eccPrimeSquared - 3 * C1 * C1) * D * D * D * D * D * D / 720);\n lat = radToDeg(lat);\n\n var lon = (D - (1 + 2 * T1 + C1) * D * D * D / 6 + (5 - 2 * C1 + 28 * T1 - 3 * C1 * C1 + 8 * eccPrimeSquared + 24 * T1 * T1) * D * D * D * D * D / 120) / Math.cos(phi1Rad);\n lon = LongOrigin + radToDeg(lon);\n\n var result;\n if (utm.accuracy) {\n var topRight = UTMtoLL({\n northing: utm.northing + utm.accuracy,\n easting: utm.easting + utm.accuracy,\n zoneLetter: utm.zoneLetter,\n zoneNumber: utm.zoneNumber\n });\n result = {\n top: topRight.lat,\n right: topRight.lon,\n bottom: lat,\n left: lon\n };\n }\n else {\n result = {\n lat: lat,\n lon: lon\n };\n }\n return result;\n}\n\n/**\n * Calculates the MGRS letter designator for the given latitude.\n *\n * @private\n * @param {number} lat The latitude in WGS84 to get the letter designator\n * for.\n * @return {char} The letter designator.\n */\nfunction getLetterDesignator(lat) {\n //This is here as an error flag to show that the Latitude is\n //outside MGRS limits\n var LetterDesignator = 'Z';\n\n if ((84 >= lat) && (lat >= 72)) {\n LetterDesignator = 'X';\n }\n else if ((72 > lat) && (lat >= 64)) {\n LetterDesignator = 'W';\n }\n else if ((64 > lat) && (lat >= 56)) {\n LetterDesignator = 'V';\n }\n else if ((56 > lat) && (lat >= 48)) {\n LetterDesignator = 'U';\n }\n else if ((48 > lat) && (lat >= 40)) {\n LetterDesignator = 'T';\n }\n else if ((40 > lat) && (lat >= 32)) {\n LetterDesignator = 'S';\n }\n else if ((32 > lat) && (lat >= 24)) {\n LetterDesignator = 'R';\n }\n else if ((24 > lat) && (lat >= 16)) {\n LetterDesignator = 'Q';\n }\n else if ((16 > lat) && (lat >= 8)) {\n LetterDesignator = 'P';\n }\n else if ((8 > lat) && (lat >= 0)) {\n LetterDesignator = 'N';\n }\n else if ((0 > lat) && (lat >= -8)) {\n LetterDesignator = 'M';\n }\n else if ((-8 > lat) && (lat >= -16)) {\n LetterDesignator = 'L';\n }\n else if ((-16 > lat) && (lat >= -24)) {\n LetterDesignator = 'K';\n }\n else if ((-24 > lat) && (lat >= -32)) {\n LetterDesignator = 'J';\n }\n else if ((-32 > lat) && (lat >= -40)) {\n LetterDesignator = 'H';\n }\n else if ((-40 > lat) && (lat >= -48)) {\n LetterDesignator = 'G';\n }\n else if ((-48 > lat) && (lat >= -56)) {\n LetterDesignator = 'F';\n }\n else if ((-56 > lat) && (lat >= -64)) {\n LetterDesignator = 'E';\n }\n else if ((-64 > lat) && (lat >= -72)) {\n LetterDesignator = 'D';\n }\n else if ((-72 > lat) && (lat >= -80)) {\n LetterDesignator = 'C';\n }\n return LetterDesignator;\n}\n\n/**\n * Encodes a UTM location as MGRS string.\n *\n * @private\n * @param {object} utm An object literal with easting, northing,\n * zoneLetter, zoneNumber\n * @param {number} accuracy Accuracy in digits (1-5).\n * @return {string} MGRS string for the given UTM location.\n */\nfunction encode(utm, accuracy) {\n // prepend with leading zeroes\n var seasting = \"00000\" + utm.easting,\n snorthing = \"00000\" + utm.northing;\n\n return utm.zoneNumber + utm.zoneLetter + get100kID(utm.easting, utm.northing, utm.zoneNumber) + seasting.substr(seasting.length - 5, accuracy) + snorthing.substr(snorthing.length - 5, accuracy);\n}\n\n/**\n * Get the two letter 100k designator for a given UTM easting,\n * northing and zone number value.\n *\n * @private\n * @param {number} easting\n * @param {number} northing\n * @param {number} zoneNumber\n * @return the two letter 100k designator for the given UTM location.\n */\nfunction get100kID(easting, northing, zoneNumber) {\n var setParm = get100kSetForZone(zoneNumber);\n var setColumn = Math.floor(easting / 100000);\n var setRow = Math.floor(northing / 100000) % 20;\n return getLetter100kID(setColumn, setRow, setParm);\n}\n\n/**\n * Given a UTM zone number, figure out the MGRS 100K set it is in.\n *\n * @private\n * @param {number} i An UTM zone number.\n * @return {number} the 100k set the UTM zone is in.\n */\nfunction get100kSetForZone(i) {\n var setParm = i % NUM_100K_SETS;\n if (setParm === 0) {\n setParm = NUM_100K_SETS;\n }\n\n return setParm;\n}\n\n/**\n * Get the two-letter MGRS 100k designator given information\n * translated from the UTM northing, easting and zone number.\n *\n * @private\n * @param {number} column the column index as it relates to the MGRS\n * 100k set spreadsheet, created from the UTM easting.\n * Values are 1-8.\n * @param {number} row the row index as it relates to the MGRS 100k set\n * spreadsheet, created from the UTM northing value. Values\n * are from 0-19.\n * @param {number} parm the set block, as it relates to the MGRS 100k set\n * spreadsheet, created from the UTM zone. Values are from\n * 1-60.\n * @return two letter MGRS 100k code.\n */\nfunction getLetter100kID(column, row, parm) {\n // colOrigin and rowOrigin are the letters at the origin of the set\n var index = parm - 1;\n var colOrigin = SET_ORIGIN_COLUMN_LETTERS.charCodeAt(index);\n var rowOrigin = SET_ORIGIN_ROW_LETTERS.charCodeAt(index);\n\n // colInt and rowInt are the letters to build to return\n var colInt = colOrigin + column - 1;\n var rowInt = rowOrigin + row;\n var rollover = false;\n\n if (colInt > Z) {\n colInt = colInt - Z + A - 1;\n rollover = true;\n }\n\n if (colInt === I || (colOrigin < I && colInt > I) || ((colInt > I || colOrigin < I) && rollover)) {\n colInt++;\n }\n\n if (colInt === O || (colOrigin < O && colInt > O) || ((colInt > O || colOrigin < O) && rollover)) {\n colInt++;\n\n if (colInt === I) {\n colInt++;\n }\n }\n\n if (colInt > Z) {\n colInt = colInt - Z + A - 1;\n }\n\n if (rowInt > V) {\n rowInt = rowInt - V + A - 1;\n rollover = true;\n }\n else {\n rollover = false;\n }\n\n if (((rowInt === I) || ((rowOrigin < I) && (rowInt > I))) || (((rowInt > I) || (rowOrigin < I)) && rollover)) {\n rowInt++;\n }\n\n if (((rowInt === O) || ((rowOrigin < O) && (rowInt > O))) || (((rowInt > O) || (rowOrigin < O)) && rollover)) {\n rowInt++;\n\n if (rowInt === I) {\n rowInt++;\n }\n }\n\n if (rowInt > V) {\n rowInt = rowInt - V + A - 1;\n }\n\n var twoLetter = String.fromCharCode(colInt) + String.fromCharCode(rowInt);\n return twoLetter;\n}\n\n/**\n * Decode the UTM parameters from a MGRS string.\n *\n * @private\n * @param {string} mgrsString an UPPERCASE coordinate string is expected.\n * @return {object} An object literal with easting, northing, zoneLetter,\n * zoneNumber and accuracy (in meters) properties.\n */\nfunction decode(mgrsString) {\n\n if (mgrsString && mgrsString.length === 0) {\n throw (\"MGRSPoint coverting from nothing\");\n }\n\n var length = mgrsString.length;\n\n var hunK = null;\n var sb = \"\";\n var testChar;\n var i = 0;\n\n // get Zone number\n while (!(/[A-Z]/).test(testChar = mgrsString.charAt(i))) {\n if (i >= 2) {\n throw (\"MGRSPoint bad conversion from: \" + mgrsString);\n }\n sb += testChar;\n i++;\n }\n\n var zoneNumber = parseInt(sb, 10);\n\n if (i === 0 || i + 3 > length) {\n // A good MGRS string has to be 4-5 digits long,\n // ##AAA/#AAA at least.\n throw (\"MGRSPoint bad conversion from: \" + mgrsString);\n }\n\n var zoneLetter = mgrsString.charAt(i++);\n\n // Should we check the zone letter here? Why not.\n if (zoneLetter <= 'A' || zoneLetter === 'B' || zoneLetter === 'Y' || zoneLetter >= 'Z' || zoneLetter === 'I' || zoneLetter === 'O') {\n throw (\"MGRSPoint zone letter \" + zoneLetter + \" not handled: \" + mgrsString);\n }\n\n hunK = mgrsString.substring(i, i += 2);\n\n var set = get100kSetForZone(zoneNumber);\n\n var east100k = getEastingFromChar(hunK.charAt(0), set);\n var north100k = getNorthingFromChar(hunK.charAt(1), set);\n\n // We have a bug where the northing may be 2000000 too low.\n // How\n // do we know when to roll over?\n\n while (north100k < getMinNorthing(zoneLetter)) {\n north100k += 2000000;\n }\n\n // calculate the char index for easting/northing separator\n var remainder = length - i;\n\n if (remainder % 2 !== 0) {\n throw (\"MGRSPoint has to have an even number \\nof digits after the zone letter and two 100km letters - front \\nhalf for easting meters, second half for \\nnorthing meters\" + mgrsString);\n }\n\n var sep = remainder / 2;\n\n var sepEasting = 0.0;\n var sepNorthing = 0.0;\n var accuracyBonus, sepEastingString, sepNorthingString, easting, northing;\n if (sep > 0) {\n accuracyBonus = 100000.0 / Math.pow(10, sep);\n sepEastingString = mgrsString.substring(i, i + sep);\n sepEasting = parseFloat(sepEastingString) * accuracyBonus;\n sepNorthingString = mgrsString.substring(i + sep);\n sepNorthing = parseFloat(sepNorthingString) * accuracyBonus;\n }\n\n easting = sepEasting + east100k;\n northing = sepNorthing + north100k;\n\n return {\n easting: easting,\n northing: northing,\n zoneLetter: zoneLetter,\n zoneNumber: zoneNumber,\n accuracy: accuracyBonus\n };\n}\n\n/**\n * Given the first letter from a two-letter MGRS 100k zone, and given the\n * MGRS table set for the zone number, figure out the easting value that\n * should be added to the other, secondary easting value.\n *\n * @private\n * @param {char} e The first letter from a two-letter MGRS 100´k zone.\n * @param {number} set The MGRS table set for the zone number.\n * @return {number} The easting value for the given letter and set.\n */\nfunction getEastingFromChar(e, set) {\n // colOrigin is the letter at the origin of the set for the\n // column\n var curCol = SET_ORIGIN_COLUMN_LETTERS.charCodeAt(set - 1);\n var eastingValue = 100000.0;\n var rewindMarker = false;\n\n while (curCol !== e.charCodeAt(0)) {\n curCol++;\n if (curCol === I) {\n curCol++;\n }\n if (curCol === O) {\n curCol++;\n }\n if (curCol > Z) {\n if (rewindMarker) {\n throw (\"Bad character: \" + e);\n }\n curCol = A;\n rewindMarker = true;\n }\n eastingValue += 100000.0;\n }\n\n return eastingValue;\n}\n\n/**\n * Given the second letter from a two-letter MGRS 100k zone, and given the\n * MGRS table set for the zone number, figure out the northing value that\n * should be added to the other, secondary northing value. You have to\n * remember that Northings are determined from the equator, and the vertical\n * cycle of letters mean a 2000000 additional northing meters. This happens\n * approx. every 18 degrees of latitude. This method does *NOT* count any\n * additional northings. You have to figure out how many 2000000 meters need\n * to be added for the zone letter of the MGRS coordinate.\n *\n * @private\n * @param {char} n Second letter of the MGRS 100k zone\n * @param {number} set The MGRS table set number, which is dependent on the\n * UTM zone number.\n * @return {number} The northing value for the given letter and set.\n */\nfunction getNorthingFromChar(n, set) {\n\n if (n > 'V') {\n throw (\"MGRSPoint given invalid Northing \" + n);\n }\n\n // rowOrigin is the letter at the origin of the set for the\n // column\n var curRow = SET_ORIGIN_ROW_LETTERS.charCodeAt(set - 1);\n var northingValue = 0.0;\n var rewindMarker = false;\n\n while (curRow !== n.charCodeAt(0)) {\n curRow++;\n if (curRow === I) {\n curRow++;\n }\n if (curRow === O) {\n curRow++;\n }\n // fixing a bug making whole application hang in this loop\n // when 'n' is a wrong character\n if (curRow > V) {\n if (rewindMarker) { // making sure that this loop ends\n throw (\"Bad character: \" + n);\n }\n curRow = A;\n rewindMarker = true;\n }\n northingValue += 100000.0;\n }\n\n return northingValue;\n}\n\n/**\n * The function getMinNorthing returns the minimum northing value of a MGRS\n * zone.\n *\n * Ported from Geotrans' c Lattitude_Band_Value structure table.\n *\n * @private\n * @param {char} zoneLetter The MGRS zone to get the min northing for.\n * @return {number}\n */\nfunction getMinNorthing(zoneLetter) {\n var northing;\n switch (zoneLetter) {\n case 'C':\n northing = 1100000.0;\n break;\n case 'D':\n northing = 2000000.0;\n break;\n case 'E':\n northing = 2800000.0;\n break;\n case 'F':\n northing = 3700000.0;\n break;\n case 'G':\n northing = 4600000.0;\n break;\n case 'H':\n northing = 5500000.0;\n break;\n case 'J':\n northing = 6400000.0;\n break;\n case 'K':\n northing = 7300000.0;\n break;\n case 'L':\n northing = 8200000.0;\n break;\n case 'M':\n northing = 9100000.0;\n break;\n case 'N':\n northing = 0.0;\n break;\n case 'P':\n northing = 800000.0;\n break;\n case 'Q':\n northing = 1700000.0;\n break;\n case 'R':\n northing = 2600000.0;\n break;\n case 'S':\n northing = 3500000.0;\n break;\n case 'T':\n northing = 4400000.0;\n break;\n case 'U':\n northing = 5300000.0;\n break;\n case 'V':\n northing = 6200000.0;\n break;\n case 'W':\n northing = 7000000.0;\n break;\n case 'X':\n northing = 7900000.0;\n break;\n default:\n northing = -1.0;\n }\n if (northing >= 0.0) {\n return northing;\n }\n else {\n throw (\"Invalid zone letter: \" + zoneLetter);\n }\n\n}\n","import {toPoint, forward} from 'mgrs';\n\nfunction Point(x, y, z) {\n if (!(this instanceof Point)) {\n return new Point(x, y, z);\n }\n if (Array.isArray(x)) {\n this.x = x[0];\n this.y = x[1];\n this.z = x[2] || 0.0;\n } else if(typeof x === 'object') {\n this.x = x.x;\n this.y = x.y;\n this.z = x.z || 0.0;\n } else if (typeof x === 'string' && typeof y === 'undefined') {\n var coords = x.split(',');\n this.x = parseFloat(coords[0], 10);\n this.y = parseFloat(coords[1], 10);\n this.z = parseFloat(coords[2], 10) || 0.0;\n } else {\n this.x = x;\n this.y = y;\n this.z = z || 0.0;\n }\n console.warn('proj4.Point will be removed in version 3, use proj4.toPoint');\n}\n\nPoint.fromMGRS = function(mgrsStr) {\n return new Point(toPoint(mgrsStr));\n};\nPoint.prototype.toMGRS = function(accuracy) {\n return forward([this.x, this.y], accuracy);\n};\nexport default Point;\n","var C00 = 1;\nvar C02 = 0.25;\nvar C04 = 0.046875;\nvar C06 = 0.01953125;\nvar C08 = 0.01068115234375;\nvar C22 = 0.75;\nvar C44 = 0.46875;\nvar C46 = 0.01302083333333333333;\nvar C48 = 0.00712076822916666666;\nvar C66 = 0.36458333333333333333;\nvar C68 = 0.00569661458333333333;\nvar C88 = 0.3076171875;\n\nexport default function(es) {\n var en = [];\n en[0] = C00 - es * (C02 + es * (C04 + es * (C06 + es * C08)));\n en[1] = es * (C22 - es * (C04 + es * (C06 + es * C08)));\n var t = es * es;\n en[2] = t * (C44 - es * (C46 + es * C48));\n t *= es;\n en[3] = t * (C66 - es * C68);\n en[4] = t * es * C88;\n return en;\n}","export default function(phi, sphi, cphi, en) {\n cphi *= sphi;\n sphi *= sphi;\n return (en[0] * phi - cphi * (en[1] + sphi * (en[2] + sphi * (en[3] + sphi * en[4]))));\n}","import pj_mlfn from \"./pj_mlfn\";\nimport {EPSLN} from '../constants/values';\n\nvar MAX_ITER = 20;\n\nexport default function(arg, es, en) {\n var k = 1 / (1 - es);\n var phi = arg;\n for (var i = MAX_ITER; i; --i) { /* rarely goes over 2 iterations */\n var s = Math.sin(phi);\n var t = 1 - es * s * s;\n //t = this.pj_mlfn(phi, s, Math.cos(phi), en) - arg;\n //phi -= t * (t * Math.sqrt(t)) * k;\n t = (pj_mlfn(phi, s, Math.cos(phi), en) - arg) * (t * Math.sqrt(t)) * k;\n phi -= t;\n if (Math.abs(t) < EPSLN) {\n return phi;\n }\n }\n //..reportError(\"cass:pj_inv_mlfn: Convergence error\");\n return phi;\n}\n","// Heavily based on this tmerc projection implementation\n// https://github.com/mbloch/mapshaper-proj/blob/master/src/projections/tmerc.js\n\nimport pj_enfn from '../common/pj_enfn';\nimport pj_mlfn from '../common/pj_mlfn';\nimport pj_inv_mlfn from '../common/pj_inv_mlfn';\nimport adjust_lon from '../common/adjust_lon';\n\nimport {EPSLN, HALF_PI} from '../constants/values';\nimport sign from '../common/sign';\n\nexport function init() {\n this.x0 = this.x0 !== undefined ? this.x0 : 0;\n this.y0 = this.y0 !== undefined ? this.y0 : 0;\n this.long0 = this.long0 !== undefined ? this.long0 : 0;\n this.lat0 = this.lat0 !== undefined ? this.lat0 : 0;\n\n if (this.es) {\n this.en = pj_enfn(this.es);\n this.ml0 = pj_mlfn(this.lat0, Math.sin(this.lat0), Math.cos(this.lat0), this.en);\n }\n}\n\n/**\n Transverse Mercator Forward - long/lat to x/y\n long/lat in radians\n */\nexport function forward(p) {\n var lon = p.x;\n var lat = p.y;\n\n var delta_lon = adjust_lon(lon - this.long0);\n var con;\n var x, y;\n var sin_phi = Math.sin(lat);\n var cos_phi = Math.cos(lat);\n\n if (!this.es) {\n var b = cos_phi * Math.sin(delta_lon);\n\n if ((Math.abs(Math.abs(b) - 1)) < EPSLN) {\n return (93);\n }\n else {\n x = 0.5 * this.a * this.k0 * Math.log((1 + b) / (1 - b)) + this.x0;\n y = cos_phi * Math.cos(delta_lon) / Math.sqrt(1 - Math.pow(b, 2));\n b = Math.abs(y);\n\n if (b >= 1) {\n if ((b - 1) > EPSLN) {\n return (93);\n }\n else {\n y = 0;\n }\n }\n else {\n y = Math.acos(y);\n }\n\n if (lat < 0) {\n y = -y;\n }\n\n y = this.a * this.k0 * (y - this.lat0) + this.y0;\n }\n }\n else {\n var al = cos_phi * delta_lon;\n var als = Math.pow(al, 2);\n var c = this.ep2 * Math.pow(cos_phi, 2);\n var cs = Math.pow(c, 2);\n var tq = Math.abs(cos_phi) > EPSLN ? Math.tan(lat) : 0;\n var t = Math.pow(tq, 2);\n var ts = Math.pow(t, 2);\n con = 1 - this.es * Math.pow(sin_phi, 2);\n al = al / Math.sqrt(con);\n var ml = pj_mlfn(lat, sin_phi, cos_phi, this.en);\n\n x = this.a * (this.k0 * al * (1 +\n als / 6 * (1 - t + c +\n als / 20 * (5 - 18 * t + ts + 14 * c - 58 * t * c +\n als / 42 * (61 + 179 * ts - ts * t - 479 * t))))) +\n this.x0;\n\n y = this.a * (this.k0 * (ml - this.ml0 +\n sin_phi * delta_lon * al / 2 * (1 +\n als / 12 * (5 - t + 9 * c + 4 * cs +\n als / 30 * (61 + ts - 58 * t + 270 * c - 330 * t * c +\n als / 56 * (1385 + 543 * ts - ts * t - 3111 * t)))))) +\n this.y0;\n }\n\n p.x = x;\n p.y = y;\n\n return p;\n}\n\n/**\n Transverse Mercator Inverse - x/y to long/lat\n */\nexport function inverse(p) {\n var con, phi;\n var lat, lon;\n var x = (p.x - this.x0) * (1 / this.a);\n var y = (p.y - this.y0) * (1 / this.a);\n\n if (!this.es) {\n var f = Math.exp(x / this.k0);\n var g = 0.5 * (f - 1 / f);\n var temp = this.lat0 + y / this.k0;\n var h = Math.cos(temp);\n con = Math.sqrt((1 - Math.pow(h, 2)) / (1 + Math.pow(g, 2)));\n lat = Math.asin(con);\n\n if (y < 0) {\n lat = -lat;\n }\n\n if ((g === 0) && (h === 0)) {\n lon = 0;\n }\n else {\n lon = adjust_lon(Math.atan2(g, h) + this.long0);\n }\n }\n else { // ellipsoidal form\n con = this.ml0 + y / this.k0;\n phi = pj_inv_mlfn(con, this.es, this.en);\n\n if (Math.abs(phi) < HALF_PI) {\n var sin_phi = Math.sin(phi);\n var cos_phi = Math.cos(phi);\n var tan_phi = Math.abs(cos_phi) > EPSLN ? Math.tan(phi) : 0;\n var c = this.ep2 * Math.pow(cos_phi, 2);\n var cs = Math.pow(c, 2);\n var t = Math.pow(tan_phi, 2);\n var ts = Math.pow(t, 2);\n con = 1 - this.es * Math.pow(sin_phi, 2);\n var d = x * Math.sqrt(con) / this.k0;\n var ds = Math.pow(d, 2);\n con = con * tan_phi;\n\n lat = phi - (con * ds / (1 - this.es)) * 0.5 * (1 -\n ds / 12 * (5 + 3 * t - 9 * c * t + c - 4 * cs -\n ds / 30 * (61 + 90 * t - 252 * c * t + 45 * ts + 46 * c -\n ds / 56 * (1385 + 3633 * t + 4095 * ts + 1574 * ts * t))));\n\n lon = adjust_lon(this.long0 + (d * (1 -\n ds / 6 * (1 + 2 * t + c -\n ds / 20 * (5 + 28 * t + 24 * ts + 8 * c * t + 6 * c -\n ds / 42 * (61 + 662 * t + 1320 * ts + 720 * ts * t)))) / cos_phi));\n }\n else {\n lat = HALF_PI * sign(y);\n lon = 0;\n }\n }\n\n p.x = lon;\n p.y = lat;\n\n return p;\n}\n\nexport var names = [\"Fast_Transverse_Mercator\", \"Fast Transverse Mercator\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","export default function(x) {\n var r = Math.exp(x);\n r = (r - 1 / r) / 2;\n return r;\n}","export default function(x, y) {\n x = Math.abs(x);\n y = Math.abs(y);\n var a = Math.max(x, y);\n var b = Math.min(x, y) / (a ? a : 1);\n\n return a * Math.sqrt(1 + Math.pow(b, 2));\n}\n","export default function(x) {\n var y = 1 + x;\n var z = y - 1;\n\n return z === 0 ? x : x * Math.log(y) / z;\n}\n","import hypot from './hypot';\nimport log1py from './log1py';\n\nexport default function(x) {\n var y = Math.abs(x);\n y = log1py(y * (1 + y / (hypot(1, y) + 1)));\n\n return x < 0 ? -y : y;\n}\n","export default function(pp, B) {\n var cos_2B = 2 * Math.cos(2 * B);\n var i = pp.length - 1;\n var h1 = pp[i];\n var h2 = 0;\n var h;\n\n while (--i >= 0) {\n h = -h2 + cos_2B * h1 + pp[i];\n h2 = h1;\n h1 = h;\n }\n\n return (B + h * Math.sin(2 * B));\n}\n","export default function(pp, arg_r) {\n var r = 2 * Math.cos(arg_r);\n var i = pp.length - 1;\n var hr1 = pp[i];\n var hr2 = 0;\n var hr;\n\n while (--i >= 0) {\n hr = -hr2 + r * hr1 + pp[i];\n hr2 = hr1;\n hr1 = hr;\n }\n\n return Math.sin(arg_r) * hr;\n}\n","export default function(x) {\n var r = Math.exp(x);\n r = (r + 1 / r) / 2;\n return r;\n}","import sinh from './sinh';\nimport cosh from './cosh';\n\nexport default function(pp, arg_r, arg_i) {\n var sin_arg_r = Math.sin(arg_r);\n var cos_arg_r = Math.cos(arg_r);\n var sinh_arg_i = sinh(arg_i);\n var cosh_arg_i = cosh(arg_i);\n var r = 2 * cos_arg_r * cosh_arg_i;\n var i = -2 * sin_arg_r * sinh_arg_i;\n var j = pp.length - 1;\n var hr = pp[j];\n var hi1 = 0;\n var hr1 = 0;\n var hi = 0;\n var hr2;\n var hi2;\n\n while (--j >= 0) {\n hr2 = hr1;\n hi2 = hi1;\n hr1 = hr;\n hi1 = hi;\n hr = -hr2 + r * hr1 - i * hi1 + pp[j];\n hi = -hi2 + i * hr1 + r * hi1;\n }\n\n r = sin_arg_r * cosh_arg_i;\n i = cos_arg_r * sinh_arg_i;\n\n return [r * hr - i * hi, r * hi + i * hr];\n}\n","// Heavily based on this etmerc projection implementation\n// https://github.com/mbloch/mapshaper-proj/blob/master/src/projections/etmerc.js\n\nimport tmerc from '../projections/tmerc';\nimport sinh from '../common/sinh';\nimport hypot from '../common/hypot';\nimport asinhy from '../common/asinhy';\nimport gatg from '../common/gatg';\nimport clens from '../common/clens';\nimport clens_cmplx from '../common/clens_cmplx';\nimport adjust_lon from '../common/adjust_lon';\n\nexport function init() {\n if (!this.approx && (isNaN(this.es) || this.es <= 0)) {\n throw new Error('Incorrect elliptical usage. Try using the +approx option in the proj string, or PROJECTION[\"Fast_Transverse_Mercator\"] in the WKT.');\n }\n if (this.approx) {\n // When '+approx' is set, use tmerc instead\n tmerc.init.apply(this);\n this.forward = tmerc.forward;\n this.inverse = tmerc.inverse;\n }\n\n this.x0 = this.x0 !== undefined ? this.x0 : 0;\n this.y0 = this.y0 !== undefined ? this.y0 : 0;\n this.long0 = this.long0 !== undefined ? this.long0 : 0;\n this.lat0 = this.lat0 !== undefined ? this.lat0 : 0;\n\n this.cgb = [];\n this.cbg = [];\n this.utg = [];\n this.gtu = [];\n\n var f = this.es / (1 + Math.sqrt(1 - this.es));\n var n = f / (2 - f);\n var np = n;\n\n this.cgb[0] = n * (2 + n * (-2 / 3 + n * (-2 + n * (116 / 45 + n * (26 / 45 + n * (-2854 / 675 ))))));\n this.cbg[0] = n * (-2 + n * ( 2 / 3 + n * ( 4 / 3 + n * (-82 / 45 + n * (32 / 45 + n * (4642 / 4725))))));\n\n np = np * n;\n this.cgb[1] = np * (7 / 3 + n * (-8 / 5 + n * (-227 / 45 + n * (2704 / 315 + n * (2323 / 945)))));\n this.cbg[1] = np * (5 / 3 + n * (-16 / 15 + n * ( -13 / 9 + n * (904 / 315 + n * (-1522 / 945)))));\n\n np = np * n;\n this.cgb[2] = np * (56 / 15 + n * (-136 / 35 + n * (-1262 / 105 + n * (73814 / 2835))));\n this.cbg[2] = np * (-26 / 15 + n * (34 / 21 + n * (8 / 5 + n * (-12686 / 2835))));\n\n np = np * n;\n this.cgb[3] = np * (4279 / 630 + n * (-332 / 35 + n * (-399572 / 14175)));\n this.cbg[3] = np * (1237 / 630 + n * (-12 / 5 + n * ( -24832 / 14175)));\n\n np = np * n;\n this.cgb[4] = np * (4174 / 315 + n * (-144838 / 6237));\n this.cbg[4] = np * (-734 / 315 + n * (109598 / 31185));\n\n np = np * n;\n this.cgb[5] = np * (601676 / 22275);\n this.cbg[5] = np * (444337 / 155925);\n\n np = Math.pow(n, 2);\n this.Qn = this.k0 / (1 + n) * (1 + np * (1 / 4 + np * (1 / 64 + np / 256)));\n\n this.utg[0] = n * (-0.5 + n * ( 2 / 3 + n * (-37 / 96 + n * ( 1 / 360 + n * (81 / 512 + n * (-96199 / 604800))))));\n this.gtu[0] = n * (0.5 + n * (-2 / 3 + n * (5 / 16 + n * (41 / 180 + n * (-127 / 288 + n * (7891 / 37800))))));\n\n this.utg[1] = np * (-1 / 48 + n * (-1 / 15 + n * (437 / 1440 + n * (-46 / 105 + n * (1118711 / 3870720)))));\n this.gtu[1] = np * (13 / 48 + n * (-3 / 5 + n * (557 / 1440 + n * (281 / 630 + n * (-1983433 / 1935360)))));\n\n np = np * n;\n this.utg[2] = np * (-17 / 480 + n * (37 / 840 + n * (209 / 4480 + n * (-5569 / 90720 ))));\n this.gtu[2] = np * (61 / 240 + n * (-103 / 140 + n * (15061 / 26880 + n * (167603 / 181440))));\n\n np = np * n;\n this.utg[3] = np * (-4397 / 161280 + n * (11 / 504 + n * (830251 / 7257600)));\n this.gtu[3] = np * (49561 / 161280 + n * (-179 / 168 + n * (6601661 / 7257600)));\n\n np = np * n;\n this.utg[4] = np * (-4583 / 161280 + n * (108847 / 3991680));\n this.gtu[4] = np * (34729 / 80640 + n * (-3418889 / 1995840));\n\n np = np * n;\n this.utg[5] = np * (-20648693 / 638668800);\n this.gtu[5] = np * (212378941 / 319334400);\n\n var Z = gatg(this.cbg, this.lat0);\n this.Zb = -this.Qn * (Z + clens(this.gtu, 2 * Z));\n}\n\nexport function forward(p) {\n var Ce = adjust_lon(p.x - this.long0);\n var Cn = p.y;\n\n Cn = gatg(this.cbg, Cn);\n var sin_Cn = Math.sin(Cn);\n var cos_Cn = Math.cos(Cn);\n var sin_Ce = Math.sin(Ce);\n var cos_Ce = Math.cos(Ce);\n\n Cn = Math.atan2(sin_Cn, cos_Ce * cos_Cn);\n Ce = Math.atan2(sin_Ce * cos_Cn, hypot(sin_Cn, cos_Cn * cos_Ce));\n Ce = asinhy(Math.tan(Ce));\n\n var tmp = clens_cmplx(this.gtu, 2 * Cn, 2 * Ce);\n\n Cn = Cn + tmp[0];\n Ce = Ce + tmp[1];\n\n var x;\n var y;\n\n if (Math.abs(Ce) <= 2.623395162778) {\n x = this.a * (this.Qn * Ce) + this.x0;\n y = this.a * (this.Qn * Cn + this.Zb) + this.y0;\n }\n else {\n x = Infinity;\n y = Infinity;\n }\n\n p.x = x;\n p.y = y;\n\n return p;\n}\n\nexport function inverse(p) {\n var Ce = (p.x - this.x0) * (1 / this.a);\n var Cn = (p.y - this.y0) * (1 / this.a);\n\n Cn = (Cn - this.Zb) / this.Qn;\n Ce = Ce / this.Qn;\n\n var lon;\n var lat;\n\n if (Math.abs(Ce) <= 2.623395162778) {\n var tmp = clens_cmplx(this.utg, 2 * Cn, 2 * Ce);\n\n Cn = Cn + tmp[0];\n Ce = Ce + tmp[1];\n Ce = Math.atan(sinh(Ce));\n\n var sin_Cn = Math.sin(Cn);\n var cos_Cn = Math.cos(Cn);\n var sin_Ce = Math.sin(Ce);\n var cos_Ce = Math.cos(Ce);\n\n Cn = Math.atan2(sin_Cn * cos_Ce, hypot(sin_Ce, cos_Ce * cos_Cn));\n Ce = Math.atan2(sin_Ce, cos_Ce * cos_Cn);\n\n lon = adjust_lon(Ce + this.long0);\n lat = gatg(this.cgb, Cn);\n }\n else {\n lon = Infinity;\n lat = Infinity;\n }\n\n p.x = lon;\n p.y = lat;\n\n return p;\n}\n\nexport var names = [\"Extended_Transverse_Mercator\", \"Extended Transverse Mercator\", \"etmerc\", \"Transverse_Mercator\", \"Transverse Mercator\", \"Gauss Kruger\", \"Gauss_Kruger\", \"tmerc\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import adjust_lon from './adjust_lon';\n\nexport default function(zone, lon) {\n if (zone === undefined) {\n zone = Math.floor((adjust_lon(lon) + Math.PI) * 30 / Math.PI) + 1;\n\n if (zone < 0) {\n return 0;\n } else if (zone > 60) {\n return 60;\n }\n }\n return zone;\n}\n","import adjust_zone from '../common/adjust_zone';\nimport etmerc from './etmerc';\nexport var dependsOn = 'etmerc';\nimport {D2R} from '../constants/values';\n\n\nexport function init() {\n var zone = adjust_zone(this.zone, this.long0);\n if (zone === undefined) {\n throw new Error('unknown utm zone');\n }\n this.lat0 = 0;\n this.long0 = ((6 * Math.abs(zone)) - 183) * D2R;\n this.x0 = 500000;\n this.y0 = this.utmSouth ? 10000000 : 0;\n this.k0 = 0.9996;\n\n etmerc.init.apply(this);\n this.forward = etmerc.forward;\n this.inverse = etmerc.inverse;\n}\n\nexport var names = [\"Universal Transverse Mercator System\", \"utm\"];\nexport default {\n init: init,\n names: names,\n dependsOn: dependsOn\n};\n","export default function(esinp, exp) {\n return (Math.pow((1 - esinp) / (1 + esinp), exp));\n}","import srat from '../common/srat';\nvar MAX_ITER = 20;\nimport {HALF_PI, FORTPI} from '../constants/values';\n\nexport function init() {\n var sphi = Math.sin(this.lat0);\n var cphi = Math.cos(this.lat0);\n cphi *= cphi;\n this.rc = Math.sqrt(1 - this.es) / (1 - this.es * sphi * sphi);\n this.C = Math.sqrt(1 + this.es * cphi * cphi / (1 - this.es));\n this.phic0 = Math.asin(sphi / this.C);\n this.ratexp = 0.5 * this.C * this.e;\n this.K = Math.tan(0.5 * this.phic0 + FORTPI) / (Math.pow(Math.tan(0.5 * this.lat0 + FORTPI), this.C) * srat(this.e * sphi, this.ratexp));\n}\n\nexport function forward(p) {\n var lon = p.x;\n var lat = p.y;\n\n p.y = 2 * Math.atan(this.K * Math.pow(Math.tan(0.5 * lat + FORTPI), this.C) * srat(this.e * Math.sin(lat), this.ratexp)) - HALF_PI;\n p.x = this.C * lon;\n return p;\n}\n\nexport function inverse(p) {\n var DEL_TOL = 1e-14;\n var lon = p.x / this.C;\n var lat = p.y;\n var num = Math.pow(Math.tan(0.5 * lat + FORTPI) / this.K, 1 / this.C);\n for (var i = MAX_ITER; i > 0; --i) {\n lat = 2 * Math.atan(num * srat(this.e * Math.sin(p.y), - 0.5 * this.e)) - HALF_PI;\n if (Math.abs(lat - p.y) < DEL_TOL) {\n break;\n }\n p.y = lat;\n }\n /* convergence failed */\n if (!i) {\n return null;\n }\n p.x = lon;\n p.y = lat;\n return p;\n}\n\nexport var names = [\"gauss\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import gauss from './gauss';\nimport adjust_lon from '../common/adjust_lon';\nimport hypot from '../common/hypot';\n\nexport function init() {\n gauss.init.apply(this);\n if (!this.rc) {\n return;\n }\n this.sinc0 = Math.sin(this.phic0);\n this.cosc0 = Math.cos(this.phic0);\n this.R2 = 2 * this.rc;\n if (!this.title) {\n this.title = \"Oblique Stereographic Alternative\";\n }\n}\n\nexport function forward(p) {\n var sinc, cosc, cosl, k;\n p.x = adjust_lon(p.x - this.long0);\n gauss.forward.apply(this, [p]);\n sinc = Math.sin(p.y);\n cosc = Math.cos(p.y);\n cosl = Math.cos(p.x);\n k = this.k0 * this.R2 / (1 + this.sinc0 * sinc + this.cosc0 * cosc * cosl);\n p.x = k * cosc * Math.sin(p.x);\n p.y = k * (this.cosc0 * sinc - this.sinc0 * cosc * cosl);\n p.x = this.a * p.x + this.x0;\n p.y = this.a * p.y + this.y0;\n return p;\n}\n\nexport function inverse(p) {\n var sinc, cosc, lon, lat, rho;\n p.x = (p.x - this.x0) / this.a;\n p.y = (p.y - this.y0) / this.a;\n\n p.x /= this.k0;\n p.y /= this.k0;\n if ((rho = hypot(p.x, p.y))) {\n var c = 2 * Math.atan2(rho, this.R2);\n sinc = Math.sin(c);\n cosc = Math.cos(c);\n lat = Math.asin(cosc * this.sinc0 + p.y * sinc * this.cosc0 / rho);\n lon = Math.atan2(p.x * sinc, rho * this.cosc0 * cosc - p.y * this.sinc0 * sinc);\n }\n else {\n lat = this.phic0;\n lon = 0;\n }\n\n p.x = lon;\n p.y = lat;\n gauss.inverse.apply(this, [p]);\n p.x = adjust_lon(p.x + this.long0);\n return p;\n}\n\nexport var names = [\"Stereographic_North_Pole\", \"Oblique_Stereographic\", \"sterea\",\"Oblique Stereographic Alternative\",\"Double_Stereographic\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import {EPSLN, HALF_PI} from '../constants/values';\n\nimport sign from '../common/sign';\nimport msfnz from '../common/msfnz';\nimport tsfnz from '../common/tsfnz';\nimport phi2z from '../common/phi2z';\nimport adjust_lon from '../common/adjust_lon';\n\nexport function ssfn_(phit, sinphi, eccen) {\n sinphi *= eccen;\n return (Math.tan(0.5 * (HALF_PI + phit)) * Math.pow((1 - sinphi) / (1 + sinphi), 0.5 * eccen));\n}\n\nexport function init() {\n\n // setting default parameters\n this.x0 = this.x0 || 0;\n this.y0 = this.y0 || 0;\n this.lat0 = this.lat0 || 0;\n this.long0 = this.long0 || 0;\n\n this.coslat0 = Math.cos(this.lat0);\n this.sinlat0 = Math.sin(this.lat0);\n if (this.sphere) {\n if (this.k0 === 1 && !isNaN(this.lat_ts) && Math.abs(this.coslat0) <= EPSLN) {\n this.k0 = 0.5 * (1 + sign(this.lat0) * Math.sin(this.lat_ts));\n }\n }\n else {\n if (Math.abs(this.coslat0) <= EPSLN) {\n if (this.lat0 > 0) {\n //North pole\n //trace('stere:north pole');\n this.con = 1;\n }\n else {\n //South pole\n //trace('stere:south pole');\n this.con = -1;\n }\n }\n this.cons = Math.sqrt(Math.pow(1 + this.e, 1 + this.e) * Math.pow(1 - this.e, 1 - this.e));\n if (this.k0 === 1 && !isNaN(this.lat_ts) && Math.abs(this.coslat0) <= EPSLN && Math.abs(Math.cos(this.lat_ts)) > EPSLN) {\n // When k0 is 1 (default value) and lat_ts is a vaild number and lat0 is at a pole and lat_ts is not at a pole\n // Recalculate k0 using formula 21-35 from p161 of Snyder, 1987\n this.k0 = 0.5 * this.cons * msfnz(this.e, Math.sin(this.lat_ts), Math.cos(this.lat_ts)) / tsfnz(this.e, this.con * this.lat_ts, this.con * Math.sin(this.lat_ts));\n }\n this.ms1 = msfnz(this.e, this.sinlat0, this.coslat0);\n this.X0 = 2 * Math.atan(this.ssfn_(this.lat0, this.sinlat0, this.e)) - HALF_PI;\n this.cosX0 = Math.cos(this.X0);\n this.sinX0 = Math.sin(this.X0);\n }\n}\n\n// Stereographic forward equations--mapping lat,long to x,y\nexport function forward(p) {\n var lon = p.x;\n var lat = p.y;\n var sinlat = Math.sin(lat);\n var coslat = Math.cos(lat);\n var A, X, sinX, cosX, ts, rh;\n var dlon = adjust_lon(lon - this.long0);\n\n if (Math.abs(Math.abs(lon - this.long0) - Math.PI) <= EPSLN && Math.abs(lat + this.lat0) <= EPSLN) {\n //case of the origine point\n //trace('stere:this is the origin point');\n p.x = NaN;\n p.y = NaN;\n return p;\n }\n if (this.sphere) {\n //trace('stere:sphere case');\n A = 2 * this.k0 / (1 + this.sinlat0 * sinlat + this.coslat0 * coslat * Math.cos(dlon));\n p.x = this.a * A * coslat * Math.sin(dlon) + this.x0;\n p.y = this.a * A * (this.coslat0 * sinlat - this.sinlat0 * coslat * Math.cos(dlon)) + this.y0;\n return p;\n }\n else {\n X = 2 * Math.atan(this.ssfn_(lat, sinlat, this.e)) - HALF_PI;\n cosX = Math.cos(X);\n sinX = Math.sin(X);\n if (Math.abs(this.coslat0) <= EPSLN) {\n ts = tsfnz(this.e, lat * this.con, this.con * sinlat);\n rh = 2 * this.a * this.k0 * ts / this.cons;\n p.x = this.x0 + rh * Math.sin(lon - this.long0);\n p.y = this.y0 - this.con * rh * Math.cos(lon - this.long0);\n //trace(p.toString());\n return p;\n }\n else if (Math.abs(this.sinlat0) < EPSLN) {\n //Eq\n //trace('stere:equateur');\n A = 2 * this.a * this.k0 / (1 + cosX * Math.cos(dlon));\n p.y = A * sinX;\n }\n else {\n //other case\n //trace('stere:normal case');\n A = 2 * this.a * this.k0 * this.ms1 / (this.cosX0 * (1 + this.sinX0 * sinX + this.cosX0 * cosX * Math.cos(dlon)));\n p.y = A * (this.cosX0 * sinX - this.sinX0 * cosX * Math.cos(dlon)) + this.y0;\n }\n p.x = A * cosX * Math.sin(dlon) + this.x0;\n }\n //trace(p.toString());\n return p;\n}\n\n//* Stereographic inverse equations--mapping x,y to lat/long\nexport function inverse(p) {\n p.x -= this.x0;\n p.y -= this.y0;\n var lon, lat, ts, ce, Chi;\n var rh = Math.sqrt(p.x * p.x + p.y * p.y);\n if (this.sphere) {\n var c = 2 * Math.atan(rh / (2 * this.a * this.k0));\n lon = this.long0;\n lat = this.lat0;\n if (rh <= EPSLN) {\n p.x = lon;\n p.y = lat;\n return p;\n }\n lat = Math.asin(Math.cos(c) * this.sinlat0 + p.y * Math.sin(c) * this.coslat0 / rh);\n if (Math.abs(this.coslat0) < EPSLN) {\n if (this.lat0 > 0) {\n lon = adjust_lon(this.long0 + Math.atan2(p.x, - 1 * p.y));\n }\n else {\n lon = adjust_lon(this.long0 + Math.atan2(p.x, p.y));\n }\n }\n else {\n lon = adjust_lon(this.long0 + Math.atan2(p.x * Math.sin(c), rh * this.coslat0 * Math.cos(c) - p.y * this.sinlat0 * Math.sin(c)));\n }\n p.x = lon;\n p.y = lat;\n return p;\n }\n else {\n if (Math.abs(this.coslat0) <= EPSLN) {\n if (rh <= EPSLN) {\n lat = this.lat0;\n lon = this.long0;\n p.x = lon;\n p.y = lat;\n //trace(p.toString());\n return p;\n }\n p.x *= this.con;\n p.y *= this.con;\n ts = rh * this.cons / (2 * this.a * this.k0);\n lat = this.con * phi2z(this.e, ts);\n lon = this.con * adjust_lon(this.con * this.long0 + Math.atan2(p.x, - 1 * p.y));\n }\n else {\n ce = 2 * Math.atan(rh * this.cosX0 / (2 * this.a * this.k0 * this.ms1));\n lon = this.long0;\n if (rh <= EPSLN) {\n Chi = this.X0;\n }\n else {\n Chi = Math.asin(Math.cos(ce) * this.sinX0 + p.y * Math.sin(ce) * this.cosX0 / rh);\n lon = adjust_lon(this.long0 + Math.atan2(p.x * Math.sin(ce), rh * this.cosX0 * Math.cos(ce) - p.y * this.sinX0 * Math.sin(ce)));\n }\n lat = -1 * phi2z(this.e, Math.tan(0.5 * (HALF_PI + Chi)));\n }\n }\n p.x = lon;\n p.y = lat;\n\n //trace(p.toString());\n return p;\n\n}\n\nexport var names = [\"stere\", \"Stereographic_South_Pole\", \"Polar Stereographic (variant B)\", \"Polar_Stereographic\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names,\n ssfn_: ssfn_\n};\n","/*\n references:\n Formules et constantes pour le Calcul pour la\n projection cylindrique conforme à axe oblique et pour la transformation entre\n des systèmes de référence.\n http://www.swisstopo.admin.ch/internet/swisstopo/fr/home/topics/survey/sys/refsys/switzerland.parsysrelated1.31216.downloadList.77004.DownloadFile.tmp/swissprojectionfr.pdf\n */\n\nexport function init() {\n var phy0 = this.lat0;\n this.lambda0 = this.long0;\n var sinPhy0 = Math.sin(phy0);\n var semiMajorAxis = this.a;\n var invF = this.rf;\n var flattening = 1 / invF;\n var e2 = 2 * flattening - Math.pow(flattening, 2);\n var e = this.e = Math.sqrt(e2);\n this.R = this.k0 * semiMajorAxis * Math.sqrt(1 - e2) / (1 - e2 * Math.pow(sinPhy0, 2));\n this.alpha = Math.sqrt(1 + e2 / (1 - e2) * Math.pow(Math.cos(phy0), 4));\n this.b0 = Math.asin(sinPhy0 / this.alpha);\n var k1 = Math.log(Math.tan(Math.PI / 4 + this.b0 / 2));\n var k2 = Math.log(Math.tan(Math.PI / 4 + phy0 / 2));\n var k3 = Math.log((1 + e * sinPhy0) / (1 - e * sinPhy0));\n this.K = k1 - this.alpha * k2 + this.alpha * e / 2 * k3;\n}\n\nexport function forward(p) {\n var Sa1 = Math.log(Math.tan(Math.PI / 4 - p.y / 2));\n var Sa2 = this.e / 2 * Math.log((1 + this.e * Math.sin(p.y)) / (1 - this.e * Math.sin(p.y)));\n var S = -this.alpha * (Sa1 + Sa2) + this.K;\n\n // spheric latitude\n var b = 2 * (Math.atan(Math.exp(S)) - Math.PI / 4);\n\n // spheric longitude\n var I = this.alpha * (p.x - this.lambda0);\n\n // psoeudo equatorial rotation\n var rotI = Math.atan(Math.sin(I) / (Math.sin(this.b0) * Math.tan(b) + Math.cos(this.b0) * Math.cos(I)));\n\n var rotB = Math.asin(Math.cos(this.b0) * Math.sin(b) - Math.sin(this.b0) * Math.cos(b) * Math.cos(I));\n\n p.y = this.R / 2 * Math.log((1 + Math.sin(rotB)) / (1 - Math.sin(rotB))) + this.y0;\n p.x = this.R * rotI + this.x0;\n return p;\n}\n\nexport function inverse(p) {\n var Y = p.x - this.x0;\n var X = p.y - this.y0;\n\n var rotI = Y / this.R;\n var rotB = 2 * (Math.atan(Math.exp(X / this.R)) - Math.PI / 4);\n\n var b = Math.asin(Math.cos(this.b0) * Math.sin(rotB) + Math.sin(this.b0) * Math.cos(rotB) * Math.cos(rotI));\n var I = Math.atan(Math.sin(rotI) / (Math.cos(this.b0) * Math.cos(rotI) - Math.sin(this.b0) * Math.tan(rotB)));\n\n var lambda = this.lambda0 + I / this.alpha;\n\n var S = 0;\n var phy = b;\n var prevPhy = -1000;\n var iteration = 0;\n while (Math.abs(phy - prevPhy) > 0.0000001) {\n if (++iteration > 20) {\n //...reportError(\"omercFwdInfinity\");\n return;\n }\n //S = Math.log(Math.tan(Math.PI / 4 + phy / 2));\n S = 1 / this.alpha * (Math.log(Math.tan(Math.PI / 4 + b / 2)) - this.K) + this.e * Math.log(Math.tan(Math.PI / 4 + Math.asin(this.e * Math.sin(phy)) / 2));\n prevPhy = phy;\n phy = 2 * Math.atan(Math.exp(S)) - Math.PI / 2;\n }\n\n p.x = lambda;\n p.y = phy;\n return p;\n}\n\nexport var names = [\"somerc\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import tsfnz from '../common/tsfnz';\nimport adjust_lon from '../common/adjust_lon';\nimport phi2z from '../common/phi2z';\nimport { D2R, EPSLN, HALF_PI, TWO_PI, FORTPI } from '../constants/values';\n\nvar TOL = 1e-7;\n\nfunction isTypeA(P) {\n var typeAProjections = ['Hotine_Oblique_Mercator','Hotine_Oblique_Mercator_Azimuth_Natural_Origin'];\n var projectionName = typeof P.PROJECTION === \"object\" ? Object.keys(P.PROJECTION)[0] : P.PROJECTION;\n \n return 'no_uoff' in P || 'no_off' in P || typeAProjections.indexOf(projectionName) !== -1;\n}\n\n\n/* Initialize the Oblique Mercator projection\n ------------------------------------------*/\nexport function init() { \n var con, com, cosph0, D, F, H, L, sinph0, p, J, gamma = 0,\n gamma0, lamc = 0, lam1 = 0, lam2 = 0, phi1 = 0, phi2 = 0, alpha_c = 0, AB;\n \n // only Type A uses the no_off or no_uoff property\n // https://github.com/OSGeo/proj.4/issues/104\n this.no_off = isTypeA(this);\n this.no_rot = 'no_rot' in this;\n \n var alp = false;\n if (\"alpha\" in this) {\n alp = true;\n }\n\n var gam = false;\n if (\"rectified_grid_angle\" in this) {\n gam = true;\n }\n\n if (alp) {\n alpha_c = this.alpha;\n }\n \n if (gam) {\n gamma = (this.rectified_grid_angle * D2R);\n }\n \n if (alp || gam) {\n lamc = this.longc;\n } else {\n lam1 = this.long1;\n phi1 = this.lat1;\n lam2 = this.long2;\n phi2 = this.lat2;\n \n if (Math.abs(phi1 - phi2) <= TOL || (con = Math.abs(phi1)) <= TOL ||\n Math.abs(con - HALF_PI) <= TOL || Math.abs(Math.abs(this.lat0) - HALF_PI) <= TOL ||\n Math.abs(Math.abs(phi2) - HALF_PI) <= TOL) {\n throw new Error();\n }\n }\n \n var one_es = 1.0 - this.es;\n com = Math.sqrt(one_es);\n \n if (Math.abs(this.lat0) > EPSLN) {\n sinph0 = Math.sin(this.lat0);\n cosph0 = Math.cos(this.lat0);\n con = 1 - this.es * sinph0 * sinph0;\n this.B = cosph0 * cosph0;\n this.B = Math.sqrt(1 + this.es * this.B * this.B / one_es);\n this.A = this.B * this.k0 * com / con;\n D = this.B * com / (cosph0 * Math.sqrt(con));\n F = D * D -1;\n \n if (F <= 0) {\n F = 0;\n } else {\n F = Math.sqrt(F);\n if (this.lat0 < 0) {\n F = -F;\n }\n }\n \n this.E = F += D;\n this.E *= Math.pow(tsfnz(this.e, this.lat0, sinph0), this.B);\n } else {\n this.B = 1 / com;\n this.A = this.k0;\n this.E = D = F = 1;\n }\n \n if (alp || gam) {\n if (alp) {\n gamma0 = Math.asin(Math.sin(alpha_c) / D);\n if (!gam) {\n gamma = alpha_c;\n }\n } else {\n gamma0 = gamma;\n alpha_c = Math.asin(D * Math.sin(gamma0));\n }\n this.lam0 = lamc - Math.asin(0.5 * (F - 1 / F) * Math.tan(gamma0)) / this.B;\n } else {\n H = Math.pow(tsfnz(this.e, phi1, Math.sin(phi1)), this.B);\n L = Math.pow(tsfnz(this.e, phi2, Math.sin(phi2)), this.B);\n F = this.E / H;\n p = (L - H) / (L + H);\n J = this.E * this.E;\n J = (J - L * H) / (J + L * H);\n con = lam1 - lam2;\n \n if (con < -Math.pi) {\n lam2 -=TWO_PI;\n } else if (con > Math.pi) {\n lam2 += TWO_PI;\n }\n \n this.lam0 = adjust_lon(0.5 * (lam1 + lam2) - Math.atan(J * Math.tan(0.5 * this.B * (lam1 - lam2)) / p) / this.B);\n gamma0 = Math.atan(2 * Math.sin(this.B * adjust_lon(lam1 - this.lam0)) / (F - 1 / F));\n gamma = alpha_c = Math.asin(D * Math.sin(gamma0));\n }\n \n this.singam = Math.sin(gamma0);\n this.cosgam = Math.cos(gamma0);\n this.sinrot = Math.sin(gamma);\n this.cosrot = Math.cos(gamma);\n \n this.rB = 1 / this.B;\n this.ArB = this.A * this.rB;\n this.BrA = 1 / this.ArB;\n AB = this.A * this.B;\n \n if (this.no_off) {\n this.u_0 = 0;\n } else {\n this.u_0 = Math.abs(this.ArB * Math.atan(Math.sqrt(D * D - 1) / Math.cos(alpha_c)));\n \n if (this.lat0 < 0) {\n this.u_0 = - this.u_0;\n } \n }\n \n F = 0.5 * gamma0;\n this.v_pole_n = this.ArB * Math.log(Math.tan(FORTPI - F));\n this.v_pole_s = this.ArB * Math.log(Math.tan(FORTPI + F));\n}\n\n\n/* Oblique Mercator forward equations--mapping lat,long to x,y\n ----------------------------------------------------------*/\nexport function forward(p) {\n var coords = {};\n var S, T, U, V, W, temp, u, v;\n p.x = p.x - this.lam0;\n \n if (Math.abs(Math.abs(p.y) - HALF_PI) > EPSLN) {\n W = this.E / Math.pow(tsfnz(this.e, p.y, Math.sin(p.y)), this.B);\n \n temp = 1 / W;\n S = 0.5 * (W - temp);\n T = 0.5 * (W + temp);\n V = Math.sin(this.B * p.x);\n U = (S * this.singam - V * this.cosgam) / T;\n \n if (Math.abs(Math.abs(U) - 1.0) < EPSLN) {\n throw new Error();\n }\n \n v = 0.5 * this.ArB * Math.log((1 - U)/(1 + U));\n temp = Math.cos(this.B * p.x);\n \n if (Math.abs(temp) < TOL) {\n u = this.A * p.x;\n } else {\n u = this.ArB * Math.atan2((S * this.cosgam + V * this.singam), temp);\n } \n } else {\n v = p.y > 0 ? this.v_pole_n : this.v_pole_s;\n u = this.ArB * p.y;\n }\n \n if (this.no_rot) {\n coords.x = u;\n coords.y = v;\n } else {\n u -= this.u_0;\n coords.x = v * this.cosrot + u * this.sinrot;\n coords.y = u * this.cosrot - v * this.sinrot;\n }\n \n coords.x = (this.a * coords.x + this.x0);\n coords.y = (this.a * coords.y + this.y0);\n \n return coords;\n}\n\nexport function inverse(p) {\n var u, v, Qp, Sp, Tp, Vp, Up;\n var coords = {};\n \n p.x = (p.x - this.x0) * (1.0 / this.a);\n p.y = (p.y - this.y0) * (1.0 / this.a);\n\n if (this.no_rot) {\n v = p.y;\n u = p.x;\n } else {\n v = p.x * this.cosrot - p.y * this.sinrot;\n u = p.y * this.cosrot + p.x * this.sinrot + this.u_0;\n }\n \n Qp = Math.exp(-this.BrA * v);\n Sp = 0.5 * (Qp - 1 / Qp);\n Tp = 0.5 * (Qp + 1 / Qp);\n Vp = Math.sin(this.BrA * u);\n Up = (Vp * this.cosgam + Sp * this.singam) / Tp;\n \n if (Math.abs(Math.abs(Up) - 1) < EPSLN) {\n coords.x = 0;\n coords.y = Up < 0 ? -HALF_PI : HALF_PI;\n } else {\n coords.y = this.E / Math.sqrt((1 + Up) / (1 - Up));\n coords.y = phi2z(this.e, Math.pow(coords.y, 1 / this.B));\n \n if (coords.y === Infinity) {\n throw new Error();\n }\n \n coords.x = -this.rB * Math.atan2((Sp * this.cosgam - Vp * this.singam), Math.cos(this.BrA * u));\n }\n \n coords.x += this.lam0;\n \n return coords;\n}\n\nexport var names = [\"Hotine_Oblique_Mercator\", \"Hotine Oblique Mercator\", \"Hotine_Oblique_Mercator_Azimuth_Natural_Origin\", \"Hotine_Oblique_Mercator_Two_Point_Natural_Origin\", \"Hotine_Oblique_Mercator_Azimuth_Center\", \"Oblique_Mercator\", \"omerc\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import msfnz from '../common/msfnz';\nimport tsfnz from '../common/tsfnz';\nimport sign from '../common/sign';\nimport adjust_lon from '../common/adjust_lon';\nimport phi2z from '../common/phi2z';\nimport {HALF_PI, EPSLN} from '../constants/values';\nexport function init() {\n \n //double lat0; /* the reference latitude */\n //double long0; /* the reference longitude */\n //double lat1; /* first standard parallel */\n //double lat2; /* second standard parallel */\n //double r_maj; /* major axis */\n //double r_min; /* minor axis */\n //double false_east; /* x offset in meters */\n //double false_north; /* y offset in meters */\n \n //the above value can be set with proj4.defs\n //example: proj4.defs(\"EPSG:2154\",\"+proj=lcc +lat_1=49 +lat_2=44 +lat_0=46.5 +lon_0=3 +x_0=700000 +y_0=6600000 +ellps=GRS80 +towgs84=0,0,0,0,0,0,0 +units=m +no_defs\");\n\n if (!this.lat2) {\n this.lat2 = this.lat1;\n } //if lat2 is not defined\n if (!this.k0) {\n this.k0 = 1;\n }\n this.x0 = this.x0 || 0;\n this.y0 = this.y0 || 0;\n // Standard Parallels cannot be equal and on opposite sides of the equator\n if (Math.abs(this.lat1 + this.lat2) < EPSLN) {\n return;\n }\n\n var temp = this.b / this.a;\n this.e = Math.sqrt(1 - temp * temp);\n\n var sin1 = Math.sin(this.lat1);\n var cos1 = Math.cos(this.lat1);\n var ms1 = msfnz(this.e, sin1, cos1);\n var ts1 = tsfnz(this.e, this.lat1, sin1);\n\n var sin2 = Math.sin(this.lat2);\n var cos2 = Math.cos(this.lat2);\n var ms2 = msfnz(this.e, sin2, cos2);\n var ts2 = tsfnz(this.e, this.lat2, sin2);\n\n var ts0 = tsfnz(this.e, this.lat0, Math.sin(this.lat0));\n\n if (Math.abs(this.lat1 - this.lat2) > EPSLN) {\n this.ns = Math.log(ms1 / ms2) / Math.log(ts1 / ts2);\n }\n else {\n this.ns = sin1;\n }\n if (isNaN(this.ns)) {\n this.ns = sin1;\n }\n this.f0 = ms1 / (this.ns * Math.pow(ts1, this.ns));\n this.rh = this.a * this.f0 * Math.pow(ts0, this.ns);\n if (!this.title) {\n this.title = \"Lambert Conformal Conic\";\n }\n}\n\n// Lambert Conformal conic forward equations--mapping lat,long to x,y\n// -----------------------------------------------------------------\nexport function forward(p) {\n\n var lon = p.x;\n var lat = p.y;\n\n // singular cases :\n if (Math.abs(2 * Math.abs(lat) - Math.PI) <= EPSLN) {\n lat = sign(lat) * (HALF_PI - 2 * EPSLN);\n }\n\n var con = Math.abs(Math.abs(lat) - HALF_PI);\n var ts, rh1;\n if (con > EPSLN) {\n ts = tsfnz(this.e, lat, Math.sin(lat));\n rh1 = this.a * this.f0 * Math.pow(ts, this.ns);\n }\n else {\n con = lat * this.ns;\n if (con <= 0) {\n return null;\n }\n rh1 = 0;\n }\n var theta = this.ns * adjust_lon(lon - this.long0);\n p.x = this.k0 * (rh1 * Math.sin(theta)) + this.x0;\n p.y = this.k0 * (this.rh - rh1 * Math.cos(theta)) + this.y0;\n\n return p;\n}\n\n// Lambert Conformal Conic inverse equations--mapping x,y to lat/long\n// -----------------------------------------------------------------\nexport function inverse(p) {\n\n var rh1, con, ts;\n var lat, lon;\n var x = (p.x - this.x0) / this.k0;\n var y = (this.rh - (p.y - this.y0) / this.k0);\n if (this.ns > 0) {\n rh1 = Math.sqrt(x * x + y * y);\n con = 1;\n }\n else {\n rh1 = -Math.sqrt(x * x + y * y);\n con = -1;\n }\n var theta = 0;\n if (rh1 !== 0) {\n theta = Math.atan2((con * x), (con * y));\n }\n if ((rh1 !== 0) || (this.ns > 0)) {\n con = 1 / this.ns;\n ts = Math.pow((rh1 / (this.a * this.f0)), con);\n lat = phi2z(this.e, ts);\n if (lat === -9999) {\n return null;\n }\n }\n else {\n lat = -HALF_PI;\n }\n lon = adjust_lon(theta / this.ns + this.long0);\n\n p.x = lon;\n p.y = lat;\n return p;\n}\n\nexport var names = [\n \"Lambert Tangential Conformal Conic Projection\",\n \"Lambert_Conformal_Conic\",\n \"Lambert_Conformal_Conic_1SP\",\n \"Lambert_Conformal_Conic_2SP\",\n \"lcc\",\n \"Lambert Conic Conformal (1SP)\",\n \"Lambert Conic Conformal (2SP)\"\n];\n\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import adjust_lon from '../common/adjust_lon';\n\nexport function init() {\n this.a = 6377397.155;\n this.es = 0.006674372230614;\n this.e = Math.sqrt(this.es);\n if (!this.lat0) {\n this.lat0 = 0.863937979737193;\n }\n if (!this.long0) {\n this.long0 = 0.7417649320975901 - 0.308341501185665;\n }\n /* if scale not set default to 0.9999 */\n if (!this.k0) {\n this.k0 = 0.9999;\n }\n this.s45 = 0.785398163397448; /* 45 */\n this.s90 = 2 * this.s45;\n this.fi0 = this.lat0;\n this.e2 = this.es;\n this.e = Math.sqrt(this.e2);\n this.alfa = Math.sqrt(1 + (this.e2 * Math.pow(Math.cos(this.fi0), 4)) / (1 - this.e2));\n this.uq = 1.04216856380474;\n this.u0 = Math.asin(Math.sin(this.fi0) / this.alfa);\n this.g = Math.pow((1 + this.e * Math.sin(this.fi0)) / (1 - this.e * Math.sin(this.fi0)), this.alfa * this.e / 2);\n this.k = Math.tan(this.u0 / 2 + this.s45) / Math.pow(Math.tan(this.fi0 / 2 + this.s45), this.alfa) * this.g;\n this.k1 = this.k0;\n this.n0 = this.a * Math.sqrt(1 - this.e2) / (1 - this.e2 * Math.pow(Math.sin(this.fi0), 2));\n this.s0 = 1.37008346281555;\n this.n = Math.sin(this.s0);\n this.ro0 = this.k1 * this.n0 / Math.tan(this.s0);\n this.ad = this.s90 - this.uq;\n}\n\n/* ellipsoid */\n/* calculate xy from lat/lon */\n/* Constants, identical to inverse transform function */\nexport function forward(p) {\n var gfi, u, deltav, s, d, eps, ro;\n var lon = p.x;\n var lat = p.y;\n var delta_lon = adjust_lon(lon - this.long0);\n /* Transformation */\n gfi = Math.pow(((1 + this.e * Math.sin(lat)) / (1 - this.e * Math.sin(lat))), (this.alfa * this.e / 2));\n u = 2 * (Math.atan(this.k * Math.pow(Math.tan(lat / 2 + this.s45), this.alfa) / gfi) - this.s45);\n deltav = -delta_lon * this.alfa;\n s = Math.asin(Math.cos(this.ad) * Math.sin(u) + Math.sin(this.ad) * Math.cos(u) * Math.cos(deltav));\n d = Math.asin(Math.cos(u) * Math.sin(deltav) / Math.cos(s));\n eps = this.n * d;\n ro = this.ro0 * Math.pow(Math.tan(this.s0 / 2 + this.s45), this.n) / Math.pow(Math.tan(s / 2 + this.s45), this.n);\n p.y = ro * Math.cos(eps) / 1;\n p.x = ro * Math.sin(eps) / 1;\n\n if (!this.czech) {\n p.y *= -1;\n p.x *= -1;\n }\n return (p);\n}\n\n/* calculate lat/lon from xy */\nexport function inverse(p) {\n var u, deltav, s, d, eps, ro, fi1;\n var ok;\n\n /* Transformation */\n /* revert y, x*/\n var tmp = p.x;\n p.x = p.y;\n p.y = tmp;\n if (!this.czech) {\n p.y *= -1;\n p.x *= -1;\n }\n ro = Math.sqrt(p.x * p.x + p.y * p.y);\n eps = Math.atan2(p.y, p.x);\n d = eps / Math.sin(this.s0);\n s = 2 * (Math.atan(Math.pow(this.ro0 / ro, 1 / this.n) * Math.tan(this.s0 / 2 + this.s45)) - this.s45);\n u = Math.asin(Math.cos(this.ad) * Math.sin(s) - Math.sin(this.ad) * Math.cos(s) * Math.cos(d));\n deltav = Math.asin(Math.cos(s) * Math.sin(d) / Math.cos(u));\n p.x = this.long0 - deltav / this.alfa;\n fi1 = u;\n ok = 0;\n var iter = 0;\n do {\n p.y = 2 * (Math.atan(Math.pow(this.k, - 1 / this.alfa) * Math.pow(Math.tan(u / 2 + this.s45), 1 / this.alfa) * Math.pow((1 + this.e * Math.sin(fi1)) / (1 - this.e * Math.sin(fi1)), this.e / 2)) - this.s45);\n if (Math.abs(fi1 - p.y) < 0.0000000001) {\n ok = 1;\n }\n fi1 = p.y;\n iter += 1;\n } while (ok === 0 && iter < 15);\n if (iter >= 15) {\n return null;\n }\n\n return (p);\n}\n\nexport var names = [\"Krovak\", \"krovak\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","export default function(e0, e1, e2, e3, phi) {\n return (e0 * phi - e1 * Math.sin(2 * phi) + e2 * Math.sin(4 * phi) - e3 * Math.sin(6 * phi));\n}","export default function(x) {\n return (1 - 0.25 * x * (1 + x / 16 * (3 + 1.25 * x)));\n}","export default function(x) {\n return (0.375 * x * (1 + 0.25 * x * (1 + 0.46875 * x)));\n}","export default function(x) {\n return (0.05859375 * x * x * (1 + 0.75 * x));\n}","export default function(x) {\n return (x * x * x * (35 / 3072));\n}","export default function(a, e, sinphi) {\n var temp = e * sinphi;\n return a / Math.sqrt(1 - temp * temp);\n}","import {HALF_PI} from '../constants/values';\nimport sign from './sign';\n\nexport default function(x) {\n return (Math.abs(x) < HALF_PI) ? x : (x - (sign(x) * Math.PI));\n}\n","export default function(ml, e0, e1, e2, e3) {\n var phi;\n var dphi;\n\n phi = ml / e0;\n for (var i = 0; i < 15; i++) {\n dphi = (ml - (e0 * phi - e1 * Math.sin(2 * phi) + e2 * Math.sin(4 * phi) - e3 * Math.sin(6 * phi))) / (e0 - 2 * e1 * Math.cos(2 * phi) + 4 * e2 * Math.cos(4 * phi) - 6 * e3 * Math.cos(6 * phi));\n phi += dphi;\n if (Math.abs(dphi) <= 0.0000000001) {\n return phi;\n }\n }\n\n //..reportError(\"IMLFN-CONV:Latitude failed to converge after 15 iterations\");\n return NaN;\n}","import mlfn from '../common/mlfn';\nimport e0fn from '../common/e0fn';\nimport e1fn from '../common/e1fn';\nimport e2fn from '../common/e2fn';\nimport e3fn from '../common/e3fn';\nimport gN from '../common/gN';\nimport adjust_lon from '../common/adjust_lon';\nimport adjust_lat from '../common/adjust_lat';\nimport imlfn from '../common/imlfn';\nimport {HALF_PI, EPSLN} from '../constants/values';\n\nexport function init() {\n if (!this.sphere) {\n this.e0 = e0fn(this.es);\n this.e1 = e1fn(this.es);\n this.e2 = e2fn(this.es);\n this.e3 = e3fn(this.es);\n this.ml0 = this.a * mlfn(this.e0, this.e1, this.e2, this.e3, this.lat0);\n }\n}\n\n/* Cassini forward equations--mapping lat,long to x,y\n -----------------------------------------------------------------------*/\nexport function forward(p) {\n\n /* Forward equations\n -----------------*/\n var x, y;\n var lam = p.x;\n var phi = p.y;\n lam = adjust_lon(lam - this.long0);\n\n if (this.sphere) {\n x = this.a * Math.asin(Math.cos(phi) * Math.sin(lam));\n y = this.a * (Math.atan2(Math.tan(phi), Math.cos(lam)) - this.lat0);\n }\n else {\n //ellipsoid\n var sinphi = Math.sin(phi);\n var cosphi = Math.cos(phi);\n var nl = gN(this.a, this.e, sinphi);\n var tl = Math.tan(phi) * Math.tan(phi);\n var al = lam * Math.cos(phi);\n var asq = al * al;\n var cl = this.es * cosphi * cosphi / (1 - this.es);\n var ml = this.a * mlfn(this.e0, this.e1, this.e2, this.e3, phi);\n\n x = nl * al * (1 - asq * tl * (1 / 6 - (8 - tl + 8 * cl) * asq / 120));\n y = ml - this.ml0 + nl * sinphi / cosphi * asq * (0.5 + (5 - tl + 6 * cl) * asq / 24);\n\n\n }\n\n p.x = x + this.x0;\n p.y = y + this.y0;\n return p;\n}\n\n/* Inverse equations\n -----------------*/\nexport function inverse(p) {\n p.x -= this.x0;\n p.y -= this.y0;\n var x = p.x / this.a;\n var y = p.y / this.a;\n var phi, lam;\n\n if (this.sphere) {\n var dd = y + this.lat0;\n phi = Math.asin(Math.sin(dd) * Math.cos(x));\n lam = Math.atan2(Math.tan(x), Math.cos(dd));\n }\n else {\n /* ellipsoid */\n var ml1 = this.ml0 / this.a + y;\n var phi1 = imlfn(ml1, this.e0, this.e1, this.e2, this.e3);\n if (Math.abs(Math.abs(phi1) - HALF_PI) <= EPSLN) {\n p.x = this.long0;\n p.y = HALF_PI;\n if (y < 0) {\n p.y *= -1;\n }\n return p;\n }\n var nl1 = gN(this.a, this.e, Math.sin(phi1));\n\n var rl1 = nl1 * nl1 * nl1 / this.a / this.a * (1 - this.es);\n var tl1 = Math.pow(Math.tan(phi1), 2);\n var dl = x * this.a / nl1;\n var dsq = dl * dl;\n phi = phi1 - nl1 * Math.tan(phi1) / rl1 * dl * dl * (0.5 - (1 + 3 * tl1) * dl * dl / 24);\n lam = dl * (1 - dsq * (tl1 / 3 + (1 + 3 * tl1) * tl1 * dsq / 15)) / Math.cos(phi1);\n\n }\n\n p.x = adjust_lon(lam + this.long0);\n p.y = adjust_lat(phi);\n return p;\n\n}\n\nexport var names = [\"Cassini\", \"Cassini_Soldner\", \"cass\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","export default function(eccent, sinphi) {\n var con;\n if (eccent > 1.0e-7) {\n con = eccent * sinphi;\n return ((1 - eccent * eccent) * (sinphi / (1 - con * con) - (0.5 / eccent) * Math.log((1 - con) / (1 + con))));\n }\n else {\n return (2 * sinphi);\n }\n}","\nimport {HALF_PI, EPSLN, FORTPI} from '../constants/values';\n\nimport qsfnz from '../common/qsfnz';\nimport adjust_lon from '../common/adjust_lon';\n\n/*\n reference\n \"New Equal-Area Map Projections for Noncircular Regions\", John P. Snyder,\n The American Cartographer, Vol 15, No. 4, October 1988, pp. 341-355.\n */\n\nexport var S_POLE = 1;\n\nexport var N_POLE = 2;\nexport var EQUIT = 3;\nexport var OBLIQ = 4;\n\n/* Initialize the Lambert Azimuthal Equal Area projection\n ------------------------------------------------------*/\nexport function init() {\n var t = Math.abs(this.lat0);\n if (Math.abs(t - HALF_PI) < EPSLN) {\n this.mode = this.lat0 < 0 ? this.S_POLE : this.N_POLE;\n }\n else if (Math.abs(t) < EPSLN) {\n this.mode = this.EQUIT;\n }\n else {\n this.mode = this.OBLIQ;\n }\n if (this.es > 0) {\n var sinphi;\n\n this.qp = qsfnz(this.e, 1);\n this.mmf = 0.5 / (1 - this.es);\n this.apa = authset(this.es);\n switch (this.mode) {\n case this.N_POLE:\n this.dd = 1;\n break;\n case this.S_POLE:\n this.dd = 1;\n break;\n case this.EQUIT:\n this.rq = Math.sqrt(0.5 * this.qp);\n this.dd = 1 / this.rq;\n this.xmf = 1;\n this.ymf = 0.5 * this.qp;\n break;\n case this.OBLIQ:\n this.rq = Math.sqrt(0.5 * this.qp);\n sinphi = Math.sin(this.lat0);\n this.sinb1 = qsfnz(this.e, sinphi) / this.qp;\n this.cosb1 = Math.sqrt(1 - this.sinb1 * this.sinb1);\n this.dd = Math.cos(this.lat0) / (Math.sqrt(1 - this.es * sinphi * sinphi) * this.rq * this.cosb1);\n this.ymf = (this.xmf = this.rq) / this.dd;\n this.xmf *= this.dd;\n break;\n }\n }\n else {\n if (this.mode === this.OBLIQ) {\n this.sinph0 = Math.sin(this.lat0);\n this.cosph0 = Math.cos(this.lat0);\n }\n }\n}\n\n/* Lambert Azimuthal Equal Area forward equations--mapping lat,long to x,y\n -----------------------------------------------------------------------*/\nexport function forward(p) {\n\n /* Forward equations\n -----------------*/\n var x, y, coslam, sinlam, sinphi, q, sinb, cosb, b, cosphi;\n var lam = p.x;\n var phi = p.y;\n\n lam = adjust_lon(lam - this.long0);\n if (this.sphere) {\n sinphi = Math.sin(phi);\n cosphi = Math.cos(phi);\n coslam = Math.cos(lam);\n if (this.mode === this.OBLIQ || this.mode === this.EQUIT) {\n y = (this.mode === this.EQUIT) ? 1 + cosphi * coslam : 1 + this.sinph0 * sinphi + this.cosph0 * cosphi * coslam;\n if (y <= EPSLN) {\n return null;\n }\n y = Math.sqrt(2 / y);\n x = y * cosphi * Math.sin(lam);\n y *= (this.mode === this.EQUIT) ? sinphi : this.cosph0 * sinphi - this.sinph0 * cosphi * coslam;\n }\n else if (this.mode === this.N_POLE || this.mode === this.S_POLE) {\n if (this.mode === this.N_POLE) {\n coslam = -coslam;\n }\n if (Math.abs(phi + this.lat0) < EPSLN) {\n return null;\n }\n y = FORTPI - phi * 0.5;\n y = 2 * ((this.mode === this.S_POLE) ? Math.cos(y) : Math.sin(y));\n x = y * Math.sin(lam);\n y *= coslam;\n }\n }\n else {\n sinb = 0;\n cosb = 0;\n b = 0;\n coslam = Math.cos(lam);\n sinlam = Math.sin(lam);\n sinphi = Math.sin(phi);\n q = qsfnz(this.e, sinphi);\n if (this.mode === this.OBLIQ || this.mode === this.EQUIT) {\n sinb = q / this.qp;\n cosb = Math.sqrt(1 - sinb * sinb);\n }\n switch (this.mode) {\n case this.OBLIQ:\n b = 1 + this.sinb1 * sinb + this.cosb1 * cosb * coslam;\n break;\n case this.EQUIT:\n b = 1 + cosb * coslam;\n break;\n case this.N_POLE:\n b = HALF_PI + phi;\n q = this.qp - q;\n break;\n case this.S_POLE:\n b = phi - HALF_PI;\n q = this.qp + q;\n break;\n }\n if (Math.abs(b) < EPSLN) {\n return null;\n }\n switch (this.mode) {\n case this.OBLIQ:\n case this.EQUIT:\n b = Math.sqrt(2 / b);\n if (this.mode === this.OBLIQ) {\n y = this.ymf * b * (this.cosb1 * sinb - this.sinb1 * cosb * coslam);\n }\n else {\n y = (b = Math.sqrt(2 / (1 + cosb * coslam))) * sinb * this.ymf;\n }\n x = this.xmf * b * cosb * sinlam;\n break;\n case this.N_POLE:\n case this.S_POLE:\n if (q >= 0) {\n x = (b = Math.sqrt(q)) * sinlam;\n y = coslam * ((this.mode === this.S_POLE) ? b : -b);\n }\n else {\n x = y = 0;\n }\n break;\n }\n }\n\n p.x = this.a * x + this.x0;\n p.y = this.a * y + this.y0;\n return p;\n}\n\n/* Inverse equations\n -----------------*/\nexport function inverse(p) {\n p.x -= this.x0;\n p.y -= this.y0;\n var x = p.x / this.a;\n var y = p.y / this.a;\n var lam, phi, cCe, sCe, q, rho, ab;\n if (this.sphere) {\n var cosz = 0,\n rh, sinz = 0;\n\n rh = Math.sqrt(x * x + y * y);\n phi = rh * 0.5;\n if (phi > 1) {\n return null;\n }\n phi = 2 * Math.asin(phi);\n if (this.mode === this.OBLIQ || this.mode === this.EQUIT) {\n sinz = Math.sin(phi);\n cosz = Math.cos(phi);\n }\n switch (this.mode) {\n case this.EQUIT:\n phi = (Math.abs(rh) <= EPSLN) ? 0 : Math.asin(y * sinz / rh);\n x *= sinz;\n y = cosz * rh;\n break;\n case this.OBLIQ:\n phi = (Math.abs(rh) <= EPSLN) ? this.lat0 : Math.asin(cosz * this.sinph0 + y * sinz * this.cosph0 / rh);\n x *= sinz * this.cosph0;\n y = (cosz - Math.sin(phi) * this.sinph0) * rh;\n break;\n case this.N_POLE:\n y = -y;\n phi = HALF_PI - phi;\n break;\n case this.S_POLE:\n phi -= HALF_PI;\n break;\n }\n lam = (y === 0 && (this.mode === this.EQUIT || this.mode === this.OBLIQ)) ? 0 : Math.atan2(x, y);\n }\n else {\n ab = 0;\n if (this.mode === this.OBLIQ || this.mode === this.EQUIT) {\n x /= this.dd;\n y *= this.dd;\n rho = Math.sqrt(x * x + y * y);\n if (rho < EPSLN) {\n p.x = this.long0;\n p.y = this.lat0;\n return p;\n }\n sCe = 2 * Math.asin(0.5 * rho / this.rq);\n cCe = Math.cos(sCe);\n x *= (sCe = Math.sin(sCe));\n if (this.mode === this.OBLIQ) {\n ab = cCe * this.sinb1 + y * sCe * this.cosb1 / rho;\n q = this.qp * ab;\n y = rho * this.cosb1 * cCe - y * this.sinb1 * sCe;\n }\n else {\n ab = y * sCe / rho;\n q = this.qp * ab;\n y = rho * cCe;\n }\n }\n else if (this.mode === this.N_POLE || this.mode === this.S_POLE) {\n if (this.mode === this.N_POLE) {\n y = -y;\n }\n q = (x * x + y * y);\n if (!q) {\n p.x = this.long0;\n p.y = this.lat0;\n return p;\n }\n ab = 1 - q / this.qp;\n if (this.mode === this.S_POLE) {\n ab = -ab;\n }\n }\n lam = Math.atan2(x, y);\n phi = authlat(Math.asin(ab), this.apa);\n }\n\n p.x = adjust_lon(this.long0 + lam);\n p.y = phi;\n return p;\n}\n\n/* determine latitude from authalic latitude */\nvar P00 = 0.33333333333333333333;\n\nvar P01 = 0.17222222222222222222;\nvar P02 = 0.10257936507936507936;\nvar P10 = 0.06388888888888888888;\nvar P11 = 0.06640211640211640211;\nvar P20 = 0.01641501294219154443;\n\nfunction authset(es) {\n var t;\n var APA = [];\n APA[0] = es * P00;\n t = es * es;\n APA[0] += t * P01;\n APA[1] = t * P10;\n t *= es;\n APA[0] += t * P02;\n APA[1] += t * P11;\n APA[2] = t * P20;\n return APA;\n}\n\nfunction authlat(beta, APA) {\n var t = beta + beta;\n return (beta + APA[0] * Math.sin(t) + APA[1] * Math.sin(t + t) + APA[2] * Math.sin(t + t + t));\n}\n\nexport var names = [\"Lambert Azimuthal Equal Area\", \"Lambert_Azimuthal_Equal_Area\", \"laea\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names,\n S_POLE: S_POLE,\n N_POLE: N_POLE,\n EQUIT: EQUIT,\n OBLIQ: OBLIQ\n};\n","export default function(x) {\n if (Math.abs(x) > 1) {\n x = (x > 1) ? 1 : -1;\n }\n return Math.asin(x);\n}","import msfnz from '../common/msfnz';\nimport qsfnz from '../common/qsfnz';\nimport adjust_lon from '../common/adjust_lon';\nimport asinz from '../common/asinz';\nimport {EPSLN} from '../constants/values';\n\nexport function init() {\n\n if (Math.abs(this.lat1 + this.lat2) < EPSLN) {\n return;\n }\n this.temp = this.b / this.a;\n this.es = 1 - Math.pow(this.temp, 2);\n this.e3 = Math.sqrt(this.es);\n\n this.sin_po = Math.sin(this.lat1);\n this.cos_po = Math.cos(this.lat1);\n this.t1 = this.sin_po;\n this.con = this.sin_po;\n this.ms1 = msfnz(this.e3, this.sin_po, this.cos_po);\n this.qs1 = qsfnz(this.e3, this.sin_po);\n\n this.sin_po = Math.sin(this.lat2);\n this.cos_po = Math.cos(this.lat2);\n this.t2 = this.sin_po;\n this.ms2 = msfnz(this.e3, this.sin_po, this.cos_po);\n this.qs2 = qsfnz(this.e3, this.sin_po);\n\n this.sin_po = Math.sin(this.lat0);\n this.cos_po = Math.cos(this.lat0);\n this.t3 = this.sin_po;\n this.qs0 = qsfnz(this.e3, this.sin_po);\n\n if (Math.abs(this.lat1 - this.lat2) > EPSLN) {\n this.ns0 = (this.ms1 * this.ms1 - this.ms2 * this.ms2) / (this.qs2 - this.qs1);\n }\n else {\n this.ns0 = this.con;\n }\n this.c = this.ms1 * this.ms1 + this.ns0 * this.qs1;\n this.rh = this.a * Math.sqrt(this.c - this.ns0 * this.qs0) / this.ns0;\n}\n\n/* Albers Conical Equal Area forward equations--mapping lat,long to x,y\n -------------------------------------------------------------------*/\nexport function forward(p) {\n\n var lon = p.x;\n var lat = p.y;\n\n this.sin_phi = Math.sin(lat);\n this.cos_phi = Math.cos(lat);\n\n var qs = qsfnz(this.e3, this.sin_phi);\n var rh1 = this.a * Math.sqrt(this.c - this.ns0 * qs) / this.ns0;\n var theta = this.ns0 * adjust_lon(lon - this.long0);\n var x = rh1 * Math.sin(theta) + this.x0;\n var y = this.rh - rh1 * Math.cos(theta) + this.y0;\n\n p.x = x;\n p.y = y;\n return p;\n}\n\nexport function inverse(p) {\n var rh1, qs, con, theta, lon, lat;\n\n p.x -= this.x0;\n p.y = this.rh - p.y + this.y0;\n if (this.ns0 >= 0) {\n rh1 = Math.sqrt(p.x * p.x + p.y * p.y);\n con = 1;\n }\n else {\n rh1 = -Math.sqrt(p.x * p.x + p.y * p.y);\n con = -1;\n }\n theta = 0;\n if (rh1 !== 0) {\n theta = Math.atan2(con * p.x, con * p.y);\n }\n con = rh1 * this.ns0 / this.a;\n if (this.sphere) {\n lat = Math.asin((this.c - con * con) / (2 * this.ns0));\n }\n else {\n qs = (this.c - con * con) / this.ns0;\n lat = this.phi1z(this.e3, qs);\n }\n\n lon = adjust_lon(theta / this.ns0 + this.long0);\n p.x = lon;\n p.y = lat;\n return p;\n}\n\n/* Function to compute phi1, the latitude for the inverse of the\n Albers Conical Equal-Area projection.\n-------------------------------------------*/\nexport function phi1z(eccent, qs) {\n var sinphi, cosphi, con, com, dphi;\n var phi = asinz(0.5 * qs);\n if (eccent < EPSLN) {\n return phi;\n }\n\n var eccnts = eccent * eccent;\n for (var i = 1; i <= 25; i++) {\n sinphi = Math.sin(phi);\n cosphi = Math.cos(phi);\n con = eccent * sinphi;\n com = 1 - con * con;\n dphi = 0.5 * com * com / cosphi * (qs / (1 - eccnts) - sinphi / com + 0.5 / eccent * Math.log((1 - con) / (1 + con)));\n phi = phi + dphi;\n if (Math.abs(dphi) <= 1e-7) {\n return phi;\n }\n }\n return null;\n}\n\nexport var names = [\"Albers_Conic_Equal_Area\", \"Albers\", \"aea\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names,\n phi1z: phi1z\n};\n","import adjust_lon from '../common/adjust_lon';\nimport asinz from '../common/asinz';\nimport {EPSLN} from '../constants/values';\n\n/*\n reference:\n Wolfram Mathworld \"Gnomonic Projection\"\n http://mathworld.wolfram.com/GnomonicProjection.html\n Accessed: 12th November 2009\n */\nexport function init() {\n\n /* Place parameters in static storage for common use\n -------------------------------------------------*/\n this.sin_p14 = Math.sin(this.lat0);\n this.cos_p14 = Math.cos(this.lat0);\n // Approximation for projecting points to the horizon (infinity)\n this.infinity_dist = 1000 * this.a;\n this.rc = 1;\n}\n\n/* Gnomonic forward equations--mapping lat,long to x,y\n ---------------------------------------------------*/\nexport function forward(p) {\n var sinphi, cosphi; /* sin and cos value */\n var dlon; /* delta longitude value */\n var coslon; /* cos of longitude */\n var ksp; /* scale factor */\n var g;\n var x, y;\n var lon = p.x;\n var lat = p.y;\n /* Forward equations\n -----------------*/\n dlon = adjust_lon(lon - this.long0);\n\n sinphi = Math.sin(lat);\n cosphi = Math.cos(lat);\n\n coslon = Math.cos(dlon);\n g = this.sin_p14 * sinphi + this.cos_p14 * cosphi * coslon;\n ksp = 1;\n if ((g > 0) || (Math.abs(g) <= EPSLN)) {\n x = this.x0 + this.a * ksp * cosphi * Math.sin(dlon) / g;\n y = this.y0 + this.a * ksp * (this.cos_p14 * sinphi - this.sin_p14 * cosphi * coslon) / g;\n }\n else {\n\n // Point is in the opposing hemisphere and is unprojectable\n // We still need to return a reasonable point, so we project\n // to infinity, on a bearing\n // equivalent to the northern hemisphere equivalent\n // This is a reasonable approximation for short shapes and lines that\n // straddle the horizon.\n\n x = this.x0 + this.infinity_dist * cosphi * Math.sin(dlon);\n y = this.y0 + this.infinity_dist * (this.cos_p14 * sinphi - this.sin_p14 * cosphi * coslon);\n\n }\n p.x = x;\n p.y = y;\n return p;\n}\n\nexport function inverse(p) {\n var rh; /* Rho */\n var sinc, cosc;\n var c;\n var lon, lat;\n\n /* Inverse equations\n -----------------*/\n p.x = (p.x - this.x0) / this.a;\n p.y = (p.y - this.y0) / this.a;\n\n p.x /= this.k0;\n p.y /= this.k0;\n\n if ((rh = Math.sqrt(p.x * p.x + p.y * p.y))) {\n c = Math.atan2(rh, this.rc);\n sinc = Math.sin(c);\n cosc = Math.cos(c);\n\n lat = asinz(cosc * this.sin_p14 + (p.y * sinc * this.cos_p14) / rh);\n lon = Math.atan2(p.x * sinc, rh * this.cos_p14 * cosc - p.y * this.sin_p14 * sinc);\n lon = adjust_lon(this.long0 + lon);\n }\n else {\n lat = this.phic0;\n lon = 0;\n }\n\n p.x = lon;\n p.y = lat;\n return p;\n}\n\nexport var names = [\"gnom\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import {HALF_PI} from '../constants/values';\n\nexport default function(eccent, q) {\n var temp = 1 - (1 - eccent * eccent) / (2 * eccent) * Math.log((1 - eccent) / (1 + eccent));\n if (Math.abs(Math.abs(q) - temp) < 1.0E-6) {\n if (q < 0) {\n return (-1 * HALF_PI);\n }\n else {\n return HALF_PI;\n }\n }\n //var phi = 0.5* q/(1-eccent*eccent);\n var phi = Math.asin(0.5 * q);\n var dphi;\n var sin_phi;\n var cos_phi;\n var con;\n for (var i = 0; i < 30; i++) {\n sin_phi = Math.sin(phi);\n cos_phi = Math.cos(phi);\n con = eccent * sin_phi;\n dphi = Math.pow(1 - con * con, 2) / (2 * cos_phi) * (q / (1 - eccent * eccent) - sin_phi / (1 - con * con) + 0.5 / eccent * Math.log((1 - con) / (1 + con)));\n phi += dphi;\n if (Math.abs(dphi) <= 0.0000000001) {\n return phi;\n }\n }\n\n //console.log(\"IQSFN-CONV:Latitude failed to converge after 30 iterations\");\n return NaN;\n}\n","import adjust_lon from '../common/adjust_lon';\nimport qsfnz from '../common/qsfnz';\nimport msfnz from '../common/msfnz';\nimport iqsfnz from '../common/iqsfnz';\n\n/*\n reference:\n \"Cartographic Projection Procedures for the UNIX Environment-\n A User's Manual\" by Gerald I. Evenden,\n USGS Open File Report 90-284and Release 4 Interim Reports (2003)\n*/\nexport function init() {\n //no-op\n if (!this.sphere) {\n this.k0 = msfnz(this.e, Math.sin(this.lat_ts), Math.cos(this.lat_ts));\n }\n}\n\n/* Cylindrical Equal Area forward equations--mapping lat,long to x,y\n ------------------------------------------------------------*/\nexport function forward(p) {\n var lon = p.x;\n var lat = p.y;\n var x, y;\n /* Forward equations\n -----------------*/\n var dlon = adjust_lon(lon - this.long0);\n if (this.sphere) {\n x = this.x0 + this.a * dlon * Math.cos(this.lat_ts);\n y = this.y0 + this.a * Math.sin(lat) / Math.cos(this.lat_ts);\n }\n else {\n var qs = qsfnz(this.e, Math.sin(lat));\n x = this.x0 + this.a * this.k0 * dlon;\n y = this.y0 + this.a * qs * 0.5 / this.k0;\n }\n\n p.x = x;\n p.y = y;\n return p;\n}\n\n/* Cylindrical Equal Area inverse equations--mapping x,y to lat/long\n ------------------------------------------------------------*/\nexport function inverse(p) {\n p.x -= this.x0;\n p.y -= this.y0;\n var lon, lat;\n\n if (this.sphere) {\n lon = adjust_lon(this.long0 + (p.x / this.a) / Math.cos(this.lat_ts));\n lat = Math.asin((p.y / this.a) * Math.cos(this.lat_ts));\n }\n else {\n lat = iqsfnz(this.e, 2 * p.y * this.k0 / this.a);\n lon = adjust_lon(this.long0 + p.x / (this.a * this.k0));\n }\n\n p.x = lon;\n p.y = lat;\n return p;\n}\n\nexport var names = [\"cea\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import adjust_lon from '../common/adjust_lon';\nimport adjust_lat from '../common/adjust_lat';\n\nexport function init() {\n\n this.x0 = this.x0 || 0;\n this.y0 = this.y0 || 0;\n this.lat0 = this.lat0 || 0;\n this.long0 = this.long0 || 0;\n this.lat_ts = this.lat_ts || 0;\n this.title = this.title || \"Equidistant Cylindrical (Plate Carre)\";\n\n this.rc = Math.cos(this.lat_ts);\n}\n\n// forward equations--mapping lat,long to x,y\n// -----------------------------------------------------------------\nexport function forward(p) {\n\n var lon = p.x;\n var lat = p.y;\n\n var dlon = adjust_lon(lon - this.long0);\n var dlat = adjust_lat(lat - this.lat0);\n p.x = this.x0 + (this.a * dlon * this.rc);\n p.y = this.y0 + (this.a * dlat);\n return p;\n}\n\n// inverse equations--mapping x,y to lat/long\n// -----------------------------------------------------------------\nexport function inverse(p) {\n\n var x = p.x;\n var y = p.y;\n\n p.x = adjust_lon(this.long0 + ((x - this.x0) / (this.a * this.rc)));\n p.y = adjust_lat(this.lat0 + ((y - this.y0) / (this.a)));\n return p;\n}\n\nexport var names = [\"Equirectangular\", \"Equidistant_Cylindrical\", \"eqc\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import e0fn from '../common/e0fn';\nimport e1fn from '../common/e1fn';\nimport e2fn from '../common/e2fn';\nimport e3fn from '../common/e3fn';\nimport adjust_lon from '../common/adjust_lon';\nimport adjust_lat from '../common/adjust_lat';\nimport mlfn from '../common/mlfn';\nimport {EPSLN} from '../constants/values';\n\nimport gN from '../common/gN';\nvar MAX_ITER = 20;\n\nexport function init() {\n /* Place parameters in static storage for common use\n -------------------------------------------------*/\n this.temp = this.b / this.a;\n this.es = 1 - Math.pow(this.temp, 2); // devait etre dans tmerc.js mais n y est pas donc je commente sinon retour de valeurs nulles\n this.e = Math.sqrt(this.es);\n this.e0 = e0fn(this.es);\n this.e1 = e1fn(this.es);\n this.e2 = e2fn(this.es);\n this.e3 = e3fn(this.es);\n this.ml0 = this.a * mlfn(this.e0, this.e1, this.e2, this.e3, this.lat0); //si que des zeros le calcul ne se fait pas\n}\n\n/* Polyconic forward equations--mapping lat,long to x,y\n ---------------------------------------------------*/\nexport function forward(p) {\n var lon = p.x;\n var lat = p.y;\n var x, y, el;\n var dlon = adjust_lon(lon - this.long0);\n el = dlon * Math.sin(lat);\n if (this.sphere) {\n if (Math.abs(lat) <= EPSLN) {\n x = this.a * dlon;\n y = -1 * this.a * this.lat0;\n }\n else {\n x = this.a * Math.sin(el) / Math.tan(lat);\n y = this.a * (adjust_lat(lat - this.lat0) + (1 - Math.cos(el)) / Math.tan(lat));\n }\n }\n else {\n if (Math.abs(lat) <= EPSLN) {\n x = this.a * dlon;\n y = -1 * this.ml0;\n }\n else {\n var nl = gN(this.a, this.e, Math.sin(lat)) / Math.tan(lat);\n x = nl * Math.sin(el);\n y = this.a * mlfn(this.e0, this.e1, this.e2, this.e3, lat) - this.ml0 + nl * (1 - Math.cos(el));\n }\n\n }\n p.x = x + this.x0;\n p.y = y + this.y0;\n return p;\n}\n\n/* Inverse equations\n -----------------*/\nexport function inverse(p) {\n var lon, lat, x, y, i;\n var al, bl;\n var phi, dphi;\n x = p.x - this.x0;\n y = p.y - this.y0;\n\n if (this.sphere) {\n if (Math.abs(y + this.a * this.lat0) <= EPSLN) {\n lon = adjust_lon(x / this.a + this.long0);\n lat = 0;\n }\n else {\n al = this.lat0 + y / this.a;\n bl = x * x / this.a / this.a + al * al;\n phi = al;\n var tanphi;\n for (i = MAX_ITER; i; --i) {\n tanphi = Math.tan(phi);\n dphi = -1 * (al * (phi * tanphi + 1) - phi - 0.5 * (phi * phi + bl) * tanphi) / ((phi - al) / tanphi - 1);\n phi += dphi;\n if (Math.abs(dphi) <= EPSLN) {\n lat = phi;\n break;\n }\n }\n lon = adjust_lon(this.long0 + (Math.asin(x * Math.tan(phi) / this.a)) / Math.sin(lat));\n }\n }\n else {\n if (Math.abs(y + this.ml0) <= EPSLN) {\n lat = 0;\n lon = adjust_lon(this.long0 + x / this.a);\n }\n else {\n\n al = (this.ml0 + y) / this.a;\n bl = x * x / this.a / this.a + al * al;\n phi = al;\n var cl, mln, mlnp, ma;\n var con;\n for (i = MAX_ITER; i; --i) {\n con = this.e * Math.sin(phi);\n cl = Math.sqrt(1 - con * con) * Math.tan(phi);\n mln = this.a * mlfn(this.e0, this.e1, this.e2, this.e3, phi);\n mlnp = this.e0 - 2 * this.e1 * Math.cos(2 * phi) + 4 * this.e2 * Math.cos(4 * phi) - 6 * this.e3 * Math.cos(6 * phi);\n ma = mln / this.a;\n dphi = (al * (cl * ma + 1) - ma - 0.5 * cl * (ma * ma + bl)) / (this.es * Math.sin(2 * phi) * (ma * ma + bl - 2 * al * ma) / (4 * cl) + (al - ma) * (cl * mlnp - 2 / Math.sin(2 * phi)) - mlnp);\n phi -= dphi;\n if (Math.abs(dphi) <= EPSLN) {\n lat = phi;\n break;\n }\n }\n\n //lat=phi4z(this.e,this.e0,this.e1,this.e2,this.e3,al,bl,0,0);\n cl = Math.sqrt(1 - this.es * Math.pow(Math.sin(lat), 2)) * Math.tan(lat);\n lon = adjust_lon(this.long0 + Math.asin(x * cl / this.a) / Math.sin(lat));\n }\n }\n\n p.x = lon;\n p.y = lat;\n return p;\n}\n\nexport var names = [\"Polyconic\", \"poly\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import {SEC_TO_RAD} from '../constants/values';\n\n/*\n reference\n Department of Land and Survey Technical Circular 1973/32\n http://www.linz.govt.nz/docs/miscellaneous/nz-map-definition.pdf\n OSG Technical Report 4.1\n http://www.linz.govt.nz/docs/miscellaneous/nzmg.pdf\n */\n\n/**\n * iterations: Number of iterations to refine inverse transform.\n * 0 -> km accuracy\n * 1 -> m accuracy -- suitable for most mapping applications\n * 2 -> mm accuracy\n */\nexport var iterations = 1;\n\nexport function init() {\n this.A = [];\n this.A[1] = 0.6399175073;\n this.A[2] = -0.1358797613;\n this.A[3] = 0.063294409;\n this.A[4] = -0.02526853;\n this.A[5] = 0.0117879;\n this.A[6] = -0.0055161;\n this.A[7] = 0.0026906;\n this.A[8] = -0.001333;\n this.A[9] = 0.00067;\n this.A[10] = -0.00034;\n\n this.B_re = [];\n this.B_im = [];\n this.B_re[1] = 0.7557853228;\n this.B_im[1] = 0;\n this.B_re[2] = 0.249204646;\n this.B_im[2] = 0.003371507;\n this.B_re[3] = -0.001541739;\n this.B_im[3] = 0.041058560;\n this.B_re[4] = -0.10162907;\n this.B_im[4] = 0.01727609;\n this.B_re[5] = -0.26623489;\n this.B_im[5] = -0.36249218;\n this.B_re[6] = -0.6870983;\n this.B_im[6] = -1.1651967;\n\n this.C_re = [];\n this.C_im = [];\n this.C_re[1] = 1.3231270439;\n this.C_im[1] = 0;\n this.C_re[2] = -0.577245789;\n this.C_im[2] = -0.007809598;\n this.C_re[3] = 0.508307513;\n this.C_im[3] = -0.112208952;\n this.C_re[4] = -0.15094762;\n this.C_im[4] = 0.18200602;\n this.C_re[5] = 1.01418179;\n this.C_im[5] = 1.64497696;\n this.C_re[6] = 1.9660549;\n this.C_im[6] = 2.5127645;\n\n this.D = [];\n this.D[1] = 1.5627014243;\n this.D[2] = 0.5185406398;\n this.D[3] = -0.03333098;\n this.D[4] = -0.1052906;\n this.D[5] = -0.0368594;\n this.D[6] = 0.007317;\n this.D[7] = 0.01220;\n this.D[8] = 0.00394;\n this.D[9] = -0.0013;\n}\n\n/**\n New Zealand Map Grid Forward - long/lat to x/y\n long/lat in radians\n */\nexport function forward(p) {\n var n;\n var lon = p.x;\n var lat = p.y;\n\n var delta_lat = lat - this.lat0;\n var delta_lon = lon - this.long0;\n\n // 1. Calculate d_phi and d_psi ... // and d_lambda\n // For this algorithm, delta_latitude is in seconds of arc x 10-5, so we need to scale to those units. Longitude is radians.\n var d_phi = delta_lat / SEC_TO_RAD * 1E-5;\n var d_lambda = delta_lon;\n var d_phi_n = 1; // d_phi^0\n\n var d_psi = 0;\n for (n = 1; n <= 10; n++) {\n d_phi_n = d_phi_n * d_phi;\n d_psi = d_psi + this.A[n] * d_phi_n;\n }\n\n // 2. Calculate theta\n var th_re = d_psi;\n var th_im = d_lambda;\n\n // 3. Calculate z\n var th_n_re = 1;\n var th_n_im = 0; // theta^0\n var th_n_re1;\n var th_n_im1;\n\n var z_re = 0;\n var z_im = 0;\n for (n = 1; n <= 6; n++) {\n th_n_re1 = th_n_re * th_re - th_n_im * th_im;\n th_n_im1 = th_n_im * th_re + th_n_re * th_im;\n th_n_re = th_n_re1;\n th_n_im = th_n_im1;\n z_re = z_re + this.B_re[n] * th_n_re - this.B_im[n] * th_n_im;\n z_im = z_im + this.B_im[n] * th_n_re + this.B_re[n] * th_n_im;\n }\n\n // 4. Calculate easting and northing\n p.x = (z_im * this.a) + this.x0;\n p.y = (z_re * this.a) + this.y0;\n\n return p;\n}\n\n/**\n New Zealand Map Grid Inverse - x/y to long/lat\n */\nexport function inverse(p) {\n var n;\n var x = p.x;\n var y = p.y;\n\n var delta_x = x - this.x0;\n var delta_y = y - this.y0;\n\n // 1. Calculate z\n var z_re = delta_y / this.a;\n var z_im = delta_x / this.a;\n\n // 2a. Calculate theta - first approximation gives km accuracy\n var z_n_re = 1;\n var z_n_im = 0; // z^0\n var z_n_re1;\n var z_n_im1;\n\n var th_re = 0;\n var th_im = 0;\n for (n = 1; n <= 6; n++) {\n z_n_re1 = z_n_re * z_re - z_n_im * z_im;\n z_n_im1 = z_n_im * z_re + z_n_re * z_im;\n z_n_re = z_n_re1;\n z_n_im = z_n_im1;\n th_re = th_re + this.C_re[n] * z_n_re - this.C_im[n] * z_n_im;\n th_im = th_im + this.C_im[n] * z_n_re + this.C_re[n] * z_n_im;\n }\n\n // 2b. Iterate to refine the accuracy of the calculation\n // 0 iterations gives km accuracy\n // 1 iteration gives m accuracy -- good enough for most mapping applications\n // 2 iterations bives mm accuracy\n for (var i = 0; i < this.iterations; i++) {\n var th_n_re = th_re;\n var th_n_im = th_im;\n var th_n_re1;\n var th_n_im1;\n\n var num_re = z_re;\n var num_im = z_im;\n for (n = 2; n <= 6; n++) {\n th_n_re1 = th_n_re * th_re - th_n_im * th_im;\n th_n_im1 = th_n_im * th_re + th_n_re * th_im;\n th_n_re = th_n_re1;\n th_n_im = th_n_im1;\n num_re = num_re + (n - 1) * (this.B_re[n] * th_n_re - this.B_im[n] * th_n_im);\n num_im = num_im + (n - 1) * (this.B_im[n] * th_n_re + this.B_re[n] * th_n_im);\n }\n\n th_n_re = 1;\n th_n_im = 0;\n var den_re = this.B_re[1];\n var den_im = this.B_im[1];\n for (n = 2; n <= 6; n++) {\n th_n_re1 = th_n_re * th_re - th_n_im * th_im;\n th_n_im1 = th_n_im * th_re + th_n_re * th_im;\n th_n_re = th_n_re1;\n th_n_im = th_n_im1;\n den_re = den_re + n * (this.B_re[n] * th_n_re - this.B_im[n] * th_n_im);\n den_im = den_im + n * (this.B_im[n] * th_n_re + this.B_re[n] * th_n_im);\n }\n\n // Complex division\n var den2 = den_re * den_re + den_im * den_im;\n th_re = (num_re * den_re + num_im * den_im) / den2;\n th_im = (num_im * den_re - num_re * den_im) / den2;\n }\n\n // 3. Calculate d_phi ... // and d_lambda\n var d_psi = th_re;\n var d_lambda = th_im;\n var d_psi_n = 1; // d_psi^0\n\n var d_phi = 0;\n for (n = 1; n <= 9; n++) {\n d_psi_n = d_psi_n * d_psi;\n d_phi = d_phi + this.D[n] * d_psi_n;\n }\n\n // 4. Calculate latitude and longitude\n // d_phi is calcuated in second of arc * 10^-5, so we need to scale back to radians. d_lambda is in radians.\n var lat = this.lat0 + (d_phi * SEC_TO_RAD * 1E5);\n var lon = this.long0 + d_lambda;\n\n p.x = lon;\n p.y = lat;\n\n return p;\n}\n\nexport var names = [\"New_Zealand_Map_Grid\", \"nzmg\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import adjust_lon from '../common/adjust_lon';\n\n/*\n reference\n \"New Equal-Area Map Projections for Noncircular Regions\", John P. Snyder,\n The American Cartographer, Vol 15, No. 4, October 1988, pp. 341-355.\n */\n\n\n/* Initialize the Miller Cylindrical projection\n -------------------------------------------*/\nexport function init() {\n //no-op\n}\n\n/* Miller Cylindrical forward equations--mapping lat,long to x,y\n ------------------------------------------------------------*/\nexport function forward(p) {\n var lon = p.x;\n var lat = p.y;\n /* Forward equations\n -----------------*/\n var dlon = adjust_lon(lon - this.long0);\n var x = this.x0 + this.a * dlon;\n var y = this.y0 + this.a * Math.log(Math.tan((Math.PI / 4) + (lat / 2.5))) * 1.25;\n\n p.x = x;\n p.y = y;\n return p;\n}\n\n/* Miller Cylindrical inverse equations--mapping x,y to lat/long\n ------------------------------------------------------------*/\nexport function inverse(p) {\n p.x -= this.x0;\n p.y -= this.y0;\n\n var lon = adjust_lon(this.long0 + p.x / this.a);\n var lat = 2.5 * (Math.atan(Math.exp(0.8 * p.y / this.a)) - Math.PI / 4);\n\n p.x = lon;\n p.y = lat;\n return p;\n}\n\nexport var names = [\"Miller_Cylindrical\", \"mill\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import adjust_lon from '../common/adjust_lon';\nimport adjust_lat from '../common/adjust_lat';\nimport pj_enfn from '../common/pj_enfn';\nvar MAX_ITER = 20;\nimport pj_mlfn from '../common/pj_mlfn';\nimport pj_inv_mlfn from '../common/pj_inv_mlfn';\nimport {EPSLN, HALF_PI} from '../constants/values';\n\nimport asinz from '../common/asinz';\n\n\nexport function init() {\n /* Place parameters in static storage for common use\n -------------------------------------------------*/\n\n\n if (!this.sphere) {\n this.en = pj_enfn(this.es);\n }\n else {\n this.n = 1;\n this.m = 0;\n this.es = 0;\n this.C_y = Math.sqrt((this.m + 1) / this.n);\n this.C_x = this.C_y / (this.m + 1);\n }\n\n}\n\n/* Sinusoidal forward equations--mapping lat,long to x,y\n -----------------------------------------------------*/\nexport function forward(p) {\n var x, y;\n var lon = p.x;\n var lat = p.y;\n /* Forward equations\n -----------------*/\n lon = adjust_lon(lon - this.long0);\n\n if (this.sphere) {\n if (!this.m) {\n lat = this.n !== 1 ? Math.asin(this.n * Math.sin(lat)) : lat;\n }\n else {\n var k = this.n * Math.sin(lat);\n for (var i = MAX_ITER; i; --i) {\n var V = (this.m * lat + Math.sin(lat) - k) / (this.m + Math.cos(lat));\n lat -= V;\n if (Math.abs(V) < EPSLN) {\n break;\n }\n }\n }\n x = this.a * this.C_x * lon * (this.m + Math.cos(lat));\n y = this.a * this.C_y * lat;\n\n }\n else {\n\n var s = Math.sin(lat);\n var c = Math.cos(lat);\n y = this.a * pj_mlfn(lat, s, c, this.en);\n x = this.a * lon * c / Math.sqrt(1 - this.es * s * s);\n }\n\n p.x = x;\n p.y = y;\n return p;\n}\n\nexport function inverse(p) {\n var lat, temp, lon, s;\n\n p.x -= this.x0;\n lon = p.x / this.a;\n p.y -= this.y0;\n lat = p.y / this.a;\n\n if (this.sphere) {\n lat /= this.C_y;\n lon = lon / (this.C_x * (this.m + Math.cos(lat)));\n if (this.m) {\n lat = asinz((this.m * lat + Math.sin(lat)) / this.n);\n }\n else if (this.n !== 1) {\n lat = asinz(Math.sin(lat) / this.n);\n }\n lon = adjust_lon(lon + this.long0);\n lat = adjust_lat(lat);\n }\n else {\n lat = pj_inv_mlfn(p.y / this.a, this.es, this.en);\n s = Math.abs(lat);\n if (s < HALF_PI) {\n s = Math.sin(lat);\n temp = this.long0 + p.x * Math.sqrt(1 - this.es * s * s) / (this.a * Math.cos(lat));\n //temp = this.long0 + p.x / (this.a * Math.cos(lat));\n lon = adjust_lon(temp);\n }\n else if ((s - EPSLN) < HALF_PI) {\n lon = this.long0;\n }\n }\n p.x = lon;\n p.y = lat;\n return p;\n}\n\nexport var names = [\"Sinusoidal\", \"sinu\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import adjust_lon from '../common/adjust_lon';\nexport function init() {}\nimport {EPSLN} from '../constants/values';\n/* Mollweide forward equations--mapping lat,long to x,y\n ----------------------------------------------------*/\nexport function forward(p) {\n\n /* Forward equations\n -----------------*/\n var lon = p.x;\n var lat = p.y;\n\n var delta_lon = adjust_lon(lon - this.long0);\n var theta = lat;\n var con = Math.PI * Math.sin(lat);\n\n /* Iterate using the Newton-Raphson method to find theta\n -----------------------------------------------------*/\n while (true) {\n var delta_theta = -(theta + Math.sin(theta) - con) / (1 + Math.cos(theta));\n theta += delta_theta;\n if (Math.abs(delta_theta) < EPSLN) {\n break;\n }\n }\n theta /= 2;\n\n /* If the latitude is 90 deg, force the x coordinate to be \"0 + false easting\"\n this is done here because of precision problems with \"cos(theta)\"\n --------------------------------------------------------------------------*/\n if (Math.PI / 2 - Math.abs(lat) < EPSLN) {\n delta_lon = 0;\n }\n var x = 0.900316316158 * this.a * delta_lon * Math.cos(theta) + this.x0;\n var y = 1.4142135623731 * this.a * Math.sin(theta) + this.y0;\n\n p.x = x;\n p.y = y;\n return p;\n}\n\nexport function inverse(p) {\n var theta;\n var arg;\n\n /* Inverse equations\n -----------------*/\n p.x -= this.x0;\n p.y -= this.y0;\n arg = p.y / (1.4142135623731 * this.a);\n\n /* Because of division by zero problems, 'arg' can not be 1. Therefore\n a number very close to one is used instead.\n -------------------------------------------------------------------*/\n if (Math.abs(arg) > 0.999999999999) {\n arg = 0.999999999999;\n }\n theta = Math.asin(arg);\n var lon = adjust_lon(this.long0 + (p.x / (0.900316316158 * this.a * Math.cos(theta))));\n if (lon < (-Math.PI)) {\n lon = -Math.PI;\n }\n if (lon > Math.PI) {\n lon = Math.PI;\n }\n arg = (2 * theta + Math.sin(2 * theta)) / Math.PI;\n if (Math.abs(arg) > 1) {\n arg = 1;\n }\n var lat = Math.asin(arg);\n\n p.x = lon;\n p.y = lat;\n return p;\n}\n\nexport var names = [\"Mollweide\", \"moll\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import e0fn from '../common/e0fn';\nimport e1fn from '../common/e1fn';\nimport e2fn from '../common/e2fn';\nimport e3fn from '../common/e3fn';\nimport msfnz from '../common/msfnz';\nimport mlfn from '../common/mlfn';\nimport adjust_lon from '../common/adjust_lon';\nimport adjust_lat from '../common/adjust_lat';\nimport imlfn from '../common/imlfn';\nimport {EPSLN} from '../constants/values';\n\nexport function init() {\n\n /* Place parameters in static storage for common use\n -------------------------------------------------*/\n // Standard Parallels cannot be equal and on opposite sides of the equator\n if (Math.abs(this.lat1 + this.lat2) < EPSLN) {\n return;\n }\n this.lat2 = this.lat2 || this.lat1;\n this.temp = this.b / this.a;\n this.es = 1 - Math.pow(this.temp, 2);\n this.e = Math.sqrt(this.es);\n this.e0 = e0fn(this.es);\n this.e1 = e1fn(this.es);\n this.e2 = e2fn(this.es);\n this.e3 = e3fn(this.es);\n\n this.sinphi = Math.sin(this.lat1);\n this.cosphi = Math.cos(this.lat1);\n\n this.ms1 = msfnz(this.e, this.sinphi, this.cosphi);\n this.ml1 = mlfn(this.e0, this.e1, this.e2, this.e3, this.lat1);\n\n if (Math.abs(this.lat1 - this.lat2) < EPSLN) {\n this.ns = this.sinphi;\n }\n else {\n this.sinphi = Math.sin(this.lat2);\n this.cosphi = Math.cos(this.lat2);\n this.ms2 = msfnz(this.e, this.sinphi, this.cosphi);\n this.ml2 = mlfn(this.e0, this.e1, this.e2, this.e3, this.lat2);\n this.ns = (this.ms1 - this.ms2) / (this.ml2 - this.ml1);\n }\n this.g = this.ml1 + this.ms1 / this.ns;\n this.ml0 = mlfn(this.e0, this.e1, this.e2, this.e3, this.lat0);\n this.rh = this.a * (this.g - this.ml0);\n}\n\n/* Equidistant Conic forward equations--mapping lat,long to x,y\n -----------------------------------------------------------*/\nexport function forward(p) {\n var lon = p.x;\n var lat = p.y;\n var rh1;\n\n /* Forward equations\n -----------------*/\n if (this.sphere) {\n rh1 = this.a * (this.g - lat);\n }\n else {\n var ml = mlfn(this.e0, this.e1, this.e2, this.e3, lat);\n rh1 = this.a * (this.g - ml);\n }\n var theta = this.ns * adjust_lon(lon - this.long0);\n var x = this.x0 + rh1 * Math.sin(theta);\n var y = this.y0 + this.rh - rh1 * Math.cos(theta);\n p.x = x;\n p.y = y;\n return p;\n}\n\n/* Inverse equations\n -----------------*/\nexport function inverse(p) {\n p.x -= this.x0;\n p.y = this.rh - p.y + this.y0;\n var con, rh1, lat, lon;\n if (this.ns >= 0) {\n rh1 = Math.sqrt(p.x * p.x + p.y * p.y);\n con = 1;\n }\n else {\n rh1 = -Math.sqrt(p.x * p.x + p.y * p.y);\n con = -1;\n }\n var theta = 0;\n if (rh1 !== 0) {\n theta = Math.atan2(con * p.x, con * p.y);\n }\n\n if (this.sphere) {\n lon = adjust_lon(this.long0 + theta / this.ns);\n lat = adjust_lat(this.g - rh1 / this.a);\n p.x = lon;\n p.y = lat;\n return p;\n }\n else {\n var ml = this.g - rh1 / this.a;\n lat = imlfn(ml, this.e0, this.e1, this.e2, this.e3);\n lon = adjust_lon(this.long0 + theta / this.ns);\n p.x = lon;\n p.y = lat;\n return p;\n }\n\n}\n\nexport var names = [\"Equidistant_Conic\", \"eqdc\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import adjust_lon from '../common/adjust_lon';\n\nimport {HALF_PI, EPSLN} from '../constants/values';\n\nimport asinz from '../common/asinz';\n\n/* Initialize the Van Der Grinten projection\n ----------------------------------------*/\nexport function init() {\n //this.R = 6370997; //Radius of earth\n this.R = this.a;\n}\n\nexport function forward(p) {\n\n var lon = p.x;\n var lat = p.y;\n\n /* Forward equations\n -----------------*/\n var dlon = adjust_lon(lon - this.long0);\n var x, y;\n\n if (Math.abs(lat) <= EPSLN) {\n x = this.x0 + this.R * dlon;\n y = this.y0;\n }\n var theta = asinz(2 * Math.abs(lat / Math.PI));\n if ((Math.abs(dlon) <= EPSLN) || (Math.abs(Math.abs(lat) - HALF_PI) <= EPSLN)) {\n x = this.x0;\n if (lat >= 0) {\n y = this.y0 + Math.PI * this.R * Math.tan(0.5 * theta);\n }\n else {\n y = this.y0 + Math.PI * this.R * -Math.tan(0.5 * theta);\n }\n // return(OK);\n }\n var al = 0.5 * Math.abs((Math.PI / dlon) - (dlon / Math.PI));\n var asq = al * al;\n var sinth = Math.sin(theta);\n var costh = Math.cos(theta);\n\n var g = costh / (sinth + costh - 1);\n var gsq = g * g;\n var m = g * (2 / sinth - 1);\n var msq = m * m;\n var con = Math.PI * this.R * (al * (g - msq) + Math.sqrt(asq * (g - msq) * (g - msq) - (msq + asq) * (gsq - msq))) / (msq + asq);\n if (dlon < 0) {\n con = -con;\n }\n x = this.x0 + con;\n //con = Math.abs(con / (Math.PI * this.R));\n var q = asq + g;\n con = Math.PI * this.R * (m * q - al * Math.sqrt((msq + asq) * (asq + 1) - q * q)) / (msq + asq);\n if (lat >= 0) {\n //y = this.y0 + Math.PI * this.R * Math.sqrt(1 - con * con - 2 * al * con);\n y = this.y0 + con;\n }\n else {\n //y = this.y0 - Math.PI * this.R * Math.sqrt(1 - con * con - 2 * al * con);\n y = this.y0 - con;\n }\n p.x = x;\n p.y = y;\n return p;\n}\n\n/* Van Der Grinten inverse equations--mapping x,y to lat/long\n ---------------------------------------------------------*/\nexport function inverse(p) {\n var lon, lat;\n var xx, yy, xys, c1, c2, c3;\n var a1;\n var m1;\n var con;\n var th1;\n var d;\n\n /* inverse equations\n -----------------*/\n p.x -= this.x0;\n p.y -= this.y0;\n con = Math.PI * this.R;\n xx = p.x / con;\n yy = p.y / con;\n xys = xx * xx + yy * yy;\n c1 = -Math.abs(yy) * (1 + xys);\n c2 = c1 - 2 * yy * yy + xx * xx;\n c3 = -2 * c1 + 1 + 2 * yy * yy + xys * xys;\n d = yy * yy / c3 + (2 * c2 * c2 * c2 / c3 / c3 / c3 - 9 * c1 * c2 / c3 / c3) / 27;\n a1 = (c1 - c2 * c2 / 3 / c3) / c3;\n m1 = 2 * Math.sqrt(-a1 / 3);\n con = ((3 * d) / a1) / m1;\n if (Math.abs(con) > 1) {\n if (con >= 0) {\n con = 1;\n }\n else {\n con = -1;\n }\n }\n th1 = Math.acos(con) / 3;\n if (p.y >= 0) {\n lat = (-m1 * Math.cos(th1 + Math.PI / 3) - c2 / 3 / c3) * Math.PI;\n }\n else {\n lat = -(-m1 * Math.cos(th1 + Math.PI / 3) - c2 / 3 / c3) * Math.PI;\n }\n\n if (Math.abs(xx) < EPSLN) {\n lon = this.long0;\n }\n else {\n lon = adjust_lon(this.long0 + Math.PI * (xys - 1 + Math.sqrt(1 + 2 * (xx * xx - yy * yy) + xys * xys)) / 2 / xx);\n }\n\n p.x = lon;\n p.y = lat;\n return p;\n}\n\nexport var names = [\"Van_der_Grinten_I\", \"VanDerGrinten\", \"vandg\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import adjust_lon from '../common/adjust_lon';\nimport {HALF_PI, EPSLN} from '../constants/values';\n\nimport mlfn from '../common/mlfn';\nimport e0fn from '../common/e0fn';\nimport e1fn from '../common/e1fn';\nimport e2fn from '../common/e2fn';\nimport e3fn from '../common/e3fn';\nimport gN from '../common/gN';\nimport asinz from '../common/asinz';\nimport imlfn from '../common/imlfn';\n\n\n\nexport function init() {\n this.sin_p12 = Math.sin(this.lat0);\n this.cos_p12 = Math.cos(this.lat0);\n}\n\nexport function forward(p) {\n var lon = p.x;\n var lat = p.y;\n var sinphi = Math.sin(p.y);\n var cosphi = Math.cos(p.y);\n var dlon = adjust_lon(lon - this.long0);\n var e0, e1, e2, e3, Mlp, Ml, tanphi, Nl1, Nl, psi, Az, G, H, GH, Hs, c, kp, cos_c, s, s2, s3, s4, s5;\n if (this.sphere) {\n if (Math.abs(this.sin_p12 - 1) <= EPSLN) {\n //North Pole case\n p.x = this.x0 + this.a * (HALF_PI - lat) * Math.sin(dlon);\n p.y = this.y0 - this.a * (HALF_PI - lat) * Math.cos(dlon);\n return p;\n }\n else if (Math.abs(this.sin_p12 + 1) <= EPSLN) {\n //South Pole case\n p.x = this.x0 + this.a * (HALF_PI + lat) * Math.sin(dlon);\n p.y = this.y0 + this.a * (HALF_PI + lat) * Math.cos(dlon);\n return p;\n }\n else {\n //default case\n cos_c = this.sin_p12 * sinphi + this.cos_p12 * cosphi * Math.cos(dlon);\n c = Math.acos(cos_c);\n kp = c ? c / Math.sin(c) : 1;\n p.x = this.x0 + this.a * kp * cosphi * Math.sin(dlon);\n p.y = this.y0 + this.a * kp * (this.cos_p12 * sinphi - this.sin_p12 * cosphi * Math.cos(dlon));\n return p;\n }\n }\n else {\n e0 = e0fn(this.es);\n e1 = e1fn(this.es);\n e2 = e2fn(this.es);\n e3 = e3fn(this.es);\n if (Math.abs(this.sin_p12 - 1) <= EPSLN) {\n //North Pole case\n Mlp = this.a * mlfn(e0, e1, e2, e3, HALF_PI);\n Ml = this.a * mlfn(e0, e1, e2, e3, lat);\n p.x = this.x0 + (Mlp - Ml) * Math.sin(dlon);\n p.y = this.y0 - (Mlp - Ml) * Math.cos(dlon);\n return p;\n }\n else if (Math.abs(this.sin_p12 + 1) <= EPSLN) {\n //South Pole case\n Mlp = this.a * mlfn(e0, e1, e2, e3, HALF_PI);\n Ml = this.a * mlfn(e0, e1, e2, e3, lat);\n p.x = this.x0 + (Mlp + Ml) * Math.sin(dlon);\n p.y = this.y0 + (Mlp + Ml) * Math.cos(dlon);\n return p;\n }\n else {\n //Default case\n tanphi = sinphi / cosphi;\n Nl1 = gN(this.a, this.e, this.sin_p12);\n Nl = gN(this.a, this.e, sinphi);\n psi = Math.atan((1 - this.es) * tanphi + this.es * Nl1 * this.sin_p12 / (Nl * cosphi));\n Az = Math.atan2(Math.sin(dlon), this.cos_p12 * Math.tan(psi) - this.sin_p12 * Math.cos(dlon));\n if (Az === 0) {\n s = Math.asin(this.cos_p12 * Math.sin(psi) - this.sin_p12 * Math.cos(psi));\n }\n else if (Math.abs(Math.abs(Az) - Math.PI) <= EPSLN) {\n s = -Math.asin(this.cos_p12 * Math.sin(psi) - this.sin_p12 * Math.cos(psi));\n }\n else {\n s = Math.asin(Math.sin(dlon) * Math.cos(psi) / Math.sin(Az));\n }\n G = this.e * this.sin_p12 / Math.sqrt(1 - this.es);\n H = this.e * this.cos_p12 * Math.cos(Az) / Math.sqrt(1 - this.es);\n GH = G * H;\n Hs = H * H;\n s2 = s * s;\n s3 = s2 * s;\n s4 = s3 * s;\n s5 = s4 * s;\n c = Nl1 * s * (1 - s2 * Hs * (1 - Hs) / 6 + s3 / 8 * GH * (1 - 2 * Hs) + s4 / 120 * (Hs * (4 - 7 * Hs) - 3 * G * G * (1 - 7 * Hs)) - s5 / 48 * GH);\n p.x = this.x0 + c * Math.sin(Az);\n p.y = this.y0 + c * Math.cos(Az);\n return p;\n }\n }\n\n\n}\n\nexport function inverse(p) {\n p.x -= this.x0;\n p.y -= this.y0;\n var rh, z, sinz, cosz, lon, lat, con, e0, e1, e2, e3, Mlp, M, N1, psi, Az, cosAz, tmp, A, B, D, Ee, F, sinpsi;\n if (this.sphere) {\n rh = Math.sqrt(p.x * p.x + p.y * p.y);\n if (rh > (2 * HALF_PI * this.a)) {\n return;\n }\n z = rh / this.a;\n\n sinz = Math.sin(z);\n cosz = Math.cos(z);\n\n lon = this.long0;\n if (Math.abs(rh) <= EPSLN) {\n lat = this.lat0;\n }\n else {\n lat = asinz(cosz * this.sin_p12 + (p.y * sinz * this.cos_p12) / rh);\n con = Math.abs(this.lat0) - HALF_PI;\n if (Math.abs(con) <= EPSLN) {\n if (this.lat0 >= 0) {\n lon = adjust_lon(this.long0 + Math.atan2(p.x, - p.y));\n }\n else {\n lon = adjust_lon(this.long0 - Math.atan2(-p.x, p.y));\n }\n }\n else {\n /*con = cosz - this.sin_p12 * Math.sin(lat);\n if ((Math.abs(con) < EPSLN) && (Math.abs(p.x) < EPSLN)) {\n //no-op, just keep the lon value as is\n } else {\n var temp = Math.atan2((p.x * sinz * this.cos_p12), (con * rh));\n lon = adjust_lon(this.long0 + Math.atan2((p.x * sinz * this.cos_p12), (con * rh)));\n }*/\n lon = adjust_lon(this.long0 + Math.atan2(p.x * sinz, rh * this.cos_p12 * cosz - p.y * this.sin_p12 * sinz));\n }\n }\n\n p.x = lon;\n p.y = lat;\n return p;\n }\n else {\n e0 = e0fn(this.es);\n e1 = e1fn(this.es);\n e2 = e2fn(this.es);\n e3 = e3fn(this.es);\n if (Math.abs(this.sin_p12 - 1) <= EPSLN) {\n //North pole case\n Mlp = this.a * mlfn(e0, e1, e2, e3, HALF_PI);\n rh = Math.sqrt(p.x * p.x + p.y * p.y);\n M = Mlp - rh;\n lat = imlfn(M / this.a, e0, e1, e2, e3);\n lon = adjust_lon(this.long0 + Math.atan2(p.x, - 1 * p.y));\n p.x = lon;\n p.y = lat;\n return p;\n }\n else if (Math.abs(this.sin_p12 + 1) <= EPSLN) {\n //South pole case\n Mlp = this.a * mlfn(e0, e1, e2, e3, HALF_PI);\n rh = Math.sqrt(p.x * p.x + p.y * p.y);\n M = rh - Mlp;\n\n lat = imlfn(M / this.a, e0, e1, e2, e3);\n lon = adjust_lon(this.long0 + Math.atan2(p.x, p.y));\n p.x = lon;\n p.y = lat;\n return p;\n }\n else {\n //default case\n rh = Math.sqrt(p.x * p.x + p.y * p.y);\n Az = Math.atan2(p.x, p.y);\n N1 = gN(this.a, this.e, this.sin_p12);\n cosAz = Math.cos(Az);\n tmp = this.e * this.cos_p12 * cosAz;\n A = -tmp * tmp / (1 - this.es);\n B = 3 * this.es * (1 - A) * this.sin_p12 * this.cos_p12 * cosAz / (1 - this.es);\n D = rh / N1;\n Ee = D - A * (1 + A) * Math.pow(D, 3) / 6 - B * (1 + 3 * A) * Math.pow(D, 4) / 24;\n F = 1 - A * Ee * Ee / 2 - D * Ee * Ee * Ee / 6;\n psi = Math.asin(this.sin_p12 * Math.cos(Ee) + this.cos_p12 * Math.sin(Ee) * cosAz);\n lon = adjust_lon(this.long0 + Math.asin(Math.sin(Az) * Math.sin(Ee) / Math.cos(psi)));\n sinpsi = Math.sin(psi);\n lat = Math.atan2((sinpsi - this.es * F * this.sin_p12) * Math.tan(psi), sinpsi * (1 - this.es));\n p.x = lon;\n p.y = lat;\n return p;\n }\n }\n\n}\n\nexport var names = [\"Azimuthal_Equidistant\", \"aeqd\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import adjust_lon from '../common/adjust_lon';\nimport asinz from '../common/asinz';\nimport {EPSLN, HALF_PI} from '../constants/values';\n\nexport function init() {\n //double temp; /* temporary variable */\n\n /* Place parameters in static storage for common use\n -------------------------------------------------*/\n this.sin_p14 = Math.sin(this.lat0);\n this.cos_p14 = Math.cos(this.lat0);\n}\n\n/* Orthographic forward equations--mapping lat,long to x,y\n ---------------------------------------------------*/\nexport function forward(p) {\n var sinphi, cosphi; /* sin and cos value */\n var dlon; /* delta longitude value */\n var coslon; /* cos of longitude */\n var ksp; /* scale factor */\n var g, x, y;\n var lon = p.x;\n var lat = p.y;\n /* Forward equations\n -----------------*/\n dlon = adjust_lon(lon - this.long0);\n\n sinphi = Math.sin(lat);\n cosphi = Math.cos(lat);\n\n coslon = Math.cos(dlon);\n g = this.sin_p14 * sinphi + this.cos_p14 * cosphi * coslon;\n ksp = 1;\n if ((g > 0) || (Math.abs(g) <= EPSLN)) {\n x = this.a * ksp * cosphi * Math.sin(dlon);\n y = this.y0 + this.a * ksp * (this.cos_p14 * sinphi - this.sin_p14 * cosphi * coslon);\n }\n p.x = x;\n p.y = y;\n return p;\n}\n\nexport function inverse(p) {\n var rh; /* height above ellipsoid */\n var z; /* angle */\n var sinz, cosz; /* sin of z and cos of z */\n var con;\n var lon, lat;\n /* Inverse equations\n -----------------*/\n p.x -= this.x0;\n p.y -= this.y0;\n rh = Math.sqrt(p.x * p.x + p.y * p.y);\n z = asinz(rh / this.a);\n\n sinz = Math.sin(z);\n cosz = Math.cos(z);\n\n lon = this.long0;\n if (Math.abs(rh) <= EPSLN) {\n lat = this.lat0;\n p.x = lon;\n p.y = lat;\n return p;\n }\n lat = asinz(cosz * this.sin_p14 + (p.y * sinz * this.cos_p14) / rh);\n con = Math.abs(this.lat0) - HALF_PI;\n if (Math.abs(con) <= EPSLN) {\n if (this.lat0 >= 0) {\n lon = adjust_lon(this.long0 + Math.atan2(p.x, - p.y));\n }\n else {\n lon = adjust_lon(this.long0 - Math.atan2(-p.x, p.y));\n }\n p.x = lon;\n p.y = lat;\n return p;\n }\n lon = adjust_lon(this.long0 + Math.atan2((p.x * sinz), rh * this.cos_p14 * cosz - p.y * this.sin_p14 * sinz));\n p.x = lon;\n p.y = lat;\n return p;\n}\n\nexport var names = [\"ortho\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","// QSC projection rewritten from the original PROJ4\n// https://github.com/OSGeo/proj.4/blob/master/src/PJ_qsc.c\n\nimport {EPSLN, TWO_PI, SPI, HALF_PI, FORTPI} from '../constants/values';\n\n/* constants */\nvar FACE_ENUM = {\n FRONT: 1,\n RIGHT: 2,\n BACK: 3,\n LEFT: 4,\n TOP: 5,\n BOTTOM: 6\n};\n\nvar AREA_ENUM = {\n AREA_0: 1,\n AREA_1: 2,\n AREA_2: 3,\n AREA_3: 4\n};\n\nexport function init() {\n\n this.x0 = this.x0 || 0;\n this.y0 = this.y0 || 0;\n this.lat0 = this.lat0 || 0;\n this.long0 = this.long0 || 0;\n this.lat_ts = this.lat_ts || 0;\n this.title = this.title || \"Quadrilateralized Spherical Cube\";\n\n /* Determine the cube face from the center of projection. */\n if (this.lat0 >= HALF_PI - FORTPI / 2.0) {\n this.face = FACE_ENUM.TOP;\n } else if (this.lat0 <= -(HALF_PI - FORTPI / 2.0)) {\n this.face = FACE_ENUM.BOTTOM;\n } else if (Math.abs(this.long0) <= FORTPI) {\n this.face = FACE_ENUM.FRONT;\n } else if (Math.abs(this.long0) <= HALF_PI + FORTPI) {\n this.face = this.long0 > 0.0 ? FACE_ENUM.RIGHT : FACE_ENUM.LEFT;\n } else {\n this.face = FACE_ENUM.BACK;\n }\n\n /* Fill in useful values for the ellipsoid <-> sphere shift\n * described in [LK12]. */\n if (this.es !== 0) {\n this.one_minus_f = 1 - (this.a - this.b) / this.a;\n this.one_minus_f_squared = this.one_minus_f * this.one_minus_f;\n }\n}\n\n// QSC forward equations--mapping lat,long to x,y\n// -----------------------------------------------------------------\nexport function forward(p) {\n var xy = {x: 0, y: 0};\n var lat, lon;\n var theta, phi;\n var t, mu;\n /* nu; */\n var area = {value: 0};\n\n // move lon according to projection's lon\n p.x -= this.long0;\n\n /* Convert the geodetic latitude to a geocentric latitude.\n * This corresponds to the shift from the ellipsoid to the sphere\n * described in [LK12]. */\n if (this.es !== 0) {//if (P->es != 0) {\n lat = Math.atan(this.one_minus_f_squared * Math.tan(p.y));\n } else {\n lat = p.y;\n }\n\n /* Convert the input lat, lon into theta, phi as used by QSC.\n * This depends on the cube face and the area on it.\n * For the top and bottom face, we can compute theta and phi\n * directly from phi, lam. For the other faces, we must use\n * unit sphere cartesian coordinates as an intermediate step. */\n lon = p.x; //lon = lp.lam;\n if (this.face === FACE_ENUM.TOP) {\n phi = HALF_PI - lat;\n if (lon >= FORTPI && lon <= HALF_PI + FORTPI) {\n area.value = AREA_ENUM.AREA_0;\n theta = lon - HALF_PI;\n } else if (lon > HALF_PI + FORTPI || lon <= -(HALF_PI + FORTPI)) {\n area.value = AREA_ENUM.AREA_1;\n theta = (lon > 0.0 ? lon - SPI : lon + SPI);\n } else if (lon > -(HALF_PI + FORTPI) && lon <= -FORTPI) {\n area.value = AREA_ENUM.AREA_2;\n theta = lon + HALF_PI;\n } else {\n area.value = AREA_ENUM.AREA_3;\n theta = lon;\n }\n } else if (this.face === FACE_ENUM.BOTTOM) {\n phi = HALF_PI + lat;\n if (lon >= FORTPI && lon <= HALF_PI + FORTPI) {\n area.value = AREA_ENUM.AREA_0;\n theta = -lon + HALF_PI;\n } else if (lon < FORTPI && lon >= -FORTPI) {\n area.value = AREA_ENUM.AREA_1;\n theta = -lon;\n } else if (lon < -FORTPI && lon >= -(HALF_PI + FORTPI)) {\n area.value = AREA_ENUM.AREA_2;\n theta = -lon - HALF_PI;\n } else {\n area.value = AREA_ENUM.AREA_3;\n theta = (lon > 0.0 ? -lon + SPI : -lon - SPI);\n }\n } else {\n var q, r, s;\n var sinlat, coslat;\n var sinlon, coslon;\n\n if (this.face === FACE_ENUM.RIGHT) {\n lon = qsc_shift_lon_origin(lon, +HALF_PI);\n } else if (this.face === FACE_ENUM.BACK) {\n lon = qsc_shift_lon_origin(lon, +SPI);\n } else if (this.face === FACE_ENUM.LEFT) {\n lon = qsc_shift_lon_origin(lon, -HALF_PI);\n }\n sinlat = Math.sin(lat);\n coslat = Math.cos(lat);\n sinlon = Math.sin(lon);\n coslon = Math.cos(lon);\n q = coslat * coslon;\n r = coslat * sinlon;\n s = sinlat;\n\n if (this.face === FACE_ENUM.FRONT) {\n phi = Math.acos(q);\n theta = qsc_fwd_equat_face_theta(phi, s, r, area);\n } else if (this.face === FACE_ENUM.RIGHT) {\n phi = Math.acos(r);\n theta = qsc_fwd_equat_face_theta(phi, s, -q, area);\n } else if (this.face === FACE_ENUM.BACK) {\n phi = Math.acos(-q);\n theta = qsc_fwd_equat_face_theta(phi, s, -r, area);\n } else if (this.face === FACE_ENUM.LEFT) {\n phi = Math.acos(-r);\n theta = qsc_fwd_equat_face_theta(phi, s, q, area);\n } else {\n /* Impossible */\n phi = theta = 0;\n area.value = AREA_ENUM.AREA_0;\n }\n }\n\n /* Compute mu and nu for the area of definition.\n * For mu, see Eq. (3-21) in [OL76], but note the typos:\n * compare with Eq. (3-14). For nu, see Eq. (3-38). */\n mu = Math.atan((12 / SPI) * (theta + Math.acos(Math.sin(theta) * Math.cos(FORTPI)) - HALF_PI));\n t = Math.sqrt((1 - Math.cos(phi)) / (Math.cos(mu) * Math.cos(mu)) / (1 - Math.cos(Math.atan(1 / Math.cos(theta)))));\n\n /* Apply the result to the real area. */\n if (area.value === AREA_ENUM.AREA_1) {\n mu += HALF_PI;\n } else if (area.value === AREA_ENUM.AREA_2) {\n mu += SPI;\n } else if (area.value === AREA_ENUM.AREA_3) {\n mu += 1.5 * SPI;\n }\n\n /* Now compute x, y from mu and nu */\n xy.x = t * Math.cos(mu);\n xy.y = t * Math.sin(mu);\n xy.x = xy.x * this.a + this.x0;\n xy.y = xy.y * this.a + this.y0;\n\n p.x = xy.x;\n p.y = xy.y;\n return p;\n}\n\n// QSC inverse equations--mapping x,y to lat/long\n// -----------------------------------------------------------------\nexport function inverse(p) {\n var lp = {lam: 0, phi: 0};\n var mu, nu, cosmu, tannu;\n var tantheta, theta, cosphi, phi;\n var t;\n var area = {value: 0};\n\n /* de-offset */\n p.x = (p.x - this.x0) / this.a;\n p.y = (p.y - this.y0) / this.a;\n\n /* Convert the input x, y to the mu and nu angles as used by QSC.\n * This depends on the area of the cube face. */\n nu = Math.atan(Math.sqrt(p.x * p.x + p.y * p.y));\n mu = Math.atan2(p.y, p.x);\n if (p.x >= 0.0 && p.x >= Math.abs(p.y)) {\n area.value = AREA_ENUM.AREA_0;\n } else if (p.y >= 0.0 && p.y >= Math.abs(p.x)) {\n area.value = AREA_ENUM.AREA_1;\n mu -= HALF_PI;\n } else if (p.x < 0.0 && -p.x >= Math.abs(p.y)) {\n area.value = AREA_ENUM.AREA_2;\n mu = (mu < 0.0 ? mu + SPI : mu - SPI);\n } else {\n area.value = AREA_ENUM.AREA_3;\n mu += HALF_PI;\n }\n\n /* Compute phi and theta for the area of definition.\n * The inverse projection is not described in the original paper, but some\n * good hints can be found here (as of 2011-12-14):\n * http://fits.gsfc.nasa.gov/fitsbits/saf.93/saf.9302\n * (search for \"Message-Id: <9302181759.AA25477 at fits.cv.nrao.edu>\") */\n t = (SPI / 12) * Math.tan(mu);\n tantheta = Math.sin(t) / (Math.cos(t) - (1 / Math.sqrt(2)));\n theta = Math.atan(tantheta);\n cosmu = Math.cos(mu);\n tannu = Math.tan(nu);\n cosphi = 1 - cosmu * cosmu * tannu * tannu * (1 - Math.cos(Math.atan(1 / Math.cos(theta))));\n if (cosphi < -1) {\n cosphi = -1;\n } else if (cosphi > +1) {\n cosphi = +1;\n }\n\n /* Apply the result to the real area on the cube face.\n * For the top and bottom face, we can compute phi and lam directly.\n * For the other faces, we must use unit sphere cartesian coordinates\n * as an intermediate step. */\n if (this.face === FACE_ENUM.TOP) {\n phi = Math.acos(cosphi);\n lp.phi = HALF_PI - phi;\n if (area.value === AREA_ENUM.AREA_0) {\n lp.lam = theta + HALF_PI;\n } else if (area.value === AREA_ENUM.AREA_1) {\n lp.lam = (theta < 0.0 ? theta + SPI : theta - SPI);\n } else if (area.value === AREA_ENUM.AREA_2) {\n lp.lam = theta - HALF_PI;\n } else /* area.value == AREA_ENUM.AREA_3 */ {\n lp.lam = theta;\n }\n } else if (this.face === FACE_ENUM.BOTTOM) {\n phi = Math.acos(cosphi);\n lp.phi = phi - HALF_PI;\n if (area.value === AREA_ENUM.AREA_0) {\n lp.lam = -theta + HALF_PI;\n } else if (area.value === AREA_ENUM.AREA_1) {\n lp.lam = -theta;\n } else if (area.value === AREA_ENUM.AREA_2) {\n lp.lam = -theta - HALF_PI;\n } else /* area.value == AREA_ENUM.AREA_3 */ {\n lp.lam = (theta < 0.0 ? -theta - SPI : -theta + SPI);\n }\n } else {\n /* Compute phi and lam via cartesian unit sphere coordinates. */\n var q, r, s;\n q = cosphi;\n t = q * q;\n if (t >= 1) {\n s = 0;\n } else {\n s = Math.sqrt(1 - t) * Math.sin(theta);\n }\n t += s * s;\n if (t >= 1) {\n r = 0;\n } else {\n r = Math.sqrt(1 - t);\n }\n /* Rotate q,r,s into the correct area. */\n if (area.value === AREA_ENUM.AREA_1) {\n t = r;\n r = -s;\n s = t;\n } else if (area.value === AREA_ENUM.AREA_2) {\n r = -r;\n s = -s;\n } else if (area.value === AREA_ENUM.AREA_3) {\n t = r;\n r = s;\n s = -t;\n }\n /* Rotate q,r,s into the correct cube face. */\n if (this.face === FACE_ENUM.RIGHT) {\n t = q;\n q = -r;\n r = t;\n } else if (this.face === FACE_ENUM.BACK) {\n q = -q;\n r = -r;\n } else if (this.face === FACE_ENUM.LEFT) {\n t = q;\n q = r;\n r = -t;\n }\n /* Now compute phi and lam from the unit sphere coordinates. */\n lp.phi = Math.acos(-s) - HALF_PI;\n lp.lam = Math.atan2(r, q);\n if (this.face === FACE_ENUM.RIGHT) {\n lp.lam = qsc_shift_lon_origin(lp.lam, -HALF_PI);\n } else if (this.face === FACE_ENUM.BACK) {\n lp.lam = qsc_shift_lon_origin(lp.lam, -SPI);\n } else if (this.face === FACE_ENUM.LEFT) {\n lp.lam = qsc_shift_lon_origin(lp.lam, +HALF_PI);\n }\n }\n\n /* Apply the shift from the sphere to the ellipsoid as described\n * in [LK12]. */\n if (this.es !== 0) {\n var invert_sign;\n var tanphi, xa;\n invert_sign = (lp.phi < 0 ? 1 : 0);\n tanphi = Math.tan(lp.phi);\n xa = this.b / Math.sqrt(tanphi * tanphi + this.one_minus_f_squared);\n lp.phi = Math.atan(Math.sqrt(this.a * this.a - xa * xa) / (this.one_minus_f * xa));\n if (invert_sign) {\n lp.phi = -lp.phi;\n }\n }\n\n lp.lam += this.long0;\n p.x = lp.lam;\n p.y = lp.phi;\n return p;\n}\n\n/* Helper function for forward projection: compute the theta angle\n * and determine the area number. */\nfunction qsc_fwd_equat_face_theta(phi, y, x, area) {\n var theta;\n if (phi < EPSLN) {\n area.value = AREA_ENUM.AREA_0;\n theta = 0.0;\n } else {\n theta = Math.atan2(y, x);\n if (Math.abs(theta) <= FORTPI) {\n area.value = AREA_ENUM.AREA_0;\n } else if (theta > FORTPI && theta <= HALF_PI + FORTPI) {\n area.value = AREA_ENUM.AREA_1;\n theta -= HALF_PI;\n } else if (theta > HALF_PI + FORTPI || theta <= -(HALF_PI + FORTPI)) {\n area.value = AREA_ENUM.AREA_2;\n theta = (theta >= 0.0 ? theta - SPI : theta + SPI);\n } else {\n area.value = AREA_ENUM.AREA_3;\n theta += HALF_PI;\n }\n }\n return theta;\n}\n\n/* Helper function: shift the longitude. */\nfunction qsc_shift_lon_origin(lon, offset) {\n var slon = lon + offset;\n if (slon < -SPI) {\n slon += TWO_PI;\n } else if (slon > +SPI) {\n slon -= TWO_PI;\n }\n return slon;\n}\n\nexport var names = [\"Quadrilateralized Spherical Cube\", \"Quadrilateralized_Spherical_Cube\", \"qsc\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n\n","// Robinson projection\n// Based on https://github.com/OSGeo/proj.4/blob/master/src/PJ_robin.c\n// Polynomial coeficients from http://article.gmane.org/gmane.comp.gis.proj-4.devel/6039\n\nimport {HALF_PI, D2R, R2D, EPSLN} from '../constants/values';\nimport adjust_lon from '../common/adjust_lon';\n\nvar COEFS_X = [\n [1.0000, 2.2199e-17, -7.15515e-05, 3.1103e-06],\n [0.9986, -0.000482243, -2.4897e-05, -1.3309e-06],\n [0.9954, -0.00083103, -4.48605e-05, -9.86701e-07],\n [0.9900, -0.00135364, -5.9661e-05, 3.6777e-06],\n [0.9822, -0.00167442, -4.49547e-06, -5.72411e-06],\n [0.9730, -0.00214868, -9.03571e-05, 1.8736e-08],\n [0.9600, -0.00305085, -9.00761e-05, 1.64917e-06],\n [0.9427, -0.00382792, -6.53386e-05, -2.6154e-06],\n [0.9216, -0.00467746, -0.00010457, 4.81243e-06],\n [0.8962, -0.00536223, -3.23831e-05, -5.43432e-06],\n [0.8679, -0.00609363, -0.000113898, 3.32484e-06],\n [0.8350, -0.00698325, -6.40253e-05, 9.34959e-07],\n [0.7986, -0.00755338, -5.00009e-05, 9.35324e-07],\n [0.7597, -0.00798324, -3.5971e-05, -2.27626e-06],\n [0.7186, -0.00851367, -7.01149e-05, -8.6303e-06],\n [0.6732, -0.00986209, -0.000199569, 1.91974e-05],\n [0.6213, -0.010418, 8.83923e-05, 6.24051e-06],\n [0.5722, -0.00906601, 0.000182, 6.24051e-06],\n [0.5322, -0.00677797, 0.000275608, 6.24051e-06]\n];\n\nvar COEFS_Y = [\n [-5.20417e-18, 0.0124, 1.21431e-18, -8.45284e-11],\n [0.0620, 0.0124, -1.26793e-09, 4.22642e-10],\n [0.1240, 0.0124, 5.07171e-09, -1.60604e-09],\n [0.1860, 0.0123999, -1.90189e-08, 6.00152e-09],\n [0.2480, 0.0124002, 7.10039e-08, -2.24e-08],\n [0.3100, 0.0123992, -2.64997e-07, 8.35986e-08],\n [0.3720, 0.0124029, 9.88983e-07, -3.11994e-07],\n [0.4340, 0.0123893, -3.69093e-06, -4.35621e-07],\n [0.4958, 0.0123198, -1.02252e-05, -3.45523e-07],\n [0.5571, 0.0121916, -1.54081e-05, -5.82288e-07],\n [0.6176, 0.0119938, -2.41424e-05, -5.25327e-07],\n [0.6769, 0.011713, -3.20223e-05, -5.16405e-07],\n [0.7346, 0.0113541, -3.97684e-05, -6.09052e-07],\n [0.7903, 0.0109107, -4.89042e-05, -1.04739e-06],\n [0.8435, 0.0103431, -6.4615e-05, -1.40374e-09],\n [0.8936, 0.00969686, -6.4636e-05, -8.547e-06],\n [0.9394, 0.00840947, -0.000192841, -4.2106e-06],\n [0.9761, 0.00616527, -0.000256, -4.2106e-06],\n [1.0000, 0.00328947, -0.000319159, -4.2106e-06]\n];\n\nvar FXC = 0.8487;\nvar FYC = 1.3523;\nvar C1 = R2D/5; // rad to 5-degree interval\nvar RC1 = 1/C1;\nvar NODES = 18;\n\nvar poly3_val = function(coefs, x) {\n return coefs[0] + x * (coefs[1] + x * (coefs[2] + x * coefs[3]));\n};\n\nvar poly3_der = function(coefs, x) {\n return coefs[1] + x * (2 * coefs[2] + x * 3 * coefs[3]);\n};\n\nfunction newton_rapshon(f_df, start, max_err, iters) {\n var x = start;\n for (; iters; --iters) {\n var upd = f_df(x);\n x -= upd;\n if (Math.abs(upd) < max_err) {\n break;\n }\n }\n return x;\n}\n\nexport function init() {\n this.x0 = this.x0 || 0;\n this.y0 = this.y0 || 0;\n this.long0 = this.long0 || 0;\n this.es = 0;\n this.title = this.title || \"Robinson\";\n}\n\nexport function forward(ll) {\n var lon = adjust_lon(ll.x - this.long0);\n\n var dphi = Math.abs(ll.y);\n var i = Math.floor(dphi * C1);\n if (i < 0) {\n i = 0;\n } else if (i >= NODES) {\n i = NODES - 1;\n }\n dphi = R2D * (dphi - RC1 * i);\n var xy = {\n x: poly3_val(COEFS_X[i], dphi) * lon,\n y: poly3_val(COEFS_Y[i], dphi)\n };\n if (ll.y < 0) {\n xy.y = -xy.y;\n }\n\n xy.x = xy.x * this.a * FXC + this.x0;\n xy.y = xy.y * this.a * FYC + this.y0;\n return xy;\n}\n\nexport function inverse(xy) {\n var ll = {\n x: (xy.x - this.x0) / (this.a * FXC),\n y: Math.abs(xy.y - this.y0) / (this.a * FYC)\n };\n\n if (ll.y >= 1) { // pathologic case\n ll.x /= COEFS_X[NODES][0];\n ll.y = xy.y < 0 ? -HALF_PI : HALF_PI;\n } else {\n // find table interval\n var i = Math.floor(ll.y * NODES);\n if (i < 0) {\n i = 0;\n } else if (i >= NODES) {\n i = NODES - 1;\n }\n for (;;) {\n if (COEFS_Y[i][0] > ll.y) {\n --i;\n } else if (COEFS_Y[i+1][0] <= ll.y) {\n ++i;\n } else {\n break;\n }\n }\n // linear interpolation in 5 degree interval\n var coefs = COEFS_Y[i];\n var t = 5 * (ll.y - coefs[0]) / (COEFS_Y[i+1][0] - coefs[0]);\n // find t so that poly3_val(coefs, t) = ll.y\n t = newton_rapshon(function(x) {\n return (poly3_val(coefs, x) - ll.y) / poly3_der(coefs, x);\n }, t, EPSLN, 100);\n\n ll.x /= poly3_val(COEFS_X[i], t);\n ll.y = (5 * i + t) * D2R;\n if (xy.y < 0) {\n ll.y = -ll.y;\n }\n }\n\n ll.x = adjust_lon(ll.x + this.long0);\n return ll;\n}\n\nexport var names = [\"Robinson\", \"robin\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import {\n geodeticToGeocentric,\n geocentricToGeodetic\n} from '../datumUtils';\n\nexport function init() {\n this.name = 'geocent';\n\n}\n\nexport function forward(p) {\n var point = geodeticToGeocentric(p, this.es, this.a);\n return point;\n}\n\nexport function inverse(p) {\n var point = geocentricToGeodetic(p, this.es, this.a, this.b);\n return point;\n}\n\nexport var names = [\"Geocentric\", 'geocentric', \"geocent\", \"Geocent\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};","\nvar mode = {\n N_POLE: 0,\n S_POLE: 1,\n EQUIT: 2,\n OBLIQ: 3\n};\n\nimport { D2R, HALF_PI, EPSLN } from \"../constants/values\";\nimport hypot from \"../common/hypot\";\n\nvar params = {\n h: { def: 100000, num: true }, // default is Karman line, no default in PROJ.7\n azi: { def: 0, num: true, degrees: true }, // default is North\n tilt: { def: 0, num: true, degrees: true }, // default is Nadir\n long0: { def: 0, num: true }, // default is Greenwich, conversion to rad is automatic\n lat0: { def: 0, num: true } // default is Equator, conversion to rad is automatic\n};\n\nexport function init() {\n Object.keys(params).forEach(function (p) {\n if (typeof this[p] === \"undefined\") {\n this[p] = params[p].def;\n } else if (params[p].num && isNaN(this[p])) {\n throw new Error(\"Invalid parameter value, must be numeric \" + p + \" = \" + this[p]);\n } else if (params[p].num) {\n this[p] = parseFloat(this[p]);\n }\n if (params[p].degrees) {\n this[p] = this[p] * D2R;\n }\n }.bind(this));\n\n if (Math.abs((Math.abs(this.lat0) - HALF_PI)) < EPSLN) {\n this.mode = this.lat0 < 0 ? mode.S_POLE : mode.N_POLE;\n } else if (Math.abs(this.lat0) < EPSLN) {\n this.mode = mode.EQUIT;\n } else {\n this.mode = mode.OBLIQ;\n this.sinph0 = Math.sin(this.lat0);\n this.cosph0 = Math.cos(this.lat0);\n }\n\n this.pn1 = this.h / this.a; // Normalize relative to the Earth's radius\n\n if (this.pn1 <= 0 || this.pn1 > 1e10) {\n throw new Error(\"Invalid height\");\n }\n \n this.p = 1 + this.pn1;\n this.rp = 1 / this.p;\n this.h1 = 1 / this.pn1;\n this.pfact = (this.p + 1) * this.h1;\n this.es = 0;\n\n var omega = this.tilt;\n var gamma = this.azi;\n this.cg = Math.cos(gamma);\n this.sg = Math.sin(gamma);\n this.cw = Math.cos(omega);\n this.sw = Math.sin(omega);\n}\n\nexport function forward(p) {\n p.x -= this.long0;\n var sinphi = Math.sin(p.y);\n var cosphi = Math.cos(p.y);\n var coslam = Math.cos(p.x);\n var x, y;\n switch (this.mode) {\n case mode.OBLIQ:\n y = this.sinph0 * sinphi + this.cosph0 * cosphi * coslam;\n break;\n case mode.EQUIT:\n y = cosphi * coslam;\n break;\n case mode.S_POLE:\n y = -sinphi;\n break;\n case mode.N_POLE:\n y = sinphi;\n break;\n }\n y = this.pn1 / (this.p - y);\n x = y * cosphi * Math.sin(p.x);\n\n switch (this.mode) {\n case mode.OBLIQ:\n y *= this.cosph0 * sinphi - this.sinph0 * cosphi * coslam;\n break;\n case mode.EQUIT:\n y *= sinphi;\n break;\n case mode.N_POLE:\n y *= -(cosphi * coslam);\n break;\n case mode.S_POLE:\n y *= cosphi * coslam;\n break;\n }\n\n // Tilt \n var yt, ba;\n yt = y * this.cg + x * this.sg;\n ba = 1 / (yt * this.sw * this.h1 + this.cw);\n x = (x * this.cg - y * this.sg) * this.cw * ba;\n y = yt * ba;\n\n p.x = x * this.a;\n p.y = y * this.a;\n return p;\n}\n\nexport function inverse(p) {\n p.x /= this.a;\n p.y /= this.a;\n var r = { x: p.x, y: p.y };\n\n // Un-Tilt\n var bm, bq, yt;\n yt = 1 / (this.pn1 - p.y * this.sw);\n bm = this.pn1 * p.x * yt;\n bq = this.pn1 * p.y * this.cw * yt;\n p.x = bm * this.cg + bq * this.sg;\n p.y = bq * this.cg - bm * this.sg;\n\n var rh = hypot(p.x, p.y);\n if (Math.abs(rh) < EPSLN) {\n r.x = 0;\n r.y = p.y;\n } else {\n var cosz, sinz;\n sinz = 1 - rh * rh * this.pfact;\n sinz = (this.p - Math.sqrt(sinz)) / (this.pn1 / rh + rh / this.pn1);\n cosz = Math.sqrt(1 - sinz * sinz);\n switch (this.mode) {\n case mode.OBLIQ:\n r.y = Math.asin(cosz * this.sinph0 + p.y * sinz * this.cosph0 / rh);\n p.y = (cosz - this.sinph0 * Math.sin(r.y)) * rh;\n p.x *= sinz * this.cosph0;\n break;\n case mode.EQUIT:\n r.y = Math.asin(p.y * sinz / rh);\n p.y = cosz * rh;\n p.x *= sinz;\n break;\n case mode.N_POLE:\n r.y = Math.asin(cosz);\n p.y = -p.y;\n break;\n case mode.S_POLE:\n r.y = -Math.asin(cosz);\n break;\n }\n r.x = Math.atan2(p.x, p.y);\n }\n\n p.x = r.x + this.long0;\n p.y = r.y;\n return p;\n}\n\nexport var names = [\"Tilted_Perspective\", \"tpers\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};\n","import hypot from '../common/hypot';\n\nexport function init() {\n this.flip_axis = (this.sweep === 'x' ? 1 : 0);\n this.h = Number(this.h);\n this.radius_g_1 = this.h / this.a;\n\n if (this.radius_g_1 <= 0 || this.radius_g_1 > 1e10) {\n throw new Error();\n }\n\n this.radius_g = 1.0 + this.radius_g_1;\n this.C = this.radius_g * this.radius_g - 1.0;\n\n if (this.es !== 0.0) {\n var one_es = 1.0 - this.es;\n var rone_es = 1 / one_es;\n\n this.radius_p = Math.sqrt(one_es);\n this.radius_p2 = one_es;\n this.radius_p_inv2 = rone_es;\n\n this.shape = 'ellipse'; // Use as a condition in the forward and inverse functions.\n } else {\n this.radius_p = 1.0;\n this.radius_p2 = 1.0;\n this.radius_p_inv2 = 1.0;\n\n this.shape = 'sphere'; // Use as a condition in the forward and inverse functions.\n }\n\n if (!this.title) {\n this.title = \"Geostationary Satellite View\";\n }\n}\n\nfunction forward(p) {\n var lon = p.x;\n var lat = p.y;\n var tmp, v_x, v_y, v_z;\n lon = lon - this.long0;\n\n if (this.shape === 'ellipse') {\n lat = Math.atan(this.radius_p2 * Math.tan(lat));\n var r = this.radius_p / hypot(this.radius_p * Math.cos(lat), Math.sin(lat));\n\n v_x = r * Math.cos(lon) * Math.cos(lat);\n v_y = r * Math.sin(lon) * Math.cos(lat);\n v_z = r * Math.sin(lat);\n\n if (((this.radius_g - v_x) * v_x - v_y * v_y - v_z * v_z * this.radius_p_inv2) < 0.0) {\n p.x = Number.NaN;\n p.y = Number.NaN;\n return p;\n }\n\n tmp = this.radius_g - v_x;\n if (this.flip_axis) {\n p.x = this.radius_g_1 * Math.atan(v_y / hypot(v_z, tmp));\n p.y = this.radius_g_1 * Math.atan(v_z / tmp);\n } else {\n p.x = this.radius_g_1 * Math.atan(v_y / tmp);\n p.y = this.radius_g_1 * Math.atan(v_z / hypot(v_y, tmp));\n }\n } else if (this.shape === 'sphere') {\n tmp = Math.cos(lat);\n v_x = Math.cos(lon) * tmp;\n v_y = Math.sin(lon) * tmp;\n v_z = Math.sin(lat);\n tmp = this.radius_g - v_x;\n\n if (this.flip_axis) {\n p.x = this.radius_g_1 * Math.atan(v_y / hypot(v_z, tmp));\n p.y = this.radius_g_1 * Math.atan(v_z / tmp);\n } else {\n p.x = this.radius_g_1 * Math.atan(v_y / tmp);\n p.y = this.radius_g_1 * Math.atan(v_z / hypot(v_y, tmp));\n }\n }\n p.x = p.x * this.a;\n p.y = p.y * this.a;\n return p;\n}\n\nfunction inverse(p) {\n var v_x = -1.0;\n var v_y = 0.0;\n var v_z = 0.0;\n var a, b, det, k;\n\n p.x = p.x / this.a;\n p.y = p.y / this.a;\n\n if (this.shape === 'ellipse') {\n if (this.flip_axis) {\n v_z = Math.tan(p.y / this.radius_g_1);\n v_y = Math.tan(p.x / this.radius_g_1) * hypot(1.0, v_z);\n } else {\n v_y = Math.tan(p.x / this.radius_g_1);\n v_z = Math.tan(p.y / this.radius_g_1) * hypot(1.0, v_y);\n }\n\n var v_zp = v_z / this.radius_p;\n a = v_y * v_y + v_zp * v_zp + v_x * v_x;\n b = 2 * this.radius_g * v_x;\n det = (b * b) - 4 * a * this.C;\n\n if (det < 0.0) {\n p.x = Number.NaN;\n p.y = Number.NaN;\n return p;\n }\n\n k = (-b - Math.sqrt(det)) / (2.0 * a);\n v_x = this.radius_g + k * v_x;\n v_y *= k;\n v_z *= k;\n\n p.x = Math.atan2(v_y, v_x);\n p.y = Math.atan(v_z * Math.cos(p.x) / v_x);\n p.y = Math.atan(this.radius_p_inv2 * Math.tan(p.y));\n } else if (this.shape === 'sphere') {\n if (this.flip_axis) {\n v_z = Math.tan(p.y / this.radius_g_1);\n v_y = Math.tan(p.x / this.radius_g_1) * Math.sqrt(1.0 + v_z * v_z);\n } else {\n v_y = Math.tan(p.x / this.radius_g_1);\n v_z = Math.tan(p.y / this.radius_g_1) * Math.sqrt(1.0 + v_y * v_y);\n }\n\n a = v_y * v_y + v_z * v_z + v_x * v_x;\n b = 2 * this.radius_g * v_x;\n det = (b * b) - 4 * a * this.C;\n if (det < 0.0) {\n p.x = Number.NaN;\n p.y = Number.NaN;\n return p;\n }\n\n k = (-b - Math.sqrt(det)) / (2.0 * a);\n v_x = this.radius_g + k * v_x;\n v_y *= k;\n v_z *= k;\n\n p.x = Math.atan2(v_y, v_x);\n p.y = Math.atan(v_z * Math.cos(p.x) / v_x);\n }\n p.x = p.x + this.long0;\n return p;\n}\n\nexport var names = [\"Geostationary Satellite View\", \"Geostationary_Satellite\", \"geos\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names,\n};\n\n","/**\n * Copyright 2018 Bernie Jenny, Monash University, Melbourne, Australia.\n *\n * Licensed under the Apache License, Version 2.0 (the \"License\");\n * you may not use this file except in compliance with the License.\n * You may obtain a copy of the License at\n *\n * http://www.apache.org/licenses/LICENSE-2.0\n *\n * Unless required by applicable law or agreed to in writing, software\n * distributed under the License is distributed on an \"AS IS\" BASIS,\n * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n * See the License for the specific language governing permissions and\n * limitations under the License.\n *\n * Equal Earth is a projection inspired by the Robinson projection, but unlike\n * the Robinson projection retains the relative size of areas. The projection\n * was designed in 2018 by Bojan Savric, Tom Patterson and Bernhard Jenny.\n *\n * Publication:\n * Bojan Savric, Tom Patterson & Bernhard Jenny (2018). The Equal Earth map\n * projection, International Journal of Geographical Information Science,\n * DOI: 10.1080/13658816.2018.1504949\n *\n * Code released August 2018\n * Ported to JavaScript and adapted for mapshaper-proj by Matthew Bloch August 2018\n * Modified for proj4js by Andreas Hocevar by Andreas Hocevar March 2024\n */\n\nimport adjust_lon from \"../common/adjust_lon\";\n\nvar A1 = 1.340264,\n A2 = -0.081106,\n A3 = 0.000893,\n A4 = 0.003796,\n M = Math.sqrt(3) / 2.0;\n\nexport function init() {\n this.es = 0;\n this.long0 = this.long0 !== undefined ? this.long0 : 0;\n}\n\nexport function forward(p) {\n var lam = adjust_lon(p.x - this.long0);\n var phi = p.y;\n var paramLat = Math.asin(M * Math.sin(phi)),\n paramLatSq = paramLat * paramLat,\n paramLatPow6 = paramLatSq * paramLatSq * paramLatSq;\n p.x = lam * Math.cos(paramLat) /\n (M * (A1 + 3 * A2 * paramLatSq + paramLatPow6 * (7 * A3 + 9 * A4 * paramLatSq)));\n p.y = paramLat * (A1 + A2 * paramLatSq + paramLatPow6 * (A3 + A4 * paramLatSq));\n\n p.x = this.a * p.x + this.x0;\n p.y = this.a * p.y + this.y0;\n return p;\n}\n\nexport function inverse(p) {\n p.x = (p.x - this.x0) / this.a;\n p.y = (p.y - this.y0) / this.a;\n\n var EPS = 1e-9,\n NITER = 12,\n paramLat = p.y,\n paramLatSq, paramLatPow6, fy, fpy, dlat, i;\n\n for (i = 0; i < NITER; ++i) {\n paramLatSq = paramLat * paramLat;\n paramLatPow6 = paramLatSq * paramLatSq * paramLatSq;\n fy = paramLat * (A1 + A2 * paramLatSq + paramLatPow6 * (A3 + A4 * paramLatSq)) - p.y;\n fpy = A1 + 3 * A2 * paramLatSq + paramLatPow6 * (7 * A3 + 9 * A4 * paramLatSq);\n paramLat -= dlat = fy / fpy;\n if (Math.abs(dlat) < EPS) {\n break;\n }\n }\n paramLatSq = paramLat * paramLat;\n paramLatPow6 = paramLatSq * paramLatSq * paramLatSq;\n p.x = M * p.x * (A1 + 3 * A2 * paramLatSq + paramLatPow6 * (7 * A3 + 9 * A4 * paramLatSq)) /\n Math.cos(paramLat);\n p.y = Math.asin(Math.sin(paramLat) / M);\n\n p.x = adjust_lon(p.x + this.long0);\n return p;\n}\n\nexport var names = [\"eqearth\", \"Equal Earth\", \"Equal_Earth\"];\nexport default {\n init: init,\n forward: forward,\n inverse: inverse,\n names: names\n};","import tmerc from './lib/projections/tmerc';\nimport etmerc from './lib/projections/etmerc';\nimport utm from './lib/projections/utm';\nimport sterea from './lib/projections/sterea';\nimport stere from './lib/projections/stere';\nimport somerc from './lib/projections/somerc';\nimport omerc from './lib/projections/omerc';\nimport lcc from './lib/projections/lcc';\nimport krovak from './lib/projections/krovak';\nimport cass from './lib/projections/cass';\nimport laea from './lib/projections/laea';\nimport aea from './lib/projections/aea';\nimport gnom from './lib/projections/gnom';\nimport cea from './lib/projections/cea';\nimport eqc from './lib/projections/eqc';\nimport poly from './lib/projections/poly';\nimport nzmg from './lib/projections/nzmg';\nimport mill from './lib/projections/mill';\nimport sinu from './lib/projections/sinu';\nimport moll from './lib/projections/moll';\nimport eqdc from './lib/projections/eqdc';\nimport vandg from './lib/projections/vandg';\nimport aeqd from './lib/projections/aeqd';\nimport ortho from './lib/projections/ortho';\nimport qsc from './lib/projections/qsc';\nimport robin from './lib/projections/robin';\nimport geocent from './lib/projections/geocent';\nimport tpers from './lib/projections/tpers';\nimport geos from './lib/projections/geos';\nimport eqearth from './lib/projections/eqearth';\nexport default function(proj4){\n proj4.Proj.projections.add(tmerc);\n proj4.Proj.projections.add(etmerc);\n proj4.Proj.projections.add(utm);\n proj4.Proj.projections.add(sterea);\n proj4.Proj.projections.add(stere);\n proj4.Proj.projections.add(somerc);\n proj4.Proj.projections.add(omerc);\n proj4.Proj.projections.add(lcc);\n proj4.Proj.projections.add(krovak);\n proj4.Proj.projections.add(cass);\n proj4.Proj.projections.add(laea);\n proj4.Proj.projections.add(aea);\n proj4.Proj.projections.add(gnom);\n proj4.Proj.projections.add(cea);\n proj4.Proj.projections.add(eqc);\n proj4.Proj.projections.add(poly);\n proj4.Proj.projections.add(nzmg);\n proj4.Proj.projections.add(mill);\n proj4.Proj.projections.add(sinu);\n proj4.Proj.projections.add(moll);\n proj4.Proj.projections.add(eqdc);\n proj4.Proj.projections.add(vandg);\n proj4.Proj.projections.add(aeqd);\n proj4.Proj.projections.add(ortho);\n proj4.Proj.projections.add(qsc);\n proj4.Proj.projections.add(robin);\n proj4.Proj.projections.add(geocent);\n proj4.Proj.projections.add(tpers);\n proj4.Proj.projections.add(geos);\n proj4.Proj.projections.add(eqearth);\n}","import proj4 from './core';\nimport Proj from \"./Proj\";\nimport Point from \"./Point\";\nimport common from \"./common/toPoint\";\nimport defs from \"./defs\";\nimport nadgrid from \"./nadgrid\";\nimport transform from \"./transform\";\nimport mgrs from \"mgrs\";\nimport includedProjections from \"../projs\";\n\nproj4.defaultDatum = 'WGS84'; //default datum\nproj4.Proj = Proj;\nproj4.WGS84 = new proj4.Proj('WGS84');\nproj4.Point = Point;\nproj4.toPoint = common;\nproj4.defs = defs;\nproj4.nadgrid = nadgrid;\nproj4.transform = transform;\nproj4.mgrs = mgrs;\nproj4.version = '__VERSION__';\nincludedProjections(proj4);\nexport default proj4;\n","import { ref } from \"vue\"\r\nconst bus = ref(new Map())\r\n\r\nexport default function useEventsBus() {\r\n function emit(event, ...args) {\r\n bus.value.set(event, args)\r\n }\r\n\r\n return {\r\n emit,\r\n bus\r\n }\r\n}\r\n","\r\n\r\n\r\n\r\n","\r\n\r\n\r\n\r\n","export enum GeometryTypes {\r\n Point = \"Point\",\r\n MultiPoint = \"MultiPoint\",\r\n LineString = \"LineString\",\r\n MultiLineString = \"MultiLineString\",\r\n Polygon = \"Polygon\",\r\n MultiPolygon = \"MultiPolygon\",\r\n GeometryCollection = \"GeometryCollection\"\r\n }\r\n\r\nexport enum AreaTypes {\r\n Municipality = 0,\r\n Province = 1,\r\n Country = 2\r\n }\r\n\r\nexport enum MarkerColors {\r\n DarkBlue = \"002C74\",\r\n Blue = \"0058B1\",\r\n LightBlue = \"008DE3\",\r\n Turquoise = \"026273\",\r\n LightTurquoise = \"00A2A5\",\r\n Green = \"056805\",\r\n Purple = \"820084\",\r\n DarkRed = \"9E003B\",\r\n Red = \"E90008\",\r\n Pink = \"C50084\",\r\n Grey = \"555555\"\r\n }\r\n\r\nexport enum TimeOfDay {\r\n Daytime = 1,\r\n Evening = 2,\r\n Night = 3\r\n}\r\n","import { MarkerColors } from \"./enums\"\r\n\r\n// export default class MarkerUtils extends Vue {\r\nexport default class MarkerUtils {\r\n constructor(\r\n contentServiceUrl: string,\r\n timestamp: string) {\r\n this.contentServiceUrl = contentServiceUrl\r\n this.timestamp = timestamp\r\n }\r\n\r\n contentServiceUrl: string\r\n timestamp: string\r\n\r\n private darkRedMarker: string = \"\"\r\n public createDarkRedMarker(): string {\r\n if (this.darkRedMarker === \"\") {\r\n this.darkRedMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri9E003B.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.darkRedMarker\r\n }\r\n\r\n private redMarker: string = \"\"\r\n public createRedMarker(): string {\r\n if (this.redMarker === \"\") {\r\n this.redMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeriE90008.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.redMarker\r\n }\r\n\r\n private turquoiseMarker: string = \"\"\r\n public createTurquoiseMarker(): string {\r\n if (this.turquoiseMarker === \"\") {\r\n this.turquoiseMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri026273.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.turquoiseMarker\r\n }\r\n\r\n private lightTurquoiseMarker: string = \"\"\r\n public createLightTurquoiseMarker(): string {\r\n if (this.lightTurquoiseMarker === \"\") {\r\n this.lightTurquoiseMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri00A2A5.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.lightTurquoiseMarker\r\n }\r\n\r\n private darkBlueMarker: string = \"\"\r\n public createDarkBlueMarker(): string {\r\n if (this.darkBlueMarker === \"\") {\r\n this.darkBlueMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri002C74.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.darkBlueMarker\r\n }\r\n\r\n private blueMarker: string = \"\"\r\n public createBlueMarker(): string {\r\n if (this.blueMarker === \"\") {\r\n this.blueMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri0058B1.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.blueMarker\r\n }\r\n\r\n private lightBlueMarker: string = \"\"\r\n public createLightBlueMarker(): string {\r\n if (this.lightBlueMarker === \"\") {\r\n this.lightBlueMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri008DE3.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.lightBlueMarker\r\n }\r\n\r\n private greenMarker: string = \"\"\r\n public createGreenMarker(): string {\r\n if (this.greenMarker === \"\") {\r\n this.greenMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri056805.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.greenMarker\r\n }\r\n\r\n private pinkMarker: string = \"\"\r\n public createPinkMarker(): string {\r\n if (this.pinkMarker === \"\") {\r\n this.pinkMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeriC50084.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.pinkMarker\r\n }\r\n\r\n private greyMarker: string = \"\"\r\n public createGreyMarker(): string {\r\n if (this.greyMarker === \"\") {\r\n this.greyMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri555555.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.greyMarker\r\n }\r\n\r\n private grayMarker: string = \"\"\r\n public createGrayMarker(): string {\r\n if (this.grayMarker === \"\") {\r\n this.grayMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri056805.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.grayMarker\r\n }\r\n\r\n private blackMarker: string = \"\"\r\n public createBlackMarker(): string {\r\n if (this.blackMarker === \"\") {\r\n this.blackMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri464646.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.blackMarker\r\n }\r\n\r\n private darkBlackMarker: string = \"\"\r\n public createDarkBlackMarker(): string {\r\n if (this.darkBlackMarker === \"\") {\r\n this.darkBlackMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri_musta.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.darkBlackMarker\r\n }\r\n\r\n private purpleMarker: string = \"\"\r\n public createPurpleMarker(): string {\r\n if (this.purpleMarker === \"\") {\r\n this.purpleMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri820084.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.purpleMarker\r\n }\r\n\r\n private darkRedSelectedMarker: string = \"\"\r\n public createDarkRedSelectedMarker(): string {\r\n if (this.darkRedSelectedMarker === \"\") {\r\n this.darkRedSelectedMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri_korostettu_9E003B.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.darkRedSelectedMarker\r\n }\r\n\r\n private redSelectedMarker: string = \"\"\r\n public createRedSelectedMarker(): string {\r\n if (this.redSelectedMarker === \"\") {\r\n this.redSelectedMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri_korostettu_E90008.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.redSelectedMarker\r\n }\r\n\r\n private turquoiseSelectedMarker: string = \"\"\r\n public createTurquoiseSelectedMarker(): string {\r\n if (this.turquoiseSelectedMarker === \"\") {\r\n this.turquoiseSelectedMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri_korostettu_026273.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.turquoiseSelectedMarker\r\n }\r\n\r\n private lightTurquoiseSelectedMarker: string = \"\"\r\n public createLightTurquoiseSelectedMarker(): string {\r\n if (this.lightTurquoiseSelectedMarker === \"\") {\r\n this.lightTurquoiseSelectedMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri_korostettu_00A2A5.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.lightTurquoiseSelectedMarker\r\n }\r\n\r\n private darkBlueSelectedMarker: string = \"\"\r\n public createDarkBlueSelectedMarker(): string {\r\n if (this.darkBlueSelectedMarker === \"\") {\r\n this.darkBlueSelectedMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri_korostettu_002C74.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.darkBlueSelectedMarker\r\n }\r\n\r\n private blueSelectedMarker: string = \"\"\r\n public createBlueSelectedMarker(): string {\r\n if (this.blueSelectedMarker === \"\") {\r\n this.blueSelectedMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri_korostettu_0058B1.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.blueSelectedMarker\r\n }\r\n\r\n private lightBlueSelectedMarker: string = \"\"\r\n public createLightBlueSelectedMarker(): string {\r\n if (this.lightBlueSelectedMarker === \"\") {\r\n this.lightBlueSelectedMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri_korostettu_008DE3.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.lightBlueSelectedMarker\r\n }\r\n\r\n private greenSelectedMarker: string = \"\"\r\n public createGreenSelectedMarker(): string {\r\n if (this.greenSelectedMarker === \"\") {\r\n this.greenSelectedMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri_korostettu_056805.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.greenSelectedMarker\r\n }\r\n\r\n private pinkSelectedMarker: string = \"\"\r\n public createPinkSelectedMarker(): string {\r\n if (this.pinkSelectedMarker === \"\") {\r\n this.pinkSelectedMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri_korostettu_C50084.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.pinkSelectedMarker\r\n }\r\n\r\n private greySelectedMarker: string = \"\"\r\n public createGreySelectedMarker(): string {\r\n if (this.greySelectedMarker === \"\") {\r\n this.greySelectedMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri_korostettu_555555.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.greySelectedMarker\r\n }\r\n\r\n private purpleSelectedMarker: string = \"\"\r\n public createPurpleSelectedMarker(): string {\r\n if (this.purpleSelectedMarker === \"\") {\r\n this.purpleSelectedMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri_korostettu_820084.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.purpleSelectedMarker\r\n }\r\n\r\n private darkBlackSelectedMarker: string = \"\"\r\n public createDarkBlackSelectedMarker(): string {\r\n if (this.darkBlackSelectedMarker === \"\") {\r\n this.darkBlackSelectedMarker = this.contentServiceUrl + \"/Content/icons/svg/markkeri_korostettu_FFFFFF.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.darkBlackSelectedMarker\r\n }\r\n\r\n private locationMarker: string = \"\"\r\n public createLocationMarker(): string {\r\n if (this.locationMarker === \"\") {\r\n this.locationMarker = this.contentServiceUrl + \"/Content/icons/svg/location.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.locationMarker\r\n }\r\n\r\n private locateMarker: string = \"\"\r\n public createLocateMarker(): string {\r\n if (this.locateMarker === \"\") {\r\n this.locateMarker = this.contentServiceUrl + \"/Content/icons/svg/location_v2.svg\" + \"?\" + this.timestamp\r\n }\r\n return this.locateMarker\r\n }\r\n\r\n public createLocationMarkerByColor(color): string {\r\n if (color != null && color.startsWith(\"#\")) {\r\n color = color.substring(1, color.length)\r\n }\r\n\r\n switch (color) {\r\n case MarkerColors.Blue:\r\n return this.createBlueMarker()\r\n case MarkerColors.LightBlue:\r\n return this.createLightBlueMarker()\r\n case MarkerColors.DarkBlue:\r\n return this.createDarkBlueMarker()\r\n case MarkerColors.Purple:\r\n return this.createPurpleMarker()\r\n case MarkerColors.Green:\r\n return this.createGreenMarker()\r\n case MarkerColors.Red:\r\n return this.createRedMarker()\r\n case MarkerColors.DarkRed:\r\n return this.createDarkRedMarker()\r\n case MarkerColors.Turquoise:\r\n return this.createTurquoiseMarker()\r\n case MarkerColors.LightTurquoise:\r\n return this.createLightTurquoiseMarker()\r\n case MarkerColors.Pink:\r\n return this.createPinkMarker()\r\n case MarkerColors.Grey:\r\n return this.createGreyMarker()\r\n default:\r\n return this.createDarkBlackMarker()\r\n }\r\n }\r\n\r\n public createSelectedLocationMarkerByColor(color): string {\r\n if (color != null && color.startsWith(\"#\")) {\r\n color = color.substring(1, color.length)\r\n }\r\n\r\n switch (color) {\r\n case MarkerColors.Blue:\r\n return this.createBlueSelectedMarker()\r\n case MarkerColors.LightBlue:\r\n return this.createLightBlueSelectedMarker()\r\n case MarkerColors.DarkBlue:\r\n return this.createDarkBlueSelectedMarker()\r\n case MarkerColors.Purple:\r\n return this.createPurpleSelectedMarker()\r\n case MarkerColors.Green:\r\n return this.createGreenSelectedMarker()\r\n case MarkerColors.Red:\r\n return this.createRedSelectedMarker()\r\n case MarkerColors.DarkRed:\r\n return this.createDarkRedSelectedMarker()\r\n case MarkerColors.Turquoise:\r\n return this.createTurquoiseSelectedMarker()\r\n case MarkerColors.LightTurquoise:\r\n return this.createLightTurquoiseSelectedMarker()\r\n case MarkerColors.Pink:\r\n return this.createPinkSelectedMarker()\r\n case MarkerColors.Grey:\r\n return this.createGreySelectedMarker()\r\n default:\r\n return this.createDarkBlackSelectedMarker()\r\n }\r\n }\r\n}\r\n","\r\n\r\n\r\n\r\n\r\n","\r\n\r\n\r\n\r\n\r\n","\r\n\r\n\r\n\r\n\r\n","\r\n\r\n\r\n\r\n\r\n","export default class DropDownListModel {\r\n constructor(\r\n labelText: string,\r\n identifier: string,\r\n checked: boolean) {\r\n this.labelText = labelText\r\n this.identifier = identifier\r\n this.checked = checked\r\n }\r\n\r\n labelText: string\r\n identifier: string\r\n checked: boolean\r\n\r\n static createEmpty(): DropDownListModel {\r\n return new DropDownListModel(\"\", \"\", false)\r\n }\r\n}\r\n","\r\n\r\n\r\n\r\n\r\n","\r\n\r\n\r\n\r\n\r\n","\r\n\r\n\r\n\r\n\r\n","\r\n\r\n\r\n\r\n\r\n","\r\n\r\n\r\n\r\n\r\n","\r\n\r\n\r\n\r\n\r\n","/* @preserve\n * Leaflet 1.9.4, a JS library for interactive maps. https://leafletjs.com\n * (c) 2010-2023 Vladimir Agafonkin, (c) 2010-2011 CloudMade\n */\n\n(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports) :\n typeof define === 'function' && define.amd ? define(['exports'], factory) :\n (global = typeof globalThis !== 'undefined' ? globalThis : global || self, factory(global.leaflet = {}));\n})(this, (function (exports) { 'use strict';\n\n var version = \"1.9.4\";\n\n /*\r\n * @namespace Util\r\n *\r\n * Various utility functions, used by Leaflet internally.\r\n */\r\n\r\n // @function extend(dest: Object, src?: Object): Object\r\n // Merges the properties of the `src` object (or multiple objects) into `dest` object and returns the latter. Has an `L.extend` shortcut.\r\n function extend(dest) {\r\n \tvar i, j, len, src;\r\n\r\n \tfor (j = 1, len = arguments.length; j < len; j++) {\r\n \t\tsrc = arguments[j];\r\n \t\tfor (i in src) {\r\n \t\t\tdest[i] = src[i];\r\n \t\t}\r\n \t}\r\n \treturn dest;\r\n }\r\n\r\n // @function create(proto: Object, properties?: Object): Object\r\n // Compatibility polyfill for [Object.create](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Object/create)\r\n var create$2 = Object.create || (function () {\r\n \tfunction F() {}\r\n \treturn function (proto) {\r\n \t\tF.prototype = proto;\r\n \t\treturn new F();\r\n \t};\r\n })();\r\n\r\n // @function bind(fn: Function, …): Function\r\n // Returns a new function bound to the arguments passed, like [Function.prototype.bind](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Function/bind).\r\n // Has a `L.bind()` shortcut.\r\n function bind(fn, obj) {\r\n \tvar slice = Array.prototype.slice;\r\n\r\n \tif (fn.bind) {\r\n \t\treturn fn.bind.apply(fn, slice.call(arguments, 1));\r\n \t}\r\n\r\n \tvar args = slice.call(arguments, 2);\r\n\r\n \treturn function () {\r\n \t\treturn fn.apply(obj, args.length ? args.concat(slice.call(arguments)) : arguments);\r\n \t};\r\n }\r\n\r\n // @property lastId: Number\r\n // Last unique ID used by [`stamp()`](#util-stamp)\r\n var lastId = 0;\r\n\r\n // @function stamp(obj: Object): Number\r\n // Returns the unique ID of an object, assigning it one if it doesn't have it.\r\n function stamp(obj) {\r\n \tif (!('_leaflet_id' in obj)) {\r\n \t\tobj['_leaflet_id'] = ++lastId;\r\n \t}\r\n \treturn obj._leaflet_id;\r\n }\r\n\r\n // @function throttle(fn: Function, time: Number, context: Object): Function\r\n // Returns a function which executes function `fn` with the given scope `context`\r\n // (so that the `this` keyword refers to `context` inside `fn`'s code). The function\r\n // `fn` will be called no more than one time per given amount of `time`. The arguments\r\n // received by the bound function will be any arguments passed when binding the\r\n // function, followed by any arguments passed when invoking the bound function.\r\n // Has an `L.throttle` shortcut.\r\n function throttle(fn, time, context) {\r\n \tvar lock, args, wrapperFn, later;\r\n\r\n \tlater = function () {\r\n \t\t// reset lock and call if queued\r\n \t\tlock = false;\r\n \t\tif (args) {\r\n \t\t\twrapperFn.apply(context, args);\r\n \t\t\targs = false;\r\n \t\t}\r\n \t};\r\n\r\n \twrapperFn = function () {\r\n \t\tif (lock) {\r\n \t\t\t// called too soon, queue to call later\r\n \t\t\targs = arguments;\r\n\r\n \t\t} else {\r\n \t\t\t// call and lock until later\r\n \t\t\tfn.apply(context, arguments);\r\n \t\t\tsetTimeout(later, time);\r\n \t\t\tlock = true;\r\n \t\t}\r\n \t};\r\n\r\n \treturn wrapperFn;\r\n }\r\n\r\n // @function wrapNum(num: Number, range: Number[], includeMax?: Boolean): Number\r\n // Returns the number `num` modulo `range` in such a way so it lies within\r\n // `range[0]` and `range[1]`. The returned value will be always smaller than\r\n // `range[1]` unless `includeMax` is set to `true`.\r\n function wrapNum(x, range, includeMax) {\r\n \tvar max = range[1],\r\n \t min = range[0],\r\n \t d = max - min;\r\n \treturn x === max && includeMax ? x : ((x - min) % d + d) % d + min;\r\n }\r\n\r\n // @function falseFn(): Function\r\n // Returns a function which always returns `false`.\r\n function falseFn() { return false; }\r\n\r\n // @function formatNum(num: Number, precision?: Number|false): Number\r\n // Returns the number `num` rounded with specified `precision`.\r\n // The default `precision` value is 6 decimal places.\r\n // `false` can be passed to skip any processing (can be useful to avoid round-off errors).\r\n function formatNum(num, precision) {\r\n \tif (precision === false) { return num; }\r\n \tvar pow = Math.pow(10, precision === undefined ? 6 : precision);\r\n \treturn Math.round(num * pow) / pow;\r\n }\r\n\r\n // @function trim(str: String): String\r\n // Compatibility polyfill for [String.prototype.trim](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/String/Trim)\r\n function trim(str) {\r\n \treturn str.trim ? str.trim() : str.replace(/^\\s+|\\s+$/g, '');\r\n }\r\n\r\n // @function splitWords(str: String): String[]\r\n // Trims and splits the string on whitespace and returns the array of parts.\r\n function splitWords(str) {\r\n \treturn trim(str).split(/\\s+/);\r\n }\r\n\r\n // @function setOptions(obj: Object, options: Object): Object\r\n // Merges the given properties to the `options` of the `obj` object, returning the resulting options. See `Class options`. Has an `L.setOptions` shortcut.\r\n function setOptions(obj, options) {\r\n \tif (!Object.prototype.hasOwnProperty.call(obj, 'options')) {\r\n \t\tobj.options = obj.options ? create$2(obj.options) : {};\r\n \t}\r\n \tfor (var i in options) {\r\n \t\tobj.options[i] = options[i];\r\n \t}\r\n \treturn obj.options;\r\n }\r\n\r\n // @function getParamString(obj: Object, existingUrl?: String, uppercase?: Boolean): String\r\n // Converts an object into a parameter URL string, e.g. `{a: \"foo\", b: \"bar\"}`\r\n // translates to `'?a=foo&b=bar'`. If `existingUrl` is set, the parameters will\r\n // be appended at the end. If `uppercase` is `true`, the parameter names will\r\n // be uppercased (e.g. `'?A=foo&B=bar'`)\r\n function getParamString(obj, existingUrl, uppercase) {\r\n \tvar params = [];\r\n \tfor (var i in obj) {\r\n \t\tparams.push(encodeURIComponent(uppercase ? i.toUpperCase() : i) + '=' + encodeURIComponent(obj[i]));\r\n \t}\r\n \treturn ((!existingUrl || existingUrl.indexOf('?') === -1) ? '?' : '&') + params.join('&');\r\n }\r\n\r\n var templateRe = /\\{ *([\\w_ -]+) *\\}/g;\r\n\r\n // @function template(str: String, data: Object): String\r\n // Simple templating facility, accepts a template string of the form `'Hello {a}, {b}'`\r\n // and a data object like `{a: 'foo', b: 'bar'}`, returns evaluated string\r\n // `('Hello foo, bar')`. You can also specify functions instead of strings for\r\n // data values — they will be evaluated passing `data` as an argument.\r\n function template(str, data) {\r\n \treturn str.replace(templateRe, function (str, key) {\r\n \t\tvar value = data[key];\r\n\r\n \t\tif (value === undefined) {\r\n \t\t\tthrow new Error('No value provided for variable ' + str);\r\n\r\n \t\t} else if (typeof value === 'function') {\r\n \t\t\tvalue = value(data);\r\n \t\t}\r\n \t\treturn value;\r\n \t});\r\n }\r\n\r\n // @function isArray(obj): Boolean\r\n // Compatibility polyfill for [Array.isArray](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Array/isArray)\r\n var isArray = Array.isArray || function (obj) {\r\n \treturn (Object.prototype.toString.call(obj) === '[object Array]');\r\n };\r\n\r\n // @function indexOf(array: Array, el: Object): Number\r\n // Compatibility polyfill for [Array.prototype.indexOf](https://developer.mozilla.org/docs/Web/JavaScript/Reference/Global_Objects/Array/indexOf)\r\n function indexOf(array, el) {\r\n \tfor (var i = 0; i < array.length; i++) {\r\n \t\tif (array[i] === el) { return i; }\r\n \t}\r\n \treturn -1;\r\n }\r\n\r\n // @property emptyImageUrl: String\r\n // Data URI string containing a base64-encoded empty GIF image.\r\n // Used as a hack to free memory from unused images on WebKit-powered\r\n // mobile devices (by setting image `src` to this string).\r\n var emptyImageUrl = 'data:image/gif;base64,R0lGODlhAQABAAD/ACwAAAAAAQABAAACADs=';\r\n\r\n // inspired by https://paulirish.com/2011/requestanimationframe-for-smart-animating/\r\n\r\n function getPrefixed(name) {\r\n \treturn window['webkit' + name] || window['moz' + name] || window['ms' + name];\r\n }\r\n\r\n var lastTime = 0;\r\n\r\n // fallback for IE 7-8\r\n function timeoutDefer(fn) {\r\n \tvar time = +new Date(),\r\n \t timeToCall = Math.max(0, 16 - (time - lastTime));\r\n\r\n \tlastTime = time + timeToCall;\r\n \treturn window.setTimeout(fn, timeToCall);\r\n }\r\n\r\n var requestFn = window.requestAnimationFrame || getPrefixed('RequestAnimationFrame') || timeoutDefer;\r\n var cancelFn = window.cancelAnimationFrame || getPrefixed('CancelAnimationFrame') ||\r\n \t\tgetPrefixed('CancelRequestAnimationFrame') || function (id) { window.clearTimeout(id); };\r\n\r\n // @function requestAnimFrame(fn: Function, context?: Object, immediate?: Boolean): Number\r\n // Schedules `fn` to be executed when the browser repaints. `fn` is bound to\r\n // `context` if given. When `immediate` is set, `fn` is called immediately if\r\n // the browser doesn't have native support for\r\n // [`window.requestAnimationFrame`](https://developer.mozilla.org/docs/Web/API/window/requestAnimationFrame),\r\n // otherwise it's delayed. Returns a request ID that can be used to cancel the request.\r\n function requestAnimFrame(fn, context, immediate) {\r\n \tif (immediate && requestFn === timeoutDefer) {\r\n \t\tfn.call(context);\r\n \t} else {\r\n \t\treturn requestFn.call(window, bind(fn, context));\r\n \t}\r\n }\r\n\r\n // @function cancelAnimFrame(id: Number): undefined\r\n // Cancels a previous `requestAnimFrame`. See also [window.cancelAnimationFrame](https://developer.mozilla.org/docs/Web/API/window/cancelAnimationFrame).\r\n function cancelAnimFrame(id) {\r\n \tif (id) {\r\n \t\tcancelFn.call(window, id);\r\n \t}\r\n }\n\n var Util = {\n __proto__: null,\n extend: extend,\n create: create$2,\n bind: bind,\n get lastId () { return lastId; },\n stamp: stamp,\n throttle: throttle,\n wrapNum: wrapNum,\n falseFn: falseFn,\n formatNum: formatNum,\n trim: trim,\n splitWords: splitWords,\n setOptions: setOptions,\n getParamString: getParamString,\n template: template,\n isArray: isArray,\n indexOf: indexOf,\n emptyImageUrl: emptyImageUrl,\n requestFn: requestFn,\n cancelFn: cancelFn,\n requestAnimFrame: requestAnimFrame,\n cancelAnimFrame: cancelAnimFrame\n };\n\n // @class Class\r\n // @aka L.Class\r\n\r\n // @section\r\n // @uninheritable\r\n\r\n // Thanks to John Resig and Dean Edwards for inspiration!\r\n\r\n function Class() {}\r\n\r\n Class.extend = function (props) {\r\n\r\n \t// @function extend(props: Object): Function\r\n \t// [Extends the current class](#class-inheritance) given the properties to be included.\r\n \t// Returns a Javascript function that is a class constructor (to be called with `new`).\r\n \tvar NewClass = function () {\r\n\r\n \t\tsetOptions(this);\r\n\r\n \t\t// call the constructor\r\n \t\tif (this.initialize) {\r\n \t\t\tthis.initialize.apply(this, arguments);\r\n \t\t}\r\n\r\n \t\t// call all constructor hooks\r\n \t\tthis.callInitHooks();\r\n \t};\r\n\r\n \tvar parentProto = NewClass.__super__ = this.prototype;\r\n\r\n \tvar proto = create$2(parentProto);\r\n \tproto.constructor = NewClass;\r\n\r\n \tNewClass.prototype = proto;\r\n\r\n \t// inherit parent's statics\r\n \tfor (var i in this) {\r\n \t\tif (Object.prototype.hasOwnProperty.call(this, i) && i !== 'prototype' && i !== '__super__') {\r\n \t\t\tNewClass[i] = this[i];\r\n \t\t}\r\n \t}\r\n\r\n \t// mix static properties into the class\r\n \tif (props.statics) {\r\n \t\textend(NewClass, props.statics);\r\n \t}\r\n\r\n \t// mix includes into the prototype\r\n \tif (props.includes) {\r\n \t\tcheckDeprecatedMixinEvents(props.includes);\r\n \t\textend.apply(null, [proto].concat(props.includes));\r\n \t}\r\n\r\n \t// mix given properties into the prototype\r\n \textend(proto, props);\r\n \tdelete proto.statics;\r\n \tdelete proto.includes;\r\n\r\n \t// merge options\r\n \tif (proto.options) {\r\n \t\tproto.options = parentProto.options ? create$2(parentProto.options) : {};\r\n \t\textend(proto.options, props.options);\r\n \t}\r\n\r\n \tproto._initHooks = [];\r\n\r\n \t// add method for calling all hooks\r\n \tproto.callInitHooks = function () {\r\n\r\n \t\tif (this._initHooksCalled) { return; }\r\n\r\n \t\tif (parentProto.callInitHooks) {\r\n \t\t\tparentProto.callInitHooks.call(this);\r\n \t\t}\r\n\r\n \t\tthis._initHooksCalled = true;\r\n\r\n \t\tfor (var i = 0, len = proto._initHooks.length; i < len; i++) {\r\n \t\t\tproto._initHooks[i].call(this);\r\n \t\t}\r\n \t};\r\n\r\n \treturn NewClass;\r\n };\r\n\r\n\r\n // @function include(properties: Object): this\r\n // [Includes a mixin](#class-includes) into the current class.\r\n Class.include = function (props) {\r\n \tvar parentOptions = this.prototype.options;\r\n \textend(this.prototype, props);\r\n \tif (props.options) {\r\n \t\tthis.prototype.options = parentOptions;\r\n \t\tthis.mergeOptions(props.options);\r\n \t}\r\n \treturn this;\r\n };\r\n\r\n // @function mergeOptions(options: Object): this\r\n // [Merges `options`](#class-options) into the defaults of the class.\r\n Class.mergeOptions = function (options) {\r\n \textend(this.prototype.options, options);\r\n \treturn this;\r\n };\r\n\r\n // @function addInitHook(fn: Function): this\r\n // Adds a [constructor hook](#class-constructor-hooks) to the class.\r\n Class.addInitHook = function (fn) { // (Function) || (String, args...)\r\n \tvar args = Array.prototype.slice.call(arguments, 1);\r\n\r\n \tvar init = typeof fn === 'function' ? fn : function () {\r\n \t\tthis[fn].apply(this, args);\r\n \t};\r\n\r\n \tthis.prototype._initHooks = this.prototype._initHooks || [];\r\n \tthis.prototype._initHooks.push(init);\r\n \treturn this;\r\n };\r\n\r\n function checkDeprecatedMixinEvents(includes) {\r\n \t/* global L: true */\r\n \tif (typeof L === 'undefined' || !L || !L.Mixin) { return; }\r\n\r\n \tincludes = isArray(includes) ? includes : [includes];\r\n\r\n \tfor (var i = 0; i < includes.length; i++) {\r\n \t\tif (includes[i] === L.Mixin.Events) {\r\n \t\t\tconsole.warn('Deprecated include of L.Mixin.Events: ' +\r\n \t\t\t\t'this property will be removed in future releases, ' +\r\n \t\t\t\t'please inherit from L.Evented instead.', new Error().stack);\r\n \t\t}\r\n \t}\r\n }\n\n /*\r\n * @class Evented\r\n * @aka L.Evented\r\n * @inherits Class\r\n *\r\n * A set of methods shared between event-powered classes (like `Map` and `Marker`). Generally, events allow you to execute some function when something happens with an object (e.g. the user clicks on the map, causing the map to fire `'click'` event).\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * map.on('click', function(e) {\r\n * \talert(e.latlng);\r\n * } );\r\n * ```\r\n *\r\n * Leaflet deals with event listeners by reference, so if you want to add a listener and then remove it, define it as a function:\r\n *\r\n * ```js\r\n * function onClick(e) { ... }\r\n *\r\n * map.on('click', onClick);\r\n * map.off('click', onClick);\r\n * ```\r\n */\r\n\r\n var Events = {\r\n \t/* @method on(type: String, fn: Function, context?: Object): this\r\n \t * Adds a listener function (`fn`) to a particular event type of the object. You can optionally specify the context of the listener (object the this keyword will point to). You can also pass several space-separated types (e.g. `'click dblclick'`).\r\n \t *\r\n \t * @alternative\r\n \t * @method on(eventMap: Object): this\r\n \t * Adds a set of type/listener pairs, e.g. `{click: onClick, mousemove: onMouseMove}`\r\n \t */\r\n \ton: function (types, fn, context) {\r\n\r\n \t\t// types can be a map of types/handlers\r\n \t\tif (typeof types === 'object') {\r\n \t\t\tfor (var type in types) {\r\n \t\t\t\t// we don't process space-separated events here for performance;\r\n \t\t\t\t// it's a hot path since Layer uses the on(obj) syntax\r\n \t\t\t\tthis._on(type, types[type], fn);\r\n \t\t\t}\r\n\r\n \t\t} else {\r\n \t\t\t// types can be a string of space-separated words\r\n \t\t\ttypes = splitWords(types);\r\n\r\n \t\t\tfor (var i = 0, len = types.length; i < len; i++) {\r\n \t\t\t\tthis._on(types[i], fn, context);\r\n \t\t\t}\r\n \t\t}\r\n\r\n \t\treturn this;\r\n \t},\r\n\r\n \t/* @method off(type: String, fn?: Function, context?: Object): this\r\n \t * Removes a previously added listener function. If no function is specified, it will remove all the listeners of that particular event from the object. Note that if you passed a custom context to `on`, you must pass the same context to `off` in order to remove the listener.\r\n \t *\r\n \t * @alternative\r\n \t * @method off(eventMap: Object): this\r\n \t * Removes a set of type/listener pairs.\r\n \t *\r\n \t * @alternative\r\n \t * @method off: this\r\n \t * Removes all listeners to all events on the object. This includes implicitly attached events.\r\n \t */\r\n \toff: function (types, fn, context) {\r\n\r\n \t\tif (!arguments.length) {\r\n \t\t\t// clear all listeners if called without arguments\r\n \t\t\tdelete this._events;\r\n\r\n \t\t} else if (typeof types === 'object') {\r\n \t\t\tfor (var type in types) {\r\n \t\t\t\tthis._off(type, types[type], fn);\r\n \t\t\t}\r\n\r\n \t\t} else {\r\n \t\t\ttypes = splitWords(types);\r\n\r\n \t\t\tvar removeAll = arguments.length === 1;\r\n \t\t\tfor (var i = 0, len = types.length; i < len; i++) {\r\n \t\t\t\tif (removeAll) {\r\n \t\t\t\t\tthis._off(types[i]);\r\n \t\t\t\t} else {\r\n \t\t\t\t\tthis._off(types[i], fn, context);\r\n \t\t\t\t}\r\n \t\t\t}\r\n \t\t}\r\n\r\n \t\treturn this;\r\n \t},\r\n\r\n \t// attach listener (without syntactic sugar now)\r\n \t_on: function (type, fn, context, _once) {\r\n \t\tif (typeof fn !== 'function') {\r\n \t\t\tconsole.warn('wrong listener type: ' + typeof fn);\r\n \t\t\treturn;\r\n \t\t}\r\n\r\n \t\t// check if fn already there\r\n \t\tif (this._listens(type, fn, context) !== false) {\r\n \t\t\treturn;\r\n \t\t}\r\n\r\n \t\tif (context === this) {\r\n \t\t\t// Less memory footprint.\r\n \t\t\tcontext = undefined;\r\n \t\t}\r\n\r\n \t\tvar newListener = {fn: fn, ctx: context};\r\n \t\tif (_once) {\r\n \t\t\tnewListener.once = true;\r\n \t\t}\r\n\r\n \t\tthis._events = this._events || {};\r\n \t\tthis._events[type] = this._events[type] || [];\r\n \t\tthis._events[type].push(newListener);\r\n \t},\r\n\r\n \t_off: function (type, fn, context) {\r\n \t\tvar listeners,\r\n \t\t i,\r\n \t\t len;\r\n\r\n \t\tif (!this._events) {\r\n \t\t\treturn;\r\n \t\t}\r\n\r\n \t\tlisteners = this._events[type];\r\n \t\tif (!listeners) {\r\n \t\t\treturn;\r\n \t\t}\r\n\r\n \t\tif (arguments.length === 1) { // remove all\r\n \t\t\tif (this._firingCount) {\r\n \t\t\t\t// Set all removed listeners to noop\r\n \t\t\t\t// so they are not called if remove happens in fire\r\n \t\t\t\tfor (i = 0, len = listeners.length; i < len; i++) {\r\n \t\t\t\t\tlisteners[i].fn = falseFn;\r\n \t\t\t\t}\r\n \t\t\t}\r\n \t\t\t// clear all listeners for a type if function isn't specified\r\n \t\t\tdelete this._events[type];\r\n \t\t\treturn;\r\n \t\t}\r\n\r\n \t\tif (typeof fn !== 'function') {\r\n \t\t\tconsole.warn('wrong listener type: ' + typeof fn);\r\n \t\t\treturn;\r\n \t\t}\r\n\r\n \t\t// find fn and remove it\r\n \t\tvar index = this._listens(type, fn, context);\r\n \t\tif (index !== false) {\r\n \t\t\tvar listener = listeners[index];\r\n \t\t\tif (this._firingCount) {\r\n \t\t\t\t// set the removed listener to noop so that's not called if remove happens in fire\r\n \t\t\t\tlistener.fn = falseFn;\r\n\r\n \t\t\t\t/* copy array in case events are being fired */\r\n \t\t\t\tthis._events[type] = listeners = listeners.slice();\r\n \t\t\t}\r\n \t\t\tlisteners.splice(index, 1);\r\n \t\t}\r\n \t},\r\n\r\n \t// @method fire(type: String, data?: Object, propagate?: Boolean): this\r\n \t// Fires an event of the specified type. You can optionally provide a data\r\n \t// object — the first argument of the listener function will contain its\r\n \t// properties. The event can optionally be propagated to event parents.\r\n \tfire: function (type, data, propagate) {\r\n \t\tif (!this.listens(type, propagate)) { return this; }\r\n\r\n \t\tvar event = extend({}, data, {\r\n \t\t\ttype: type,\r\n \t\t\ttarget: this,\r\n \t\t\tsourceTarget: data && data.sourceTarget || this\r\n \t\t});\r\n\r\n \t\tif (this._events) {\r\n \t\t\tvar listeners = this._events[type];\r\n \t\t\tif (listeners) {\r\n \t\t\t\tthis._firingCount = (this._firingCount + 1) || 1;\r\n \t\t\t\tfor (var i = 0, len = listeners.length; i < len; i++) {\r\n \t\t\t\t\tvar l = listeners[i];\r\n \t\t\t\t\t// off overwrites l.fn, so we need to copy fn to a var\r\n \t\t\t\t\tvar fn = l.fn;\r\n \t\t\t\t\tif (l.once) {\r\n \t\t\t\t\t\tthis.off(type, fn, l.ctx);\r\n \t\t\t\t\t}\r\n \t\t\t\t\tfn.call(l.ctx || this, event);\r\n \t\t\t\t}\r\n\r\n \t\t\t\tthis._firingCount--;\r\n \t\t\t}\r\n \t\t}\r\n\r\n \t\tif (propagate) {\r\n \t\t\t// propagate the event to parents (set with addEventParent)\r\n \t\t\tthis._propagateEvent(event);\r\n \t\t}\r\n\r\n \t\treturn this;\r\n \t},\r\n\r\n \t// @method listens(type: String, propagate?: Boolean): Boolean\r\n \t// @method listens(type: String, fn: Function, context?: Object, propagate?: Boolean): Boolean\r\n \t// Returns `true` if a particular event type has any listeners attached to it.\r\n \t// The verification can optionally be propagated, it will return `true` if parents have the listener attached to it.\r\n \tlistens: function (type, fn, context, propagate) {\r\n \t\tif (typeof type !== 'string') {\r\n \t\t\tconsole.warn('\"string\" type argument expected');\r\n \t\t}\r\n\r\n \t\t// we don't overwrite the input `fn` value, because we need to use it for propagation\r\n \t\tvar _fn = fn;\r\n \t\tif (typeof fn !== 'function') {\r\n \t\t\tpropagate = !!fn;\r\n \t\t\t_fn = undefined;\r\n \t\t\tcontext = undefined;\r\n \t\t}\r\n\r\n \t\tvar listeners = this._events && this._events[type];\r\n \t\tif (listeners && listeners.length) {\r\n \t\t\tif (this._listens(type, _fn, context) !== false) {\r\n \t\t\t\treturn true;\r\n \t\t\t}\r\n \t\t}\r\n\r\n \t\tif (propagate) {\r\n \t\t\t// also check parents for listeners if event propagates\r\n \t\t\tfor (var id in this._eventParents) {\r\n \t\t\t\tif (this._eventParents[id].listens(type, fn, context, propagate)) { return true; }\r\n \t\t\t}\r\n \t\t}\r\n \t\treturn false;\r\n \t},\r\n\r\n \t// returns the index (number) or false\r\n \t_listens: function (type, fn, context) {\r\n \t\tif (!this._events) {\r\n \t\t\treturn false;\r\n \t\t}\r\n\r\n \t\tvar listeners = this._events[type] || [];\r\n \t\tif (!fn) {\r\n \t\t\treturn !!listeners.length;\r\n \t\t}\r\n\r\n \t\tif (context === this) {\r\n \t\t\t// Less memory footprint.\r\n \t\t\tcontext = undefined;\r\n \t\t}\r\n\r\n \t\tfor (var i = 0, len = listeners.length; i < len; i++) {\r\n \t\t\tif (listeners[i].fn === fn && listeners[i].ctx === context) {\r\n \t\t\t\treturn i;\r\n \t\t\t}\r\n \t\t}\r\n \t\treturn false;\r\n\r\n \t},\r\n\r\n \t// @method once(…): this\r\n \t// Behaves as [`on(…)`](#evented-on), except the listener will only get fired once and then removed.\r\n \tonce: function (types, fn, context) {\r\n\r\n \t\t// types can be a map of types/handlers\r\n \t\tif (typeof types === 'object') {\r\n \t\t\tfor (var type in types) {\r\n \t\t\t\t// we don't process space-separated events here for performance;\r\n \t\t\t\t// it's a hot path since Layer uses the on(obj) syntax\r\n \t\t\t\tthis._on(type, types[type], fn, true);\r\n \t\t\t}\r\n\r\n \t\t} else {\r\n \t\t\t// types can be a string of space-separated words\r\n \t\t\ttypes = splitWords(types);\r\n\r\n \t\t\tfor (var i = 0, len = types.length; i < len; i++) {\r\n \t\t\t\tthis._on(types[i], fn, context, true);\r\n \t\t\t}\r\n \t\t}\r\n\r\n \t\treturn this;\r\n \t},\r\n\r\n \t// @method addEventParent(obj: Evented): this\r\n \t// Adds an event parent - an `Evented` that will receive propagated events\r\n \taddEventParent: function (obj) {\r\n \t\tthis._eventParents = this._eventParents || {};\r\n \t\tthis._eventParents[stamp(obj)] = obj;\r\n \t\treturn this;\r\n \t},\r\n\r\n \t// @method removeEventParent(obj: Evented): this\r\n \t// Removes an event parent, so it will stop receiving propagated events\r\n \tremoveEventParent: function (obj) {\r\n \t\tif (this._eventParents) {\r\n \t\t\tdelete this._eventParents[stamp(obj)];\r\n \t\t}\r\n \t\treturn this;\r\n \t},\r\n\r\n \t_propagateEvent: function (e) {\r\n \t\tfor (var id in this._eventParents) {\r\n \t\t\tthis._eventParents[id].fire(e.type, extend({\r\n \t\t\t\tlayer: e.target,\r\n \t\t\t\tpropagatedFrom: e.target\r\n \t\t\t}, e), true);\r\n \t\t}\r\n \t}\r\n };\r\n\r\n // aliases; we should ditch those eventually\r\n\r\n // @method addEventListener(…): this\r\n // Alias to [`on(…)`](#evented-on)\r\n Events.addEventListener = Events.on;\r\n\r\n // @method removeEventListener(…): this\r\n // Alias to [`off(…)`](#evented-off)\r\n\r\n // @method clearAllEventListeners(…): this\r\n // Alias to [`off()`](#evented-off)\r\n Events.removeEventListener = Events.clearAllEventListeners = Events.off;\r\n\r\n // @method addOneTimeEventListener(…): this\r\n // Alias to [`once(…)`](#evented-once)\r\n Events.addOneTimeEventListener = Events.once;\r\n\r\n // @method fireEvent(…): this\r\n // Alias to [`fire(…)`](#evented-fire)\r\n Events.fireEvent = Events.fire;\r\n\r\n // @method hasEventListeners(…): Boolean\r\n // Alias to [`listens(…)`](#evented-listens)\r\n Events.hasEventListeners = Events.listens;\r\n\r\n var Evented = Class.extend(Events);\n\n /*\r\n * @class Point\r\n * @aka L.Point\r\n *\r\n * Represents a point with `x` and `y` coordinates in pixels.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var point = L.point(200, 300);\r\n * ```\r\n *\r\n * All Leaflet methods and options that accept `Point` objects also accept them in a simple Array form (unless noted otherwise), so these lines are equivalent:\r\n *\r\n * ```js\r\n * map.panBy([200, 300]);\r\n * map.panBy(L.point(200, 300));\r\n * ```\r\n *\r\n * Note that `Point` does not inherit from Leaflet's `Class` object,\r\n * which means new classes can't inherit from it, and new methods\r\n * can't be added to it with the `include` function.\r\n */\r\n\r\n function Point(x, y, round) {\r\n \t// @property x: Number; The `x` coordinate of the point\r\n \tthis.x = (round ? Math.round(x) : x);\r\n \t// @property y: Number; The `y` coordinate of the point\r\n \tthis.y = (round ? Math.round(y) : y);\r\n }\r\n\r\n var trunc = Math.trunc || function (v) {\r\n \treturn v > 0 ? Math.floor(v) : Math.ceil(v);\r\n };\r\n\r\n Point.prototype = {\r\n\r\n \t// @method clone(): Point\r\n \t// Returns a copy of the current point.\r\n \tclone: function () {\r\n \t\treturn new Point(this.x, this.y);\r\n \t},\r\n\r\n \t// @method add(otherPoint: Point): Point\r\n \t// Returns the result of addition of the current and the given points.\r\n \tadd: function (point) {\r\n \t\t// non-destructive, returns a new point\r\n \t\treturn this.clone()._add(toPoint(point));\r\n \t},\r\n\r\n \t_add: function (point) {\r\n \t\t// destructive, used directly for performance in situations where it's safe to modify existing point\r\n \t\tthis.x += point.x;\r\n \t\tthis.y += point.y;\r\n \t\treturn this;\r\n \t},\r\n\r\n \t// @method subtract(otherPoint: Point): Point\r\n \t// Returns the result of subtraction of the given point from the current.\r\n \tsubtract: function (point) {\r\n \t\treturn this.clone()._subtract(toPoint(point));\r\n \t},\r\n\r\n \t_subtract: function (point) {\r\n \t\tthis.x -= point.x;\r\n \t\tthis.y -= point.y;\r\n \t\treturn this;\r\n \t},\r\n\r\n \t// @method divideBy(num: Number): Point\r\n \t// Returns the result of division of the current point by the given number.\r\n \tdivideBy: function (num) {\r\n \t\treturn this.clone()._divideBy(num);\r\n \t},\r\n\r\n \t_divideBy: function (num) {\r\n \t\tthis.x /= num;\r\n \t\tthis.y /= num;\r\n \t\treturn this;\r\n \t},\r\n\r\n \t// @method multiplyBy(num: Number): Point\r\n \t// Returns the result of multiplication of the current point by the given number.\r\n \tmultiplyBy: function (num) {\r\n \t\treturn this.clone()._multiplyBy(num);\r\n \t},\r\n\r\n \t_multiplyBy: function (num) {\r\n \t\tthis.x *= num;\r\n \t\tthis.y *= num;\r\n \t\treturn this;\r\n \t},\r\n\r\n \t// @method scaleBy(scale: Point): Point\r\n \t// Multiply each coordinate of the current point by each coordinate of\r\n \t// `scale`. In linear algebra terms, multiply the point by the\r\n \t// [scaling matrix](https://en.wikipedia.org/wiki/Scaling_%28geometry%29#Matrix_representation)\r\n \t// defined by `scale`.\r\n \tscaleBy: function (point) {\r\n \t\treturn new Point(this.x * point.x, this.y * point.y);\r\n \t},\r\n\r\n \t// @method unscaleBy(scale: Point): Point\r\n \t// Inverse of `scaleBy`. Divide each coordinate of the current point by\r\n \t// each coordinate of `scale`.\r\n \tunscaleBy: function (point) {\r\n \t\treturn new Point(this.x / point.x, this.y / point.y);\r\n \t},\r\n\r\n \t// @method round(): Point\r\n \t// Returns a copy of the current point with rounded coordinates.\r\n \tround: function () {\r\n \t\treturn this.clone()._round();\r\n \t},\r\n\r\n \t_round: function () {\r\n \t\tthis.x = Math.round(this.x);\r\n \t\tthis.y = Math.round(this.y);\r\n \t\treturn this;\r\n \t},\r\n\r\n \t// @method floor(): Point\r\n \t// Returns a copy of the current point with floored coordinates (rounded down).\r\n \tfloor: function () {\r\n \t\treturn this.clone()._floor();\r\n \t},\r\n\r\n \t_floor: function () {\r\n \t\tthis.x = Math.floor(this.x);\r\n \t\tthis.y = Math.floor(this.y);\r\n \t\treturn this;\r\n \t},\r\n\r\n \t// @method ceil(): Point\r\n \t// Returns a copy of the current point with ceiled coordinates (rounded up).\r\n \tceil: function () {\r\n \t\treturn this.clone()._ceil();\r\n \t},\r\n\r\n \t_ceil: function () {\r\n \t\tthis.x = Math.ceil(this.x);\r\n \t\tthis.y = Math.ceil(this.y);\r\n \t\treturn this;\r\n \t},\r\n\r\n \t// @method trunc(): Point\r\n \t// Returns a copy of the current point with truncated coordinates (rounded towards zero).\r\n \ttrunc: function () {\r\n \t\treturn this.clone()._trunc();\r\n \t},\r\n\r\n \t_trunc: function () {\r\n \t\tthis.x = trunc(this.x);\r\n \t\tthis.y = trunc(this.y);\r\n \t\treturn this;\r\n \t},\r\n\r\n \t// @method distanceTo(otherPoint: Point): Number\r\n \t// Returns the cartesian distance between the current and the given points.\r\n \tdistanceTo: function (point) {\r\n \t\tpoint = toPoint(point);\r\n\r\n \t\tvar x = point.x - this.x,\r\n \t\t y = point.y - this.y;\r\n\r\n \t\treturn Math.sqrt(x * x + y * y);\r\n \t},\r\n\r\n \t// @method equals(otherPoint: Point): Boolean\r\n \t// Returns `true` if the given point has the same coordinates.\r\n \tequals: function (point) {\r\n \t\tpoint = toPoint(point);\r\n\r\n \t\treturn point.x === this.x &&\r\n \t\t point.y === this.y;\r\n \t},\r\n\r\n \t// @method contains(otherPoint: Point): Boolean\r\n \t// Returns `true` if both coordinates of the given point are less than the corresponding current point coordinates (in absolute values).\r\n \tcontains: function (point) {\r\n \t\tpoint = toPoint(point);\r\n\r\n \t\treturn Math.abs(point.x) <= Math.abs(this.x) &&\r\n \t\t Math.abs(point.y) <= Math.abs(this.y);\r\n \t},\r\n\r\n \t// @method toString(): String\r\n \t// Returns a string representation of the point for debugging purposes.\r\n \ttoString: function () {\r\n \t\treturn 'Point(' +\r\n \t\t formatNum(this.x) + ', ' +\r\n \t\t formatNum(this.y) + ')';\r\n \t}\r\n };\r\n\r\n // @factory L.point(x: Number, y: Number, round?: Boolean)\r\n // Creates a Point object with the given `x` and `y` coordinates. If optional `round` is set to true, rounds the `x` and `y` values.\r\n\r\n // @alternative\r\n // @factory L.point(coords: Number[])\r\n // Expects an array of the form `[x, y]` instead.\r\n\r\n // @alternative\r\n // @factory L.point(coords: Object)\r\n // Expects a plain object of the form `{x: Number, y: Number}` instead.\r\n function toPoint(x, y, round) {\r\n \tif (x instanceof Point) {\r\n \t\treturn x;\r\n \t}\r\n \tif (isArray(x)) {\r\n \t\treturn new Point(x[0], x[1]);\r\n \t}\r\n \tif (x === undefined || x === null) {\r\n \t\treturn x;\r\n \t}\r\n \tif (typeof x === 'object' && 'x' in x && 'y' in x) {\r\n \t\treturn new Point(x.x, x.y);\r\n \t}\r\n \treturn new Point(x, y, round);\r\n }\n\n /*\r\n * @class Bounds\r\n * @aka L.Bounds\r\n *\r\n * Represents a rectangular area in pixel coordinates.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var p1 = L.point(10, 10),\r\n * p2 = L.point(40, 60),\r\n * bounds = L.bounds(p1, p2);\r\n * ```\r\n *\r\n * All Leaflet methods that accept `Bounds` objects also accept them in a simple Array form (unless noted otherwise), so the bounds example above can be passed like this:\r\n *\r\n * ```js\r\n * otherBounds.intersects([[10, 10], [40, 60]]);\r\n * ```\r\n *\r\n * Note that `Bounds` does not inherit from Leaflet's `Class` object,\r\n * which means new classes can't inherit from it, and new methods\r\n * can't be added to it with the `include` function.\r\n */\r\n\r\n function Bounds(a, b) {\r\n \tif (!a) { return; }\r\n\r\n \tvar points = b ? [a, b] : a;\r\n\r\n \tfor (var i = 0, len = points.length; i < len; i++) {\r\n \t\tthis.extend(points[i]);\r\n \t}\r\n }\r\n\r\n Bounds.prototype = {\r\n \t// @method extend(point: Point): this\r\n \t// Extends the bounds to contain the given point.\r\n\r\n \t// @alternative\r\n \t// @method extend(otherBounds: Bounds): this\r\n \t// Extend the bounds to contain the given bounds\r\n \textend: function (obj) {\r\n \t\tvar min2, max2;\r\n \t\tif (!obj) { return this; }\r\n\r\n \t\tif (obj instanceof Point || typeof obj[0] === 'number' || 'x' in obj) {\r\n \t\t\tmin2 = max2 = toPoint(obj);\r\n \t\t} else {\r\n \t\t\tobj = toBounds(obj);\r\n \t\t\tmin2 = obj.min;\r\n \t\t\tmax2 = obj.max;\r\n\r\n \t\t\tif (!min2 || !max2) { return this; }\r\n \t\t}\r\n\r\n \t\t// @property min: Point\r\n \t\t// The top left corner of the rectangle.\r\n \t\t// @property max: Point\r\n \t\t// The bottom right corner of the rectangle.\r\n \t\tif (!this.min && !this.max) {\r\n \t\t\tthis.min = min2.clone();\r\n \t\t\tthis.max = max2.clone();\r\n \t\t} else {\r\n \t\t\tthis.min.x = Math.min(min2.x, this.min.x);\r\n \t\t\tthis.max.x = Math.max(max2.x, this.max.x);\r\n \t\t\tthis.min.y = Math.min(min2.y, this.min.y);\r\n \t\t\tthis.max.y = Math.max(max2.y, this.max.y);\r\n \t\t}\r\n \t\treturn this;\r\n \t},\r\n\r\n \t// @method getCenter(round?: Boolean): Point\r\n \t// Returns the center point of the bounds.\r\n \tgetCenter: function (round) {\r\n \t\treturn toPoint(\r\n \t\t (this.min.x + this.max.x) / 2,\r\n \t\t (this.min.y + this.max.y) / 2, round);\r\n \t},\r\n\r\n \t// @method getBottomLeft(): Point\r\n \t// Returns the bottom-left point of the bounds.\r\n \tgetBottomLeft: function () {\r\n \t\treturn toPoint(this.min.x, this.max.y);\r\n \t},\r\n\r\n \t// @method getTopRight(): Point\r\n \t// Returns the top-right point of the bounds.\r\n \tgetTopRight: function () { // -> Point\r\n \t\treturn toPoint(this.max.x, this.min.y);\r\n \t},\r\n\r\n \t// @method getTopLeft(): Point\r\n \t// Returns the top-left point of the bounds (i.e. [`this.min`](#bounds-min)).\r\n \tgetTopLeft: function () {\r\n \t\treturn this.min; // left, top\r\n \t},\r\n\r\n \t// @method getBottomRight(): Point\r\n \t// Returns the bottom-right point of the bounds (i.e. [`this.max`](#bounds-max)).\r\n \tgetBottomRight: function () {\r\n \t\treturn this.max; // right, bottom\r\n \t},\r\n\r\n \t// @method getSize(): Point\r\n \t// Returns the size of the given bounds\r\n \tgetSize: function () {\r\n \t\treturn this.max.subtract(this.min);\r\n \t},\r\n\r\n \t// @method contains(otherBounds: Bounds): Boolean\r\n \t// Returns `true` if the rectangle contains the given one.\r\n \t// @alternative\r\n \t// @method contains(point: Point): Boolean\r\n \t// Returns `true` if the rectangle contains the given point.\r\n \tcontains: function (obj) {\r\n \t\tvar min, max;\r\n\r\n \t\tif (typeof obj[0] === 'number' || obj instanceof Point) {\r\n \t\t\tobj = toPoint(obj);\r\n \t\t} else {\r\n \t\t\tobj = toBounds(obj);\r\n \t\t}\r\n\r\n \t\tif (obj instanceof Bounds) {\r\n \t\t\tmin = obj.min;\r\n \t\t\tmax = obj.max;\r\n \t\t} else {\r\n \t\t\tmin = max = obj;\r\n \t\t}\r\n\r\n \t\treturn (min.x >= this.min.x) &&\r\n \t\t (max.x <= this.max.x) &&\r\n \t\t (min.y >= this.min.y) &&\r\n \t\t (max.y <= this.max.y);\r\n \t},\r\n\r\n \t// @method intersects(otherBounds: Bounds): Boolean\r\n \t// Returns `true` if the rectangle intersects the given bounds. Two bounds\r\n \t// intersect if they have at least one point in common.\r\n \tintersects: function (bounds) { // (Bounds) -> Boolean\r\n \t\tbounds = toBounds(bounds);\r\n\r\n \t\tvar min = this.min,\r\n \t\t max = this.max,\r\n \t\t min2 = bounds.min,\r\n \t\t max2 = bounds.max,\r\n \t\t xIntersects = (max2.x >= min.x) && (min2.x <= max.x),\r\n \t\t yIntersects = (max2.y >= min.y) && (min2.y <= max.y);\r\n\r\n \t\treturn xIntersects && yIntersects;\r\n \t},\r\n\r\n \t// @method overlaps(otherBounds: Bounds): Boolean\r\n \t// Returns `true` if the rectangle overlaps the given bounds. Two bounds\r\n \t// overlap if their intersection is an area.\r\n \toverlaps: function (bounds) { // (Bounds) -> Boolean\r\n \t\tbounds = toBounds(bounds);\r\n\r\n \t\tvar min = this.min,\r\n \t\t max = this.max,\r\n \t\t min2 = bounds.min,\r\n \t\t max2 = bounds.max,\r\n \t\t xOverlaps = (max2.x > min.x) && (min2.x < max.x),\r\n \t\t yOverlaps = (max2.y > min.y) && (min2.y < max.y);\r\n\r\n \t\treturn xOverlaps && yOverlaps;\r\n \t},\r\n\r\n \t// @method isValid(): Boolean\r\n \t// Returns `true` if the bounds are properly initialized.\r\n \tisValid: function () {\r\n \t\treturn !!(this.min && this.max);\r\n \t},\r\n\r\n\r\n \t// @method pad(bufferRatio: Number): Bounds\r\n \t// Returns bounds created by extending or retracting the current bounds by a given ratio in each direction.\r\n \t// For example, a ratio of 0.5 extends the bounds by 50% in each direction.\r\n \t// Negative values will retract the bounds.\r\n \tpad: function (bufferRatio) {\r\n \t\tvar min = this.min,\r\n \t\tmax = this.max,\r\n \t\theightBuffer = Math.abs(min.x - max.x) * bufferRatio,\r\n \t\twidthBuffer = Math.abs(min.y - max.y) * bufferRatio;\r\n\r\n\r\n \t\treturn toBounds(\r\n \t\t\ttoPoint(min.x - heightBuffer, min.y - widthBuffer),\r\n \t\t\ttoPoint(max.x + heightBuffer, max.y + widthBuffer));\r\n \t},\r\n\r\n\r\n \t// @method equals(otherBounds: Bounds): Boolean\r\n \t// Returns `true` if the rectangle is equivalent to the given bounds.\r\n \tequals: function (bounds) {\r\n \t\tif (!bounds) { return false; }\r\n\r\n \t\tbounds = toBounds(bounds);\r\n\r\n \t\treturn this.min.equals(bounds.getTopLeft()) &&\r\n \t\t\tthis.max.equals(bounds.getBottomRight());\r\n \t},\r\n };\r\n\r\n\r\n // @factory L.bounds(corner1: Point, corner2: Point)\r\n // Creates a Bounds object from two corners coordinate pairs.\r\n // @alternative\r\n // @factory L.bounds(points: Point[])\r\n // Creates a Bounds object from the given array of points.\r\n function toBounds(a, b) {\r\n \tif (!a || a instanceof Bounds) {\r\n \t\treturn a;\r\n \t}\r\n \treturn new Bounds(a, b);\r\n }\n\n /*\r\n * @class LatLngBounds\r\n * @aka L.LatLngBounds\r\n *\r\n * Represents a rectangular geographical area on a map.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var corner1 = L.latLng(40.712, -74.227),\r\n * corner2 = L.latLng(40.774, -74.125),\r\n * bounds = L.latLngBounds(corner1, corner2);\r\n * ```\r\n *\r\n * All Leaflet methods that accept LatLngBounds objects also accept them in a simple Array form (unless noted otherwise), so the bounds example above can be passed like this:\r\n *\r\n * ```js\r\n * map.fitBounds([\r\n * \t[40.712, -74.227],\r\n * \t[40.774, -74.125]\r\n * ]);\r\n * ```\r\n *\r\n * Caution: if the area crosses the antimeridian (often confused with the International Date Line), you must specify corners _outside_ the [-180, 180] degrees longitude range.\r\n *\r\n * Note that `LatLngBounds` does not inherit from Leaflet's `Class` object,\r\n * which means new classes can't inherit from it, and new methods\r\n * can't be added to it with the `include` function.\r\n */\r\n\r\n function LatLngBounds(corner1, corner2) { // (LatLng, LatLng) or (LatLng[])\r\n \tif (!corner1) { return; }\r\n\r\n \tvar latlngs = corner2 ? [corner1, corner2] : corner1;\r\n\r\n \tfor (var i = 0, len = latlngs.length; i < len; i++) {\r\n \t\tthis.extend(latlngs[i]);\r\n \t}\r\n }\r\n\r\n LatLngBounds.prototype = {\r\n\r\n \t// @method extend(latlng: LatLng): this\r\n \t// Extend the bounds to contain the given point\r\n\r\n \t// @alternative\r\n \t// @method extend(otherBounds: LatLngBounds): this\r\n \t// Extend the bounds to contain the given bounds\r\n \textend: function (obj) {\r\n \t\tvar sw = this._southWest,\r\n \t\t ne = this._northEast,\r\n \t\t sw2, ne2;\r\n\r\n \t\tif (obj instanceof LatLng) {\r\n \t\t\tsw2 = obj;\r\n \t\t\tne2 = obj;\r\n\r\n \t\t} else if (obj instanceof LatLngBounds) {\r\n \t\t\tsw2 = obj._southWest;\r\n \t\t\tne2 = obj._northEast;\r\n\r\n \t\t\tif (!sw2 || !ne2) { return this; }\r\n\r\n \t\t} else {\r\n \t\t\treturn obj ? this.extend(toLatLng(obj) || toLatLngBounds(obj)) : this;\r\n \t\t}\r\n\r\n \t\tif (!sw && !ne) {\r\n \t\t\tthis._southWest = new LatLng(sw2.lat, sw2.lng);\r\n \t\t\tthis._northEast = new LatLng(ne2.lat, ne2.lng);\r\n \t\t} else {\r\n \t\t\tsw.lat = Math.min(sw2.lat, sw.lat);\r\n \t\t\tsw.lng = Math.min(sw2.lng, sw.lng);\r\n \t\t\tne.lat = Math.max(ne2.lat, ne.lat);\r\n \t\t\tne.lng = Math.max(ne2.lng, ne.lng);\r\n \t\t}\r\n\r\n \t\treturn this;\r\n \t},\r\n\r\n \t// @method pad(bufferRatio: Number): LatLngBounds\r\n \t// Returns bounds created by extending or retracting the current bounds by a given ratio in each direction.\r\n \t// For example, a ratio of 0.5 extends the bounds by 50% in each direction.\r\n \t// Negative values will retract the bounds.\r\n \tpad: function (bufferRatio) {\r\n \t\tvar sw = this._southWest,\r\n \t\t ne = this._northEast,\r\n \t\t heightBuffer = Math.abs(sw.lat - ne.lat) * bufferRatio,\r\n \t\t widthBuffer = Math.abs(sw.lng - ne.lng) * bufferRatio;\r\n\r\n \t\treturn new LatLngBounds(\r\n \t\t new LatLng(sw.lat - heightBuffer, sw.lng - widthBuffer),\r\n \t\t new LatLng(ne.lat + heightBuffer, ne.lng + widthBuffer));\r\n \t},\r\n\r\n \t// @method getCenter(): LatLng\r\n \t// Returns the center point of the bounds.\r\n \tgetCenter: function () {\r\n \t\treturn new LatLng(\r\n \t\t (this._southWest.lat + this._northEast.lat) / 2,\r\n \t\t (this._southWest.lng + this._northEast.lng) / 2);\r\n \t},\r\n\r\n \t// @method getSouthWest(): LatLng\r\n \t// Returns the south-west point of the bounds.\r\n \tgetSouthWest: function () {\r\n \t\treturn this._southWest;\r\n \t},\r\n\r\n \t// @method getNorthEast(): LatLng\r\n \t// Returns the north-east point of the bounds.\r\n \tgetNorthEast: function () {\r\n \t\treturn this._northEast;\r\n \t},\r\n\r\n \t// @method getNorthWest(): LatLng\r\n \t// Returns the north-west point of the bounds.\r\n \tgetNorthWest: function () {\r\n \t\treturn new LatLng(this.getNorth(), this.getWest());\r\n \t},\r\n\r\n \t// @method getSouthEast(): LatLng\r\n \t// Returns the south-east point of the bounds.\r\n \tgetSouthEast: function () {\r\n \t\treturn new LatLng(this.getSouth(), this.getEast());\r\n \t},\r\n\r\n \t// @method getWest(): Number\r\n \t// Returns the west longitude of the bounds\r\n \tgetWest: function () {\r\n \t\treturn this._southWest.lng;\r\n \t},\r\n\r\n \t// @method getSouth(): Number\r\n \t// Returns the south latitude of the bounds\r\n \tgetSouth: function () {\r\n \t\treturn this._southWest.lat;\r\n \t},\r\n\r\n \t// @method getEast(): Number\r\n \t// Returns the east longitude of the bounds\r\n \tgetEast: function () {\r\n \t\treturn this._northEast.lng;\r\n \t},\r\n\r\n \t// @method getNorth(): Number\r\n \t// Returns the north latitude of the bounds\r\n \tgetNorth: function () {\r\n \t\treturn this._northEast.lat;\r\n \t},\r\n\r\n \t// @method contains(otherBounds: LatLngBounds): Boolean\r\n \t// Returns `true` if the rectangle contains the given one.\r\n\r\n \t// @alternative\r\n \t// @method contains (latlng: LatLng): Boolean\r\n \t// Returns `true` if the rectangle contains the given point.\r\n \tcontains: function (obj) { // (LatLngBounds) or (LatLng) -> Boolean\r\n \t\tif (typeof obj[0] === 'number' || obj instanceof LatLng || 'lat' in obj) {\r\n \t\t\tobj = toLatLng(obj);\r\n \t\t} else {\r\n \t\t\tobj = toLatLngBounds(obj);\r\n \t\t}\r\n\r\n \t\tvar sw = this._southWest,\r\n \t\t ne = this._northEast,\r\n \t\t sw2, ne2;\r\n\r\n \t\tif (obj instanceof LatLngBounds) {\r\n \t\t\tsw2 = obj.getSouthWest();\r\n \t\t\tne2 = obj.getNorthEast();\r\n \t\t} else {\r\n \t\t\tsw2 = ne2 = obj;\r\n \t\t}\r\n\r\n \t\treturn (sw2.lat >= sw.lat) && (ne2.lat <= ne.lat) &&\r\n \t\t (sw2.lng >= sw.lng) && (ne2.lng <= ne.lng);\r\n \t},\r\n\r\n \t// @method intersects(otherBounds: LatLngBounds): Boolean\r\n \t// Returns `true` if the rectangle intersects the given bounds. Two bounds intersect if they have at least one point in common.\r\n \tintersects: function (bounds) {\r\n \t\tbounds = toLatLngBounds(bounds);\r\n\r\n \t\tvar sw = this._southWest,\r\n \t\t ne = this._northEast,\r\n \t\t sw2 = bounds.getSouthWest(),\r\n \t\t ne2 = bounds.getNorthEast(),\r\n\r\n \t\t latIntersects = (ne2.lat >= sw.lat) && (sw2.lat <= ne.lat),\r\n \t\t lngIntersects = (ne2.lng >= sw.lng) && (sw2.lng <= ne.lng);\r\n\r\n \t\treturn latIntersects && lngIntersects;\r\n \t},\r\n\r\n \t// @method overlaps(otherBounds: LatLngBounds): Boolean\r\n \t// Returns `true` if the rectangle overlaps the given bounds. Two bounds overlap if their intersection is an area.\r\n \toverlaps: function (bounds) {\r\n \t\tbounds = toLatLngBounds(bounds);\r\n\r\n \t\tvar sw = this._southWest,\r\n \t\t ne = this._northEast,\r\n \t\t sw2 = bounds.getSouthWest(),\r\n \t\t ne2 = bounds.getNorthEast(),\r\n\r\n \t\t latOverlaps = (ne2.lat > sw.lat) && (sw2.lat < ne.lat),\r\n \t\t lngOverlaps = (ne2.lng > sw.lng) && (sw2.lng < ne.lng);\r\n\r\n \t\treturn latOverlaps && lngOverlaps;\r\n \t},\r\n\r\n \t// @method toBBoxString(): String\r\n \t// Returns a string with bounding box coordinates in a 'southwest_lng,southwest_lat,northeast_lng,northeast_lat' format. Useful for sending requests to web services that return geo data.\r\n \ttoBBoxString: function () {\r\n \t\treturn [this.getWest(), this.getSouth(), this.getEast(), this.getNorth()].join(',');\r\n \t},\r\n\r\n \t// @method equals(otherBounds: LatLngBounds, maxMargin?: Number): Boolean\r\n \t// Returns `true` if the rectangle is equivalent (within a small margin of error) to the given bounds. The margin of error can be overridden by setting `maxMargin` to a small number.\r\n \tequals: function (bounds, maxMargin) {\r\n \t\tif (!bounds) { return false; }\r\n\r\n \t\tbounds = toLatLngBounds(bounds);\r\n\r\n \t\treturn this._southWest.equals(bounds.getSouthWest(), maxMargin) &&\r\n \t\t this._northEast.equals(bounds.getNorthEast(), maxMargin);\r\n \t},\r\n\r\n \t// @method isValid(): Boolean\r\n \t// Returns `true` if the bounds are properly initialized.\r\n \tisValid: function () {\r\n \t\treturn !!(this._southWest && this._northEast);\r\n \t}\r\n };\r\n\r\n // TODO International date line?\r\n\r\n // @factory L.latLngBounds(corner1: LatLng, corner2: LatLng)\r\n // Creates a `LatLngBounds` object by defining two diagonally opposite corners of the rectangle.\r\n\r\n // @alternative\r\n // @factory L.latLngBounds(latlngs: LatLng[])\r\n // Creates a `LatLngBounds` object defined by the geographical points it contains. Very useful for zooming the map to fit a particular set of locations with [`fitBounds`](#map-fitbounds).\r\n function toLatLngBounds(a, b) {\r\n \tif (a instanceof LatLngBounds) {\r\n \t\treturn a;\r\n \t}\r\n \treturn new LatLngBounds(a, b);\r\n }\n\n /* @class LatLng\r\n * @aka L.LatLng\r\n *\r\n * Represents a geographical point with a certain latitude and longitude.\r\n *\r\n * @example\r\n *\r\n * ```\r\n * var latlng = L.latLng(50.5, 30.5);\r\n * ```\r\n *\r\n * All Leaflet methods that accept LatLng objects also accept them in a simple Array form and simple object form (unless noted otherwise), so these lines are equivalent:\r\n *\r\n * ```\r\n * map.panTo([50, 30]);\r\n * map.panTo({lon: 30, lat: 50});\r\n * map.panTo({lat: 50, lng: 30});\r\n * map.panTo(L.latLng(50, 30));\r\n * ```\r\n *\r\n * Note that `LatLng` does not inherit from Leaflet's `Class` object,\r\n * which means new classes can't inherit from it, and new methods\r\n * can't be added to it with the `include` function.\r\n */\r\n\r\n function LatLng(lat, lng, alt) {\r\n \tif (isNaN(lat) || isNaN(lng)) {\r\n \t\tthrow new Error('Invalid LatLng object: (' + lat + ', ' + lng + ')');\r\n \t}\r\n\r\n \t// @property lat: Number\r\n \t// Latitude in degrees\r\n \tthis.lat = +lat;\r\n\r\n \t// @property lng: Number\r\n \t// Longitude in degrees\r\n \tthis.lng = +lng;\r\n\r\n \t// @property alt: Number\r\n \t// Altitude in meters (optional)\r\n \tif (alt !== undefined) {\r\n \t\tthis.alt = +alt;\r\n \t}\r\n }\r\n\r\n LatLng.prototype = {\r\n \t// @method equals(otherLatLng: LatLng, maxMargin?: Number): Boolean\r\n \t// Returns `true` if the given `LatLng` point is at the same position (within a small margin of error). The margin of error can be overridden by setting `maxMargin` to a small number.\r\n \tequals: function (obj, maxMargin) {\r\n \t\tif (!obj) { return false; }\r\n\r\n \t\tobj = toLatLng(obj);\r\n\r\n \t\tvar margin = Math.max(\r\n \t\t Math.abs(this.lat - obj.lat),\r\n \t\t Math.abs(this.lng - obj.lng));\r\n\r\n \t\treturn margin <= (maxMargin === undefined ? 1.0E-9 : maxMargin);\r\n \t},\r\n\r\n \t// @method toString(): String\r\n \t// Returns a string representation of the point (for debugging purposes).\r\n \ttoString: function (precision) {\r\n \t\treturn 'LatLng(' +\r\n \t\t formatNum(this.lat, precision) + ', ' +\r\n \t\t formatNum(this.lng, precision) + ')';\r\n \t},\r\n\r\n \t// @method distanceTo(otherLatLng: LatLng): Number\r\n \t// Returns the distance (in meters) to the given `LatLng` calculated using the [Spherical Law of Cosines](https://en.wikipedia.org/wiki/Spherical_law_of_cosines).\r\n \tdistanceTo: function (other) {\r\n \t\treturn Earth.distance(this, toLatLng(other));\r\n \t},\r\n\r\n \t// @method wrap(): LatLng\r\n \t// Returns a new `LatLng` object with the longitude wrapped so it's always between -180 and +180 degrees.\r\n \twrap: function () {\r\n \t\treturn Earth.wrapLatLng(this);\r\n \t},\r\n\r\n \t// @method toBounds(sizeInMeters: Number): LatLngBounds\r\n \t// Returns a new `LatLngBounds` object in which each boundary is `sizeInMeters/2` meters apart from the `LatLng`.\r\n \ttoBounds: function (sizeInMeters) {\r\n \t\tvar latAccuracy = 180 * sizeInMeters / 40075017,\r\n \t\t lngAccuracy = latAccuracy / Math.cos((Math.PI / 180) * this.lat);\r\n\r\n \t\treturn toLatLngBounds(\r\n \t\t [this.lat - latAccuracy, this.lng - lngAccuracy],\r\n \t\t [this.lat + latAccuracy, this.lng + lngAccuracy]);\r\n \t},\r\n\r\n \tclone: function () {\r\n \t\treturn new LatLng(this.lat, this.lng, this.alt);\r\n \t}\r\n };\r\n\r\n\r\n\r\n // @factory L.latLng(latitude: Number, longitude: Number, altitude?: Number): LatLng\r\n // Creates an object representing a geographical point with the given latitude and longitude (and optionally altitude).\r\n\r\n // @alternative\r\n // @factory L.latLng(coords: Array): LatLng\r\n // Expects an array of the form `[Number, Number]` or `[Number, Number, Number]` instead.\r\n\r\n // @alternative\r\n // @factory L.latLng(coords: Object): LatLng\r\n // Expects an plain object of the form `{lat: Number, lng: Number}` or `{lat: Number, lng: Number, alt: Number}` instead.\r\n\r\n function toLatLng(a, b, c) {\r\n \tif (a instanceof LatLng) {\r\n \t\treturn a;\r\n \t}\r\n \tif (isArray(a) && typeof a[0] !== 'object') {\r\n \t\tif (a.length === 3) {\r\n \t\t\treturn new LatLng(a[0], a[1], a[2]);\r\n \t\t}\r\n \t\tif (a.length === 2) {\r\n \t\t\treturn new LatLng(a[0], a[1]);\r\n \t\t}\r\n \t\treturn null;\r\n \t}\r\n \tif (a === undefined || a === null) {\r\n \t\treturn a;\r\n \t}\r\n \tif (typeof a === 'object' && 'lat' in a) {\r\n \t\treturn new LatLng(a.lat, 'lng' in a ? a.lng : a.lon, a.alt);\r\n \t}\r\n \tif (b === undefined) {\r\n \t\treturn null;\r\n \t}\r\n \treturn new LatLng(a, b, c);\r\n }\n\n /*\r\n * @namespace CRS\r\n * @crs L.CRS.Base\r\n * Object that defines coordinate reference systems for projecting\r\n * geographical points into pixel (screen) coordinates and back (and to\r\n * coordinates in other units for [WMS](https://en.wikipedia.org/wiki/Web_Map_Service) services). See\r\n * [spatial reference system](https://en.wikipedia.org/wiki/Spatial_reference_system).\r\n *\r\n * Leaflet defines the most usual CRSs by default. If you want to use a\r\n * CRS not defined by default, take a look at the\r\n * [Proj4Leaflet](https://github.com/kartena/Proj4Leaflet) plugin.\r\n *\r\n * Note that the CRS instances do not inherit from Leaflet's `Class` object,\r\n * and can't be instantiated. Also, new classes can't inherit from them,\r\n * and methods can't be added to them with the `include` function.\r\n */\r\n\r\n var CRS = {\r\n \t// @method latLngToPoint(latlng: LatLng, zoom: Number): Point\r\n \t// Projects geographical coordinates into pixel coordinates for a given zoom.\r\n \tlatLngToPoint: function (latlng, zoom) {\r\n \t\tvar projectedPoint = this.projection.project(latlng),\r\n \t\t scale = this.scale(zoom);\r\n\r\n \t\treturn this.transformation._transform(projectedPoint, scale);\r\n \t},\r\n\r\n \t// @method pointToLatLng(point: Point, zoom: Number): LatLng\r\n \t// The inverse of `latLngToPoint`. Projects pixel coordinates on a given\r\n \t// zoom into geographical coordinates.\r\n \tpointToLatLng: function (point, zoom) {\r\n \t\tvar scale = this.scale(zoom),\r\n \t\t untransformedPoint = this.transformation.untransform(point, scale);\r\n\r\n \t\treturn this.projection.unproject(untransformedPoint);\r\n \t},\r\n\r\n \t// @method project(latlng: LatLng): Point\r\n \t// Projects geographical coordinates into coordinates in units accepted for\r\n \t// this CRS (e.g. meters for EPSG:3857, for passing it to WMS services).\r\n \tproject: function (latlng) {\r\n \t\treturn this.projection.project(latlng);\r\n \t},\r\n\r\n \t// @method unproject(point: Point): LatLng\r\n \t// Given a projected coordinate returns the corresponding LatLng.\r\n \t// The inverse of `project`.\r\n \tunproject: function (point) {\r\n \t\treturn this.projection.unproject(point);\r\n \t},\r\n\r\n \t// @method scale(zoom: Number): Number\r\n \t// Returns the scale used when transforming projected coordinates into\r\n \t// pixel coordinates for a particular zoom. For example, it returns\r\n \t// `256 * 2^zoom` for Mercator-based CRS.\r\n \tscale: function (zoom) {\r\n \t\treturn 256 * Math.pow(2, zoom);\r\n \t},\r\n\r\n \t// @method zoom(scale: Number): Number\r\n \t// Inverse of `scale()`, returns the zoom level corresponding to a scale\r\n \t// factor of `scale`.\r\n \tzoom: function (scale) {\r\n \t\treturn Math.log(scale / 256) / Math.LN2;\r\n \t},\r\n\r\n \t// @method getProjectedBounds(zoom: Number): Bounds\r\n \t// Returns the projection's bounds scaled and transformed for the provided `zoom`.\r\n \tgetProjectedBounds: function (zoom) {\r\n \t\tif (this.infinite) { return null; }\r\n\r\n \t\tvar b = this.projection.bounds,\r\n \t\t s = this.scale(zoom),\r\n \t\t min = this.transformation.transform(b.min, s),\r\n \t\t max = this.transformation.transform(b.max, s);\r\n\r\n \t\treturn new Bounds(min, max);\r\n \t},\r\n\r\n \t// @method distance(latlng1: LatLng, latlng2: LatLng): Number\r\n \t// Returns the distance between two geographical coordinates.\r\n\r\n \t// @property code: String\r\n \t// Standard code name of the CRS passed into WMS services (e.g. `'EPSG:3857'`)\r\n \t//\r\n \t// @property wrapLng: Number[]\r\n \t// An array of two numbers defining whether the longitude (horizontal) coordinate\r\n \t// axis wraps around a given range and how. Defaults to `[-180, 180]` in most\r\n \t// geographical CRSs. If `undefined`, the longitude axis does not wrap around.\r\n \t//\r\n \t// @property wrapLat: Number[]\r\n \t// Like `wrapLng`, but for the latitude (vertical) axis.\r\n\r\n \t// wrapLng: [min, max],\r\n \t// wrapLat: [min, max],\r\n\r\n \t// @property infinite: Boolean\r\n \t// If true, the coordinate space will be unbounded (infinite in both axes)\r\n \tinfinite: false,\r\n\r\n \t// @method wrapLatLng(latlng: LatLng): LatLng\r\n \t// Returns a `LatLng` where lat and lng has been wrapped according to the\r\n \t// CRS's `wrapLat` and `wrapLng` properties, if they are outside the CRS's bounds.\r\n \twrapLatLng: function (latlng) {\r\n \t\tvar lng = this.wrapLng ? wrapNum(latlng.lng, this.wrapLng, true) : latlng.lng,\r\n \t\t lat = this.wrapLat ? wrapNum(latlng.lat, this.wrapLat, true) : latlng.lat,\r\n \t\t alt = latlng.alt;\r\n\r\n \t\treturn new LatLng(lat, lng, alt);\r\n \t},\r\n\r\n \t// @method wrapLatLngBounds(bounds: LatLngBounds): LatLngBounds\r\n \t// Returns a `LatLngBounds` with the same size as the given one, ensuring\r\n \t// that its center is within the CRS's bounds.\r\n \t// Only accepts actual `L.LatLngBounds` instances, not arrays.\r\n \twrapLatLngBounds: function (bounds) {\r\n \t\tvar center = bounds.getCenter(),\r\n \t\t newCenter = this.wrapLatLng(center),\r\n \t\t latShift = center.lat - newCenter.lat,\r\n \t\t lngShift = center.lng - newCenter.lng;\r\n\r\n \t\tif (latShift === 0 && lngShift === 0) {\r\n \t\t\treturn bounds;\r\n \t\t}\r\n\r\n \t\tvar sw = bounds.getSouthWest(),\r\n \t\t ne = bounds.getNorthEast(),\r\n \t\t newSw = new LatLng(sw.lat - latShift, sw.lng - lngShift),\r\n \t\t newNe = new LatLng(ne.lat - latShift, ne.lng - lngShift);\r\n\r\n \t\treturn new LatLngBounds(newSw, newNe);\r\n \t}\r\n };\n\n /*\n * @namespace CRS\n * @crs L.CRS.Earth\n *\n * Serves as the base for CRS that are global such that they cover the earth.\n * Can only be used as the base for other CRS and cannot be used directly,\n * since it does not have a `code`, `projection` or `transformation`. `distance()` returns\n * meters.\n */\n\n var Earth = extend({}, CRS, {\n \twrapLng: [-180, 180],\n\n \t// Mean Earth Radius, as recommended for use by\n \t// the International Union of Geodesy and Geophysics,\n \t// see https://rosettacode.org/wiki/Haversine_formula\n \tR: 6371000,\n\n \t// distance between two geographical points using spherical law of cosines approximation\n \tdistance: function (latlng1, latlng2) {\n \t\tvar rad = Math.PI / 180,\n \t\t lat1 = latlng1.lat * rad,\n \t\t lat2 = latlng2.lat * rad,\n \t\t sinDLat = Math.sin((latlng2.lat - latlng1.lat) * rad / 2),\n \t\t sinDLon = Math.sin((latlng2.lng - latlng1.lng) * rad / 2),\n \t\t a = sinDLat * sinDLat + Math.cos(lat1) * Math.cos(lat2) * sinDLon * sinDLon,\n \t\t c = 2 * Math.atan2(Math.sqrt(a), Math.sqrt(1 - a));\n \t\treturn this.R * c;\n \t}\n });\n\n /*\r\n * @namespace Projection\r\n * @projection L.Projection.SphericalMercator\r\n *\r\n * Spherical Mercator projection — the most common projection for online maps,\r\n * used by almost all free and commercial tile providers. Assumes that Earth is\r\n * a sphere. Used by the `EPSG:3857` CRS.\r\n */\r\n\r\n var earthRadius = 6378137;\r\n\r\n var SphericalMercator = {\r\n\r\n \tR: earthRadius,\r\n \tMAX_LATITUDE: 85.0511287798,\r\n\r\n \tproject: function (latlng) {\r\n \t\tvar d = Math.PI / 180,\r\n \t\t max = this.MAX_LATITUDE,\r\n \t\t lat = Math.max(Math.min(max, latlng.lat), -max),\r\n \t\t sin = Math.sin(lat * d);\r\n\r\n \t\treturn new Point(\r\n \t\t\tthis.R * latlng.lng * d,\r\n \t\t\tthis.R * Math.log((1 + sin) / (1 - sin)) / 2);\r\n \t},\r\n\r\n \tunproject: function (point) {\r\n \t\tvar d = 180 / Math.PI;\r\n\r\n \t\treturn new LatLng(\r\n \t\t\t(2 * Math.atan(Math.exp(point.y / this.R)) - (Math.PI / 2)) * d,\r\n \t\t\tpoint.x * d / this.R);\r\n \t},\r\n\r\n \tbounds: (function () {\r\n \t\tvar d = earthRadius * Math.PI;\r\n \t\treturn new Bounds([-d, -d], [d, d]);\r\n \t})()\r\n };\n\n /*\r\n * @class Transformation\r\n * @aka L.Transformation\r\n *\r\n * Represents an affine transformation: a set of coefficients `a`, `b`, `c`, `d`\r\n * for transforming a point of a form `(x, y)` into `(a*x + b, c*y + d)` and doing\r\n * the reverse. Used by Leaflet in its projections code.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * var transformation = L.transformation(2, 5, -1, 10),\r\n * \tp = L.point(1, 2),\r\n * \tp2 = transformation.transform(p), // L.point(7, 8)\r\n * \tp3 = transformation.untransform(p2); // L.point(1, 2)\r\n * ```\r\n */\r\n\r\n\r\n // factory new L.Transformation(a: Number, b: Number, c: Number, d: Number)\r\n // Creates a `Transformation` object with the given coefficients.\r\n function Transformation(a, b, c, d) {\r\n \tif (isArray(a)) {\r\n \t\t// use array properties\r\n \t\tthis._a = a[0];\r\n \t\tthis._b = a[1];\r\n \t\tthis._c = a[2];\r\n \t\tthis._d = a[3];\r\n \t\treturn;\r\n \t}\r\n \tthis._a = a;\r\n \tthis._b = b;\r\n \tthis._c = c;\r\n \tthis._d = d;\r\n }\r\n\r\n Transformation.prototype = {\r\n \t// @method transform(point: Point, scale?: Number): Point\r\n \t// Returns a transformed point, optionally multiplied by the given scale.\r\n \t// Only accepts actual `L.Point` instances, not arrays.\r\n \ttransform: function (point, scale) { // (Point, Number) -> Point\r\n \t\treturn this._transform(point.clone(), scale);\r\n \t},\r\n\r\n \t// destructive transform (faster)\r\n \t_transform: function (point, scale) {\r\n \t\tscale = scale || 1;\r\n \t\tpoint.x = scale * (this._a * point.x + this._b);\r\n \t\tpoint.y = scale * (this._c * point.y + this._d);\r\n \t\treturn point;\r\n \t},\r\n\r\n \t// @method untransform(point: Point, scale?: Number): Point\r\n \t// Returns the reverse transformation of the given point, optionally divided\r\n \t// by the given scale. Only accepts actual `L.Point` instances, not arrays.\r\n \tuntransform: function (point, scale) {\r\n \t\tscale = scale || 1;\r\n \t\treturn new Point(\r\n \t\t (point.x / scale - this._b) / this._a,\r\n \t\t (point.y / scale - this._d) / this._c);\r\n \t}\r\n };\r\n\r\n // factory L.transformation(a: Number, b: Number, c: Number, d: Number)\r\n\r\n // @factory L.transformation(a: Number, b: Number, c: Number, d: Number)\r\n // Instantiates a Transformation object with the given coefficients.\r\n\r\n // @alternative\r\n // @factory L.transformation(coefficients: Array): Transformation\r\n // Expects an coefficients array of the form\r\n // `[a: Number, b: Number, c: Number, d: Number]`.\r\n\r\n function toTransformation(a, b, c, d) {\r\n \treturn new Transformation(a, b, c, d);\r\n }\n\n /*\r\n * @namespace CRS\r\n * @crs L.CRS.EPSG3857\r\n *\r\n * The most common CRS for online maps, used by almost all free and commercial\r\n * tile providers. Uses Spherical Mercator projection. Set in by default in\r\n * Map's `crs` option.\r\n */\r\n\r\n var EPSG3857 = extend({}, Earth, {\r\n \tcode: 'EPSG:3857',\r\n \tprojection: SphericalMercator,\r\n\r\n \ttransformation: (function () {\r\n \t\tvar scale = 0.5 / (Math.PI * SphericalMercator.R);\r\n \t\treturn toTransformation(scale, 0.5, -scale, 0.5);\r\n \t}())\r\n });\r\n\r\n var EPSG900913 = extend({}, EPSG3857, {\r\n \tcode: 'EPSG:900913'\r\n });\n\n // @namespace SVG; @section\n // There are several static functions which can be called without instantiating L.SVG:\n\n // @function create(name: String): SVGElement\n // Returns a instance of [SVGElement](https://developer.mozilla.org/docs/Web/API/SVGElement),\n // corresponding to the class name passed. For example, using 'line' will return\n // an instance of [SVGLineElement](https://developer.mozilla.org/docs/Web/API/SVGLineElement).\n function svgCreate(name) {\n \treturn document.createElementNS('http://www.w3.org/2000/svg', name);\n }\n\n // @function pointsToPath(rings: Point[], closed: Boolean): String\n // Generates a SVG path string for multiple rings, with each ring turning\n // into \"M..L..L..\" instructions\n function pointsToPath(rings, closed) {\n \tvar str = '',\n \ti, j, len, len2, points, p;\n\n \tfor (i = 0, len = rings.length; i < len; i++) {\n \t\tpoints = rings[i];\n\n \t\tfor (j = 0, len2 = points.length; j < len2; j++) {\n \t\t\tp = points[j];\n \t\t\tstr += (j ? 'L' : 'M') + p.x + ' ' + p.y;\n \t\t}\n\n \t\t// closes the ring for polygons; \"x\" is VML syntax\n \t\tstr += closed ? (Browser.svg ? 'z' : 'x') : '';\n \t}\n\n \t// SVG complains about empty path strings\n \treturn str || 'M0 0';\n }\n\n /*\r\n * @namespace Browser\r\n * @aka L.Browser\r\n *\r\n * A namespace with static properties for browser/feature detection used by Leaflet internally.\r\n *\r\n * @example\r\n *\r\n * ```js\r\n * if (L.Browser.ielt9) {\r\n * alert('Upgrade your browser, dude!');\r\n * }\r\n * ```\r\n */\r\n\r\n var style = document.documentElement.style;\r\n\r\n // @property ie: Boolean; `true` for all Internet Explorer versions (not Edge).\r\n var ie = 'ActiveXObject' in window;\r\n\r\n // @property ielt9: Boolean; `true` for Internet Explorer versions less than 9.\r\n var ielt9 = ie && !document.addEventListener;\r\n\r\n // @property edge: Boolean; `true` for the Edge web browser.\r\n var edge = 'msLaunchUri' in navigator && !('documentMode' in document);\r\n\r\n // @property webkit: Boolean;\r\n // `true` for webkit-based browsers like Chrome and Safari (including mobile versions).\r\n var webkit = userAgentContains('webkit');\r\n\r\n // @property android: Boolean\r\n // **Deprecated.** `true` for any browser running on an Android platform.\r\n var android = userAgentContains('android');\r\n\r\n // @property android23: Boolean; **Deprecated.** `true` for browsers running on Android 2 or Android 3.\r\n var android23 = userAgentContains('android 2') || userAgentContains('android 3');\r\n\r\n /* See https://stackoverflow.com/a/17961266 for details on detecting stock Android */\r\n var webkitVer = parseInt(/WebKit\\/([0-9]+)|$/.exec(navigator.userAgent)[1], 10); // also matches AppleWebKit\r\n // @property androidStock: Boolean; **Deprecated.** `true` for the Android stock browser (i.e. not Chrome)\r\n var androidStock = android && userAgentContains('Google') && webkitVer < 537 && !('AudioNode' in window);\r\n\r\n // @property opera: Boolean; `true` for the Opera browser\r\n var opera = !!window.opera;\r\n\r\n // @property chrome: Boolean; `true` for the Chrome browser.\r\n var chrome = !edge && userAgentContains('chrome');\r\n\r\n // @property gecko: Boolean; `true` for gecko-based browsers like Firefox.\r\n var gecko = userAgentContains('gecko') && !webkit && !opera && !ie;\r\n\r\n // @property safari: Boolean; `true` for the Safari browser.\r\n var safari = !chrome && userAgentContains('safari');\r\n\r\n var phantom = userAgentContains('phantom');\r\n\r\n // @property opera12: Boolean\r\n // `true` for the Opera browser supporting CSS transforms (version 12 or later).\r\n var opera12 = 'OTransition' in style;\r\n\r\n // @property win: Boolean; `true` when the browser is running in a Windows platform\r\n var win = navigator.platform.indexOf('Win') === 0;\r\n\r\n // @property ie3d: Boolean; `true` for all Internet Explorer versions supporting CSS transforms.\r\n var ie3d = ie && ('transition' in style);\r\n\r\n // @property webkit3d: Boolean; `true` for webkit-based browsers supporting CSS transforms.\r\n var webkit3d = ('WebKitCSSMatrix' in window) && ('m11' in new window.WebKitCSSMatrix()) && !android23;\r\n\r\n // @property gecko3d: Boolean; `true` for gecko-based browsers supporting CSS transforms.\r\n var gecko3d = 'MozPerspective' in style;\r\n\r\n // @property any3d: Boolean\r\n // `true` for all browsers supporting CSS transforms.\r\n var any3d = !window.L_DISABLE_3D && (ie3d || webkit3d || gecko3d) && !opera12 && !phantom;\r\n\r\n // @property mobile: Boolean; `true` for all browsers running in a mobile device.\r\n var mobile = typeof orientation !== 'undefined' || userAgentContains('mobile');\r\n\r\n // @property mobileWebkit: Boolean; `true` for all webkit-based browsers in a mobile device.\r\n var mobileWebkit = mobile && webkit;\r\n\r\n // @property mobileWebkit3d: Boolean\r\n // `true` for all webkit-based browsers in a mobile device supporting CSS transforms.\r\n var mobileWebkit3d = mobile && webkit3d;\r\n\r\n // @property msPointer: Boolean\r\n // `true` for browsers implementing the Microsoft touch events model (notably IE10).\r\n var msPointer = !window.PointerEvent && window.MSPointerEvent;\r\n\r\n // @property pointer: Boolean\r\n // `true` for all browsers supporting [pointer events](https://msdn.microsoft.com/en-us/library/dn433244%28v=vs.85%29.aspx).\r\n var pointer = !!(window.PointerEvent || msPointer);\r\n\r\n // @property touchNative: Boolean\r\n // `true` for all browsers supporting [touch events](https://developer.mozilla.org/docs/Web/API/Touch_events).\r\n // **This does not necessarily mean** that the browser is running in a computer with\r\n // a touchscreen, it only means that the browser is capable of understanding\r\n // touch events.\r\n var touchNative = 'ontouchstart' in window || !!window.TouchEvent;\r\n\r\n // @property touch: Boolean\r\n // `true` for all browsers supporting either [touch](#browser-touch) or [pointer](#browser-pointer) events.\r\n // Note: pointer events will be preferred (if available), and processed for all `touch*` listeners.\r\n var touch = !window.L_NO_TOUCH && (touchNative || pointer);\r\n\r\n // @property mobileOpera: Boolean; `true` for the Opera browser in a mobile device.\r\n var mobileOpera = mobile && opera;\r\n\r\n // @property mobileGecko: Boolean\r\n // `true` for gecko-based browsers running in a mobile device.\r\n var mobileGecko = mobile && gecko;\r\n\r\n // @property retina: Boolean\r\n // `true` for browsers on a high-resolution \"retina\" screen or on any screen when browser's display zoom is more than 100%.\r\n var retina = (window.devicePixelRatio || (window.screen.deviceXDPI / window.screen.logicalXDPI)) > 1;\r\n\r\n // @property passiveEvents: Boolean\r\n // `true` for browsers that support passive events.\r\n var passiveEvents = (function () {\r\n \tvar supportsPassiveOption = false;\r\n \ttry {\r\n \t\tvar opts = Object.defineProperty({}, 'passive', {\r\n \t\t\tget: function () { // eslint-disable-line getter-return\r\n \t\t\t\tsupportsPassiveOption = true;\r\n \t\t\t}\r\n \t\t});\r\n \t\twindow.addEventListener('testPassiveEventSupport', falseFn, opts);\r\n \t\twindow.removeEventListener('testPassiveEventSupport', falseFn, opts);\r\n \t} catch (e) {\r\n \t\t// Errors can safely be ignored since this is only a browser support test.\r\n \t}\r\n \treturn supportsPassiveOption;\r\n }());\r\n\r\n // @property canvas: Boolean\r\n // `true` when the browser supports [``](https://developer.mozilla.org/docs/Web/API/Canvas_API).\r\n var canvas$1 = (function () {\r\n \treturn !!document.createElement('canvas').getContext;\r\n }());\r\n\r\n // @property svg: Boolean\r\n // `true` when the browser supports [SVG](https://developer.mozilla.org/docs/Web/SVG).\r\n var svg$1 = !!(document.createElementNS && svgCreate('svg').createSVGRect);\r\n\r\n var inlineSvg = !!svg$1 && (function () {\r\n \tvar div = document.createElement('div');\r\n \tdiv.innerHTML = '';\r\n \treturn (div.firstChild && div.firstChild.namespaceURI) === 'http://www.w3.org/2000/svg';\r\n })();\r\n\r\n // @property vml: Boolean\r\n // `true` if the browser supports [VML](https://en.wikipedia.org/wiki/Vector_Markup_Language).\r\n var vml = !svg$1 && (function () {\r\n \ttry {\r\n \t\tvar div = document.createElement('div');\r\n \t\tdiv.innerHTML = '';\r\n\r\n \t\tvar shape = div.firstChild;\r\n \t\tshape.style.behavior = 'url(#default#VML)';\r\n\r\n \t\treturn shape && (typeof shape.adj === 'object');\r\n\r\n \t} catch (e) {\r\n \t\treturn false;\r\n \t}\r\n }());\r\n\r\n\r\n // @property mac: Boolean; `true` when the browser is running in a Mac platform\r\n var mac = navigator.platform.indexOf('Mac') === 0;\r\n\r\n // @property mac: Boolean; `true` when the browser is running in a Linux platform\r\n var linux = navigator.platform.indexOf('Linux') === 0;\r\n\r\n function userAgentContains(str) {\r\n \treturn navigator.userAgent.toLowerCase().indexOf(str) >= 0;\r\n }\r\n\r\n\r\n var Browser = {\r\n \tie: ie,\r\n \tielt9: ielt9,\r\n \tedge: edge,\r\n \twebkit: webkit,\r\n \tandroid: android,\r\n \tandroid23: android23,\r\n \tandroidStock: androidStock,\r\n \topera: opera,\r\n \tchrome: chrome,\r\n \tgecko: gecko,\r\n \tsafari: safari,\r\n \tphantom: phantom,\r\n \topera12: opera12,\r\n \twin: win,\r\n \tie3d: ie3d,\r\n \twebkit3d: webkit3d,\r\n \tgecko3d: gecko3d,\r\n \tany3d: any3d,\r\n \tmobile: mobile,\r\n \tmobileWebkit: mobileWebkit,\r\n \tmobileWebkit3d: mobileWebkit3d,\r\n \tmsPointer: msPointer,\r\n \tpointer: pointer,\r\n \ttouch: touch,\r\n \ttouchNative: touchNative,\r\n \tmobileOpera: mobileOpera,\r\n \tmobileGecko: mobileGecko,\r\n \tretina: retina,\r\n \tpassiveEvents: passiveEvents,\r\n \tcanvas: canvas$1,\r\n \tsvg: svg$1,\r\n \tvml: vml,\r\n \tinlineSvg: inlineSvg,\r\n \tmac: mac,\r\n \tlinux: linux\r\n };\n\n /*\n * Extends L.DomEvent to provide touch support for Internet Explorer and Windows-based devices.\n */\n\n var POINTER_DOWN = Browser.msPointer ? 'MSPointerDown' : 'pointerdown';\n var POINTER_MOVE = Browser.msPointer ? 'MSPointerMove' : 'pointermove';\n var POINTER_UP = Browser.msPointer ? 'MSPointerUp' : 'pointerup';\n var POINTER_CANCEL = Browser.msPointer ? 'MSPointerCancel' : 'pointercancel';\n var pEvent = {\n \ttouchstart : POINTER_DOWN,\n \ttouchmove : POINTER_MOVE,\n \ttouchend : POINTER_UP,\n \ttouchcancel : POINTER_CANCEL\n };\n var handle = {\n \ttouchstart : _onPointerStart,\n \ttouchmove : _handlePointer,\n \ttouchend : _handlePointer,\n \ttouchcancel : _handlePointer\n };\n var _pointers = {};\n var _pointerDocListener = false;\n\n // Provides a touch events wrapper for (ms)pointer events.\n // ref https://www.w3.org/TR/pointerevents/ https://www.w3.org/Bugs/Public/show_bug.cgi?id=22890\n\n function addPointerListener(obj, type, handler) {\n \tif (type === 'touchstart') {\n \t\t_addPointerDocListener();\n \t}\n \tif (!handle[type]) {\n \t\tconsole.warn('wrong event specified:', type);\n \t\treturn falseFn;\n \t}\n \thandler = handle[type].bind(this, handler);\n \tobj.addEventListener(pEvent[type], handler, false);\n \treturn handler;\n }\n\n function removePointerListener(obj, type, handler) {\n \tif (!pEvent[type]) {\n \t\tconsole.warn('wrong event specified:', type);\n \t\treturn;\n \t}\n \tobj.removeEventListener(pEvent[type], handler, false);\n }\n\n function _globalPointerDown(e) {\n \t_pointers[e.pointerId] = e;\n }\n\n function _globalPointerMove(e) {\n \tif (_pointers[e.pointerId]) {\n \t\t_pointers[e.pointerId] = e;\n \t}\n }\n\n function _globalPointerUp(e) {\n \tdelete _pointers[e.pointerId];\n }\n\n function _addPointerDocListener() {\n \t// need to keep track of what pointers and how many are active to provide e.touches emulation\n \tif (!_pointerDocListener) {\n \t\t// we listen document as any drags that end by moving the touch off the screen get fired there\n \t\tdocument.addEventListener(POINTER_DOWN, _globalPointerDown, true);\n \t\tdocument.addEventListener(POINTER_MOVE, _globalPointerMove, true);\n \t\tdocument.addEventListener(POINTER_UP, _globalPointerUp, true);\n \t\tdocument.addEventListener(POINTER_CANCEL, _globalPointerUp, true);\n\n \t\t_pointerDocListener = true;\n \t}\n }\n\n function _handlePointer(handler, e) {\n \tif (e.pointerType === (e.MSPOINTER_TYPE_MOUSE || 'mouse')) { return; }\n\n \te.touches = [];\n \tfor (var i in _pointers) {\n \t\te.touches.push(_pointers[i]);\n \t}\n \te.changedTouches = [e];\n\n \thandler(e);\n }\n\n function _onPointerStart(handler, e) {\n \t// IE10 specific: MsTouch needs preventDefault. See #2000\n \tif (e.MSPOINTER_TYPE_TOUCH && e.pointerType === e.MSPOINTER_TYPE_TOUCH) {\n \t\tpreventDefault(e);\n \t}\n \t_handlePointer(handler, e);\n }\n\n /*\r\n * Extends the event handling code with double tap support for mobile browsers.\r\n *\r\n * Note: currently most browsers fire native dblclick, with only a few exceptions\r\n * (see https://github.com/Leaflet/Leaflet/issues/7012#issuecomment-595087386)\r\n */\r\n\r\n function makeDblclick(event) {\r\n \t// in modern browsers `type` cannot be just overridden:\r\n \t// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Errors/Getter_only\r\n \tvar newEvent = {},\r\n \t prop, i;\r\n \tfor (i in event) {\r\n \t\tprop = event[i];\r\n \t\tnewEvent[i] = prop && prop.bind ? prop.bind(event) : prop;\r\n \t}\r\n \tevent = newEvent;\r\n \tnewEvent.type = 'dblclick';\r\n \tnewEvent.detail = 2;\r\n \tnewEvent.isTrusted = false;\r\n \tnewEvent._simulated = true; // for debug purposes\r\n \treturn newEvent;\r\n }\r\n\r\n var delay = 200;\r\n function addDoubleTapListener(obj, handler) {\r\n \t// Most browsers handle double tap natively\r\n \tobj.addEventListener('dblclick', handler);\r\n\r\n \t// On some platforms the browser doesn't fire native dblclicks for touch events.\r\n \t// It seems that in all such cases `detail` property of `click` event is always `1`.\r\n \t// So here we rely on that fact to avoid excessive 'dblclick' simulation when not needed.\r\n \tvar last = 0,\r\n \t detail;\r\n \tfunction simDblclick(e) {\r\n \t\tif (e.detail !== 1) {\r\n \t\t\tdetail = e.detail; // keep in sync to avoid false dblclick in some cases\r\n \t\t\treturn;\r\n \t\t}\r\n\r\n \t\tif (e.pointerType === 'mouse' ||\r\n \t\t\t(e.sourceCapabilities && !e.sourceCapabilities.firesTouchEvents)) {\r\n\r\n \t\t\treturn;\r\n \t\t}\r\n\r\n \t\t// When clicking on an , the browser generates a click on its\r\n \t\t//